NPASS Compound

Natural Product: NPC73170

Natural Product ID	NPC73170
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	QRLWKKCBBDAJID-WUTVBGSCSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	90146126
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135143 0 0 0 0 0 0 0 0999 V2000 8.7684 1.1770 1.7107 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3056 -0.0668 0.9989 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0945 0.2948 0.1711 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3919 -0.4135 -1.1529 C 0 0 2 0 0 0 0 0 0 0 0 0 6.1182 -1.1477 -1.5424 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0958 -0.4386 -0.7201 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7696 -1.1095 -0.6025 C 0 0 2 0 0 0 0 0 0 0 0 0 3.0354 -0.9574 -1.9016 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5601 -1.0329 -1.7798 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8668 -0.9401 -0.6776 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6181 -1.0210 -0.5959 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1241 0.3451 -0.2188 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0351 1.1868 0.2545 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8798 0.4284 1.2834 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5869 -0.7421 0.5957 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4689 -1.9674 1.4333 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0061 -0.3139 0.4323 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7127 -0.3621 1.7679 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0182 0.4298 1.5851 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8394 -0.3756 0.6240 C 0 0 2 0 0 0 0 0 0 0 0 0 6.1154 -1.7479 1.1668 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1993 0.3464 0.6115 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3885 0.8591 0.2185 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5480 -0.1069 0.2333 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6707 0.5038 -0.5754 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9420 1.9410 -0.1447 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6825 2.6900 0.0940 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9583 4.0016 0.7849 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7598 4.7189 0.9908 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8039 1.9829 0.9218 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6674 2.5514 -1.1535 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9643 2.8783 -0.7400 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2197 4.3143 -0.9649 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.5127 4.5223 -1.7217 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.6129 3.6185 -1.1962 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0872 2.2046 -1.0394 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.9455 1.1730 -1.6885 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.2583 1.2328 -1.1690 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7981 2.1165 -1.5735 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1431 4.1306 -0.0239 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3269 4.3935 -3.0957 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2253 5.0634 0.2238 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8737 -0.1844 -0.4500 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2455 -1.3446 -0.3133 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4829 -2.4021 0.5881 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5675 -3.2498 0.0031 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1243 -4.6239 -0.3982 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2052 -5.2805 0.5778 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3862 -4.2926 1.3718 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8116 -4.2737 2.8211 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2928 -3.0482 0.8003 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3948 -6.1771 -0.1456 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2884 -5.4155 -0.4708 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6627 -3.4014 0.8843 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4467 -1.2783 -0.8948 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2795 -0.4648 -0.1157 C 0 0 2 0 0 0 0 0 0 0 0 0 10.4960 -1.1381 0.3804 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6850 -0.2531 0.5849 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7811 0.8909 -0.3633 C 0 0 1 0 0 0 0 0 0 0 0 0 13.1486 1.0117 -1.0034 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1690 2.1038 -1.8814 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7593 0.6914 -1.4635 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5085 0.6897 -0.8514 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6604 1.0391 2.3300 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9428 1.5140 2.3591 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9689 1.9903 0.9842 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1245 -0.8758 1.7047 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9678 1.3774 0.0313 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6235 0.3386 -1.9226 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9609 -1.0372 -2.6232 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1620 -2.2194 -1.2600 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9450 0.5963 -1.0354 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8218 -2.1834 -0.3463 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3517 -1.7908 -2.5736 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3703 -0.0166 -2.4157 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0085 -1.1830 -2.7161 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9853 -1.2738 -1.6279 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9334 -1.8006 0.1333 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4627 0.8145 -1.1673 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7396 1.4172 -0.5712 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2552 2.1465 0.6849 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5737 1.1644 1.6978 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2908 0.0093 2.0873 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7121 -2.6427 0.9870 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0978 -1.7589 2.4677 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4101 -2.5692 1.4572 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0824 0.7608 0.0989 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1298 0.1537 2.5372 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9183 -1.3793 2.1244 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7291 1.4027 1.1893 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5090 0.4540 2.5711 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2857 -1.6388 2.2676 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9990 -2.2304 0.6816 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2829 -2.4597 1.0481 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2845 1.2111 -0.8303 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9050 -0.3006 1.2845 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3830 0.5023 -1.6314 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5669 1.9133 0.7618 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1446 2.9223 -0.8483 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4329 3.8918 1.7723 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5629 4.6857 0.1387 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9822 4.0896 1.0057 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0977 2.5793 0.3252 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4112 4.7384 -1.6058 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8378 5.5652 -1.5317 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4101 3.5933 -1.9567 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0099 1.9973 0.0405 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9494 1.3045 -2.7838 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5876 0.1491 -1.4641 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1999 0.8098 -0.2623 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4655 4.3808 0.6419 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0561 4.8568 -3.5992 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8646 4.5649 0.9838 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9102 -0.4952 0.5106 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8732 -1.9751 1.5522 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0232 -2.7773 -0.9154 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7083 -4.5844 -1.4256 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7764 -5.9281 1.2995 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3353 -4.7093 1.3787 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4561 -5.1767 3.3681 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9374 -4.3428 2.8381 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4462 -3.4058 3.3678 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4220 -5.9504 -0.0004 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5628 -5.5695 -1.4190 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9720 -4.3188 0.9533 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2680 -1.6118 1.3775 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7366 -2.0072 -0.2952 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7717 0.1257 1.6455 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6018 -0.8892 0.4507 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5634 1.8406 0.1595 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9053 1.0914 -0.2119 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3533 0.1081 -1.6303 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4770 2.7674 -1.6731 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7964 1.5765 -2.1315 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9197 -0.2629 -1.9909 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 12 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 27 30 1 0 26 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 36 39 1 0 35 40 1 0 34 41 1 0 33 42 1 0 25 43 1 0 24 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 48 52 1 0 47 53 1 0 46 54 1 0 4 55 1 0 56 55 1 6 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 59 62 1 0 62 63 1 0 56 2 1 0 20 3 1 0 30 23 1 0 39 32 1 0 51 45 1 0 63 56 1 0 20 6 1 0 17 7 1 0 15 10 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 1 3 68 1 6 4 69 1 6 5 70 1 0 5 71 1 0 6 72 1 6 7 73 1 1 8 74 1 0 8 75 1 0 9 76 1 0 11 77 1 0 11 78 1 0 12 79 1 6 13 80 1 0 13 81 1 0 14 82 1 0 14 83 1 0 16 84 1 0 16 85 1 0 16 86 1 0 17 87 1 6 18 88 1 0 18 89 1 0 19 90 1 0 19 91 1 0 21 92 1 0 21 93 1 0 21 94 1 0 23 95 1 6 24 96 1 1 25 97 1 6 26 98 1 1 27 99 1 6 28100 1 0 28101 1 0 29102 1 0 32103 1 1 33104 1 6 34105 1 6 35106 1 6 36107 1 1 37108 1 0 37109 1 0 38110 1 0 40111 1 0 41112 1 0 42113 1 0 43114 1 0 45115 1 1 46116 1 6 47117 1 6 48118 1 1 49119 1 1 50120 1 0 50121 1 0 50122 1 0 52123 1 0 53124 1 0 54125 1 0 57126 1 0 57127 1 0 58128 1 0 58129 1 0 59130 1 1 60131 1 0 60132 1 0 61133 1 0 62134 1 0 62135 1 0 M END

