20 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
8 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC62031
Formula: C34H30O10
Ingredient ID: NPC62031
| Common Name | n.a. |
| IUPAC Name | 1-(2,7-dihydroxy-5,6,10-trimethoxyphenanthren-1-yl)-3,4,9-trimethoxyphenanthrene-2,7-diol |
| Canonical SMILES | COc1c(O)c(c2c(c1OC)c1ccc(cc1c(c2)OC)O)c1c(O)ccc2c1c(OC)cc1c2c(OC)c(c(c1)O)OC |
| Standard InCHI | InChI=1S/C34H30O10/c1-39-23-14-20-26(17-8-7-16(35)13-19(17)23)33(43-5)34(44-6)30(38)28(20)29-21(36)10-9-18-25-15(12-24(40-2)27(18)29)11-22(37)31(41-3)32(25)42-4/h7-14,35-38H,1-6H3 |
| Standard InCHIKey | FAEKSGIHDACYAU-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 100989757 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD11976] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Sophora tomentosa | Sophora | Fabaceae |
 |
Ingredient ID: NPC60220
Formula: C17H18O5
Ingredient ID: NPC60220
| Common Name | n.a. |
| IUPAC Name | 3,4,6-trimethoxy-9,10-dihydrophenanthrene-2,7-diol |
| Canonical SMILES | COc1cc2c(cc1O)CCc1c2c(OC)c(c(c1)O)OC |
| Standard InCHI | InChI=1S/C17H18O5/c1-20-14-8-11-9(6-12(14)18)4-5-10-7-13(19)16(21-2)17(22-3)15(10)11/h6-8,18-19H,4-5H2,1-3H3 |
| Standard InCHIKey | RTVAFWMIPOUAKD-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 181637 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD151967] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Sophora tomentosa | Sophora | Fabaceae |
|
Ingredient ID: NPC53781
Formula: C15H12O3
Ingredient ID: NPC53781
| Common Name | n.a. |
| IUPAC Name | 4-methoxyphenanthrene-2,7-diol |
| Canonical SMILES | COc1cc(O)cc2c1c1ccc(cc1cc2)O |
| Standard InCHI | InChI=1S/C15H12O3/c1-18-14-8-12(17)7-10-3-2-9-6-11(16)4-5-13(9)15(10)14/h2-8,16-17H,1H3 |
| Standard InCHIKey | CJYQJCATAOEZRC-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 14777892 ZINC ID: ZINC000014651052 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC53781] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pleione yunnanensis | Pleione | Orchidaceae | |
| Pleione bulbocodioides | Pleione | Orchidaceae | |
| Cremastra appendiculata | Cremastra | Orchidaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Dendrobium nobile | Dendrobium | Orchidaceae |
 |
| Syzygium aromaticum | Syzygium | Myrtaceae |
 |
Ingredient ID: NPC42716
Formula: C16H12O5
Ingredient ID: NPC42716
| Common Name | Maackiain |
| IUPAC Name | n.a. |
| Canonical SMILES | Oc1ccc2c(c1)OC[C@@H]1[C@H]2Oc2c1cc1c(c2)OCO1 |
| Standard InCHI | InChI=1S/C16H12O5/c17-8-1-2-9-12(3-8)18-6-11-10-4-14-15(20-7-19-14)5-13(10)21-16(9)11/h1-5,11,16-17H,6-7H2/t11-,16-/m0/s1 |
| Standard InCHIKey | HUKSJTUUSUGIDC-ZBEGNZNMSA-N |
| Ingredient External Links |
PubChem CID: 91510 ZINC ID: ZINC000000899884 ChEMBL ID: CHEMBL334918 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC42716] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Abies pinsapo var. marocana | Abies | Pinaceae | |
| Ipomoea muricata | Ipomoea | Convolvulaceae |
|
| Erysimum leptophyllum | Erysimum | Brassicaceae | |
| Chondrodendron tomentosum | Chondrodendron | Menispermaceae |
|
| Haplophyllum obtusifolium | Haplophyllum | Rutaceae | |
| Syzygium polycephaloides | Syzygium | Myrtaceae |
|
| Euphrasia genargentea | Euphrasia | Orobanchaceae | |
| Xanthorhiza simplicissima | Xanthorhiza | Ranunculaceae |
|
| Glycyrrhiza | Glycyrrhiza | Fabaceae |
|
| Piper regnellii | Piper | Piperaceae |
|
| Gymnocalycium schickendantzii | Gymnocalycium | Cactaceae | |
| Onopordum acanthium | Onopordum | Asteraceae |
|
| Pancratium sickenbergeri | Pancratium | Amaryllidaceae | |
| Centaurea maculosa | Centaurea | Asteraceae | |
