NPASS drugs

Drug Information

Drug ID:	NPD2344
Drug Name:	Benzarone
Molecular Formula:	C17H14O3
Canonical SMILES:	CCc1oc2c(c1C(=O)c1ccc(cc1)O)cccc2
Standard InCHI:	InChI=1S/C17H14O3/c1-2-14-16(13-5-3-4-6-15(13)20-14)17(19)11-7-9-12(18)10-8-11/h3-10,18H,2H2,1H3
Standard InCHIKey:	RFRXIWQYSOIBDI-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2344

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	238
0.1-0.2	1368
0.2-0.3	2455
0.3-0.4	7006
0.4-0.5	6112
0.5-0.6	3179
0.6-0.7	5557
0.7-0.8	4301
0.8-0.85	602
0.85-0.9	65
0.9-0.95	7
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9124	NPC62735
High Similarity	0.9118	NPC163029
High Similarity	0.9097	NPC156244
High Similarity	0.9078	NPC230943
High Similarity	0.9034	NPC67654
High Similarity	0.9007	NPC302181
High Similarity	0.9007	NPC225884
High Similarity	0.8936	NPC53192
High Similarity	0.8889	NPC135325
High Similarity	0.8881	NPC51641

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD2344 OpenBabel08211702172D 21 23 0 0 0 0 0 0 0 0999 V2000 2.4945 0.9706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4945 0.9706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2079 -2.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0739 -2.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6581 -2.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0739 -1.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6666 -2.1759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0193 -2.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9756 -3.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3283 -3.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6884 -1.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3065 -3.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6581 -1.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9945 0.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2079 -0.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4013 -0.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3794 -1.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6155 -4.8212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0485 -0.2738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5936 -5.0291 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 14 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 13 2 0 0 0 0 6 15 2 0 0 0 0 7 9 1 0 0 0 0 7 11 2 0 0 0 0 8 10 2 0 0 0 0 8 11 1 0 0 0 0 9 12 2 0 0 0 0 10 12 1 0 0 0 0 11 17 1 0 0 0 0 12 18 1 0 0 0 0 13 15 1 0 0 0 0 13 16 1 0 0 0 0 14 16 2 0 0 0 0 14 20 1 0 0 0 0 15 20 1 0 0 0 0 16 17 1 0 0 0 0 17 19 2 0 0 0 0 18 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	266.09
ALogP	-1.1149
MLogP	3
XLogP	4.153
HDA	1
HBD	1
Rotatable Bonds	5
TPSA	50.44
RO5 Violation	0