NPASS Compound

Natural Product: NPC63842

Natural Product ID	NPC63842
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	BQPYEFAVIPEQIK-GLGXXUBOSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	5321436
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 122128 0 0 0 0 0 0 0 0999 V2000 -8.6592 -2.4689 0.1928 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7093 -0.9359 0.4026 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9038 -0.7555 1.3084 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7505 -0.2889 -0.8935 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6490 0.5701 -1.4282 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7268 0.9826 -0.2562 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4426 1.5401 -0.6887 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2892 1.5985 0.2648 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1124 0.3596 1.1377 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7264 0.7391 2.4763 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9591 -0.6183 0.3677 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3120 -1.5123 -0.3367 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8800 -1.7415 -0.5344 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0921 -1.1187 0.5659 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6333 -0.9748 0.2371 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1090 -2.2485 0.7382 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4405 -1.0910 -1.2688 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0366 -0.9700 -1.6161 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5297 0.4511 -1.2981 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7124 1.1443 -0.2619 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2231 2.1646 -0.8341 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7395 1.9981 0.5307 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1469 0.1704 0.7103 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4727 0.7897 1.9461 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9131 1.1146 1.7552 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7457 -0.1188 1.4314 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8287 -0.8049 2.8363 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8344 0.2512 -0.8553 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7851 0.6965 -1.7465 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7520 1.6225 -1.1427 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2204 1.2663 -1.4244 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3468 0.8115 -2.8420 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3061 -0.1795 -3.2519 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8703 -1.4488 -3.7495 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5741 -2.5883 -3.3083 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7964 -1.3853 -4.7806 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4150 -0.4734 -2.2252 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2740 1.9201 -3.6815 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6325 0.4064 -0.4579 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6142 0.8941 0.3859 C 0 0 1 0 0 0 0 0 0 0 0 0 7.2289 0.9878 1.8301 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6334 -0.2483 2.6080 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7920 -1.4237 1.6638 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8792 -1.0533 0.6822 C 0 0 1 0 0 0 0 0 0 0 0 0 8.7312 -2.0380 -0.4892 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7154 -1.8382 -1.4451 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7715 0.1942 0.1554 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1648 -2.5676 2.3513 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7595 -0.5969 3.6033 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8986 2.0835 2.3862 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5077 2.9212 -1.6782 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3945 -0.4492 0.2602 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4136 -0.7015 1.2511 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6168 1.7985 0.5252 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8512 2.0656 0.2618 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2603 2.4210 1.6843 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6995 -2.8150 -0.0494 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3922 -2.9131 1.1584 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0419 -2.7481 -0.6569 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6579 0.0876 2.0055 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7905 -0.3838 0.7199 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1402 -1.6404 1.9099 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7105 0.3093 -0.9783 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9191 -1.0629 -1.7110 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0106 1.4896 -1.9109 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9985 0.0378 -2.1425 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1084 0.9774 -1.5906 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5898 2.5998 -1.0435 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3989 1.7661 -0.3865 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3038 2.4932 0.9233 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5930 0.1617 2.7630 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0364 0.6642 3.3510 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8817 1.8723 2.5194 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0144 -2.2281 -0.8744 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7397 -2.8585 -0.5636 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5543 -1.4326 -1.5581 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0562 -2.0720 1.2428 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1962 -2.0703 0.7584 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2442 -2.5266 1.7328 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0892 -3.0335 -0.0133 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9417 -0.3590 -1.8718 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7108 -2.1317 -1.5827 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0930 -1.0644 -2.7184 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6614 -1.7500 -1.1882 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5115 1.0476 -2.2457 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1928 1.8443 -1.1514 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3111 2.5787 -1.7456 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3289 3.0572 -0.1832 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5008 1.3940 1.0091 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2202 2.7421 1.1505 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2561 2.6308 -0.2556 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1236 -0.2253 1.1729 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3798 0.0644 2.8130 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0733 1.6733 2.2624 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2331 1.5199 2.7638 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0190 1.9483 1.0816 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8309 -1.2312 3.0056 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1872 -1.7476 2.8264 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3722 -0.2299 3.6272 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2335 1.1828 -2.5982 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6145 1.7815 -0.0380 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7513 2.2672 -1.3768 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3398 0.3419 -3.0585 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7036 0.2550 -4.0743 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4066 -2.1476 -5.0466 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3406 2.2161 -3.7459 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8284 1.9486 0.0325 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1625 1.1878 1.9039 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6361 -0.0600 3.0519 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8583 -1.6190 1.0926 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8809 -1.2853 1.1073 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7248 -3.0680 -0.0759 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7597 -1.8321 -0.9507 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8563 -2.6933 -1.9217 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1589 -2.6709 2.4028 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8824 0.0095 4.3912 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6806 2.3586 1.8636 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1577 3.4934 -1.1999 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7213 -1.1892 -0.5893 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3010 -1.5460 1.9358 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7640 0.1779 1.8727 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7420 3.1323 2.1888 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 9 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 20 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 19 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 2 0 34 36 1 0 33 37 1 0 32 38 1 0 31 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 44 47 1 0 43 48 1 0 42 49 1 0 41 50 1 0 30 51 1 0 11 52 1 0 52 53 1 0 6 54 1 0 54 55 2 0 54 56 1 0 53 2 1 0 52 6 1 0 26 9 1 0 37 29 1 0 47 40 1 0 26 14 1 0 23 15 1 0 1 57 1 0 1 58 1 0 1 59 1 0 3 60 1 0 3 61 1 0 3 62 1 0 4 63 1 0 4 64 1 0 5 65 1 0 5 66 1 0 7 67 1 0 7 68 1 0 8 69 1 0 8 70 1 0 10 71 1 0 10 72 1 0 10 73 1 0 12 74 1 0 13 75 1 0 13 76 1 0 14 77 1 0 16 78 1 0 16 79 1 0 16 80 1 0 17 81 1 0 17 82 1 0 18 83 1 0 18 84 1 0 19 85 1 6 21 86 1 0 21 87 1 0 21 88 1 0 22 89 1 0 22 90 1 0 22 91 1 0 23 92 1 0 24 93 1 0 24 94 1 0 25 95 1 0 25 96 1 0 27 97 1 0 27 98 1 0 27 99 1 0 29100 1 6 30101 1 1 31102 1 6 32103 1 1 33104 1 6 36105 1 0 38106 1 0 40107 1 6 41108 1 6 42109 1 1 43110 1 6 44111 1 1 45112 1 0 45113 1 0 46114 1 0 48115 1 0 49116 1 0 50117 1 0 51118 1 0 52119 1 0 53120 1 0 53121 1 0 56122 1 0 M END

