Natural Product: NPC285829| Natural Product ID | NPC285829 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Plumbagin |
| IUPAC Name | 5-hydroxy-2-methylnaphthalene-1,4-dione |
| Synonyms | plumbagin |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL295316 |
| PubChem CID |
10205 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | VCMMXZQDRFWYSE-UHFFFAOYSA-N |
| Standard InCHI | InChI=1S/C11H8O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-5,12H,1H3 |
| SMILES | CC1=CC(=O)c2c(cccc2O)C1=O |
  Calculated Properties| Molecular Weight:   | 188.05 | Volume:   | 192.251 Van der Waals volume.
|
| Dense:   | 0.978 | LogP:   | 2.375 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 2.446 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -2.766 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 0.0 | Rigid Bonds:   | 13.0 |
| TPSA:   | 54.37 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 3.0 |
| H-Bond Donor:   | 1.0 | Rings:   | 2.0 |
| Heavy Atoms:   | 3.0 |
| QED Drug-Likeness Score:   | 0.674 | GASA:   | 1.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 2.267 | Fsp3:   | 0.091 |
| MCE-18:   | 24.0 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Rejected | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Accepted | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 1 |
| Colloidal aggregators:   | 0.138 | Fluc inhibitor:   | 0.664 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.8 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.214 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.871 | Promiscuous compounds:   | 0.236 |
| Caco-2 Permeability:   | -4.692 | MDCK Permeability:   | -4.608 |
| Pgp-inhibitor:   | 0.012 | Pgp-substrate:   | 0.002 |
| PAMPA:   |
0.969 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.406 |
| 20% Bioavailability (F20%):   | 0.018 | 30% Bioavailability (F30%):   | 0.256 |
| 50% Bioavailability (F50%):   | 0.517 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.0 | MRP1:   | 0.819 |
| Plasma Protein Binding (PPB):   | 97.095% | Volume Distribution (VD):   | -0.269 |
| Fu: |
2.772% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.982 |
| OATP1B3 inhibitor:   | 0.996 | BCRP inhibitor:   | 0.001 |
| BSEP inhibitor:   | 0.425 |
| CYP1A2-inhibitor:   | 0.996 | CYP1A2-substrate:   | 1.0 |
| CYP2C19-inhibitor:   | 0.0 | CYP2C19-substrate:   | 0.729 |
| CYP2C9-inhibitor:   | 0.317 | CYP2C9-substrate:   | 0.977 |
| CYP2D6-inhibitor:   | 0.002 | CYP2D6-substrate:   | 0.383 |
| CYP3A4-inhibitor:   | 0.002 | CYP3A4-substrate:   | 0.985 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 0.994 |
| HLM stability:   |
0.458 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 5.946 | Half-life (T1/2):   | 1.042 |
| hERG Blockers:   | 0.048 | hERG Blockers (10um):   | 0.502 |
| Human Hepatotoxicity (H-HT):   | 0.678 | Drug-induced Liver Injury (DILI):   | 0.629 |
| AMES Toxicity:   | 0.793 | Rat Oral Acute Toxicity:   | 0.575 |
| Maximum Recommended Daily Dose:   | 0.615 | Skin Sensitization:   | 0.964 |
| Carcinogencity:   | 0.738 | Eye Corrosion:   | 0.798 |
| Eye Irritation:   | 0.998 | Respiratory Toxicity:   | 0.927 |
| Drug-induced Neurotoxicity:   | 0.429 | Ototoxicity:   | 0.185 |
| Hematotoxicity:   | 0.556 | Drug-induced Nephrotoxicity:   | 0.3 |
| Genotoxicity:   | 0.688 | RPMI-8226 Immunitoxicity:   | 0.108 |
| A549 Cytotoxicity:   | 0.242 | Hek293 Cytotoxicity:   | 0.452 |
| BCF:   |
2.223 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
4.92 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
5.527 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
5.141 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO64856 | Terminalia pallida + Cladosporium delicatulum symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 30294561] |
| NPO6969 | Triphyophyllum peltatum | Species | Dioncophyllaceae | Eukaryota | n.a. | root | n.a. | DOI[10.1007/s004360050318] |
| NPO6969 | Triphyophyllum peltatum | Species | Dioncophyllaceae | Eukaryota | n.a. | stem | n.a. | DOI[10.1007/s004360050318] |
| NPO16662 | Plumbago indica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1007/s10529-015-1969-z] |
| NPO16662 | Plumbago indica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/j.jbiosc.2011.02.003] |
| NPO30483 | Plumbago rosea | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/j.jbiosc.2011.02.003] |
| NPO30483 | Plumbago rosea | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/S0168-1656(02)00338-3] |
| NPO25454 | Plumbago europaea | Species | Plumbaginaceae | Eukaryota | n.a. | root | n.a. | DOI[10.2225/vol5-issue3-fulltext-4] |
| NPO30483 | Plumbago rosea | Species | Plumbaginaceae | Eukaryota | n.a. | root | n.a. | DOI[10.2225/vol5-issue3-fulltext-4] |
| NPO22192 | Cribraria cancellata | Species | Cribrariaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[14695806] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | root | n.a. |
PMID[14727919] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | leaf | n.a. |
PMID[14727919] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | n.a. | root | n.a. |
PMID[14727919] |
| NPO17858 | Juglans cinerea | Species | Juglandaceae | Eukaryota | n.a. | bark | n.a. |
PMID[14727919] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | xylem | n.a. |
PMID[14727919] |
| NPO17858 | Juglans cinerea | Species | Juglandaceae | Eukaryota | n.a. | leaf | n.a. |
PMID[14727919] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | n.a. | leaf | n.a. |
PMID[14727919] |
| NPO17858 | Juglans cinerea | Species | Juglandaceae | Eukaryota | n.a. | xylem | n.a. |
PMID[14727919] |
| NPO17858 | Juglans cinerea | Species | Juglandaceae | Eukaryota | n.a. | root | n.a. |
PMID[14727919] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | n.a. | bark | n.a. |
PMID[14727919] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | bark | n.a. |
PMID[14727919] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | n.a. | xylem | n.a. |
PMID[14727919] |
| NPO27122 | Plumbago scandens | Species | Plumbaginaceae | Eukaryota | n.a. | root | n.a. |
PMID[14762525] |
| NPO16657 | Diospyros maritima | Species | Ebenaceae | Eukaryota | bark | Indonesia | n.a. |
PMID[15270571] |
| NPO13608 | Plumbago zeylanica | Species | Plumbaginaceae | Eukaryota | n.a. | root | n.a. |
PMID[16078700] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | pericarp | n.a. |
PMID[18496782] |
| NPO29119 | Nepenthes thorelii | Species | Nepenthaceae | Eukaryota | roots | n.a. | n.a. |
PMID[19299148] |
| NPO20721 | Halichondria panicea | Species | Halichondriidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[20695474] |
| NPO6969 | Triphyophyllum peltatum | Species | Dioncophyllaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[22019229] |