| Ephedra sinica | Ephedra | Ephedraceae |
|
| Plathymenia reticulata | Plathymenia | Fabaceae | |
| Asimina parviflora | Asimina | Annonaceae |
|
| Pteridium esculentum | Pteridium | Dennstaedtiaceae |
|
| Esenbeckia leiocarpa | Esenbeckia | Rutaceae | |
| Sophora flavescens | Sophora | Fabaceae |
|
| Hypericum styphelioides | Hypericum | Hypericaceae | |
| Vellozia nanuzae | Vellozia | Velloziaceae | |
| Baccharis neglecta | Baccharis | Asteraceae | |
| Atraphaxis spinosa | Atraphaxis | Polygonaceae |
|
| Embelia schimperi | Embelia | Primulaceae |
|
| Epilobium hirsutum | Epilobium | Onagraceae |
|
| Lythrum salicaria | Lythrum | Lythraceae |
|
| Simarouba glauca | Simarouba | Simaroubaceae |
|
| Erythrina melanacantha | Erythrina | Fabaceae |
|
| Monsonia senegalensis | Monsonia | Geraniaceae |
|
| Clerodendrum bungei | Clerodendrum | Lamiaceae |
|
| Lemaireocereus longispinus | Lemaireocereus | Cactaceae | |
| Eria anomala | Eria | Orchidaceae | |
| Embelia parviflora | Embelia | Primulaceae |
|
| Dactylorhiza viridis | Dactylorhiza | Orchidaceae | |
| Euphorbia nematocypha | Euphorbia | Euphorbiaceae |
|
| Pterolobium hexapetalum | Pterolobium | Fabaceae |
|
| Abelia chinensis | Abelia | Caprifoliaceae | |
| Diospyros assimilis | Diospyros | Ebenaceae |
|
| Faramea salicifolia | Faramea | Rubiaceae | |
| Polygonum salicifolium | Polygonum | Polygonaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Vernonia fagifolia | Vernonia | Asteraceae | |
| Cordia leucocephala | Cordia | Cordiaceae | |
| Calicotome villosa | Calicotome | Fabaceae |
|
| Diplopterygium glaucum | Diplopterygium | Gleicheniaceae | |
| Erycibe expansa | Erycibe | Convolvulaceae |
|
| Buxus natalensis | Buxus | Buxaceae | |
| Maytenus chuchuhuasha | Maytenus | Celastraceae | |
| Oxytropis falcata | Oxytropis | Fabaceae | |
| Lycoris radiata | Lycoris | Amaryllidaceae |
|
| Helichrysum tenuifolium | Helichrysum | Asteraceae | |
| Angelica acutiloba | Angelica | Apiaceae |
|
| Solanum lanceolatum | Solanum | Solanaceae |
|
| Morella rubra | Morella | Myricaceae | |
| Bryonia alba | Bryonia | Cucurbitaceae |
|
| Viburnum erubescens | Viburnum | Adoxaceae |
|
| Remirea maritima | Remirea | Cyperaceae | |
| Arnica mollis | Arnica | Asteraceae | |
| Croton gratissimus | Croton | Euphorbiaceae |
|
| Wikstroemia viridiflora | Wikstroemia | Thymelaeaceae |
|
| Brassica carinata | Brassica | Brassicaceae |
|
| Ranunculus asiaticus | Ranunculus | Ranunculaceae | |
| Eurycoma harmandiana | Eurycoma | Simaroubaceae |
|
| Eucalyptus resinifera | Eucalyptus | Myrtaceae |
|
| Sophora tonkinensis | Sophora | Fabaceae | |
| Sinapis alba | Sinapis | Brassicaceae |
|
| Carpha glomerata | Carpha | Cyperaceae | |
| Picrasma quassioides | Picrasma | Simaroubaceae |
|
| Cyanostegia angustifolia | Cyanostegia | Lamiaceae | |
| Orthosiphon spicatus | Orthosiphon | Lamiaceae |
|
| Lysimachia fordiana | Lysimachia | Primulaceae | |
| Ampelocera edentula | Ampelocera | Ulmaceae | |
| Ixeris debilis | Ixeris | Asteraceae | |
| Abies excelsa | Abies | Pinaceae |
Ingredient ID: NPC308768
Formula: C17H16O5
Ingredient ID: NPC308768
| Common Name | n.a. |
| IUPAC Name | 3,4,9-trimethoxyphenanthrene-2,7-diol |
| Canonical SMILES | COc1c(O)cc2c(c1OC)c1ccc(cc1c(c2)OC)O |
| Standard InCHI | InChI=1S/C17H16O5/c1-20-14-7-9-6-13(19)16(21-2)17(22-3)15(9)11-5-4-10(18)8-12(11)14/h4-8,18-19H,1-3H3 |
| Standard InCHIKey | GIVSZLKTIBWYRM-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 14505894 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD144834] Database: NPASS [NPC308768] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Sophora tomentosa | Sophora | Fabaceae |