Standard InCHIKey	QRLWKKCBBDAJID-WUTVBGSCSA-N
Standard InCHI	InChI=1S/C45H72O18/c1-19-30-27(63-45(19)12-7-21(15-46)18-56-45)14-26-24-6-5-22-13-23(8-10-43(22,3)25(24)9-11-44(26,30)4)58-42-39(62-40-35(53)33(51)31(49)20(2)57-40)37(55)38(29(17-48)60-42)61-41-36(54)34(52)32(50)28(16-47)59-41/h5,19-21,23-42,46-55H,6-18H2,1-4H3/t19-,20-,21-,23-,24+,25-,26-,27-,28+,29+,30-,31-,32+,33+,34-,35+,36+,37-,38+,39+,40-,41-,42+,43-,44-,45+/m0/s1
SMILES	C[C@H]1[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@H](CC[C@]5(C)[C@H]4CC[C@]23C)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O)O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O[C@@]21CC[C@@H](CO)CO2

Calculated Properties

Physi-Chem Properties

Molecular Weight:	900.47	Volume:	865.455 ? Van der Waals volume.
Dense:	1.04	LogP:	0.959 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.808 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.408 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	48.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.127	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.752	Fsp³:	0.956
MCE-18:	229.091 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.678	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.241	Promiscuous compounds:	0.008

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.85	MDCK Permeability:	-4.811
Pgp-inhibitor:	0.0	Pgp-substrate:	0.915
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.024
20% Bioavailability (F20%):	0.123	30% Bioavailability (F30%):	0.977
50% Bioavailability (F50%):	0.976

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.004	MRP1:	0.011
Plasma Protein Binding (PPB):	62.607%	Volume Distribution (VD):	-0.398
Fu:	29.963% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.087
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.001	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.204	CYP3A4-substrate:	0.002
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.006 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.314

Half-life (T1/2):