Standard InCHIKey	BQPYEFAVIPEQIK-GLGXXUBOSA-N
Standard InCHI	InChI=1S/C42H66O14/c1-37(2)14-16-42(36(51)52)17-15-40(6)20(21(42)18-37)8-9-24-39(5)12-11-25(38(3,4)23(39)10-13-41(24,40)7)54-35-30(48)31(29(47)32(56-35)33(49)50)55-34-28(46)27(45)26(44)22(19-43)53-34/h8,21-32,34-35,43-48H,9-19H2,1-7H3,(H,49,50)(H,51,52)/t21?,22-,23?,24?,25+,26-,27+,28-,29+,30-,31+,32+,34+,35-,39?,40?,41?,42?/m1/s1
SMILES	CC1(C)CCC2(CCC3(C)C(=CCC4C5(C)CC[C@@H](C(C)(C)C5CCC34C)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O3)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)C2C1)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	794.45	Volume:	790.246 ? Van der Waals volume.
Dense:	1.005	LogP:	2.895 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.914 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.19 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	40.0
TPSA:	232.9 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	8.0	Rings:	7.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.137	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.776	Fsp³:	0.905
MCE-18:	154.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.915	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.055 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.183	Promiscuous compounds:	0.112

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.968	MDCK Permeability:	-5.133
Pgp-inhibitor:	0.0	Pgp-substrate:	0.001
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.003
20% Bioavailability (F20%):	0.0	30% Bioavailability (F30%):	0.001
50% Bioavailability (F50%):	0.251

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	72.775%	Volume Distribution (VD):	-0.573
Fu:	20.213% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.503
OATP1B3 inhibitor:	0.767	BCRP inhibitor:	0.0
BSEP inhibitor:	0.002

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.654	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.416	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.001
HLM stability:	0.877 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.155

Half-life (T1/2):