|
Ingredient ID: NPC308650
Formula: C20H20O5
Ingredient ID: NPC308650
| Common Name | n.a. |
| IUPAC Name | (2S)-5-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-2,3-dihydrochromen-7-olate |
| Canonical SMILES | CC(=CCc1c(O)cc(c2c1O[C@@H](CC2=O)c1ccc(cc1)[O-])O)C |
| Standard InCHI | InChI=1S/C20H20O5/c1-11(2)3-8-14-15(22)9-16(23)19-17(24)10-18(25-20(14)19)12-4-6-13(21)7-5-12/h3-7,9,18,21-23H,8,10H2,1-2H3/p-1/t18-/m0/s1 |
| Standard InCHIKey | LPEPZZAVFJPLNZ-SFHVURJKSA-M |
| Ingredient External Links |
PubChem CID: 25200892 |
| Plant-Ingredient Association Reference |
Database: TCMID [11245] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Humulus lupulus | Humulus | Cannabaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Maclura cochinchinensis | Maclura | Moraceae |
|
| Sophora moorcroftiana | Sophora | Fabaceae |
|
| Dioscorea communis | Dioscorea | Dioscoreaceae |
|
| Cullen corylifolium | Cullen | Fabaceae |
|
| Macaranga conifera | Macaranga | Euphorbiaceae |
Ingredient ID: NPC259767
Formula: C21H22O9
Ingredient ID: NPC259767
| Common Name | Isoliquiritin |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2ccc(cc2)/C=C/C(=O)c2ccc(cc2O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C21H22O9/c22-10-17-18(26)19(27)20(28)21(30-17)29-13-5-1-11(2-6-13)3-8-15(24)14-7-4-12(23)9-16(14)25/h1-9,17-23,25-28H,10H2/b8-3+/t17-,18-,19+,20-,21-/m1/s1 |
| Standard InCHIKey | YNWXJFQOCHMPCK-LXGDFETPSA-N |
| Ingredient External Links |
PubChem CID: 5318591 ZINC ID: ZINC000033832004 ChEMBL ID: CHEMBL599763 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC259767] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Mitracarpus scaber | Mitracarpus | Rubiaceae | |
| Glycyrrhiza yunnanensis | Glycyrrhiza | Fabaceae |
|
| Onobrychis viciifolia | Onobrychis | Fabaceae |
|
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Glycyrrhiza aspera | Glycyrrhiza | Fabaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Glycyrrhiza kansuensis | Glycyrrhiza | Fabaceae |
|
| Sigesbeckia pubescens | Sigesbeckia | Asteraceae | |
| Aralia subcapitata | Aralia | Araliaceae | |
| Sigesbeckia glabrescens | Sigesbeckia | Asteraceae |
|
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
|
| Robinia pseudoacacia | Robinia | Fabaceae |
|
| Portulaca oleracea | Portulaca | Portulacaceae |
|
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
| Cicer arietinum | Cicer | Fabaceae |
|
Ingredient ID: NPC258780
Formula: C30H26O6
Ingredient ID: NPC258780
| Common Name | n.a. |
| IUPAC Name | 1-(2,7-dihydroxy-4-methoxy-9,10-dihydrophenanthren-1-yl)-4-methoxy-9,10-dihydrophenanthrene-2,7-diol |
| Canonical SMILES | COc1cc(O)c(c2c1c1ccc(cc1CC2)O)c1c(O)cc(c2c1CCc1c2ccc(c1)O)OC |
| Standard InCHI | InChI=1S/C30H26O6/c1-35-25-13-23(33)29(21-7-3-15-11-17(31)5-9-19(15)27(21)25)30-22-8-4-16-12-18(32)6-10-20(16)28(22)26(36-2)14-24(30)34/h5-6,9-14,31-34H,3-4,7-8H2,1-2H3 |
| Standard InCHIKey | OZZPAAPLZANUHM-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 11317652 ZINC ID: ZINC000015274411 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC258780] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bletilla striata | Bletilla | Orchidaceae |
|
| Calanthe arisanensis | Calanthe | Orchidaceae | |
| Lebeckia plukenetiana | Lebeckia | Fabaceae | |
| Sophora tomentosa | Sophora | Fabaceae |
|
| Cyperus pilosus | Cyperus | Cyperaceae |
|
| Securigera securidaca | Securigera | Fabaceae | |
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Physocarpus intermedius | Physocarpus | Rosaceae | |
| Saraca asoca | Saraca | Fabaceae |
|
Ingredient ID: NPC239996
Formula: C17H16O5
