NPASS Compound

Natural Product: NPC538418

Natural Product ID	NPC538418
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{S},5~{R},6~{R})-2-[(2~{S},3~{R},4~{S},5~{R},6~{R})-2-[(2~{R},3~{S},4~{R},5~{R},6~{R})-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1~{S},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},14~{R},16~{R},18~{R})-14-hydroxy-5',7,9,13-tetramethyl-spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-tetrahydropyran-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-[(2~{S},3~{R},4~{S},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-4-yl]oxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{S},5~{R},6~{R})-2-[(2~{S},3~{R},4~{S},5~{R},6~{R})-2-[(2~{R},3~{S},4~{R},5~{R},6~{R})-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1~{S},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},14~{R},16~{R},18~{R})-14-hydroxy-5',7,9,13-tetramethyl-spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-tetrahydropyran-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-[(2~{S},3~{R},4~{S},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-4-yl]oxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 155164 0 0 0 0 0 0 0 0999 V2000 13.8965 -1.0736 0.3560 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4757 -0.5166 0.2780 C 0 0 1 0 0 0 0 0 0 0 0 0 12.4921 0.8758 0.8118 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2851 1.7003 0.4140 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4052 0.8685 -0.4702 C 0 0 1 0 0 0 0 0 0 0 0 0 11.1923 0.4397 -1.5392 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0094 -0.6032 -1.1570 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8787 -0.2486 0.1791 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7620 -0.6249 -0.5666 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7580 -1.3790 0.2798 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5216 -0.5616 0.2255 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6530 -0.6506 1.4575 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1319 -2.0594 1.5824 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6369 -2.1318 1.4411 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9357 -1.1680 2.3971 C 0 0 2 0 0 0 0 0 0 0 0 0 1.4676 -1.2258 2.1479 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0227 -0.2420 1.1182 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3289 -0.3536 0.8426 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6301 -0.5426 -0.4989 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4110 0.4389 -1.0287 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7816 0.3071 -0.8670 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2899 0.7894 0.4694 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7702 0.1217 1.5512 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3199 -1.0186 -1.2000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5062 -1.1020 -1.8732 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4342 -1.9459 -1.3500 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7789 -2.9902 -2.2048 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4582 -2.6464 -3.3326 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5441 -2.5543 -4.5548 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5446 -1.6287 -4.4343 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4040 -1.5154 -3.2438 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6921 -2.0038 -3.6156 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5505 -0.7654 -1.9881 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4182 0.6097 -2.0960 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5393 1.3140 -1.6934 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.0529 1.9425 -2.7906 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5920 3.1601 -3.1538 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1218 3.1046 -3.4596 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7098 4.4060 -3.8221 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8646 4.1828 -2.1049 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8740 5.1572 -1.9837 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1909 3.5021 -0.8175 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.2164 4.3584 0.2718 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3339 2.2722 -0.5784 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8331 1.7664 0.6535 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6767 -1.2251 -0.8749 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3670 -2.1403 -0.0293 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4368 -1.7307 1.2778 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6669 -2.6532 2.0267 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3942 -2.1507 3.2946 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5505 -1.3554 3.8500 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3112 0.0200 3.7678 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8676 -1.7587 3.2595 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.3743 -2.9022 3.9202 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8566 -1.9326 1.7710 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7517 -1.1346 1.1009 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2045 -1.8019 -1.9012 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.6109 -3.0913 -2.2042 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1355 -1.9431 -0.8040 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1633 -2.7824 -1.3023 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3611 1.1808 1.5300 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5112 1.2771 2.4551 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0152 1.3000 3.7836 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5398 0.2027 2.3929 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3778 0.3764 3.6823 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4789 0.2730 1.2317 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8801 1.6644 0.9047 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9670 1.7802 -0.1241 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0989 0.8656 0.1723 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6983 1.1921 1.5226 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1032 0.7122 -0.9159 C 0 0 1 0 0 0 0 0 0 0 0 0 9.2302 1.6893 -0.9134 C 0 0 2 0 0 0 0 0 0 0 0 0 9.4625 2.1206 -2.3612 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4525 -0.4965 1.1125 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8767 -2.1636 0.5878 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3604 -0.8775 -0.6476 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8803 -1.1551 0.9679 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4554 1.3610 0.5236 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5237 0.8081 1.9387 