NPASS Compound

Natural Product: NPC224557

Natural Product ID	NPC224557
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Landomycin W
IUPAC Name	8-[(2S,4R,5S,6R)-5-[(2S,4R,5R,6R)-4-[(2S,5S,6S)-5-[(2S,4R,5S,6R)-5-[(2S,4R,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-5-hydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-1,11-dihydroxy-3-methylbenzo[a]anthracene-7,12-dione
Synonyms	Landomycin W
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1668761
PubChem CID	50993663
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0003415] Angucyclines

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 130138 0 0 0 0 0 0 0 0999 V2000 -17.3196 -2.3240 -0.4209 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.9584 -1.6947 -0.3242 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.8018 -0.3797 0.0146 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.5416 0.2307 0.1115 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.5080 1.5476 0.4565 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.4372 -0.5200 -0.1426 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.5747 -1.8830 -0.4953 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.8340 -2.4339 -0.5765 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4701 -2.6619 -0.7575 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2194 -2.1248 -0.6799 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0577 -0.7990 -0.3381 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.1558 0.0334 -0.0620 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.9614 1.4131 0.2931 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.8543 2.2031 0.5483 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5751 1.9457 0.3631 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4979 1.1519 0.0981 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7035 -0.2376 -0.2588 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7545 -0.9851 -0.5049 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1879 1.6455 0.1592 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0100 2.9615 0.4955 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1140 3.7697 0.7657 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4040 3.2690 0.7019 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5091 4.0843 0.9741 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1230 0.8465 -0.1064 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7736 1.1081 -0.1268 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0386 0.4147 1.0075 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6589 -0.9554 0.4894 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7040 -1.4281 -0.2854 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4888 -0.7200 -0.4414 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7981 0.5195 -1.2197 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1378 0.8151 -1.3157 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1165 0.4215 -2.5573 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2994 -0.5517 0.2272 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3319 -1.4951 -0.0834 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1101 -2.2259 1.0819 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5901 -1.4940 2.1201 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6240 -1.0747 3.1459 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2554 -0.3147 1.6998 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0004 -0.7645 0.4504 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0580 -0.9381 -0.6197 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0081 0.1030 0.0769 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2618 -0.5482 0.1236 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8654 -0.6400 -1.2390 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4849 0.6121 -1.7595 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1623 1.3593 -0.6330 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1861 1.4368 0.5035 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0282 0.1777 1.0292 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5626 2.4701 1.5346 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3360 0.6999 -0.3411 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4781 1.4084 -0.5492 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2471 1.7506 0.7062 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0087 0.5345 1.1830 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2223 -0.3313 1.9362 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6718 -0.1471 0.0331 C 0 0 1 0 0 0 0 0 0 0 0 0 8.7880 -0.3111 -1.1564 C 0 0 2 0 0 0 0 0 0 0 0 0 8.3156 0.9363 -1.5481 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7093 -1.3470 -0.9884 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7923 0.6207 -0.3416 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9340 -0.1586 -0.1816 C 0 0 1 0 0 0 0 0 0 0 0 0 12.4912 -0.3933 -1.5855 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8555 -1.0801 -1.4679 C 0 0 1 0 0 0 0 0 0 0 0 0 14.3687 -1.1844 -2.7521 O 0 0 0 0 0 0 0 0 0 0 0 0 14.7115 -0.2416 -0.5550 C 0 0 1 0 0 0 0 0 0 0 0 0 14.0223 -0.1570 0.7873 C 0 0 2 0 0 0 0 0 0 0 0 0 12.8238 0.5174 0.6150 O 0 0 0 0 0 0 0 0 0 0 0 0 14.9231 0.6529 1.6996 C 0 0 0 0 0 0 0 0 0 0 0 0 15.9537 -0.8682 -0.4643 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1902 -0.0872 2.7070 O 0 0 0 0 0 0 0 0 0 0 0 0 -17.5377 -2.7933 0.5430 H 0 0 0 0 0 0 0 0 0 0 0 0 -18.0738 -1.5839 -0.7374 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.2758 -3.1063 -1.1907 