Ingredient ID: NPC239996
| Common Name | n.a. |
| IUPAC Name | 1,5,6-trimethoxyphenanthrene-2,7-diol |
| Canonical SMILES | COc1c(O)cc2c(c1OC)c1ccc(c(c1cc2)OC)O |
| Standard InCHI | InChI=1S/C17H16O5/c1-20-15-11-5-4-9-8-13(19)16(21-2)17(22-3)14(9)10(11)6-7-12(15)18/h4-8,18-19H,1-3H3 |
| Standard InCHIKey | JHNVCKNCEVZGGC-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 11983285 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD69607] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dendrobium chrysanthum | Dendrobium | Orchidaceae |
|
| Dendrobium chrysotoxum | Dendrobium | Orchidaceae |
|
| Dendrobium candidum | Dendrobium | Orchidaceae | |
| Sophora tomentosa | Sophora | Fabaceae |
|
| Dendrobium fimbriatum | Dendrobium | Orchidaceae |
|
| Dendrobium nobile | Dendrobium | Orchidaceae |
|
| Dendrobium loddigesii | Dendrobium | Orchidaceae |
|
Ingredient ID: NPC228503
Formula: C15H14O3
Ingredient ID: NPC228503
| Common Name | n.a. |
| IUPAC Name | 4-methoxy-9,10-dihydrophenanthrene-2,7-diol |
| Canonical SMILES | COc1cc(O)cc2c1c1ccc(cc1CC2)O |
| Standard InCHI | InChI=1S/C15H14O3/c1-18-14-8-12(17)7-10-3-2-9-6-11(16)4-5-13(9)15(10)14/h4-8,16-17H,2-3H2,1H3 |
| Standard InCHIKey | OPPGAHUCKDKQJR-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 11390848 ZINC ID: ZINC000014651078 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC228503] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Gynochthodes parvifolia | Gynochthodes | Rubiaceae |
|
| Pleione yunnanensis | Pleione | Orchidaceae | |
| Gymnadenia conopsea | Gymnadenia | Orchidaceae |
|
| Corydalis conspersa | Corydalis | Papaveraceae | |
| Calanthe arisanensis | Calanthe | Orchidaceae | |
| Sideritis grandiflora | Sideritis | Lamiaceae | |
| Ligustrum ovalifolium | Ligustrum | Oleaceae | |
| Mikania luetzelburgii | Mikania | Asteraceae | |
| Pleione bulbocodioides | Pleione | Orchidaceae | |
| Cremastra appendiculata | Cremastra | Orchidaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Pittosporum brevicalyx | Pittosporum | Pittosporaceae | |
| Dendrobium nobile | Dendrobium | Orchidaceae |
|
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Ungernia victoris | Ungernia | Amaryllidaceae | |
| Mespilus germanica | Mespilus | Rosaceae |
|
| Solanum euacanthum | Solanum | Solanaceae |
Ingredient ID: NPC22610
Formula: C15H16O3
Ingredient ID: NPC22610
| Common Name | Batatasin Iii |
| IUPAC Name | 3-[2-(3-hydroxyphenyl)ethyl]-5-methoxyphenol |
| Canonical SMILES | COc1cc(CCc2cccc(c2)O)cc(c1)O |
| Standard InCHI | InChI=1S/C15H16O3/c1-18-15-9-12(8-14(17)10-15)6-5-11-3-2-4-13(16)7-11/h2-4,7-10,16-17H,5-6H2,1H3 |
| Standard InCHIKey | VYQXIUVIYICVCM-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 10466989 ChEMBL ID: CHEMBL450788 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD114580] Database: NPASS [NPC22610] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bletilla striata | Bletilla | Orchidaceae |
|
| Gynochthodes parvifolia | Gynochthodes | Rubiaceae |
|
| Pleione yunnanensis | Pleione | Orchidaceae | |
| Gymnadenia conopsea | Gymnadenia | Orchidaceae |
|
| Corydalis conspersa | Corydalis | Papaveraceae | |
| Sideritis grandiflora | Sideritis | Lamiaceae | |
| Ligustrum ovalifolium | Ligustrum | Oleaceae | |
| Mikania luetzelburgii | Mikania | Asteraceae | |
| Nidema boothii | Nidema | Orchidaceae | |
| Pleione bulbocodioides | Pleione | Orchidaceae | |
| Cremastra appendiculata | Cremastra | Orchidaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Dendrobium fimbriatum | Dendrobium | Orchidaceae |
|
| Dioscorea polystachya | Dioscorea | Dioscoreaceae |
|
| Pittosporum brevicalyx | Pittosporum | Pittosporaceae | |