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7757 2.1480 1.2783 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6728 2.5308 -0.2367 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8982 -0.7181 -1.8205 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4412 -1.5642 -1.2649 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0805 -1.1855 -1.4475 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6130 -2.4117 -0.1562 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1312 -1.5790 1.3085 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9801 -0.7466 -0.7002 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2560 -0.4301 2.3355 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3762 -2.4858 2.6042 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6010 -2.7635 0.8703 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3357 -3.1607 1.7981 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2755 -2.0481 0.4023 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0940 -1.6218 3.4171 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8735 -1.1711 3.0883 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2433 -2.2501 1.7428 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5814 -0.4069 0.1799 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3681 -0.5049 -1.0342 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2116 1.0519 -1.6111 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1689 1.8968 0.5474 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3880 0.6330 0.4865 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1560 0.5022 2.3612 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4500 -1.6191 -0.2487 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0059 -2.4247 -0.4466 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0762 -3.5770 -3.5762 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1887 -2.2680 -5.4199 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1593 -3.5573 -4.7541 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8804 -0.7159 -4.6430 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1607 -0.8436 -4.1219 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7665 -2.9018 -3.2049 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6010 -0.9162 -1.5995 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3521 0.6114 -1.3488 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1465 3.5029 -4.0803 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9624 2.5060 -4.3873 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5379 2.7524 -2.6207 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8611 4.6183 -3.3239 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8018 4.7431 -2.3963 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1469 5.7121 -1.1937 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2427 3.1043 -0.9166 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0704 4.3947 0.7408 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2746 2.5807 -0.4002 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3402 2.1874 1.4025 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3724 -0.3950 -0.2334 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0165 -0.7588 1.5155 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0867 -2.9476 4.0011 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5328 -1.4604 3.1931 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6032 -1.5844 4.9442 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1161 0.5416 3.9182 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6035 -0.9404 3.4958 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2087 -3.6859 3.3144 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0939 -3.0236 1.5847 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6660 -1.4757 1.2801 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7276 -1.2514 -2.7147 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7520 -3.5714 -1.3396 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6238 -2.4106 0.0549 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1485 -3.6793 -0.9165 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4682 1.8629 0.6644 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4404 1.5452 2.0647 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9496 2.2978 2.3289 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7808 2.1915 4.0878 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6593 0.4902 4.5437 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9855 -0.4923 3.9089 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9937 1.2715 3.6365 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9526 -0.1298 0.3183 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9750 2.1390 0.4101 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0611 2.3242 1.7823 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5185 1.5113 -1.1201 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2867 2.8365 -0.1443 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3664 2.0503 1.4354 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1813 0.3387 1.9952 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8729 1.5114 2.1935 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5586 0.6745 -1.8824 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0679 2.6144 -0.3565 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8919 3.1415 -2.4012 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1490 1.4160 -2.8810 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5060 2.1498 -2.9254 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 6 6 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 33 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 24 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 17 61 1 0 61 62 1 0 62 63 1 0 62 64 1 0 64 65 1 1 64 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 1 69 71 1 0 71 72 1 0 72 73 1 0 7 2 1 0 71 9 1 0 72 5 1 0 69 11 1 0 66 12 1 0 64 15 1 0 59 19 1 0 46 26 1 0 55 48 1 0 44 35 1 0 1 74 1 0 1 75 1 0 1 76 1 0 2 77 1 1 3 78 1 0 3 79 1 0 4 80 1 0 4 81 1 0 7 82 1 0 7 83 1 0 9 84 1 6 10 85 1 0 10 86 1 0 11 87 1 6 12 88 1 1 13 89 1 0 13 90 1 0 14 91 1 0 14 92 1 0 15 93 1 1 16 94 1 0 16 95 1 0 17 96 1 6 19 97 1 6 21 98 1 6 22 99 1 0 22100 1 0 23101 1 0 24102 1 1 26103 1 1 28104 1 6 29105 1 0 29106 1 0 30107 1 0 31108 1 6 32109 1 0 33110 1 1 35111 1 1 37112 1 6 38113 1 0 38114 1 0 39115 1 0 40116 1 6 41117 1 0 42118 1 6 43119 1 0 44120 1 1 45121 1 0 46122 1 1 48123 1 6 50124 1 0 50125 1 0 51126 1 1 52127 1 0 53128 1 6 54129 1 0 55130 1 1 56131 1 0 57132 1 6 58133 1 0 59134 1 1 60135 1 0 61136 1 0 61137 1 0 62138 1 6 63139 1 0 65140 1 0 65141 1 0 65142 1 0 66143 1 6 67144 1 0 67145 1 0 68146 1 0 68147 1 0 70148 1 0 70149 1 0 70150 1 0 71151 1 6 72152 1 1 73153 1 0 73154 1 0 73155 1 0 M END

