NPASS Compound

Natural Product: NPC469434

Natural Product ID	NPC469434
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	LTSGALPTPGTMBA-YWYXKTAUSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	46883016
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 143150 0 0 0 0 0 0 0 0999 V2000 -4.9683 1.0964 1.5120 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6259 -0.2704 1.9059 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2706 -0.7660 1.5846 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5555 -2.1047 0.8836 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4453 -2.2920 -0.1387 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4978 -1.2539 0.2482 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4302 -0.0751 0.5993 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5546 1.0209 1.0660 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0974 0.7243 1.2493 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5552 -0.0828 0.2068 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4811 -0.7668 -0.7099 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2079 -1.8121 -1.4807 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6647 -1.8296 -1.5573 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4218 -0.5479 -1.2277 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5560 0.5411 -0.6851 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3898 1.6337 -0.1619 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5035 1.2739 0.7773 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3932 0.1928 0.2208 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6519 -0.9046 -0.4504 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3911 0.7680 -0.4925 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6801 0.6225 -0.1092 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4600 1.8466 0.2253 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7671 1.7692 -0.5821 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4615 0.5034 -0.0745 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5884 -0.6596 -0.4114 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3944 -0.2405 -0.9933 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2531 -1.5635 -1.4310 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4943 -0.8727 -2.6256 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7541 0.3775 -0.5255 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7137 0.4953 0.4540 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4750 -0.7910 0.6920 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2264 -1.2070 -0.5289 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4177 -0.0276 -1.4323 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5487 1.2888 -0.7058 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6125 1.5067 0.2647 O 0 0 0 0 0 0 0 0 0 0 0 0 14.9710 1.3670 -0.1686 C 0 0 0 0 0 0 0 0 0 0 0 0 15.2353 2.6272 0.3863 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4907 0.0255 -2.4719 O 0 0 0 0 0 0 0 0 0 0 0 0 14.4086 -1.8089 -0.1297 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6855 -1.7847 1.2388 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4391 1.6098 -1.9098 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8720 1.8946 1.5649 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8621 1.1606 -1.9340 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1154 0.2899 -0.6849 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7835 -1.8616 0.2595 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5047 -1.3851 1.3759 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8953 -1.0191 1.0548 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6098 -0.5331 2.2662 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0859 -0.1584 1.9728 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8146 -1.3324 1.4421 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1228 1.1258 1.2681 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2874 1.6859 0.9034 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0783 1.1304 -0.0317 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3103 2.1530 -1.1710 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.7606 2.0836 -1.5926 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.0290 0.5934 -1.8519 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.9358 -0.0525 -0.4618 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3581 0.8422 0.4555 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.3282 -0.4730 -0.0414 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.1810 0.6292 0.0518 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.0329 0.0996 -2.6877 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.0419 2.8763 -2.6749 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0642 3.4089 -0.6498 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4728 -2.4274 2.2866 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0320 -3.5959 1.8426 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1105 1.7053 1.1193 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7804 1.2311 0.7690 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3098 1.7316 2.3890 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7271 -0.3374 3.0333 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6533 -1.0195 2.4696 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5915 -2.9146 1.6311 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0052 -3.3086 0.0796 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7951 -2.3336 -1.1640 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0336 -1.5459 1.2177 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9164 1.4454 2.0465 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6193 1.8846 0.3497 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0194 0.2353 2.2696 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4213 1.6933 1.3835 