| Dendrobium nobile | Dendrobium | Orchidaceae |
|
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Ungernia victoris | Ungernia | Amaryllidaceae | |
| Mespilus germanica | Mespilus | Rosaceae |
|
| Solanum euacanthum | Solanum | Solanaceae | |
| Dioscorea opposita | Dioscorea | Dioscoreaceae |
|
Ingredient ID: NPC199338
Formula: C34H30O10
Ingredient ID: NPC199338
| Common Name | n.a. |
| IUPAC Name | 1-(2,7-dihydroxy-3,4,9-trimethoxyphenanthren-1-yl)-3,4,9-trimethoxyphenanthrene-2,7-diol |
| Canonical SMILES | COc1c(O)c(c2c(c1OC)c1ccc(cc1c(c2)OC)O)c1c(O)c(OC)c(c2c1cc(OC)c1c2ccc(c1)O)OC |
| Standard InCHI | InChI=1S/C34H30O10/c1-39-23-13-21-25(17-9-7-15(35)11-19(17)23)31(41-3)33(43-5)29(37)27(21)28-22-14-24(40-2)20-12-16(36)8-10-18(20)26(22)32(42-4)34(44-6)30(28)38/h7-14,35-38H,1-6H3 |
| Standard InCHIKey | DPBXUMRHNZGPCT-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 100989756 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD21757] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Sophora tomentosa | Sophora | Fabaceae |
|
Ingredient ID: NPC19615
Formula: C21H22O6
Ingredient ID: NPC19615
| Common Name | n.a. |
| IUPAC Name | 5,7-dihydroxy-3-[4-hydroxy-2-methoxy-3-(3-methylbut-2-enyl)phenyl]-2,3-dihydrochromen-4-one |
| Canonical SMILES | COc1c(ccc(c1CC=C(C)C)O)C1COc2c(C1=O)c(O)cc(c2)O |
| Standard InCHI | InChI=1S/C21H22O6/c1-11(2)4-5-14-16(23)7-6-13(21(14)26-3)15-10-27-18-9-12(22)8-17(24)19(18)20(15)25/h4,6-9,15,22-24H,5,10H2,1-3H3 |
| Standard InCHIKey | AALISTBXLBQUEH-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 442822 |
| Plant-Ingredient Association Reference |
Database: TCMID [20077] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Sophora flavescens | Sophora | Fabaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
Ingredient ID: NPC19174
Formula: C15H12O4
Ingredient ID: NPC19174
| Common Name | Isoliquiritigenin |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Canonical SMILES | Oc1ccc(cc1)/C=C/C(=O)c1ccc(cc1O)O |
| Standard InCHI | InChI=1S/C15H12O4/c16-11-4-1-10(2-5-11)3-8-14(18)13-7-6-12(17)9-15(13)19/h1-9,16-17,19H/b8-3+ |
| Standard InCHIKey | DXDRHHKMWQZJHT-FPYGCLRLSA-N |
| Ingredient External Links |
PubChem CID: 638278 ZINC ID: ZINC000003869608 ChEMBL ID: CHEMBL129795 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC19174] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Mitracarpus scaber | Mitracarpus | Rubiaceae | |
| Abies pinsapo var. marocana | Abies | Pinaceae | |
| Teucrium betonicum | Teucrium | Lamiaceae | |
| Centaurea solstitialis | Centaurea | Asteraceae |
|
| Xanthorrhoea resinosa | Xanthorrhoea | Asphodelaceae |
|
| Ocimum pilosum | Ocimum | Lamiaceae |
|
| Psorothamnus arborescens | Psorothamnus | Fabaceae | |
| Rhododendron ungerni | Rhododendron | Ericaceae | |
| Albizia julibrissin | Albizia | Fabaceae |
|
| Lagochilus leiacanthus | Lagochilus | Lamiaceae | |
| Glycyrrhiza yunnanensis | Glycyrrhiza | Fabaceae |
|
| Strychnos tricalysioides | Strychnos | Loganiaceae | |
| Piptostigma fugax | Piptostigma | Annonaceae | |
| Chara ceratophylla | Chara | Characeae | |
| Euphrasia genargentea | Euphrasia | Orobanchaceae | |
| Cosmos diversifolius | Cosmos | Asteraceae | |
| Trichodesma incanum | Trichodesma | Boraginaceae | |
| Dalbergia parviflora | Dalbergia | Fabaceae |
|
| Rhododendron mucronatum | Rhododendron | Ericaceae |
|
| Onobrychis viciifolia | Onobrychis | Fabaceae |
|
| Xanthorhiza simplicissima | Xanthorhiza | Ranunculaceae |
|
| Astragalus mongholicus | Astragalus | Fabaceae |
|
| Glycyrrhiza | Glycyrrhiza | Fabaceae |
|
| Inga velutina | Inga | Fabaceae |
|