Standard InCHIKey	UHDCCGNMEBZKTO-WPPABUAKSA-N
Standard InCHI	InChI=1S/C50H82O23/c1-19-7-10-50(65-17-19)20(2)32-27(73-50)13-25-23-6-5-21-11-22(12-31(55)49(21,4)24(23)8-9-48(25,32)3)66-45-40(63)37(60)41(30(16-53)69-45)70-47-43(72-44-38(61)33(56)26(54)18-64-44)42(35(58)29(15-52)68-47)71-46-39(62)36(59)34(57)28(14-51)67-46/h19-47,51-63H,5-18H2,1-4H3/t19-,20-,21+,22+,23+,24-,25-,26+,27-,28+,29+,30+,31+,32-,33-,34-,35+,36-,37+,38+,39+,40+,41+,42-,43+,44-,45+,46-,47-,48-,49-,50+/m0/s1
SMILES	C[C@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC[C@@H]5C[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O[C@@H]8O[C@H](CO)[C@H](O)[C@H](O)[C@H]8O)[C@H]7O[C@@H]7OC[C@@H](O)[C@H](O)[C@H]7O)[C@H](O)[C@H]6O)C[C@@H](O)[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1050.52	Volume:	989.966 ? Van der Waals volume.
Dense:	1.061	LogP:	0.628 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.476 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.7 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	54.0
TPSA:	355.29 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	13.0	Rings:	10.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.09	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.263	Fsp³:	1.0
MCE-18:	262.48 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.628	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.012 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.383	Promiscuous compounds:	0.056

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.392	MDCK Permeability:	-5.083
Pgp-inhibitor:	0.0	Pgp-substrate:	0.997
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.06
20% Bioavailability (F20%):	0.769	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.05
Plasma Protein Binding (PPB):	44.267%	Volume Distribution (VD):	-0.413
Fu:	42.998% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.012
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.002	CYP3A4-substrate:	0.999
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.264
HLM stability:	0.034 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.29

Half-life (T1/2):