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.6574 0.2413 0.2229 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.3876 2.0857 0.5622 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.8882 -3.4896 -0.8525 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5961 -3.7073 -1.0271 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3166 -2.7078 -0.8801 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0240 3.4530 0.5736 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9880 4.7984 1.0292 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9088 4.5835 0.1917 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6040 2.1905 0.0483 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6602 0.2745 1.8982 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1200 1.0068 1.2035 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4508 -1.6770 1.2762 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4541 -1.6594 -1.2001 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4864 -1.5815 -1.1396 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3177 1.3723 -0.6811 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7324 -0.1060 -3.3131 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1531 -0.1187 -2.4590 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8953 1.4163 -2.9898 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7468 -2.2059 -0.8257 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1093 -2.1866 2.6751 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2478 -0.2425 2.7956 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1899 -1.9640 3.4792 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0512 -0.7327 4.0498 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3067 0.6049 1.5459 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3801 -1.7848 0.6989 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2089 0.0647 -1.0679 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3118 -1.5978 -1.4297 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0804 -1.5913 0.4644 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5756 -1.4929 -1.2291 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0317 -0.9593 -1.9301 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2632 0.3171 -2.5232 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7235 1.2479 -2.2735 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3148 2.3925 -1.0002 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2002 1.7317 0.0602 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2936 2.0240 2.2687 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6652 2.7302 2.1331 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9370 3.3956 1.0787 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1297 2.4185 -0.9404 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0061 2.5390 0.5111 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5883 2.1633 1.4979 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8362 0.8479 1.8863 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6763 -0.6748 2.7437 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0052 -1.1718 0.3513 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4480 -0.6487 -2.0185 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9023 -1.2396 -1.7181 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2135 -2.3397 -1.1631 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3546 -1.3589 0.0405 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6786 -1.1775 0.2074 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8279 -1.1458 -2.0695 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5407 0.5640 -2.1042 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6479 -2.0880 -1.0253 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1606 -1.8037 -2.7581 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7757 0.7617 -0.9900 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8683 -1.1607 1.2367 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3265 1.0940 2.5136 H 0 0 0 0 0 0 0 0 0 0 0 0 15.4156 1.4143 1.0609 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6894 -0.0210 2.1070 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0157 -1.2962 0.4414 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9302 -0.4774 3.5684 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 4 6 2 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 2 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 13 15 1 0 15 16 2 0 16 17 1 0 17 18 2 0 16 19 1 0 19 20 2 0 20 21 1 0 21 22 2 0 22 23 1 0 19 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 29 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 46 48 1 0 45 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 54 55 1 0 55 56 1 0 55 57 1 0 54 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 64 65 1 0 64 66 1 0 63 67 1 0 38 68 1 0 8 2 1 0 17 11 1 0 31 25 1 0 40 34 1 0 47 42 1 0 56 50 1 0 65 59 1 0 12 6 1 0 22 15 1 0 1 69 1 0 1 70 1 0 1 71 1 0 3 72 1 0 5 73 1 0 8 74 1 0 9 75 1 0 10 76 1 0 20 77 1 0 21 78 1 0 23 79 1 0 25 80 1 1 26 81 1 0 26 82 1 0 27 83 1 1 28 84 1 0 29 85 1 6 30 86 1 1 32 87 1 0 32 88 1 0 32 89 1 0 34 90 1 6 36 91 1 1 37 92 1 0 37 93 1 0 37 94 1 0 38 95 1 6 39 96 1 1 40 97 1 0 40 98 1 0 42 99 1 1 43100 1 0 43101 1 0 44102 1 0 44103 1 0 45104 1 6 46105 1 6 48106 1 0 48107 1 0 48108 1 0 50109 1 6 51110 1 0 51111 1 0 52112 1 1 53113 1 0 54114 1 1 55115 1 6 57116 1 0 57117 1 0 57118 1 0 59119 1 1 60120 1 0 60121 1 0 61122 1 1 62123 1 0 63124 1 6 64125 1 1 66126 1 0 66127 1 0 66128 1 0 67129 1 0 68130 1 0 M END