| Curcuma caesia | Curcuma | Zingiberaceae |
|
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Crinum bulbispermum | Crinum | Amaryllidaceae |
|
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Cathormion altissimum | Cathormion | Fabaceae | |
| Urochloa decumbens | Urochloa | Poaceae | |
| Dactylorhiza viridis | Dactylorhiza | Orchidaceae | |
| Pterolobium hexapetalum | Pterolobium | Fabaceae |
|
| Polygonatum cyrtonema | Polygonatum | Asparagaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Dalbergia louvelii | Dalbergia | Fabaceae | |
| Diplopterygium glaucum | Diplopterygium | Gleicheniaceae | |
| Platymiscium floribundum | Platymiscium | Fabaceae | |
| Erythrophleum couminga | Erythrophleum | Fabaceae |
|
| Astragalus membranaceus | Astragalus | Fabaceae |
|
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Maytenus chuchuhuasha | Maytenus | Celastraceae | |
| Anemarrhena asphodeloides | Anemarrhena | Asparagaceae |
|
| Oxytropis falcata | Oxytropis | Fabaceae | |
| Polygonatum kingianum | Polygonatum | Asparagaceae |
|
| Angelica acutiloba | Angelica | Apiaceae |
|
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
|
| Erythrina pallida | Erythrina | Fabaceae | |
| Solanum lanceolatum | Solanum | Solanaceae |
|
| Bryonia alba | Bryonia | Cucurbitaceae |
|
| Sophora mollis | Sophora | Fabaceae |
|
| Dracaena draco | Dracaena | Asparagaceae |
|
| Robinia pseudoacacia | Robinia | Fabaceae |
|
| Viburnum erubescens | Viburnum | Adoxaceae |
|
| Remirea maritima | Remirea | Cyperaceae | |
| Arnica mollis | Arnica | Asteraceae | |
| Dipteryx odorata | Dipteryx | Fabaceae |
|
| Eucalyptus australiana | Eucalyptus | Myrtaceae | |
| Croton gratissimus | Croton | Euphorbiaceae |
|
| Wikstroemia viridiflora | Wikstroemia | Thymelaeaceae |
|
| Polygonatum falcatum | Polygonatum | Asparagaceae |
|
| Brassica carinata | Brassica | Brassicaceae |
|
| Turpinia arguta | Turpinia | Staphyleaceae | |
| Hedysarum polybotrys | Hedysarum | Fabaceae |
|
| Ranunculus asiaticus | Ranunculus | Ranunculaceae | |
| Eurycoma harmandiana | Eurycoma | Simaroubaceae |
|
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
| Eucalyptus resinifera | Eucalyptus | Myrtaceae |
|
| Allium azureum ledeb | Allium | Amaryllidaceae | |
| Phelline lucida | Phelline | Phellinaceae | |
| Glycine max | Glycine | Fabaceae |
|
| Lactuca serriola | Lactuca | Asteraceae |
|
| Sinapis alba | Sinapis | Brassicaceae |
|
| Cicer arietinum | Cicer | Fabaceae |
|
| Artocarpus altilis | Artocarpus | Moraceae |
|
| Carpha glomerata | Carpha | Cyperaceae | |
| Cryptocarya oblata | Cryptocarya | Lauraceae | |
| Cyanostegia angustifolia | Cyanostegia | Lamiaceae | |
| Orthosiphon spicatus | Orthosiphon | Lamiaceae |
|
| Solenopsis punctaticeps | Solenopsis | Campanulaceae | |
| Lysimachia fordiana | Lysimachia | Primulaceae | |
| Ampelocera edentula | Ampelocera | Ulmaceae | |
| Ixeris debilis | Ixeris | Asteraceae | |
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
| Abies excelsa | Abies | Pinaceae |
Ingredient ID: NPC178014
Formula: C16H12O5
Ingredient ID: NPC178014
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Oc1ccc2c(c1)OCC1C2Oc2c1cc1c(c2)OCO1 |
| Standard InCHI | InChI=1S/C16H12O5/c17-8-1-2-9-12(3-8)18-6-11-10-4-14-15(20-7-19-14)5-13(10)21-16(9)11/h1-5,11,16-17H,6-7H2 |
| Standard InCHIKey | HUKSJTUUSUGIDC-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 363863 ChEMBL ID: CHEMBL239047 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC178014] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Glycyrrhiza sp. | Glycyrrhiza | Fabaceae | |
| Andira inermis | Andira | Fabaceae |
|
