NPASS drugs

Drug Information

Drug ID:	NPD4059
Drug Name:	Ethinyl Estradiol; Ethinylestradiol
Molecular Formula:	C20H24O2
Canonical SMILES:	C#C[C@]1(O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)O
Standard InCHI:	"InChI=1S/C20H24O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,5,7,12,16-18,21-22H,4,6,8-11H2,2H3/t16-,17-,18+,19+,20+/m1/s1"
Standard InCHIKey:	BFPYWIDHMRZLRN-SLHNCBLASA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD4059

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	100640
0.1-0.2	108362
0.2-0.3	2595
0.3-0.4	89
0.4-0.5	14
0.5-0.6	27
0.6-0.7	11
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC99734
High Similarity	1.0	NPC611911
Remote Similarity	0.6271	NPC322753
Remote Similarity	0.623	NPC48342
Remote Similarity	0.623	NPC294638
Remote Similarity	0.623	NPC328831
Remote Similarity	0.623	NPC164649
Remote Similarity	0.623	NPC290287
Remote Similarity	0.623	NPC601860
Remote Similarity	0.623	NPC609599
Remote Similarity	0.6129	NPC271867
Remote Similarity	0.6129	NPC137249
Remote Similarity	0.6129	NPC129330
Remote Similarity	0.5968	NPC190501
Remote Similarity	0.5968	NPC77569
Remote Similarity	0.5968	NPC318552
Remote Similarity	0.5968	NPC144109
Remote Similarity	0.5968	NPC214224
Remote Similarity	0.5968	NPC142198
Remote Similarity	0.5968	NPC324264
Remote Similarity	0.5968	NPC114161
Remote Similarity	0.5968	NPC542506
Remote Similarity	0.5968	NPC603451
Remote Similarity	0.5968	NPC609551
Remote Similarity	0.5968	NPC611728
Remote Similarity	0.5938	NPC319149
Remote Similarity	0.5846	NPC265677
Remote Similarity	0.5781	NPC72232
Remote Similarity	0.5692	NPC30491
Remote Similarity	0.5692	NPC262936
Remote Similarity	0.5692	NPC529167
Remote Similarity	0.5606	NPC68723
Remote Similarity	0.5604	NPC18781
Remote Similarity	0.5571	NPC592590
Remote Similarity	0.5556	NPC319905
Remote Similarity	0.5493	NPC122548
Remote Similarity	0.5429	NPC493312
Remote Similarity	0.5312	NPC475166
Remote Similarity	0.5312	NPC566485
Remote Similarity	0.5303	NPC325928

Drug Structure

NPD4059 OpenBabel08211704332D 24 27 0 0 1 0 0 0 0 0999 V2000 -0.7226 1.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8423 0.5219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 0.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5282 -3.4032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0539 -1.9434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6857 -2.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2119 -1.4573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5274 -0.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8408 -1.4587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6848 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8411 -0.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2125 -3.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3705 -2.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0542 -2.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3702 -1.9439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5277 -1.4577 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6854 -1.9443 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8428 -1.4582 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8426 -0.4861 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.8963 -3.4020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8417 0.4856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3822 -2.5598 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7657 0.1850 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 3 0 0 0 0 2 19 1 0 0 0 0 4 6 1 0 0 0 0 4 13 1 0 0 0 0 5 7 1 0 0 0 0 5 14 2 0 0 0 0 7 15 2 0 0 0 0 8 10 1 0 0 0 0 9 11 1 0 0 0 0 9 18 1 0 0 0 0 10 19 1 0 0 0 0 11 20 1 0 0 0 0 12 13 2 0 0 0 0 12 14 1 0 0 0 0 13 15 1 0 0 0 0 14 21 1 0 0 0 0 15 16 1 0 0 0 0 16 8 1 6 0 0 0 16 17 1 0 0 0 0 17 6 1 1 0 0 0 17 18 1 0 0 0 0 18 19 1 6 0 0 0 19 20 1 1 0 0 0 20 3 1 1 0 0 0 20 22 1 0 0 0 0 21 23 1 0 0 0 0 22 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001018
DrugBank	DB00977
ChEMBL	CHEMBL691
IUPHAR/BPS	7071
PharmaGKB	PA449527
KEGG Drug	D00554
PubChem CID	5991
ChEBI	4903
CAS Number	57-63-6

Drug Properties

Molecular Weight	296.18
ALogP	0.6041
MLogP	3.44
XLogP	4.667
HDA	1
HBD	2
Rotatable Bonds	3
TPSA	40.46
RO5 Violation	0