NPASS Compound

Natural Product: NPC490126

Natural Product ID	NPC490126
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Capsicoside B1
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 117124 0 0 0 0 0 0 0 0999 V2000 7.0366 0.9285 -2.4768 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2718 0.4157 -1.1049 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0780 0.2025 -0.2414 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7512 1.6236 0.1575 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5068 1.9465 -0.6247 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9269 0.6510 -1.0876 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5632 0.4939 -0.4142 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7204 -0.4740 -1.1597 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8383 -1.3609 -0.3820 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7736 -1.2012 1.0749 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6454 -1.3370 1.6463 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5580 -0.2336 1.2255 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2631 -0.5838 0.0874 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6604 -0.6392 0.2837 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0613 -1.9100 0.0434 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4037 -2.1421 0.2243 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6825 -2.3635 1.6868 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4123 -1.3035 2.5125 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2844 -1.2114 -0.4909 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9936 -0.3975 0.3704 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3331 -0.2625 0.0234 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6173 1.0884 -0.2650 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7749 1.1386 -1.0172 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5054 1.0397 -2.5004 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7162 1.1107 -3.1833 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7192 0.0074 -0.6457 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.0062 0.4647 -0.9482 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6313 -0.1798 0.8593 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.4923 -1.1893 1.2917 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2090 -0.6418 1.1678 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1957 -2.0124 1.4249 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4713 -0.2261 -1.3547 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2889 0.8156 -1.7858 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3098 0.3277 -0.6329 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7220 1.4381 0.1424 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8466 1.0703 0.9524 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8170 1.3753 -0.4112 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4604 1.2328 1.6473 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3440 0.0352 1.6613 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6327 -0.2673 3.1457 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7057 0.2802 1.0500 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7395 -0.7134 1.4418 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3452 -1.4120 0.2764 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8883 -0.4485 -0.7946 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1443 -1.3418 -1.9904 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8447 2.4150 -0.1846 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9426 1.5543 -0.3227 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4183 1.1617 1.0223 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5066 0.1169 0.8656 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5842 0.7550 0.0105 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7590 -0.1635 -0.2225 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9412 1.1885 -1.2872 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9711 2.1322 -1.0352 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6622 0.4143 -3.2675 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9826 0.9183 -2.8229 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3363 2.0055 -2.5771 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9176 -0.4744 -1.1556 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4472 -0.3044 0.6886 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6134 1.7348 1.2548 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8363 2.5071 0.0923 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6937 2.6896 -1.4464 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6912 0.7156 -2.1768 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1127 1.5318 -0.5211 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0979 0.1119 -1.9055 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4047 -1.0523 -1.8548 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1045 -2.4310 -0.6543 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2230 -1.2890 -0.7764 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3181 -2.0689 1.5553 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6061 -1.4290 2.7467 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0462 -2.2960 1.2662 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3041 -0.0964 2.0514 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7760 -0.3373 1.3602 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5618 -3.1800 -0.2381 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0057 -3.2085 2.0723 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6938 -2.7774 1.8962 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1526 -0.6640 2.5916 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9715 -1.6889 -1.2109 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5139 -0.8948 -0.8615 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2933 2.0766 -0.7740 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9977 0.0631 -2.6643 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8910 1.8899 -2.7986 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5540 0.7806 -4.1074 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5510 -0.9056 -1.2110 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0556 1.3709 -0.5104 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8603 0.7382 1.4032 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9875 -0.9517 2.1069 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8832 -0.0429 2.0617 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9517 -2.1121 2.3929 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1224 -0.7586 -2.2616 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0804 1.6683 -1.3213 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5223 0.7391 -1.3298 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9477 1.9155 0.5177 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5337 1.8760 1.3615 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9223 2.3394 -0.5944 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0086 2.0579 1.1398 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2499 1.6385 2.6817 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7174 0.0435 3.7380 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7296 -1.3390 3.3431 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4435 0.3678 3.5347 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0313 1.2653 1.5060 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5800 -0.2694 2.0540 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3127 -1.4900 2.0956 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2456 -1.9649 0.6393 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6927 -2.1747 -0.1860 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2463 -1.3723 -2.1559 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5800 -1.0133 -2.8856 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8505 -2.4020 -1.8288 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9603 2.0643 1.4355 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6733 0.9046 1.7678 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8903 -0.0566 1.9129 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1567 -0.8194 0.4169 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9174 1.6553 0.5257 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5755 0.1425 0.4277 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4436 -1.1835 0.0645 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0344 -0.2235 -1.2951 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7472 1.7110 -1.8806 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6295 0.3407 -1.9078 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 16 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 23 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 19 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 12 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 4 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 50 52 1 0 52 53 1 0 47 2 1 0 53 47 1 0 44 3 1 0 44 6 1 0 41 7 1 0 39 10 1 0 34 14 1 0 30 21 1 0 1 54 1 0 1 55 1 0 1 56 1 0 2 57 1 0 3 58 1 0 4 59 1 0 5 60 1 0 5 61 1 0 6 62 1 0 7 63 1 0 8 64 1 0 8 65 1 0 9 66 1 0 9 67 1 0 10 68 1 0 11 69 1 0 11 70 1 0 12 71 1 0 14 72 1 0 16 73 1 0 17 74 1 0 17 75 1 0 18 76 1 0 19 77 1 0 21 78 1 0 23 79 1 0 24 80 1 0 24 81 1 0 25 82 1 0 26 83 1 0 27 84 1 0 28 85 1 0 29 86 1 0 30 87 1 0 31 88 1 0 32 89 1 0 33 90 1 0 34 91 1 0 35 92 1 0 36 93 1 0 37 94 1 0 38 95 1 0 38 96 1 0 40 97 1 0 40 98 1 0 40 99 1 0 41100 1 0 42101 1 0 42102 1 0 43103 1 0 43104 1 0 45105 1 0 45106 1 0 45107 1 0 48108 1 0 48109 1 0 49110 1 0 49111 1 0 50112 1 0 51113 1 0 51114 1 0 51115 1 0 52116 1 0 52117 1 0 M END