3.843

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.003
Human Hepatotoxicity (H-HT):	0.531	Drug-induced Liver Injury (DILI):	0.726
AMES Toxicity:	0.236	Rat Oral Acute Toxicity:	0.008
Maximum Recommended Daily Dose:	0.023	Skin Sensitization:	0.988
Carcinogencity:	0.009	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.007
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.999
Hematotoxicity:	0.233	Drug-induced Nephrotoxicity:	0.739
Genotoxicity:	0.02	RPMI-8226 Immunitoxicity:	0.03
A549 Cytotoxicity:	0.036	Hek293 Cytotoxicity:	0.043
BCF:	0.321 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.891 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.656 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.174 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jfca.2005.08.001]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18460139]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[6821187]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	n.a.	leaf	n.a.	PMID[9433811]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	Plant	n.a.	n.a.	Database[FooDB]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	Leaves	n.a.		Database[FooDB]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.		Database[Phenol-Explorer]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO14582	Spinacia oleracea	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC63842 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22730
0.1-0.2	22844
0.2-0.3	2980
0.3-0.4	776
0.4-0.5	366
0.5-0.6	94
0.6-0.7	37
0.7-0.8	0
0.8-0.85	3
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8977	High Similarity	NPC114441
0.8452	Intermediate Similarity	NPC606107
0.8261	Intermediate Similarity	NPC6377
0.8261	Intermediate Similarity	NPC208381
0.7979	Intermediate Similarity	NPC22956
0.7872	Intermediate Similarity	NPC472949
0.7732	Intermediate Similarity	NPC180550
0.7732	Intermediate Similarity	NPC35405
0.7717	Intermediate Similarity	NPC270667
0.7701	Intermediate Similarity	NPC204407
0.764	Intermediate Similarity	NPC286347
0.7527	Intermediate Similarity	NPC164194
0.7449	Intermediate Similarity	NPC114304
0.7216	Intermediate Similarity	NPC127056
0.7216	Intermediate Similarity	NPC109079
0.72	Intermediate Similarity	NPC159309
0.72	Intermediate Similarity	NPC86222
0.7184	Intermediate Similarity	NPC324875
0.7184	Intermediate Similarity	NPC292677
0.7113	Intermediate Similarity	NPC25605
0.7065	Intermediate Similarity	NPC31839
0.6923	Remote Similarity	NPC114484
0.6848	Remote Similarity	NPC283849
0.6837	Remote Similarity	NPC136877
0.6731	Remote Similarity	NPC257468
0.6667	Remote Similarity	NPC166422
0.6667	Remote Similarity	NPC294112
0.6667	Remote Similarity	NPC79718
0.6667	Remote Similarity	NPC219180
0.6667	Remote Similarity	NPC251263
0.6634	Remote Similarity	NPC488561
0.6604	Remote Similarity	NPC276093
0.66	Remote Similarity	NPC59804
0.6549	Remote Similarity	NPC54636
0.6509	Remote Similarity	NPC119794
0.65	Remote Similarity	NPC12288
0.6481	Remote Similarity	NPC488564
0.6436	Remote Similarity	NPC56713
0.6429	Remote Similarity	NPC191410
0.6364	Remote Similarity	NPC11242
0.6364	Remote Similarity	NPC62725
0.6364	Remote Similarity	NPC475472
0.6364	Remote Similarity	NPC480936
0.6316	Remote Similarity	NPC28198
0.6316	Remote Similarity	NPC476123
0.6262	Remote Similarity	NPC481082
0.6262	Remote Similarity	NPC164419
0.6226	Remote Similarity	NPC104400
0.6226	Remote Similarity	NPC10320
0.6216	Remote Similarity	NPC480939
0.62	Remote Similarity	NPC480938
0.6168	Remote Similarity	NPC139044
0.6146	Remote Similarity	NPC57362
0.614	Remote Similarity	NPC323341
0.614	Remote Similarity	NPC133818
0.6126	Remote Similarity	NPC475486