| NPO33133 | barleria alluaudii | Species | Acanthaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[22313254] |
| NPO16657 | Diospyros maritima | Species | Ebenaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[22313254] |
| NPO13608 | Plumbago zeylanica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23848163] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25466114] |
| NPO22069 | Persea major | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[2614421] |
| NPO20721 | Halichondria panicea | Species | Halichondriidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27035556] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | Flowers | n.a. | n.a. |
PMID[28737396] |
| NPO40718 | Indian beech tree | Strain | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[30108931] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[36431782] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[37570937] |
| NPO25454 | Plumbago europaea | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[37800169] |
| NPO6969 | Triphyophyllum peltatum | Species | Dioncophyllaceae | Eukaryota | n.a. | stem | n.a. |
PMID[9371362] |
| NPO6969 | Triphyophyllum peltatum | Species | Dioncophyllaceae | Eukaryota | n.a. | root | n.a. |
PMID[9371362] |
| NPO29119 | Nepenthes thorelii | Species | Nepenthaceae | Eukaryota | n.a. | root | n.a. |
PMID[9581522] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | leaf | n.a. | Database[Article] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2551 | Plumbagella micrantha | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO14370 | Ceratostigma willmottianum | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6969 | Triphyophyllum peltatum | Species | Dioncophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO16657 | Diospyros maritima | Species | Ebenaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13608 | Plumbago zeylanica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO25454 | Plumbago europaea | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO26647 | Ammannia baccifera | Species | Lythraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40718 | Indian beech tree | Strain | n.a. | n.a. | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29119 | Nepenthes thorelii | Species | Nepenthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO17858 | Juglans cinerea | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO16662 | Plumbago indica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO3770 | Drosera rotundifolia | Species | Droseraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO17623 | Melampodium linearilobum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18595 | Ceratostigma plumbaginoides | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO21383 | Cnicothamnus lorentzii | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO30483 | Plumbago rosea | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO20721 | Halichondria panicea | Species | Halichondriidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18528 | Hyparrhenia hirta | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO22196 | Kickxia ramosissima | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18387 | Sedum formosanum | Species | Crassulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO21784 | Quillaja saponaria | Species | Quillajaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO23517 | Heterotropa aspera | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5057 | Ephestia kuehniella | Species | Pyralidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO22736.1 | Drosera peltata var. lunata | Varieties | Droseraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | Embryo | n.a. | n.a. | Database[FooDB] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | Essential Oil | n.a. | n.a. | Database[FooDB] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | Pericarp | n.a. | n.a. | Database[FooDB] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO17858 | Juglans cinerea | Species | Juglandaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | Shoot | n.a. | n.a. | Database[FooDB] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | Stem Bark | n.a. | n.a. | Database[FooDB] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | Testa | n.a. | n.a. | Database[FooDB] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO17858 | Juglans cinerea | Species | Juglandaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO17858 | Juglans cinerea | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO18595 | Ceratostigma plumbaginoides | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO22736.1 | Drosera peltata var. lunata | Varieties | Droseraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO13608 | Plumbago zeylanica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO16657 | Diospyros maritima | Species | Ebenaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO26780 | Dionaea muscipula | Species | Droseraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO18256 | Aconitum excelsum | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO25454 | Plumbago europaea | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO16662 | Plumbago indica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO3770 | Drosera rotundifolia | Species | Droseraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO14370 | Ceratostigma willmottianum | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO31126 | Diospyros sp | Species | Ebenaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO31128 | Sparaxis sp | Species | Iridaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO2551 | Plumbagella micrantha | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO1775 | Euphorbia pekinensis | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO23045 | Lotus helleri | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO1775 | Euphorbia pekinensis | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO13608 | Plumbago zeylanica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO18256 | Aconitum excelsum | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO22736.1 | Drosera peltata var. lunata | Varieties | Droseraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO26780 | Dionaea muscipula | Species | Droseraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO23045 | Lotus helleri | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO17858 | Juglans cinerea | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO3770 | Drosera rotundifolia | Species | Droseraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO16657 | Diospyros maritima | Species | Ebenaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO15529 | Diospyros sp. | Species | Ebenaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO14370 | Ceratostigma willmottianum | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO2551 | Plumbagella micrantha | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO18595 | Ceratostigma plumbaginoides | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO16662 | Plumbago indica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO25454 | Plumbago europaea | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO29133 | Sparaxis sp. | Species | Iridaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO6969 | Triphyophyllum peltatum | Species | Dioncophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO16657 | Diospyros maritima | Species | Ebenaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO1775 | Euphorbia pekinensis | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO1775 | Euphorbia pekinensis | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO2551 | Plumbagella micrantha | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO21383 | Cnicothamnus lorentzii | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29276 | Juglans nigra | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9038 | Aconitum burnatii | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO27122 | Plumbago scandens | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3770 | Drosera rotundifolia | Species | Droseraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13113 | Ardisia kivuensis | Species | Primulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO16662 | Plumbago indica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO25454 | Plumbago europaea | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18674 | Juglans regia | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13608 | Plumbago zeylanica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO27035 | Artemisia eriopoda | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO26780 | Dionaea muscipula | Species | Droseraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22999 | Cussonia spicata | Species | Araliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22069 | Persea major | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO27167 | Saguinus oedipus | Species | Cebidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18595 | Ceratostigma plumbaginoides | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO26614 | Planchonella duclitan | Species | Sapotaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29119 | Nepenthes thorelii | Species | Nepenthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO16657 | Diospyros maritima | Species | Ebenaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29101 | Tanacetum larvatum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO14370 | Ceratostigma willmottianum | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO23045 | Lotus helleri | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO19736 | Haplopappus glutinosus | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO23517 | Heterotropa aspera | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18256 | Aconitum excelsum | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17645.1 | Orobanche cernua var. cumana | Varieties | Orobanchaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18387 | Sedum formosanum | Species | Crassulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1775 | Euphorbia pekinensis | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22196 | Kickxia ramosissima | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO20721 | Halichondria panicea | Species | Halichondriidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17221 | Lagerstroemia parviflora | Species | Lythraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO26647 | Ammannia baccifera | Species | Lythraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22192 | Cribraria cancellata | Species | Cribrariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18921 | Athrixia phylicoides | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13717 | Aria elegans | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5057 | Ephestia kuehniella | Species | Pyralidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22831 | Isodon angustifolius | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO20094 | Loranthus micranthus | Species | Loranthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9170 | Pulsatilla pratensis | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6969 | Triphyophyllum peltatum | Species | Dioncophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO25804 | Vernonia zanzibarensis | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18528 | Hyparrhenia hirta | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO21784 | Quillaja saponaria | Species | Quillajaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO23432 | Viguiera oaxacana | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO24158 | Phyllanthus anisolobus | Species | Leiothrichidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6591 | Arthrospira maxima | Species | Microcoleaceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO23865 | Scorzonera veratrifolia | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17623 | Melampodium linearilobum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15106 | Agrostemma gracilis | Species | Caryophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15774 | Geranium pusillum | Species | Geraniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO19238 | Choristoneura occidentalis | Species | Tortricidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17858 | Juglans cinerea | Species | Juglandaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO25454 | Plumbago europaea | Oil | Flowers | 32.4 | n.a. | n.a. | % |
PMID[37800169] |
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | MIC | = | 50000.0 | nM | PMID[9873739] |
| NPT149 | Individual protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT149 | Individual protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT1226 | Individual protein | Caspase-7 | Homo sapiens | Potency | = | 19952.6 | nM | PubChem BioAssay data set |
| NPT1424 | Individual protein | Serine/threonine-protein kinase RAF | Homo sapiens | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Potency | = | 7079.5 | nM | PubChem BioAssay data set |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Potency | = | 19952.6 | nM | PubChem BioAssay data set |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Potency | = | 5623.4 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT277 | Individual protein | Caspase-1 | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT277 | Individual protein | Caspase-1 | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT198 | Individual protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 891.3 | nM | PubChem BioAssay data set |