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0471 -0.9697 0.7084 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8223 0.0306 -1.3843 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1372 -2.8106 -1.0713 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1970 -1.7969 -2.5271 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0347 -2.5852 -0.7929 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0619 -2.2730 -2.5211 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7868 -0.1734 -2.2357 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9234 2.0677 -1.0697 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8739 2.5110 0.2578 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0302 1.0089 1.7460 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0785 2.2026 0.9740 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9058 -0.2695 1.0841 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3257 -1.6721 0.2971 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3246 -1.4630 -1.1342 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6578 0.0128 0.8264 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9658 2.7934 -0.0473 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4151 2.6423 -0.3892 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5356 0.6734 1.0403 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3156 -1.2847 0.4789 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2432 -1.9231 -1.0938 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6374 -2.4696 -1.6031 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0509 -1.3319 -3.3953 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1717 0.6892 1.4225 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2391 -0.5388 1.4842 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6381 -1.9791 -1.0636 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4162 -0.1859 -1.9403 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4654 2.0881 -1.4702 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7117 1.2508 -0.9868 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1590 0.5415 0.5382 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9448 2.5511 1.3505 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3856 1.0053 -2.6715 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1530 -2.4761 0.5738 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8113 -1.3727 1.5232 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1966 2.4769 -2.3224 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0964 1.9564 2.1797 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6608 0.4034 -2.6999 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6168 1.8521 -2.4245 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0375 1.8198 -1.6534 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8035 1.3308 -0.9779 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2078 0.1741 -0.6903 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7905 -0.3404 -1.5653 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4266 -1.9128 0.6734 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9701 -0.3010 0.1910 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1894 0.3205 2.7863 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6843 -1.3695 2.9959 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4684 0.0580 3.0396 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4818 -1.5703 0.4253 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9026 -1.1689 1.4400 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6859 -2.2351 2.1163 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3969 1.0403 0.3953 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5808 1.9274 1.8970 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6557 0.2146 -0.4369 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6702 1.8825 -2.0377 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4020 2.3327 -0.7213 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9857 0.4236 -2.3402 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3000 -0.9493 -0.4934 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.2794 -1.0457 0.8997 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.7173 -1.1029 -0.8758 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.6230 0.7161 0.9284 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7964 -0.8448 -2.5031 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5096 2.3150 -3.3482 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2184 3.3215 -0.1091 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9218 -4.4140 2.6360 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1347 -3.5098 1.6975 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5935 -4.0195 0.9214 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 25 27 1 0 27 28 1 0 24 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 33 38 1 0 32 39 1 0 31 40 1 0 23 41 1 0 22 42 1 0 15 43 1 0 7 44 1 0 4 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 56 61 1 0 55 62 1 0 54 63 1 0 46 64 1 0 64 65 1 0 46 2 1 0 7 3 1 0 11 6 1 0 15 10 1 0 19 14 1 0 26 21 1 0 35 30 1 0 58 53 1 0 1 66 1 0 1 67 1 0 1 68 1 0 2 69 1 0 3 70 1 0 4 71 1 0 5 72 1 0 5 73 1 0 6 74 1 0 8 75 1 0 8 76 1 0 9 77 1 0 9 78 1 0 10 79 1 0 11 80 1 0 12 81 1 0 12 82 1 0 13 83 1 0 13 84 1 0 14 85 1 0 16 86 1 0 16 87 1 0 17 88 1 0 17 89 1 0 18 90 1 0 19 91 1 0 19 92 1 0 21 93 1 0 22 94 1 0 23 95 1 0 24 96 1 0 25 97 1 0 27 98 1 0 27 99 1 0 28100 1 0 30101 1 0 31102 1 0 32103 1 0 33104 1 0 34105 1 0 36106 1 0 36107 1 0 37108 1 0 38109 1 0 39110 1 0 40111 1 0 41112 1 0 42113 1 0 43114 1 0 43115 1 0 43116 1 0 44117 1 0 44118 1 0 44119 1 0 47120 1 0 47121 1 0 48122 1 0 48123 1 0 49124 1 0 50125 1 0 50126 1 0 50127 1 0 51128 1 0 51129 1 0 53130 1 0 54131 1 0 55132 1 0 56133 1 0 57134 1 0 59135 1 0 59136 1 0 60137 1 0 61138 1 0 62139 1 0 63140 1 0 65141 1 0 65142 1 0 65143 1 0 M END

