NPASS drugs

Drug Information

Drug ID:	NPD3024
Drug Name:	Conjugated Equine Estrogens
Molecular Formula:	C18H22O5S.Na
Canonical SMILES:	O=C1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)OS(=O)(=O)[O-].[Na+]
Standard InCHI:	"InChI=1S/C18H22O5S.Na/c1-18-9-8-14-13-5-3-12(23-24(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)19;/h3,5,10,14-16H,2,4,6-9H2,1H3,(H,20,21,22);/q;+1/p-1/t14-,15-,16+,18+;/m1./s1"
Standard InCHIKey:	VUCAHVBMSFIGAI-ZFINNJDLSA-M
Max Developmental Stage:	Approved
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD3024

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	98502
0.1-0.2	112104
0.2-0.3	1057
0.3-0.4	47
0.4-0.5	12
0.5-0.6	13
0.6-0.7	2
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC320074
Intermediate Similarity	0.7869	NPC21216
Intermediate Similarity	0.7869	NPC611951
Remote Similarity	0.6885	NPC498325
Remote Similarity	0.6667	NPC220771
Remote Similarity	0.5938	NPC190501
Remote Similarity	0.5938	NPC318552
Remote Similarity	0.5938	NPC144109
Remote Similarity	0.5938	NPC114161
Remote Similarity	0.5938	NPC611728
Remote Similarity	0.5758	NPC252343
Remote Similarity	0.5758	NPC602434
Remote Similarity	0.5714	NPC469465
Remote Similarity	0.5714	NPC15127
Remote Similarity	0.5641	NPC469482
Remote Similarity	0.55	NPC326278
Remote Similarity	0.5455	NPC493067
Remote Similarity	0.5342	NPC89650

Drug Structure

NPD3024 OpenBabel08211702562D 25 27 0 0 1 0 0 0 0 0999 V2000 1.4684 -1.5695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8861 -4.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3429 -1.6007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9144 -4.1241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3718 -1.6003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0006 -4.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5152 -3.2822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4293 -1.6003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4577 -1.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3431 -3.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3720 -3.2829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8286 -2.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8863 -2.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9147 -2.4413 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4288 -3.2826 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4571 -3.2825 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0001 -2.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9718 -2.4415 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5000 -1.5755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7708 -1.4711 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 7.7997 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8286 -1.4711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7997 -2.4422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7997 -1.4711 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -2.5523 -2.4007 0.0000 Na 0 3 0 0 0 15 0 0 0 0 0 0 2 4 1 0 0 0 0 2 11 1 0 0 0 0 3 5 1 0 0 0 0 3 12 2 0 0 0 0 5 13 2 0 0 0 0 6 7 1 0 0 0 0 6 16 1 0 0 0 0 7 17 1 0 0 0 0 8 9 1 0 0 0 0 9 18 1 0 0 0 0 10 11 2 0 0 0 0 10 12 1 0 0 0 0 11 13 1 0 0 0 0 12 23 1 0 0 0 0 13 14 1 0 0 0 0 14 8 1 6 0 0 0 14 15 1 0 0 0 0 15 4 1 1 0 0 0 15 16 1 0 0 0 0 16 18 1 6 0 0 0 17 18 1 0 0 0 0 17 19 2 0 0 0 0 18 1 1 6 0 0 0 20 24 1 0 0 0 0 21 24 2 0 0 0 0 22 24 2 0 0 0 0 23 24 1 0 0 0 0 M CHG 2 20 -1 25 1 M END $$$$

External Identifiers

TTD	DNC001150
DrugBank	DB00286
ChEMBL	CHEMBL2106240
IUPHAR/BPS
PharmaGKB	PA164754789
KEGG Drug	D04070
PubChem CID	0
ChEBI	8389
CAS Number	12126-59-9

Drug Properties

Molecular Weight	349.11
ALogP	-0.6268
MLogP	2.78
XLogP	2.742
HDA	4
HBD	0
Rotatable Bonds	4
TPSA	91.88
RO5 Violation	0