| NPT198 | Individual protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 7943.3 | nM | PubChem BioAssay data set |
| NPT199 | Individual protein | DNA polymerase kappa | Homo sapiens | Potency | n.a. | 10000.0 | nM | PubChem BioAssay data set |
| NPT286 | Individual protein | Receptor protein-tyrosine kinase erbB-2 | Homo sapiens | IC50 | = | 30800.0 | nM | PMID[24355130] |
| NPT1079 | Individual protein | Histone acetyltransferase p300 | Homo sapiens | Kd | = | 2000.0 | nM | DOI[10.1039/C1MD00199J] |
| NPT1079 | Individual protein | Histone acetyltransferase p300 | Homo sapiens | IC50 | = | 2000.0 | nM | PMID[26701186] |
| NPT1079 | Individual protein | Histone acetyltransferase p300 | Homo sapiens | IC50 | = | 20000.0 | nM | PMID[26701186] |
| NPT1080 | Individual protein | Histone acetyltransferase PCAF | Homo sapiens | IC50 | = | 50000.0 | nM | PMID[26701186] |
| NPT1603 | Individual protein | Cytochrome P450 1A1 | Homo sapiens | Inhibition | = | 51.0 | % | PMID[30108931] |
| NPT1604 | Individual protein | Cytochrome P450 1B1 | Homo sapiens | Inhibition | = | 40.0 | % | PMID[30108931] |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | Inhibition | = | 55.0 | % | PMID[30108931] |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | Inhibition | = | 10.0 | % | PMID[30108931] |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Inhibition | = | 15.0 | % | PMID[30108931] |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | Inhibition | = | 11.0 | % | PMID[30108931] |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | Inhibition | = | 12.0 | % | PMID[30108931] |
| NPT1603 | Individual protein | Cytochrome P450 1A1 | Homo sapiens | Inhibition | = | 86.0 | % | PMID[30108931] |
| NPT1603 | Individual protein | Cytochrome P450 1A1 | Homo sapiens | IC50 | = | 2770.0 | nM | PMID[30108931] |
| NPT1603 | Individual protein | Cytochrome P450 1A1 | Homo sapiens | Ki | = | 2560.0 | nM | PMID[30108931] |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | IC50 | = | 2460.0 | nM | PMID[30108931] |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | Ki | = | 2360.0 | nM | PMID[30108931] |
| NPT1604 | Individual protein | Cytochrome P450 1B1 | Homo sapiens | IC50 | = | 6150.0 | nM | PMID[30108931] |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[30108931] |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[30108931] |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[30108931] |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[30108931] |
| NPT3441 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 7 | Homo sapiens | Kd | = | 14000.0 | nM | PMID[31563013] |
| NPT3060 | Individual protein | Dual specificity phosphatase Cdc25A | Homo sapiens | IC50 | = | 700.0 | nM | PMID[31563013] |
| NPT1080 | Individual protein | Histone acetyltransferase PCAF | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[26701186] |
| NPT346 | Individual protein | Transient receptor potential cation channel subfamily A member 1 | Homo sapiens | Activity | = | 93.5 | pA/pF | PMID[26905390] |
| NPT346 | Individual protein | Transient receptor potential cation channel subfamily A member 1 | Homo sapiens | Activity | = | 65.0 | pA/pF | PMID[26905390] |
| NPT346 | Individual protein | Transient receptor potential cation channel subfamily A member 1 | Homo sapiens | EC50 | = | 460.0 | nM | PMID[26905390] |
| NPT4147 | Individual protein | Mitogen-activated protein kinase kinase kinase 14 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[20580552] |
| NPT4147 | Individual protein | Mitogen-activated protein kinase kinase kinase 14 | Homo sapiens | Inhibition | = | 60.0 | % | PMID[20580552] |
| NPT50 | Individual protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 5623.4 | nM | PubChem BioAssay data set |
| NPT55 | Individual protein | Putative fructose-1,6-bisphosphate aldolase | Giardia intestinalis | Potency | = | 111.9 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 2511.9 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT58 | Individual protein | Bloom syndrome protein | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT21775 | Single protein | 60 kDa chaperonin | Escherichia coli (strain K12) | IC50 | > | 250000.0 | nM | PMID[30852084] |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 8912.5 | nM | PubChem BioAssay data set |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 6309.6 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT491 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 1 | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT444 | Individual protein | Ubiquitin carboxyl-terminal hydrolase 1 | Homo sapiens | Potency | n.a. | 17782.8 | nM | PubChem BioAssay data set |
| NPT444 | Individual protein | Ubiquitin carboxyl-terminal hydrolase 1 | Homo sapiens | Potency | n.a. | 50118.7 | nM | PubChem BioAssay data set |
| NPT888 | Individual protein | 78 kDa glucose-regulated protein | Homo sapiens | Potency | n.a. | 7943.3 | nM | PubChem BioAssay data set |
| NPT888 | Individual protein | 78 kDa glucose-regulated protein | Homo sapiens | Potency | n.a. | 2511.9 | nM | PubChem BioAssay data set |
| NPT67 | Individual protein | Cholinesterase | Equus caballus | Inhibition | = | 9.94 | % | PMID[23062825] |
| NPT911 | Individual protein | Dual specificity phosphatase Cdc25B | Homo sapiens | IC50 | = | 3100.0 | nM | PMID[31563013] |
| NPT29826 | Single protein | Cell division protein FtsZ | Bacillus subtilis | Kd | = | 15800.0 | nM | PMID[34700238] |
| NPT29826 | Single protein | Cell division protein FtsZ | Bacillus subtilis | Activity | n.a. | n.a. | n.a. | PMID[33908781] |
| NPT23850 | Single protein | Dihydrolipoamide dehydrogenase | Sus scrofa | Reduction | = | 15.4 | % | PMID[11170645] |
| NPT93 | Individual protein | Survival motor neuron protein | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 2238.7 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 891.3 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 562.3 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 2511.9 | nM | PubChem BioAssay data set |
| NPT583 | Individual protein | Inositol monophosphatase 1 | Rattus norvegicus | Potency | = | 1995.3 | nM | PubChem BioAssay data set |
| NPT583 | Individual protein | Inositol monophosphatase 1 | Rattus norvegicus | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT792 | Individual protein | Arachidonate 15-lipoxygenase | Homo sapiens | Potency | = | 3162.3 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 631.0 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 3162.3 | nM | PubChem BioAssay data set |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | 31.75 | % | PMID[23062825] |
| NPT21773 | Single protein | Thiosulfate sulfurtransferase | Homo sapiens | IC50 | = | 60.0 | nM | PMID[30852084] |