Standard InCHIKey	BOFSXGGSAUTBNA-UHFFFAOYSA-N
Standard InCHI	InChI=1S/C39H64O14/c1-17-7-10-39(48-16-17)18(2)28-25(53-39)12-22-20-6-5-19-11-24(23(42)13-38(19,4)21(20)8-9-37(22,28)3)49-35-33(47)31(45)34(27(15-41)51-35)52-36-32(46)30(44)29(43)26(14-40)50-36/h17-36,40-47H,5-16H2,1-4H3
SMILES	CC1C2C(CC3C4CCC5CC(OC6OC(CO)C(OC7OC(CO)C(O)C(O)C7O)C(O)C6O)C(O)CC5(C)C4CCC23C)OC11CCC(C)CO1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	756.43	Volume:	737.711 ? Van der Waals volume.
Dense:	1.025	LogP:	1.273 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.415 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.605 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	42.0
TPSA:	217.22 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	8.0	Rings:	8.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.173	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.334	Fsp³:	1.0
MCE-18:	203.846 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.003	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.063 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.066 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.32	Promiscuous compounds:	0.003

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.72	MDCK Permeability:	-4.816
Pgp-inhibitor:	0.0	Pgp-substrate:	0.325
PAMPA:	0.986 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.601
20% Bioavailability (F20%):	0.072	30% Bioavailability (F30%):	0.907
50% Bioavailability (F50%):	0.998

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.532	MRP1:	1.0
Plasma Protein Binding (PPB):	57.32%	Volume Distribution (VD):	-0.441
Fu:	30.635% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.162	BCRP inhibitor:	0.003
BSEP inhibitor:	0.505

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.977	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.999	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.035	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.002
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.183

Half-life (T1/2):

3.239

ADMET: Toxicity

hERG Blockers:	0.113	hERG Blockers (10um):	0.592
Human Hepatotoxicity (H-HT):	0.624	Drug-induced Liver Injury (DILI):	0.313
AMES Toxicity:	0.358	Rat Oral Acute Toxicity:	0.178
Maximum Recommended Daily Dose:	0.46	Skin Sensitization:	0.027
Carcinogencity:	0.124	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.018
Drug-induced Neurotoxicity:	0.548	Ototoxicity:	0.999
Hematotoxicity:	0.013	Drug-induced Nephrotoxicity:	0.019
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.109
A549 Cytotoxicity:	0.063	Hek293 Cytotoxicity:	0.771
BCF:	1.528 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.059 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.818 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.634 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	n.a.	fruit	n.a.	PMID[12932131]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20460582]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	n.a.	fruit	n.a.	PMID[25172746]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8910532]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	Tissue Culture	n.a.	n.a.	Database[FooDB]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	Seed	n.a.	n.a.	Database[FooDB]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	Root	n.a.	n.a.	Database[FooDB]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	Resin, Exudate, Sap	n.a.	n.a.	Database[FooDB]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	Pericarp	n.a.	n.a.	Database[FooDB]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	Fruit	n.a.	n.a.	Database[FooDB]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO16501	Capsicum annuum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference
NPO16501	Capsicum annuum	Raw	Root	62	62	62	mg/100g	Database [DUKE]