| Sophora flavescens | Sophora | Fabaceae |
|
| Lythrum salicaria | Lythrum | Lythraceae |
|
| Sophora japonica | Sophora | Fabaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Erycibe expansa | Erycibe | Convolvulaceae |
|
| Derris scandens | Derris | Fabaceae |
|
| Sophora tonkinensis | Sophora | Fabaceae | |
| Picrasma quassioides | Picrasma | Simaroubaceae |
|
Ingredient ID: NPC14586
Formula: C15H20N2O
Ingredient ID: NPC14586
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O=c1cccc2n1CC1CCCN3C1C2CCC3 |
| Standard InCHI | InChI=1S/C15H20N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h1,6-7,11-12,15H,2-5,8-10H2 |
| Standard InCHIKey | MMCQRJPAMIHLQX-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 618327 |
| Plant-Ingredient Association Reference |
Database: TCMID [20078] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Sophora flavescens | Sophora | Fabaceae |
|
| Sophora alopecuroides | Sophora | Fabaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Sophora viciifolia | Sophora | Fabaceae |
|
Ingredient ID: NPC133463
Formula: C30H22O6
Ingredient ID: NPC133463
| Common Name | Cirrhopetalanthin |
| IUPAC Name | 1-(2,7-dihydroxy-4-methoxyphenanthren-1-yl)-4-methoxyphenanthrene-2,7-diol |
| Canonical SMILES | COc1cc(O)c(c2c1c1ccc(cc1cc2)O)c1c(O)cc(c2c1ccc1c2ccc(c1)O)OC |
| Standard InCHI | InChI=1S/C30H22O6/c1-35-25-13-23(33)29(21-7-3-15-11-17(31)5-9-19(15)27(21)25)30-22-8-4-16-12-18(32)6-10-20(16)28(22)26(36-2)14-24(30)34/h3-14,31-34H,1-2H3 |
| Standard InCHIKey | CNLFNDMTGHNGIV-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 9982511 ZINC ID: ZINC000015274407 ChEMBL ID: CHEMBL359501 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC133463] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bletilla striata | Bletilla | Orchidaceae |
|
| Cremastra appendiculata | Cremastra | Orchidaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
Ingredient ID: NPC115159
Formula: C15H12O4
Ingredient ID: NPC115159
| Common Name | (Z)-1-(2,4-Dihydroxyphenyl)-3-(4-Hydroxyphenyl)Prop-2-En-1-One |
| IUPAC Name | (Z)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Canonical SMILES | Oc1ccc(cc1)/C=CC(=O)c1ccc(cc1O)O |
| Standard InCHI | InChI=1S/C15H12O4/c16-11-4-1-10(2-5-11)3-8-14(18)13-7-6-12(17)9-15(13)19/h1-9,16-17,19H/b8-3- |
| Standard InCHIKey | DXDRHHKMWQZJHT-BAQGIRSFSA-N |
| Ingredient External Links |
PubChem CID: 6603886 ZINC ID: ZINC000003869607 ChEMBL ID: CHEMBL1395334 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC115159] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Glycyrrhiza yunnanensis | Glycyrrhiza | Fabaceae |
|
| Onobrychis viciifolia | Onobrychis | Fabaceae |
|
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Hedysarum multijugum maxim | Hedysarum | Fabaceae | |
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
|
| Dracaena draco | Dracaena | Asparagaceae |
|
| Robinia pseudoacacia | Robinia | Fabaceae |
|
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
| Cicer arietinum | Cicer | Fabaceae |
|
Ingredient ID: NPC107572
Formula: C20H20O5
Ingredient ID: NPC107572
| Common Name | Sophoraflavanone B |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| Canonical SMILES | CC(=CCc1c(O)cc(c2c1OC(CC2=O)c1ccc(cc1)O)O)C |
| Standard InCHI | InChI=1S/C20H20O5/c1-11(2)3-8-14-15(22)9-16(23)19-17(24)10-18(25-20(14)19)12-4-6-13(21)7-5-12/h3-7,9,18,21-23H,8,10H2,1-2H3 |
| Standard InCHIKey | LPEPZZAVFJPLNZ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 509245 ChEMBL ID: CHEMBL460647 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC107572] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Humulus lupulus | Humulus | Cannabaceae |