| NPT4115 | Individual protein | Exportin-1 | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[33890470] |
| NPT991 | Individual protein | Trypanothione reductase | Trypanosoma cruzi | IC50 | = | 28000.0 | nM | PMID[11170645] |
| NPT991 | Individual protein | Trypanothione reductase | Trypanosoma cruzi | x fold | = | 525.0 | uM | PMID[11170645] |
| NPT197 | Protein-protein interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT47 | Individual protein | ATP-dependent DNA helicase Q1 | Homo sapiens | Potency | = | 22387.2 | nM | PubChem BioAssay data set |
| NPT53 | Individual protein | 4'-phosphopantetheinyl transferase ffp | Bacillus subtilis | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT197 | Protein-protein interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT197 | Protein-protein interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT539 | Individual protein | Cellular tumor antigen p53 | Homo sapiens | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT539 | Individual protein | Cellular tumor antigen p53 | Homo sapiens | Potency | = | 3981.1 | nM | PubChem BioAssay data set |
| NPT539 | Individual protein | Cellular tumor antigen p53 | Homo sapiens | Potency | = | 6309.6 | nM | PubChem BioAssay data set |
| NPT539 | Individual protein | Cellular tumor antigen p53 | Homo sapiens | Potency | = | 794.3 | nM | PubChem BioAssay data set |
| NPT443 | Individual protein | Histone acetyltransferase GCN5 | Homo sapiens | Potency | n.a. | 39810.7 | nM | PubChem BioAssay data set |
| NPT38 | Individual protein | Signal transducer and activator of transcription 3 | Homo sapiens | Inhibition | = | 58.1 | % | PMID[23791367] |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 28183.8 | nM | PubChem BioAssay data set |
| NPT467 | Individual protein | Transient receptor potential cation channel subfamily A member 1 | Mus musculus | Activity | = | 50.0 | % | PMID[26905390] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 0.3 | ug ml-1 | PMID[15270571] |
| NPT1034 | Cell line | Lu1 | Homo sapiens | ED50 | = | 0.3 | ug ml-1 | PMID[15270571] |
| NPT858 | Cell line | LNCaP | Homo sapiens | ED50 | = | 0.4 | ug ml-1 | PMID[15270571] |
| NPT737 | Cell line | HUVEC | Homo sapiens | ED50 | = | 0.4 | ug ml-1 | PMID[15270571] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 800.0 | nM | PMID[22019229] |
| NPT367 | Cell line | MDA-N | Homo sapiens | GI50 | n.a. | 1721.87 | nM | PubChem BioAssay data set |
| NPT368 | Cell line | SN12C | Homo sapiens | GI50 | n.a. | 1940.89 | nM | PubChem BioAssay data set |
| NPT369 | Cell line | ACHN | Homo sapiens | GI50 | n.a. | 1595.88 | nM | PubChem BioAssay data set |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | GI50 | n.a. | 1811.34 | nM | PubChem BioAssay data set |
| NPT371 | Cell line | UO-31 | Homo sapiens | GI50 | n.a. | 1610.65 | nM | PubChem BioAssay data set |
| NPT116 | Cell line | HL-60 | Homo sapiens | GI50 | n.a. | 152.41 | nM | PubChem BioAssay data set |
| NPT372 | Cell line | HOP-92 | Homo sapiens | GI50 | n.a. | 464.52 | nM | PubChem BioAssay data set |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | n.a. | 1648.16 | nM | PubChem BioAssay data set |
| NPT374 | Cell line | SF-539 | Homo sapiens | GI50 | n.a. | 1914.26 | nM | PubChem BioAssay data set |
| NPT373 | Cell line | SK-MEL-5 | Homo sapiens | GI50 | n.a. | 1621.81 | nM | PubChem BioAssay data set |
| NPT375 | Cell line | Malme-3M | Homo sapiens | GI50 | n.a. | 966.05 | nM | PubChem BioAssay data set |
| NPT111 | Cell line | K562 | Homo sapiens | GI50 | n.a. | 390.84 | nM | PubChem BioAssay data set |
| NPT376 | Cell line | A498 | Homo sapiens | GI50 | n.a. | 5861.38 | nM | PubChem BioAssay data set |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | GI50 | n.a. | 235.5 | nM | PubChem BioAssay data set |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | GI50 | n.a. | 1030.39 | nM | PubChem BioAssay data set |
| NPT379 | Cell line | HOP-62 | Homo sapiens | GI50 | n.a. | 5520.77 | nM | PubChem BioAssay data set |
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | GI50 | n.a. | 1757.92 | nM | PubChem BioAssay data set |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | GI50 | n.a. | 1690.44 | nM | PubChem BioAssay data set |
| NPT380 | Cell line | U-251 | Homo sapiens | GI50 | n.a. | 6165.95 | nM | PubChem BioAssay data set |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | GI50 | n.a. | 1940.89 | nM | PubChem BioAssay data set |
| NPT383 | Cell line | SNB-19 | Homo sapiens | GI50 | n.a. | 12022.64 | nM | PubChem BioAssay data set |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | GI50 | n.a. | 1918.67 | nM | PubChem BioAssay data set |
| NPT385 | Cell line | SR | Homo sapiens | GI50 | n.a. | 1690.44 | nM | PubChem BioAssay data set |
| NPT384 | Cell line | TK-10 | Homo sapiens | GI50 | n.a. | 1710.02 | nM | PubChem BioAssay data set |
| NPT323 | Cell line | SW-620 | Homo sapiens | GI50 | n.a. | 1909.85 | nM | PubChem BioAssay data set |
| NPT455 | Cell line | NCI-H522 | Homo sapiens | GI50 | n.a. | 1566.75 | nM | PubChem BioAssay data set |
| NPT386 | Cell line | KM12 | Homo sapiens | GI50 | n.a. | 6165.95 | nM | PubChem BioAssay data set |
| NPT387 | Cell line | M14 | Homo sapiens | GI50 | n.a. | 1862.09 | nM | PubChem BioAssay data set |
| NPT388 | Cell line | NCI-H322M | Homo sapiens | GI50 | n.a. | 16292.96 | nM | PubChem BioAssay data set |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | GI50 | n.a. | 891.25 | nM | PubChem BioAssay data set |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | GI50 | n.a. | 1757.92 | nM | PubChem BioAssay data set |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | GI50 | n.a. | 1811.34 | nM | PubChem BioAssay data set |
| NPT457 | Cell line | BT-549 | Homo sapiens | GI50 | n.a. | 1702.16 | nM | PubChem BioAssay data set |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | GI50 | n.a. | 1853.53 | nM | PubChem BioAssay data set |
| NPT391 | Cell line | HCC 2998 | Homo sapiens | GI50 | n.a. | 2065.38 | nM | PubChem BioAssay data set |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | n.a. | 11481.54 | nM | PubChem BioAssay data set |
| NPT392 | Cell line | SNB-75 | Homo sapiens | GI50 | n.a. | 5508.08 | nM | PubChem BioAssay data set |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | n.a. | 1659.59 | nM | PubChem BioAssay data set |
| NPT148 | Cell line | HCT-15 | Homo sapiens | GI50 | n.a. | 1702.16 | nM | PubChem BioAssay data set |
| NPT394 | Cell line | EKVX | Homo sapiens | GI50 | n.a. | 1595.88 | nM | PubChem BioAssay data set |
| NPT395 | Cell line | SF-268 | Homo sapiens | GI50 | n.a. | 2167.7 | nM | PubChem BioAssay data set |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | n.a. | 2208.0 | nM | PubChem BioAssay data set |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | n.a. | 1790.61 | nM | PubChem BioAssay data set |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | GI50 | n.a. | 14092.89 | nM | PubChem BioAssay data set |