3.276

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.006
Human Hepatotoxicity (H-HT):	0.713	Drug-induced Liver Injury (DILI):	0.987
AMES Toxicity:	0.988	Rat Oral Acute Toxicity:	0.005
Maximum Recommended Daily Dose:	0.003	Skin Sensitization:	1.0
Carcinogencity:	0.483	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.491	Drug-induced Nephrotoxicity:	0.997
Genotoxicity:	0.102	RPMI-8226 Immunitoxicity:	0.388
A549 Cytotoxicity:	0.978	Hek293 Cytotoxicity:	0.836
BCF:	1.285 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.341 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.474 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.754 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21524113]
NPO7703	Xanthorrhoea preissii	Species	Asphodelaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8173	Lupinus multiflorus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6023	Neurolaena venturana	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO6023	Neurolaena venturana	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7703	Xanthorrhoea preissii	Species	Asphodelaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO2383	Mimosa acacioides	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO5425	Polygala nyikensis	Species	Polygalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10340	Crepis rubra	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO8173	Lupinus multiflorus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC73170 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24423
0.1-0.2	21886
0.2-0.3	2641
0.3-0.4	683
0.4-0.5	90
0.5-0.6	67
0.6-0.7	20
0.7-0.8	0
0.8-0.85	9
0.85-0.9	4
0.9-0.95	2
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.967	High Similarity	NPC248746
0.9255	High Similarity	NPC480555
0.9255	High Similarity	NPC150372
0.8936	High Similarity	NPC470433
0.8936	High Similarity	NPC46190
0.8936	High Similarity	NPC171073
0.8529	High Similarity	NPC480553
0.84	Intermediate Similarity	NPC269297
0.84	Intermediate Similarity	NPC222202
0.8367	Intermediate Similarity	NPC42171
0.8333	Intermediate Similarity	NPC480554
0.8317	Intermediate Similarity	NPC475333
0.8317	Intermediate Similarity	NPC224098
0.8317	Intermediate Similarity	NPC208383
0.8235	Intermediate Similarity	NPC194207
0.8235	Intermediate Similarity	NPC22779
0.7857	Intermediate Similarity	NPC113044
0.7857	Intermediate Similarity	NPC283829
0.7857	Intermediate Similarity	NPC161676
0.785	Intermediate Similarity	NPC232054
0.7798	Intermediate Similarity	NPC480556
0.7692	Intermediate Similarity	NPC475550
0.7647	Intermediate Similarity	NPC300557
0.7568	Intermediate Similarity	NPC224314
0.7476	Intermediate Similarity	NPC6806
0.7475	Intermediate Similarity	NPC470432
0.7475	Intermediate Similarity	NPC230507
0.7451	Intermediate Similarity	NPC602423
0.7379	Intermediate Similarity	NPC477809
0.73	Intermediate Similarity	NPC94272
0.73	Intermediate Similarity	NPC6295
0.729	Intermediate Similarity	NPC32361
0.729	Intermediate Similarity	NPC13193
0.7263	Intermediate Similarity	NPC181845
0.7043	Intermediate Similarity	NPC477808
0.7009	Intermediate Similarity	NPC73243
0.7009	Intermediate Similarity	NPC244086
0.7009	Intermediate Similarity	NPC84956
0.7	Intermediate Similarity	NPC19400
0.699	Remote Similarity	NPC14704
0.6916	Remote Similarity	NPC475182
0.6881	Remote Similarity	NPC247037