Standard InCHIKey	OTNJSUYMCMBLIA-LJGUJNJOSA-N
Standard InCHI	InChI=1S/C49H62O19/c1-19-13-25-7-8-26-41(40(25)28(51)14-19)47(58)42-27(50)9-10-33(43(42)46(26)57)65-37-17-31(54)49(24(6)63-37)68-39-18-34(45(56)22(4)61-39)66-35-12-11-32(20(2)59-35)64-36-16-30(53)48(23(5)62-36)67-38-15-29(52)44(55)21(3)60-38/h7-10,13-14,20-24,29-32,34-39,44-45,48-56H,11-12,15-18H2,1-6H3/t20-,21+,22+,23+,24+,29+,30+,31+,32-,34+,35-,36-,37-,38-,39-,44+,45+,48+,49+/m0/s1
SMILES	Cc1cc(O)c2c(c1)ccc1c2C(=O)c2c(C1=O)c(ccc2O)O[C@H]1C[C@@H](O)[C@@H]([C@H](O1)C)O[C@@H]1O[C@H](C)[C@H]([C@@H](C1)O[C@H]1CC[C@@H]([C@@H](O1)C)O[C@H]1C[C@@H](O)[C@@H]([C@H](O1)C)O[C@H]1C[C@@H](O)[C@@H]([C@H](O1)C)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	954.39	Volume:	919.701 ? Van der Waals volume.
Dense:	1.038	LogP:	2.787 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.107 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.505 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	53.0
TPSA:	268.05 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	7.0	Rings:	9.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.12	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.338	Fsp³:	0.633
MCE-18:	210.25 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	1
Colloidal aggregators:	0.923	Fluc inhibitor:	0.149 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.322 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.632 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.375	Promiscuous compounds:	0.513

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.008	MDCK Permeability:	-5.03
Pgp-inhibitor:	0.491	Pgp-substrate:	0.999
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.008
20% Bioavailability (F20%):	0.022	30% Bioavailability (F30%):	0.47
50% Bioavailability (F50%):	0.988

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.226
Plasma Protein Binding (PPB):	89.696%	Volume Distribution (VD):	-0.299
Fu:	8.661% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.002
BSEP inhibitor:	0.985

ADMET: Metabolism

CYP1A2-inhibitor:	0.004	CYP1A2-substrate:	0.003
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.03	CYP3A4-substrate:	0.014
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.934
HLM stability:	0.594 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.733

Half-life (T1/2):

7.439

ADMET: Toxicity

hERG Blockers:	0.167	hERG Blockers (10um):	0.417
Human Hepatotoxicity (H-HT):	0.846	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	0.994	Rat Oral Acute Toxicity:	0.666
Maximum Recommended Daily Dose:	0.857	Skin Sensitization:	0.999
Carcinogencity:	0.268	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.265
Drug-induced Neurotoxicity:	0.006	Ototoxicity:	0.999
Hematotoxicity:	0.795	Drug-induced Nephrotoxicity:	0.985
Genotoxicity:	0.958	RPMI-8226 Immunitoxicity:	0.916
A549 Cytotoxicity:	0.997	Hek293 Cytotoxicity:	0.873
BCF:	0.823 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.828 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.581 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.748 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO19685	Streptomyces cyanogenus	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	PMID[21188999]
NPO19685	Streptomyces cyanogenus	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19685	Streptomyces cyanogenus	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Cell line	1
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	6900.0	nM	PMID[21188999]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	2650.0	nM	PMID[21188999]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC224557 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20772
0.1-0.2	28306
0.2-0.3	716
0.3-0.4	47
0.4-0.5	6
0.5-0.6	3
0.6-0.7	1
0.7-0.8	0
0.8-0.85	3
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9255	High Similarity	NPC292706
0.8469	Intermediate Similarity	NPC197357
0.8404	Intermediate Similarity	NPC58538
0.8132	Intermediate Similarity	NPC102053
0.7822	Intermediate Similarity	NPC85316
0.7624	Intermediate Similarity	NPC603833
0.703	Intermediate Similarity	NPC289876
0.6735	Remote Similarity	NPC203751
0.563	Remote Similarity	NPC232818
0.5161	Remote Similarity	NPC223735
0.5082	Remote Similarity	NPC198893

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC224557 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5520
0.1-0.2	3600
0.2-0.3	30
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data