3.519

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.006
Human Hepatotoxicity (H-HT):	0.738	Drug-induced Liver Injury (DILI):	0.969
AMES Toxicity:	0.957	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.006	Skin Sensitization:	1.0
Carcinogencity:	0.155	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.421	Drug-induced Nephrotoxicity:	0.982
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.418
A549 Cytotoxicity:	0.988	Hek293 Cytotoxicity:	0.875
BCF:	1.247 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.3 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.457 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.582 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO63259	Hemerocallis fulva var.kwanso	Genus	Asphodelaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC538418 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	29595
0.1-0.2	17456
0.2-0.3	2338
0.3-0.4	284
0.4-0.5	71
0.5-0.6	56
0.6-0.7	35
0.7-0.8	0
0.8-0.85	1
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8586	High Similarity	NPC97700
0.8586	High Similarity	NPC30856
0.8019	Intermediate Similarity	NPC132080
0.7981	Intermediate Similarity	NPC116756
0.7961	Intermediate Similarity	NPC115165
0.78	Intermediate Similarity	NPC475351
0.7736	Intermediate Similarity	NPC232037
0.7477	Intermediate Similarity	NPC470866
0.7477	Intermediate Similarity	NPC473518
0.7407	Intermediate Similarity	NPC232611
0.7379	Intermediate Similarity	NPC473601
0.7364	Intermediate Similarity	NPC233433
0.7358	Intermediate Similarity	NPC184617
0.7172	Intermediate Similarity	NPC250393
0.7117	Intermediate Similarity	NPC476112
0.7117	Intermediate Similarity	NPC307534
0.71	Intermediate Similarity	NPC206003
0.71	Intermediate Similarity	NPC473610
0.7027	Intermediate Similarity	NPC470864
0.6991	Remote Similarity	NPC31896
0.6964	Remote Similarity	NPC83137
0.6923	Remote Similarity	NPC220836
0.6869	Remote Similarity	NPC325828
0.6852	Remote Similarity	NPC51172
0.6852	Remote Similarity	NPC49032
0.6847	Remote Similarity	NPC475625
0.6667	Remote Similarity	NPC94086
0.6667	Remote Similarity	NPC475319
0.6667	Remote Similarity	NPC473817
0.6583	Remote Similarity	NPC210569
0.6571	Remote Similarity	NPC107962
0.6522	Remote Similarity	NPC470862
0.6486	Remote Similarity	NPC151134
0.6429	Remote Similarity	NPC98018
0.6429	Remote Similarity	NPC284104
0.6429	Remote Similarity	NPC103616
0.6325	Remote Similarity	NPC477811
0.6299	Remote Similarity	NPC330026
0.6226	Remote Similarity	NPC107188
0.6204	Remote Similarity	NPC125324
0.6195	Remote Similarity	NPC128572
0.616	Remote Similarity	NPC263359
0.6154	Remote Similarity	NPC329807
0.6148	Remote Similarity	NPC473505
0.6148	Remote Similarity	NPC477807
0.6136	Remote Similarity	NPC481189
0.6094	Remote Similarity	NPC481190
0.609	Remote Similarity	NPC329727
0.605	Remote Similarity	NPC84111
0.605	Remote Similarity	NPC287483
0.605	Remote Similarity	NPC470865
0.6032	Remote Similarity	NPC305771
0.6032	Remote Similarity	NPC94072
0.6032	Remote Similarity	NPC169816
0.5948	Remote Similarity	NPC51520
0.5948	Remote Similarity	NPC303069
0.594	Remote Similarity	NPC329820
0.5909	Remote Similarity	NPC6295
0.5905	Remote Similarity	NPC177834
0.5902	Remote Similarity	NPC470867
0.5902	Remote Similarity	NPC262050
0.5882	Remote Similarity	NPC108072
0.5849	Remote Similarity	NPC234352
0.5826	Remote Similarity	NPC471464
0.5826	Remote Similarity	NPC300557
0.5804	Remote Similarity	NPC160426
0.5794	Remote Similarity	NPC79900
0.5794	Remote Similarity	NPC15918
0.5781	Remote Similarity	NPC244431
0.5755	Remote Similarity	NPC297348
0.5755	Remote Similarity	NPC249204
0.5755	Remote Similarity	NPC48339
0.5755	Remote Similarity	NPC141769
0.5755	Remote Similarity	NPC477547
0.5656	Remote Similarity	NPC92297
0.5652	Remote Similarity	NPC602423
0.5636	Remote Similarity	NPC211354
0.5636	Remote Similarity	NPC19400
0.563	Remote Similarity	NPC470863
0.5603	Remote Similarity	NPC92890
0.5603	Remote Similarity	NPC477809
0.5583	Remote Similarity	NPC309278
0.5575	Remote Similarity	NPC195297
0.5524	Remote Similarity	NPC24960
0.5505	Remote Similarity	NPC477451
0.5469	Remote Similarity	NPC477808
0.5462	Remote Similarity	NPC294129
0.5446	Remote Similarity	NPC264101
0.5429	Remote Similarity	NPC481418
0.5413	Remote Similarity	NPC294686
0.5405	Remote Similarity	NPC121453
0.5385	Remote Similarity	NPC475643
0.5351	Remote Similarity	NPC470432
0.5351	Remote Similarity	NPC230507
0.5349	Remote Similarity	NPC273002
0.5328	Remote Similarity	NPC475333
0.5328	Remote Similarity	NPC224098
0.5328	Remote Similarity	NPC208383
0.5317	Remote Similarity	NPC167183
0.5294	Remote Similarity	NPC6806
0.5203	Remote Similarity	NPC470861
0.5197	Remote Similarity	NPC232054
0.5194	Remote Similarity	NPC480556
0.5179	Remote Similarity	NPC222731
0.5169	Remote Similarity	NPC202898
0.5138	Remote Similarity	NPC485594
0.5094	Remote Similarity	NPC277715
0.5091	Remote Similarity	NPC181845
0.5086	Remote Similarity	NPC485595
0.5038	Remote Similarity	NPC32707

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC538418 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7975
0.1-0.2	1109
0.2-0.3	59
0.3-0.4	4
0.4-0.5	1
0.5-0.6	0
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6869	Remote Similarity	NPD8171	Phase 2
0.6055	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data