|
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Sophora alopecuroides | Sophora | Fabaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Sophora moorcroftiana | Sophora | Fabaceae |
|
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
|
| Cudrania tricuspidata | Maclura | Moraceae |
|
| Artocarpus communis | Artocarpus | Moraceae | |
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
Ingredient ID: NPC104179
Formula: C17H16O5
Ingredient ID: NPC104179
| Common Name | n.a. |
| IUPAC Name | 3,4,6-trimethoxyphenanthrene-2,7-diol |
| Canonical SMILES | COc1cc2c(cc1O)ccc1c2c(OC)c(c(c1)O)OC |
| Standard InCHI | InChI=1S/C17H16O5/c1-20-14-8-11-9(6-12(14)18)4-5-10-7-13(19)16(21-2)17(22-3)15(10)11/h4-8,18-19H,1-3H3 |
| Standard InCHIKey | XGYYXBDYFNKQER-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 356766 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD138199] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Sophora tomentosa | Sophora | Fabaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC104179 | C17H16O5 | 3,4,6-trimethoxyphenanthrene-2,7-diol | 300.0997736 | -1.076 | 2.78 | 2.024 | 0 | 2 | 68.15 | 3 | 3 | 22 | 0 |
| NPC107572 | C20H20O5 | Sophoraflavanone B | 340.13 | 0.063 | 3.11 | 2.367 | 1 | 3 | 86.99 | 8 | 3 | 25 | 0 |
| NPC115159 | C15H12O4 | (Z)-1-(2,4-Dihydroxyphenyl)-3-(4-Hydroxyphenyl)Prop-2-En-1-One | 256.07 | -1.2836 | 2.67 | 2.764 | 1 | 3 | 77.76 | 6 | 2 | 19 | 0 |
| NPC133463 | C30H22O6 | Cirrhopetalanthin | 478.14 | -1.9448 | 4.1 | 4.992 | 0 | 4 | 99.38 | 9 | 6 | 36 | 0 |
| NPC14586 | C15H20N2O | 244.1575633 | -0.9321 | 2.78 | 0.889 | 3 | 0 | 23.55 | 0 | 4 | 18 | 0 | |
| NPC178014 | C16H12O5 | 284.07 | -1.4161 | 2.67 | 1.797 | 0 | 1 | 57.15 | 1 | 5 | 21 | 0 | |
| NPC19174 | C15H12O4 | Isoliquiritigenin | 256.07 | -1.2836 | 2.67 | 2.764 | 1 | 3 | 77.76 | 6 | 2 | 19 | 0 |
| NPC19615 | C21H22O6 | 5,7-dihydroxy-3-[4-hydroxy-2-methoxy-3-(3-methylbut-2-enyl)phenyl]-2,3-dihydrochromen-4-one | 370.1416384 | -0.1063 | 3.11 | 1.756 | 1 | 3 | 96.22 | 4 | 3 | 27 | 0 |
| NPC199338 | C34H30O10 | 1-(2,7-dihydroxy-3,4,9-trimethoxyphenanthren-1-yl)-3,4,9-trimethoxyphenanthrene-2,7-diol | 598.1838972 | -2.152 | 4.1 | 2.372 | 0 | 4 | 136.3 | 7 | 6 | 44 | 0 |
| NPC22610 | C15H16O3 | Batatasin Iii | 244.11 | -0.8476 | 2.78 | 3.739 | 0 | 2 | 49.69 | 7 | 2 | 18 | 0 |
| NPC228503 | C15H14O3 | 242.0942943 | -0.8476 | 2.78 | 2.696 | 0 | 2 | 49.69 | 4 | 3 | 18 | 0 | |
| NPC239996 | C17H16O5 | 1,5,6-trimethoxyphenanthrene-2,7-diol | 300.0997736 | -1.076 | 2.78 | 1.813 | 0 | 2 | 68.15 | 3 | 3 | 22 | 0 |
| NPC258780 | C30H26O6 | 482.1729386 | -1.6952 | 4.1 | 4.56 | 0 | 4 | 99.38 | 9 | 6 | 36 | 0 | |
| NPC259767 | C21H22O9 | Isoliquiritin | 418.13 | -3.0305 | 2.78 | 1.656 | 6 | 6 | 156.91 | 12 | 3 | 30 | 1 |
| NPC308650 | C20H20O5 | (2S)-5-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-2,3-dihydrochromen-7-olate | 339.1232487 | -0.2708 | 3.11 | 2.367 | 1 | 2 | 89.82 | 3 | 3 | 25 | 0 |
| NPC308768 | C17H16O5 | 300.0997736 | -1.076 | 2.78 | 1.602 | 0 | 2 | 68.15 | 8 | 3 | 22 | 0 | |
| NPC42716 | C16H12O5 | Maackiain | 284.07 | -1.4161 | 2.67 | 1.797 | 0 | 1 | 57.15 | 1 | 5 | 21 | 0 |
| NPC53781 | C15H12O3 | 240.0786442 | -0.9724 | 2.78 | 2.912 | 0 | 2 | 49.69 | 4 | 3 | 18 | 0 | |
| NPC60220 | C17H18O5 | 3,4,6-trimethoxy-9,10-dihydrophenanthrene-2,7-diol | 302.1154237 | -0.9512 | 2.78 | 1.808 | 0 | 2 | 68.15 | 3 | 3 | 22 | 0 |
| NPC62031 | C34H30O10 | 1-(2,7-dihydroxy-5,6,10-trimethoxyphenanthren-1-yl)-3,4,9-trimethoxyphenanthrene-2,7-diol | 598.1838972 | -2.152 | 4.1 | 2.372 | 0 | 4 | 136.3 | 7 | 6 | 44 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