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC490126 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27003
0.1-0.2	19720
0.2-0.3	2640
0.3-0.4	294
0.4-0.5	86
0.5-0.6	66
0.6-0.7	35
0.7-0.8	1
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8171	Intermediate Similarity	NPC325828
0.8152	Intermediate Similarity	NPC115165
0.7955	Intermediate Similarity	NPC195297
0.7857	Intermediate Similarity	NPC294686
0.7791	Intermediate Similarity	NPC121453
0.7732	Intermediate Similarity	NPC83137
0.7471	Intermediate Similarity	NPC222731
0.7347	Intermediate Similarity	NPC232611
0.7333	Intermediate Similarity	NPC107962
0.7312	Intermediate Similarity	NPC473601
0.72	Intermediate Similarity	NPC470862
0.7079	Intermediate Similarity	NPC250393
0.7071	Intermediate Similarity	NPC473518
0.6923	Remote Similarity	NPC107188
0.6768	Remote Similarity	NPC97700
0.6768	Remote Similarity	NPC184617
0.6768	Remote Similarity	NPC30856
0.6739	Remote Similarity	NPC54619
0.6702	Remote Similarity	NPC6295
0.663	Remote Similarity	NPC206003
0.663	Remote Similarity	NPC473610
0.6556	Remote Similarity	NPC297348
0.6556	Remote Similarity	NPC249204
0.6556	Remote Similarity	NPC48339
0.6556	Remote Similarity	NPC141769
0.6556	Remote Similarity	NPC477547
0.6484	Remote Similarity	NPC234352
0.6477	Remote Similarity	NPC24960
0.6449	Remote Similarity	NPC470867
0.6383	Remote Similarity	NPC19400
0.6354	Remote Similarity	NPC470432
0.6354	Remote Similarity	NPC230507
0.6337	Remote Similarity	NPC151134
0.6321	Remote Similarity	NPC132080
0.6262	Remote Similarity	NPC31896
0.6237	Remote Similarity	NPC477451
0.6224	Remote Similarity	NPC160426
0.6211	Remote Similarity	NPC211354
0.6207	Remote Similarity	NPC481190
0.6162	Remote Similarity	NPC475351
0.6154	Remote Similarity	NPC485594
0.6139	Remote Similarity	NPC92890
0.6139	Remote Similarity	NPC477809
0.6136	Remote Similarity	NPC277715
0.6095	Remote Similarity	NPC475625
0.6095	Remote Similarity	NPC116756
0.6038	Remote Similarity	NPC232037
0.6017	Remote Similarity	NPC330026
0.5981	Remote Similarity	NPC470864
0.5922	Remote Similarity	NPC6806
0.5914	Remote Similarity	NPC181845
0.5905	Remote Similarity	NPC51520
0.5905	Remote Similarity	NPC303069
0.5877	Remote Similarity	NPC210569
0.5865	Remote Similarity	NPC128572
0.5859	Remote Similarity	NPC485595
0.5824	Remote Similarity	NPC473774
0.5824	Remote Similarity	NPC481419
0.5824	Remote Similarity	NPC481417
0.5794	Remote Similarity	NPC470861
0.5794	Remote Similarity	NPC32361
0.5727	Remote Similarity	NPC233433
0.5727	Remote Similarity	NPC477811
0.5714	Remote Similarity	NPC480555
0.5714	Remote Similarity	NPC470866
0.5714	Remote Similarity	NPC150372
0.57	Remote Similarity	NPC125324
0.5684	Remote Similarity	NPC177834
0.5577	Remote Similarity	NPC475643
0.5545	Remote Similarity	NPC92710
0.5495	Remote Similarity	NPC476112
0.5495	Remote Similarity	NPC144790
0.5495	Remote Similarity	NPC149400
0.5495	Remote Similarity	NPC307534
0.5488	Remote Similarity	NPC227260
0.5484	Remote Similarity	NPC481420
0.5484	Remote Similarity	NPC481421
0.5472	Remote Similarity	NPC471464
0.5472	Remote Similarity	NPC300557
0.5429	Remote Similarity	NPC470433
0.5429	Remote Similarity	NPC46190
0.5429	Remote Similarity	NPC171073
0.5413	Remote Similarity	NPC269297
0.5413	Remote Similarity	NPC222202
0.5413	Remote Similarity	NPC475550
0.5397	Remote Similarity	NPC329820
0.5385	Remote Similarity	NPC220836
0.5333	Remote Similarity	NPC263359
0.5327	Remote Similarity	NPC51172
0.5327	Remote Similarity	NPC49032
0.531	Remote Similarity	NPC480553
0.5301	Remote Similarity	NPC248944
0.5301	Remote Similarity	NPC7479
0.5301	Remote Similarity	NPC257296
0.5299	Remote Similarity	NPC477807
0.5288	Remote Similarity	NPC113044
0.5288	Remote Similarity	NPC283829
0.5288	Remote Similarity	NPC161676
0.5283	Remote Similarity	NPC602423
0.5196	Remote Similarity	NPC264101
0.5182	Remote Similarity	NPC475319
0.5158	Remote Similarity	NPC481418
0.5143	Remote Similarity	NPC14704
0.5133	Remote Similarity	NPC480554
0.5128	Remote Similarity	NPC94086
0.5128	Remote Similarity	NPC473817
0.5089	Remote Similarity	NPC475333
0.5089	Remote Similarity	NPC224098
0.5089	Remote Similarity	NPC208383
0.5082	Remote Similarity	NPC244431
0.5048	Remote Similarity	NPC141433
0.5046	Remote Similarity	NPC249553
0.5044	Remote Similarity	NPC194207
0.5044	Remote Similarity	NPC22779

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC490126 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7659
0.1-0.2	1394
0.2-0.3	89
0.3-0.4	4
0.4-0.5	1
0.5-0.6	1
0.6-0.7	0
0.7-0.8	1
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.8171	Intermediate Similarity	NPD8171	Phase 2
0.7065	Intermediate Similarity	NPD8170	Phase 2
0.5301	Remote Similarity	NPD6928	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data