| NPT396 | Cell line | T47D | Homo sapiens | GI50 | n.a. | 433.51 | nM | PubChem BioAssay data set |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | GI50 | n.a. | 3639.15 | nM | PubChem BioAssay data set |
| NPT398 | Cell line | UACC-62 | Homo sapiens | GI50 | n.a. | 1936.42 | nM | PubChem BioAssay data set |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | GI50 | n.a. | 1832.31 | nM | PubChem BioAssay data set |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | GI50 | n.a. | 1733.8 | nM | PubChem BioAssay data set |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | GI50 | n.a. | 1782.38 | nM | PubChem BioAssay data set |
| NPT399 | Cell line | SF-295 | Homo sapiens | GI50 | n.a. | 11481.54 | nM | PubChem BioAssay data set |
| NPT401 | Cell line | 786-0 | Homo sapiens | GI50 | n.a. | 1648.16 | nM | PubChem BioAssay data set |
| NPT402 | Cell line | Hs-578T | Homo sapiens | GI50 | n.a. | 2910.72 | nM | PubChem BioAssay data set |
| NPT403 | Cell line | UACC-257 | Homo sapiens | GI50 | n.a. | 1811.34 | nM | PubChem BioAssay data set |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | n.a. | 208.45 | nM | PubChem BioAssay data set |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | n.a. | 1887.99 | nM | PubChem BioAssay data set |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | GI50 | n.a. | 6546.36 | nM | PubChem BioAssay data set |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | GI50 | n.a. | 1819.7 | nM | PubChem BioAssay data set |
| NPT407 | Cell line | COLO 205 | Homo sapiens | GI50 | n.a. | 1862.09 | nM | PubChem BioAssay data set |
| NPT406 | Cell line | RXF 393 | Homo sapiens | GI50 | n.a. | 1644.37 | nM | PubChem BioAssay data set |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 5500.0 | nM | PMID[22483392] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 3500.0 | nM | PMID[22483392] |
| NPT784 | Cell line | MDA-MB-468 | Homo sapiens | IC50 | = | 2500.0 | nM | PMID[22483392] |
| NPT369 | Cell line | ACHN | Homo sapiens | EC50 | = | 3700.0 | nM | PMID[22313254] |
| NPT369 | Cell line | ACHN | Homo sapiens | EC50 | = | 7300.0 | nM | PMID[22313254] |
| NPT369 | Cell line | ACHN | Homo sapiens | Ratio EC50 | = | 2.0 | n.a. | PMID[22313254] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | IC50 | = | 3200.0 | nM | PMID[22512718] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | IC50 | = | 1800.0 | nM | PMID[22512718] |
| NPT845 | Cell line | BT-474 | Homo sapiens | IC50 | = | 1800.0 | nM | PMID[22512718] |
| NPT845 | Cell line | BT-474 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[22512718] |
| NPT845 | Cell line | BT-474 | Homo sapiens | Inhibition | = | 40.0 | % | PMID[22512718] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | Inhibition | = | 50.0 | % | PMID[22512718] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | Activity | = | 20.0 | % | PMID[22512718] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | Activity | = | 43.0 | % | PMID[22512718] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | Activity | = | 73.0 | % | PMID[22512718] |
| NPT845 | Cell line | BT-474 | Homo sapiens | FC | = | 5.0 | n.a. | PMID[22512718] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | FC | = | 4.0 | n.a. | PMID[22512718] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 70.0 | % | PMID[22512718] |
| NPT845 | Cell line | BT-474 | Homo sapiens | Ratio IC50 | = | 2.0 | n.a. | PMID[22512718] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 4190.0 | nM | PMID[23791367] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 21240.0 | nM | PMID[23791367] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 5230.0 | nM | PMID[23791367] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 5100.0 | nM | PMID[24355130] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 2840.0 | nM | PMID[24355130] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 3350.0 | nM | PMID[24355130] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | > | 90.0 | % | PMID[24355130] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 12200.0 | nM | PMID[24953027] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 59000.0 | nM | PMID[24953027] |
| NPT2488 | Cell line | MDA-MB-453 | Homo sapiens | IC50 | = | 34560.0 | nM | PMID[24953027] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 51120.0 | nM | PMID[24953027] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 17190.0 | nM | PMID[24953027] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 26200.0 | nM | PMID[24953027] |
| NPT660 | Cell line | SW480 | Homo sapiens | IC50 | = | 12000.0 | nM | PMID[24828199] |
| NPT660 | Cell line | SW480 | Homo sapiens | IC50 | = | 7300.0 | nM | PMID[24828199] |
| NPT323 | Cell line | SW-620 | Homo sapiens | IC50 | = | 7700.0 | nM | PMID[24828199] |
| NPT323 | Cell line | SW-620 | Homo sapiens | IC50 | = | 7400.0 | nM | PMID[24828199] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 20000.0 | nM | PMID[24828199] |
| NPT323 | Cell line | SW-620 | Homo sapiens | FC | = | 1.68 | n.a. | PMID[24828199] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 25500.0 | nM | PMID[24913712] |
| NPT2393 | Cell line | SAS | Homo sapiens | IC50 | = | 3000.0 | nM | PMID[24913712] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 3000.0 | nM | PMID[26706169] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 3000.0 | nM | PMID[26706169] |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | IC50 | = | 5000.0 | nM | PMID[26706169] |
| NPT81 | Cell line | A549 | Homo sapiens | MNCC | <= | 2.0 | uM | PMID[28359791] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | GI | = | 32.8 | % | PMID[28558333] |
| NPT65 | Cell line | HepG2 | Homo sapiens | GI | = | 41.0 | % | PMID[28558333] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 14230.0 | nM | PMID[28558333] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 12400.0 | nM | PMID[28558333] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 10660.0 | nM | PMID[28558333] |
| NPT81 | Cell line | A549 | Homo sapiens | FC | = | 1.34 | n.a. | PMID[29772386] |
| NPT1527 | Cell line | WRL68 | Homo sapiens | IC50 | = | 15360.0 | nM | PMID[29772386] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 9800.0 | nM | PMID[29772386] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 8900.0 | nM | PMID[29772386] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 9170.0 | nM | PMID[29772386] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 6500.0 | nM | PMID[29772386] |
| NPT81 | Cell line | A549 | Homo sapiens | GI | = | 60.7 | % | PMID[29772386] |
| NPT65 | Cell line | HepG2 | Homo sapiens | GI | = | 58.9 | % | PMID[29772386] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | GI | = | 73.8 | % | PMID[29772386] |
