Drug Information| Drug ID:   | NPD1240 |
| Drug Name:   | Oxybenzone |
| Molecular Formula:   | C14H12O3 |
| Canonical SMILES:   | COc1ccc(c(c1)O)C(=O)c1ccccc1 |
| Standard InCHI:   | "InChI=1S/C14H12O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-9,15H,1H3" |
| Standard InCHIKey:   | DXGLGDHPHMLXJC-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD1240Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC551469 |
| High Similarity | 1.0 | NPC599885 |
| Intermediate Similarity | 0.7027 | NPC138050 |
| Remote Similarity | 0.675 | NPC183655 |
| Remote Similarity | 0.5952 | NPC12090 |
| Remote Similarity | 0.5714 | NPC165522 |
| Remote Similarity | 0.5455 | NPC540399 |
| Remote Similarity | 0.5405 | NPC78662 |
| Remote Similarity | 0.5333 | NPC152674 |
| Remote Similarity | 0.5263 | NPC186098 |
| Remote Similarity | 0.5263 | NPC534325 |
| Remote Similarity | 0.5263 | NPC607977 |
| Remote Similarity | 0.5238 | NPC131937 |
| Remote Similarity | 0.5238 | NPC547513 |
| Remote Similarity | 0.5116 | NPC492495 |
| Remote Similarity | 0.5111 | NPC33284 |
| TTD   | |
| DrugBank   | DB01428 |
| ChEMBL   | CHEMBL1625 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164742933 |
| KEGG Drug   | D05309 |
| PubChem CID   | 0 |
| ChEBI   | 34283 |
| CAS Number   | 131-57-7 |
| Molecular Weight   | 228.08 |
| ALogP   | -0.7759 |
| MLogP   | 2.67 |
| XLogP   | 4.066 |
| HDA   | 1 |
| HBD   | 1 |
| Rotatable Bonds   | 5 |
| TPSA   | 46.53 |
| RO5 Violation   | 0 |