0.6095	Remote Similarity	NPC80843
0.6	Remote Similarity	NPC157868
0.5962	Remote Similarity	NPC174679
0.5962	Remote Similarity	NPC279554
0.596	Remote Similarity	NPC100383
0.5946	Remote Similarity	NPC323359
0.5888	Remote Similarity	NPC469945
0.5882	Remote Similarity	NPC21691
0.5877	Remote Similarity	NPC476992
0.5868	Remote Similarity	NPC161717
0.5865	Remote Similarity	NPC603870
0.5842	Remote Similarity	NPC284807
0.58	Remote Similarity	NPC242611
0.5798	Remote Similarity	NPC4749
0.578	Remote Similarity	NPC44716
0.5778	Remote Similarity	NPC120840
0.5738	Remote Similarity	NPC471385
0.5728	Remote Similarity	NPC473481
0.5727	Remote Similarity	NPC258885
0.5727	Remote Similarity	NPC475591
0.5727	Remote Similarity	NPC236870
0.5714	Remote Similarity	NPC281148
0.5701	Remote Similarity	NPC488516
0.5686	Remote Similarity	NPC475633
0.5676	Remote Similarity	NPC73829
0.5636	Remote Similarity	NPC40775
0.5636	Remote Similarity	NPC251768
0.5625	Remote Similarity	NPC302887
0.5596	Remote Similarity	NPC192791
0.5596	Remote Similarity	NPC75417
0.5593	Remote Similarity	NPC471384
0.5586	Remote Similarity	NPC471383
0.5565	Remote Similarity	NPC111466
0.5556	Remote Similarity	NPC473884
0.5545	Remote Similarity	NPC605226
0.5534	Remote Similarity	NPC480937
0.5514	Remote Similarity	NPC108748
0.5514	Remote Similarity	NPC475516
0.5478	Remote Similarity	NPC160452
0.5478	Remote Similarity	NPC477193
0.547	Remote Similarity	NPC288205
0.547	Remote Similarity	NPC51465
0.5444	Remote Similarity	NPC480946
0.5444	Remote Similarity	NPC130577
0.5444	Remote Similarity	NPC142415
0.5444	Remote Similarity	NPC102683
0.5431	Remote Similarity	NPC187290
0.5431	Remote Similarity	NPC477194
0.5413	Remote Similarity	NPC603026
0.5391	Remote Similarity	NPC23275
0.5385	Remote Similarity	NPC270768
0.5385	Remote Similarity	NPC59263
0.5385	Remote Similarity	NPC210106
0.5385	Remote Similarity	NPC280941
0.5385	Remote Similarity	NPC473538
0.5385	Remote Similarity	NPC235772
0.5377	Remote Similarity	NPC211798
0.5377	Remote Similarity	NPC76999
0.5351	Remote Similarity	NPC64715
0.5351	Remote Similarity	NPC488515
0.5351	Remote Similarity	NPC603832
0.5345	Remote Similarity	NPC488209
0.5315	Remote Similarity	NPC223301
0.5315	Remote Similarity	NPC242840
0.5315	Remote Similarity	NPC171544
0.5299	Remote Similarity	NPC469947
0.5299	Remote Similarity	NPC480948
0.5259	Remote Similarity	NPC301449
0.5259	Remote Similarity	NPC601290
0.5248	Remote Similarity	NPC274507
0.5229	Remote Similarity	NPC309780
0.5225	Remote Similarity	NPC482746
0.5225	Remote Similarity	NPC475171
0.5221	Remote Similarity	NPC473383
0.5217	Remote Similarity	NPC275809
0.5189	Remote Similarity	NPC480943
0.5182	Remote Similarity	NPC173583
0.5175	Remote Similarity	NPC118440
0.5161	Remote Similarity	NPC158141
0.5156	Remote Similarity	NPC302543
0.514	Remote Similarity	NPC214484
0.5106	Remote Similarity	NPC298554
0.5104	Remote Similarity	NPC296164
0.5096	Remote Similarity	NPC224121
0.5091	Remote Similarity	NPC235405
0.5088	Remote Similarity	NPC11551
0.5083	Remote Similarity	NPC25998
0.5081	Remote Similarity	NPC47995
0.5052	Remote Similarity	NPC96580
0.5046	Remote Similarity	NPC48499
0.5045	Remote Similarity	NPC58448
0.5045	Remote Similarity	NPC249848
0.5045	Remote Similarity	NPC107966
0.5043	Remote Similarity	NPC114692
0.5043	Remote Similarity	NPC104372
0.5041	Remote Similarity	NPC609119

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC63842 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6886
0.1-0.2	2196
0.2-0.3	60
0.3-0.4	6
0.4-0.5	1
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.581	Remote Similarity	NPD8295	Clinical (unspecified phase)

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data