| NPT1374 | Cell line | WI-38 | Homo sapiens | IC50 | = | 26710.0 | nM | PMID[30007564] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 3670.0 | nM | PMID[30007564] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 8250.0 | nM | PMID[30007564] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | = | 1100.0 | nM | PMID[31563013] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | IC50 | = | 2600.0 | nM | PMID[31563013] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 1100.0 | nM | PMID[31563013] |
| NPT2404 | Cell line | SW982 | Homo sapiens | IC50 | = | 3600.0 | nM | PMID[31563013] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 | = | 950.0 | nM | PMID[31563013] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | = | 2400.0 | nM | PMID[31563013] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 4100.0 | nM | PMID[31563013] |
| NPT4246 | Cell line | LS174T | Homo sapiens | IC50 | = | 9900.0 | nM | PMID[31563013] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 7200.0 | nM | PMID[31563013] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | = | 2700.0 | nM | PMID[31563013] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 3500.0 | nM | PMID[30810041] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 20.0 | % | PMID[30810041] |
| NPT784 | Cell line | MDA-MB-468 | Homo sapiens | Activity | = | 25.0 | % | PMID[30810041] |
| NPT784 | Cell line | MDA-MB-468 | Homo sapiens | Activity | = | 35.0 | % | PMID[30810041] |
| NPT784 | Cell line | MDA-MB-468 | Homo sapiens | Activity | = | 20.0 | % | PMID[30810041] |
| NPT845 | Cell line | BT-474 | Homo sapiens | Activity | = | 15.0 | % | PMID[30810041] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 10.0 | % | PMID[30810041] |
| NPT83 | Cell line | MCF7 | Homo sapiens | CI | = | 0.9 | n.a. | PMID[30810041] |
| NPT845 | Cell line | BT-474 | Homo sapiens | CI | = | 0.6 | n.a. | PMID[30810041] |
| NPT784 | Cell line | MDA-MB-468 | Homo sapiens | CI | = | 0.5 | n.a. | PMID[30810041] |
| NPT71 | Cell line | HEK293 | Homo sapiens | Activity | = | 92.0 | % | PMID[33631073] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 17200.0 | nM | PMID[36858050] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 3500.0 | nM | PMID[36846377] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 3500.0 | nM | PMID[33234343] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 59000.0 | nM | PMID[36858050] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 51100.0 | nM | PMID[36858050] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | PC50 | = | 1.54 | uM | PMID[37257133] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 2430.0 | nM | PMID[34669417] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 26200.0 | nM | PMID[36858050] |
| NPT2488 | Cell line | MDA-MB-453 | Homo sapiens | IC50 | = | 34500.0 | nM | PMID[36858050] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 5410.0 | nM | PMID[34669417] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 12200.0 | nM | PMID[36858050] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | IC50 | = | 23700.0 | nM | PMID[37257133] |
| NPT1773 | Cell line | ME-180 | Homo sapiens | IC50 | = | 43400.0 | nM | PMID[36858050] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 36050.0 | nM | PMID[34669417] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 4400.0 | nM | PMID[33234343] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 9830.0 | nM | PMID[33766765] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 10200.0 | nM | PMID[33766765] |
| NPT729 | Organism | Micrococcus luteus | Micrococcus luteus | IC50 | = | 80.0 | ug.mL-1 | PMID[15270571] |
| NPT729 | Organism | Micrococcus luteus | Micrococcus luteus | Activity | = | 600.0 | ug ml-1 | PMID[15270571] |
| NPT21 | Organism | Aspergillus niger | Aspergillus niger | IC50 | = | 20.0 | ug.mL-1 | PMID[15270571] |
| NPT21 | Organism | Aspergillus niger | Aspergillus niger | Activity | = | 400.0 | ug ml-1 | PMID[15270571] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 270.0 | nM | PMID[19299148] |
| NPT1499 | Organism | Erwinia amylovora | Erwinia amylovora | MIC | = | 100000.0 | nM | PMID[23163769] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 20000.0 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 19952.62 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 100.0 | % | PMID[33631073] |
| NPT28833 | No target | No relevant target | n.a. | Activity | = | -0.346 | mV | PMID[33766765] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 7500.0 | nM | PMID[34669417] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 9000.0 | nM | PMID[34669417] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | n.a. | n.a. | % | PMID[33890470] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio | = | 15.4 | n.a. | PMID[37257133] |
| NPT1381 | Organism | Aedes aegypti | Aedes aegypti | Activity | = | 3.0 | ug ml-1 | PMID[10757739] |
| NPT602 | Organism | Mycobacterium smegmatis | Mycobacterium smegmatis | IC50 | = | 300.0 | ug.mL-1 | PMID[15270571] |
| NPT602 | Organism | Mycobacterium smegmatis | Mycobacterium smegmatis | Activity | > | 1000.0 | ug ml-1 | PMID[15270571] |
| NPT1513 | Organism | Mycobacterium avium | Mycobacterium avium | IC50 | = | 600.0 | ug.mL-1 | PMID[15270571] |
| NPT1513 | Organism | Mycobacterium avium | Mycobacterium avium | Activity | > | 1000.0 | ug ml-1 | PMID[15270571] |
| NPT20 | Organism | Candida albicans | Candida albicans | IC50 | = | 9.0 | ug.mL-1 | PMID[15270571] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IC50 | = | 10.0 | ug.mL-1 | PMID[15270571] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Activity | = | 40.0 | ug ml-1 | PMID[15270571] |
| NPT20 | Organism | Candida albicans | Candida albicans | Activity | > | 1000.0 | ug ml-1 | PMID[15270571] |
| NPT1381 | Organism | Aedes aegypti | Aedes aegypti | Activity | = | 100.0 | % | PMID[20347303] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 800.0 | nM | PMID[22019229] |
| NPT2747 | Organism | Achaea janata | Achaea janata | ED50 | = | 23.97 | microg/cm2 | DOI[10.1007/s00044-011-9559-7] |
| NPT1175 | Organism | Spodoptera litura | Spodoptera litura | ED50 | = | 43.71 | microg/cm2 | DOI[10.1007/s00044-011-9559-7] |
| NPT2747 | Organism | Achaea janata | Achaea janata | Activity | = | 35.69 | % | PMID[19530696] |
| NPT1175 | Organism | Spodoptera litura | Spodoptera litura | Activity | = | 26.0 | % | PMID[19530696] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 43400.0 | nM | PMID[24953027] |
| NPT20 | Organism | Candida albicans | Candida albicans | IZ | = | 12.0 | mm | PMID[24913712] |