Standard InCHIKey	LTSGALPTPGTMBA-YWYXKTAUSA-N
Standard InCHI	InChI=1S/C46H78O19/c1-20(19-59-41-37(55)34(52)32(50)28(16-47)61-41)8-13-46(58-5)21(2)31-27(65-46)15-26-24-7-6-22-14-23(9-11-44(22,3)25(24)10-12-45(26,31)4)60-42-39(57)36(54)40(30(18-49)63-42)64-43-38(56)35(53)33(51)29(17-48)62-43/h20-43,47-57H,6-19H2,1-5H3/t20-,21+,22-,23+,24-,25+,26+,27+,28-,29-,30-,31+,32-,33-,34+,35+,36-,37-,38-,39-,40-,41-,42-,43+,44+,45+,46-/m1/s1
SMILES	CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)O)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)OC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	934.51	Volume:	902.734 ? Van der Waals volume.
Dense:	1.035	LogP:	0.472 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.537 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.054 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	42.0
TPSA:	296.37 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.092	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.383	Fsp³:	1.0
MCE-18:	156.13 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.001	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.033 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.202 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.402	Promiscuous compounds:	0.004

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.899	MDCK Permeability:	-4.841
Pgp-inhibitor:	0.0	Pgp-substrate:	0.947
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.998
20% Bioavailability (F20%):	0.084	30% Bioavailability (F30%):	0.998
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.061	MRP1:	1.0
Plasma Protein Binding (PPB):	32.862%	Volume Distribution (VD):	-0.534
Fu:	51.608% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.003	BCRP inhibitor:	0.001
BSEP inhibitor:	0.025

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.992	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	1.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.011	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.542

Half-life (T1/2):