0.6827	Remote Similarity	NPC305423
0.6818	Remote Similarity	NPC309278
0.6796	Remote Similarity	NPC485595
0.6696	Remote Similarity	NPC249265
0.6667	Remote Similarity	NPC124677
0.6637	Remote Similarity	NPC23808
0.6637	Remote Similarity	NPC87998
0.6579	Remote Similarity	NPC477811
0.6574	Remote Similarity	NPC122819
0.6571	Remote Similarity	NPC195297
0.6415	Remote Similarity	NPC141433
0.6379	Remote Similarity	NPC308140
0.63	Remote Similarity	NPC165439
0.6102	Remote Similarity	NPC287885
0.6058	Remote Similarity	NPC477451
0.6055	Remote Similarity	NPC160426
0.6	Remote Similarity	NPC486386
0.5946	Remote Similarity	NPC98696
0.5929	Remote Similarity	NPC249553
0.5929	Remote Similarity	NPC471464
0.5897	Remote Similarity	NPC254255
0.5893	Remote Similarity	NPC265275
0.5888	Remote Similarity	NPC306131
0.5888	Remote Similarity	NPC200802
0.5865	Remote Similarity	NPC297348
0.5865	Remote Similarity	NPC249204
0.5865	Remote Similarity	NPC48339
0.5865	Remote Similarity	NPC141769
0.5865	Remote Similarity	NPC477547
0.5833	Remote Similarity	NPC31896
0.5826	Remote Similarity	NPC102016
0.5826	Remote Similarity	NPC95051
0.5804	Remote Similarity	NPC40440
0.578	Remote Similarity	NPC107962
0.5739	Remote Similarity	NPC128572
0.5714	Remote Similarity	NPC325828
0.5673	Remote Similarity	NPC485594
0.567	Remote Similarity	NPC486119
0.5652	Remote Similarity	NPC182900
0.5648	Remote Similarity	NPC206003
0.5648	Remote Similarity	NPC473610
0.5603	Remote Similarity	NPC150057
0.5603	Remote Similarity	NPC147753
0.5596	Remote Similarity	NPC211354
0.5583	Remote Similarity	NPC218571
0.5583	Remote Similarity	NPC487615
0.5512	Remote Similarity	NPC210569
0.5505	Remote Similarity	NPC121453
0.5478	Remote Similarity	NPC475643
0.5446	Remote Similarity	NPC15249
0.5446	Remote Similarity	NPC25455
0.5413	Remote Similarity	NPC222731
0.5398	Remote Similarity	NPC70204
0.5391	Remote Similarity	NPC161738
0.5354	Remote Similarity	NPC477807
0.531	Remote Similarity	NPC125324
0.5304	Remote Similarity	NPC475351
0.5299	Remote Similarity	NPC469348
0.5267	Remote Similarity	NPC305771
0.5267	Remote Similarity	NPC94072
0.5267	Remote Similarity	NPC169816
0.5259	Remote Similarity	NPC486388
0.5229	Remote Similarity	NPC294686
0.5229	Remote Similarity	NPC234352
0.52	Remote Similarity	NPC100451
0.5179	Remote Similarity	NPC107188
0.5175	Remote Similarity	NPC306991
0.5167	Remote Similarity	NPC97700
0.5167	Remote Similarity	NPC184617
0.5167	Remote Similarity	NPC30856
0.5152	Remote Similarity	NPC244431
0.514	Remote Similarity	NPC486114
0.513	Remote Similarity	NPC475670
0.5128	Remote Similarity	NPC42482
0.5088	Remote Similarity	NPC295980
0.5086	Remote Similarity	NPC470748
0.5086	Remote Similarity	NPC600116
0.5043	Remote Similarity	NPC112274
0.5042	Remote Similarity	NPC92890
0.5041	Remote Similarity	NPC475625
0.5041	Remote Similarity	NPC294129
0.504	Remote Similarity	NPC83137
0.5038	Remote Similarity	NPC263359
0.5038	Remote Similarity	NPC15918

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC73170 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7687
0.1-0.2	1391
0.2-0.3	62
0.3-0.4	6
0.4-0.5	0
0.5-0.6	3
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6574	Remote Similarity	NPD8449	Approved
0.5714	Remote Similarity	NPD8171	Phase 2
0.5603	Remote Similarity	NPD8450	Suspended
0.5175	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data