| NPT20 | Organism | Candida albicans | Candida albicans | MIC | = | 125.0 | ug.mL-1 | PMID[24913712] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 4.0 | ug.mL-1 | PMID[25264074] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 32.0 | ug.mL-1 | PMID[25264074] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 128.0 | ug.mL-1 | PMID[25264074] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 4000.0 | nM | PMID[26706169] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1000.0 | nM | PMID[26706169] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 5000.0 | nM | PMID[26706169] |
| NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | IC50 | = | 1380.0 | nM | PMID[28521262] |
| NPT23852 | Cell line | HK-2 | Homo sapiens | IC50 | = | 23580.0 | nM | PMID[29772386] |
| NPT1018 | Organism | Trypanosoma brucei | Trypanosoma brucei | ED50 | = | 1.5 | uM | PMID[11170645] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Ratio | >= | 4.0 | n.a. | PMID[12502328] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MBC | = | 50.0 | ug ml-1 | PMID[12502328] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC | = | 12.5 | ug.mL-1 | PMID[12502328] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MBC | = | 100.0 | ug ml-1 | PMID[12502328] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC | = | 25.0 | ug.mL-1 | PMID[12502328] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MBC | = | 25.0 | ug ml-1 | PMID[12502328] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 3.13 | ug.mL-1 | PMID[12502328] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | Ratio | >= | 4.0 | n.a. | PMID[12502328] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | IC50 | = | 100.0 | ug.mL-1 | PMID[15270571] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 600.0 | ug ml-1 | PMID[15270571] |
| NPT85 | Organism | Filobasidiella neoformans | Cryptococcus neoformans | IC50 | = | 20.0 | ug.mL-1 | PMID[15270571] |
| NPT85 | Organism | Filobasidiella neoformans | Cryptococcus neoformans | Activity | = | 40.0 | ug ml-1 | PMID[15270571] |
| NPT1365 | Organism | Trichoplusia ni | Trichoplusia ni | Activity | = | 12.7 | mg | DOI[10.1016/j.cropro.2011.09.009] |
| NPT1365 | Organism | Trichoplusia ni | Trichoplusia ni | Activity | = | 3.5 | cm2 | DOI[10.1016/j.cropro.2011.09.009] |
| NPT1365 | Organism | Trichoplusia ni | Trichoplusia ni | DC50 | = | 3.3 | microg/cm2 | DOI[10.1016/j.cropro.2011.09.009] |
| NPT1365 | Organism | Trichoplusia ni | Trichoplusia ni | FDI | = | 100.0 | % | DOI[10.1016/j.cropro.2011.09.009] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | IZ | = | 12.0 | mm | PMID[24913712] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 125.0 | ug.mL-1 | PMID[24913712] |
| NPT21774 | Protein complex | HSP60/HSP10 | Homo sapiens | IC50 | = | 6300.0 | nM | PMID[30852084] |
| NPT23853 | Cell line | MCF7/PTX | Homo sapiens | Activity | = | 20.0 | % | PMID[30810041] |
| NPT23853 | Cell line | MCF7/PTX | Homo sapiens | IC50 | = | 3500.0 | nM | PMID[30810041] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 96.0 | % | PMID[33631073] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[38283226] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 38000.0 | nM | PMID[10762041] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 2400.0 | nM | PMID[2033589] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MBC | = | 50.0 | ug ml-1 | PMID[12502328] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC | = | 12.5 | ug.mL-1 | PMID[12502328] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | Ratio | >= | 4.0 | n.a. | PMID[12502328] |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 2511.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 5011.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT790 | Organism | Mycobacterium tuberculosis H37Rv | Mycobacterium tuberculosis H37Rv | MIC | = | 42.3 | ug.mL-1 | DOI[10.1007/s00044-013-0485-8] |
| NPT790 | Organism | Mycobacterium tuberculosis H37Rv | Mycobacterium tuberculosis H37Rv | MIC | = | 40.3 | ug.mL-1 | DOI[10.1007/s00044-013-0485-8] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 3162.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 6309.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 3981.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 3548.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 50.0 | % | PMID[24828199] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 33.0 | % | PMID[24828199] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 20.0 | % | PMID[24828199] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 8912.5 | nM | PubChem BioAssay data set |
| NPT21772 | Protein complex | GroEL/GroES | Escherichia coli | IC50 | = | 290.0 | nM | PMID[30852084] |
| NPT21772 | Protein complex | GroEL/GroES | Escherichia coli | IC50 | = | 3800.0 | nM | PMID[30852084] |
| NPT21772 | Protein complex | GroEL/GroES | Escherichia coli | Inhibition | = | 87.0 | % | PMID[30852084] |
| NPT21772 | Protein complex | GroEL/GroES | Escherichia coli | Inhibition | = | 92.0 | % | PMID[30852084] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | FC | > | 3.0 | n.a. | PMID[23742275] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 77.0 | % | PMID[23742275] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.3 | % | PMID[23742275] |
| NPT2747 | Organism | Achaea janata | Achaea janata | mortality | < | 20.0 | % | PMID[19530696] |
| NPT1175 | Organism | Spodoptera litura | Spodoptera litura | mortality | < | 20.0 | % | PMID[19530696] |
| NPT1365 | Organism | Trichoplusia ni | Trichoplusia ni | mortality | = | 7.0 | % | DOI[10.1016/j.cropro.2011.09.009] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|---|---|---|---|---|---|
| - | Spodoptera litura | LC50 | = | 335.52 | microg/cm2 | PMID[19530696] |
| - | Aedes aegypti | LC50 | = | 5.43 | ug.mL-1 | PMID[20347303] |
| - | Aedes aegypti | LC90 | = | 6.56 | ug ml-1 | PMID[20347303] |
| - | Achaea janata | LC50 | = | 252.52 | microg/cm2 | PMID[19530696] |
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC285829 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.8056 | Intermediate Similarity | NPC206778 |
| 0.6667 | Remote Similarity | NPC609532 |
| 0.6458 | Remote Similarity | NPC34414 |
| 0.641 | Remote Similarity | NPC117609 |
| 0.6 | Remote Similarity | NPC55949 |
| 0.5946 | Remote Similarity | NPC108288 |
| 0.5854 | Remote Similarity | NPC310540 |
| 0.5854 | Remote Similarity | NPC244699 |
| 0.5854 | Remote Similarity | NPC58685 |
| 0.5556 | Remote Similarity | NPC43945 |
| 0.5476 | Remote Similarity | NPC600470 |
| 0.5455 | Remote Similarity | NPC481949 |
| 0.5455 | Remote Similarity | NPC237225 |
| 0.5455 | Remote Similarity | NPC238108 |
| 0.5366 | Remote Similarity | NPC486398 |
| 0.5227 | Remote Similarity | NPC165257 |
| 0.5116 | Remote Similarity | NPC602595 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC285829 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