3.243

ADMET: Toxicity

hERG Blockers:	0.082	hERG Blockers (10um):	0.557
Human Hepatotoxicity (H-HT):	0.593	Drug-induced Liver Injury (DILI):	0.194
AMES Toxicity:	0.426	Rat Oral Acute Toxicity:	0.088
Maximum Recommended Daily Dose:	0.263	Skin Sensitization:	0.015
Carcinogencity:	0.022	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.221	Ototoxicity:	1.0
Hematotoxicity:	0.007	Drug-induced Nephrotoxicity:	0.006
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.089
A549 Cytotoxicity:	0.04	Hek293 Cytotoxicity:	0.779
BCF:	1.444 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.025 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.904 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.521 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO16699	Agave utahensis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19645463]
NPO16699	Agave utahensis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO16699	Agave utahensis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC469434 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26098
0.1-0.2	20363
0.2-0.3	2726
0.3-0.4	389
0.4-0.5	158
0.5-0.6	70
0.6-0.7	41
0.7-0.8	1
0.8-0.85	2
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8659	High Similarity	NPC325828
0.8404	Intermediate Similarity	NPC116756
0.8229	Intermediate Similarity	NPC470864
0.7931	Intermediate Similarity	NPC250393
0.7822	Intermediate Similarity	NPC470866
0.7778	Intermediate Similarity	NPC107962
0.7753	Intermediate Similarity	NPC107188
0.766	Intermediate Similarity	NPC475643
0.7526	Intermediate Similarity	NPC97700
0.7526	Intermediate Similarity	NPC30856
0.7172	Intermediate Similarity	NPC184617
0.7059	Intermediate Similarity	NPC232611
0.7019	Intermediate Similarity	NPC132080
0.6947	Remote Similarity	NPC6295
0.6923	Remote Similarity	NPC470862
0.6923	Remote Similarity	NPC234352
0.6882	Remote Similarity	NPC206003
0.6882	Remote Similarity	NPC473610
0.6813	Remote Similarity	NPC297348
0.6813	Remote Similarity	NPC249204
0.6813	Remote Similarity	NPC48339
0.6813	Remote Similarity	NPC141769
0.6813	Remote Similarity	NPC477547
0.6809	Remote Similarity	NPC211354
0.6804	Remote Similarity	NPC160426
0.6796	Remote Similarity	NPC475625
0.6735	Remote Similarity	NPC475351
0.6731	Remote Similarity	NPC232037
0.6632	Remote Similarity	NPC19400
0.6535	Remote Similarity	NPC92890
0.6489	Remote Similarity	NPC477451
0.6452	Remote Similarity	NPC177834
0.6415	Remote Similarity	NPC194207
0.6415	Remote Similarity	NPC22779
0.6408	Remote Similarity	NPC128572
0.6389	Remote Similarity	NPC233433
0.6311	Remote Similarity	NPC6806
0.6286	Remote Similarity	NPC115165
0.6263	Remote Similarity	NPC470432
0.6263	Remote Similarity	NPC230507
0.6237	Remote Similarity	NPC485594
0.619	Remote Similarity	NPC98018
0.619	Remote Similarity	NPC284104
0.619	Remote Similarity	NPC103616
0.6168	Remote Similarity	NPC309278
0.6147	Remote Similarity	NPC83137
0.6126	Remote Similarity	NPC232054
0.61	Remote Similarity	NPC125324
0.6075	Remote Similarity	NPC470863
0.6058	Remote Similarity	NPC477809
0.6	Remote Similarity	NPC471464
0.6	Remote Similarity	NPC51172
0.6	Remote Similarity	NPC220836
0.6	Remote Similarity	NPC49032
0.5882	Remote Similarity	NPC195297
0.5859	Remote Similarity	NPC121453
0.5856	Remote Similarity	NPC476112
0.5856	Remote Similarity	NPC307534
0.5833	Remote Similarity	NPC181845
0.5804	Remote Similarity	NPC84111
0.5804	Remote Similarity	NPC287483
0.5804	Remote Similarity	NPC470865
0.5798	Remote Similarity	NPC263359
0.5789	Remote Similarity	NPC470867
0.5784	Remote Similarity	NPC485595
0.5743	Remote Similarity	NPC264101
0.5739	Remote Similarity	NPC94086
0.5739	Remote Similarity	NPC473817
0.5727	Remote Similarity	NPC473518
0.5714	Remote Similarity	NPC294686
0.5714	Remote Similarity	NPC291203
0.5714	Remote Similarity	NPC473601
0.5714	Remote Similarity	NPC217205
0.5688	Remote Similarity	NPC475319
0.5684	Remote Similarity	NPC24960
0.5664	Remote Similarity	NPC477811
0.5566	Remote Similarity	NPC202898
0.5517	Remote Similarity	NPC262050
0.5505	Remote Similarity	NPC480555
0.5505	Remote Similarity	NPC150372
0.5478	Remote Similarity	NPC31896
0.5472	Remote Similarity	NPC485605
0.5446	Remote Similarity	NPC222731
0.5413	Remote Similarity	NPC249553
0.5392	Remote Similarity	NPC128123
0.5391	Remote Similarity	NPC92297
0.5385	Remote Similarity	NPC215408
0.537	Remote Similarity	NPC485603
0.5368	Remote Similarity	NPC277715
0.5361	Remote Similarity	NPC485600
0.536	Remote Similarity	NPC481190
0.5357	Remote Similarity	NPC475550
0.5273	Remote Similarity	NPC300557
0.525	Remote Similarity	NPC477807
0.5229	Remote Similarity	NPC470433
0.5229	Remote Similarity	NPC46190
0.5229	Remote Similarity	NPC171073
0.5225	Remote Similarity	NPC485604
0.5221	Remote Similarity	NPC269297
0.5221	Remote Similarity	NPC222202
0.5194	Remote Similarity	NPC329807
0.5191	Remote Similarity	NPC481189
0.5175	Remote Similarity	NPC475333
0.5175	Remote Similarity	NPC224098
0.5175	Remote Similarity	NPC208383
0.5164	Remote Similarity	NPC210569
0.5152	Remote Similarity	NPC329727
0.5149	Remote Similarity	NPC485602
0.5133	Remote Similarity	NPC51520
0.5133	Remote Similarity	NPC303069
0.5128	Remote Similarity	NPC480553
0.5102	Remote Similarity	NPC473774
0.5102	Remote Similarity	NPC481419
0.5102	Remote Similarity	NPC481417
0.5093	Remote Similarity	NPC113044
0.5093	Remote Similarity	NPC283829
0.5093	Remote Similarity	NPC14704
0.5093	Remote Similarity	NPC161676
0.5091	Remote Similarity	NPC602423
0.5089	Remote Similarity	NPC151134
0.5086	Remote Similarity	NPC108072
0.5082	Remote Similarity	NPC273002
0.5048	Remote Similarity	NPC54619
0.5043	Remote Similarity	NPC470861

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC469434 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7571
0.1-0.2	1478
0.2-0.3	84
0.3-0.4	11
0.4-0.5	4
0.5-0.6	0
0.6-0.7	0
0.7-0.8	1
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.8659	High Similarity	NPD8171	Phase 2
0.7312	Intermediate Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data