NPASS drugs

Drug Information

Drug ID:	NPD3026
Drug Name:	Estrone Sulfuric Acid; Estrone-3-sulphate
Molecular Formula:	C18H22O5S
Canonical SMILES:	O=C1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)OS(=O)(=O)O
Standard InCHI:	"InChI=1S/C18H22O5S/c1-18-9-8-14-13-5-3-12(23-24(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)19/h3,5,10,14-16H,2,4,6-9H2,1H3,(H,20,21,22)/t14-,15-,16+,18+/m1/s1"
Standard InCHIKey:	JKKFKPJIXZFSSB-CBZIJGRNSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD3026

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	92705
0.1-0.2	117621
0.2-0.3	1322
0.3-0.4	59
0.4-0.5	15
0.5-0.6	12
0.6-0.7	3
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC21216
High Similarity	1.0	NPC611951
Intermediate Similarity	0.7869	NPC320074
Remote Similarity	0.6866	NPC89650
Remote Similarity	0.6774	NPC498325
Remote Similarity	0.6562	NPC220771
Remote Similarity	0.5846	NPC190501
Remote Similarity	0.5846	NPC318552
Remote Similarity	0.5846	NPC144109
Remote Similarity	0.5846	NPC114161
Remote Similarity	0.5846	NPC611728
Remote Similarity	0.5823	NPC326278
Remote Similarity	0.5672	NPC252343
Remote Similarity	0.5672	NPC602434
Remote Similarity	0.5625	NPC15127
Remote Similarity	0.5385	NPC493067
Remote Similarity	0.5172	NPC326305
Remote Similarity	0.5119	NPC323857

Drug Structure

NPD3026 OpenBabel08211702562D 25 28 0 0 1 0 0 0 0 0999 V2000 -6.3380 -0.0985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9167 -2.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4583 -0.1298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8894 -2.6559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4305 -0.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8064 -2.6549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2923 -1.8130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3750 -0.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3477 -0.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4581 -1.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4303 -1.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9722 -0.9722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9165 -0.9713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8891 -0.9712 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3756 -1.8135 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3483 -1.8133 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8068 -0.9713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8342 -0.9715 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3070 -0.1054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9722 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.9722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9722 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.9722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1.4582 0.8419 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 4 1 0 0 0 0 2 11 1 0 0 0 0 3 5 1 0 0 0 0 3 12 2 0 0 0 0 5 13 2 0 0 0 0 6 7 1 0 0 0 0 6 16 1 0 0 0 0 7 17 1 0 0 0 0 8 9 1 0 0 0 0 9 18 1 0 0 0 0 10 11 2 0 0 0 0 10 12 1 0 0 0 0 11 13 1 0 0 0 0 12 23 1 0 0 0 0 13 14 1 0 0 0 0 14 8 1 6 0 0 0 14 15 1 0 0 0 0 15 4 1 1 0 0 0 15 16 1 0 0 0 0 16 18 1 6 0 0 0 17 18 1 0 0 0 0 17 19 2 0 0 0 0 18 1 1 6 0 0 0 20 24 1 0 0 0 0 20 25 1 0 0 0 0 21 24 2 0 0 0 0 22 24 2 0 0 0 0 23 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB007359; DAP000818; DNC001150
DrugBank	DB04574
ChEMBL	CHEMBL494753
IUPHAR/BPS	4749
PharmaGKB	PA165958342
KEGG Drug
PubChem CID	5351489
ChEBI	17474
CAS Number	481-97-0

Drug Properties

Molecular Weight	350.12
ALogP	0.051
MLogP	2.78
XLogP	2.742
HDA	4
HBD	1
Rotatable Bonds	4
TPSA	89.05
RO5 Violation	0