NPASS Compound

Natural Product: NPC158214

Natural Product ID	NPC158214
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Rugosin D
IUPAC Name	n.a.
Synonyms	Rugosin D
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL454004
PubChem CID	16129626
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000238] Tannins [CHEMONTID:0001710] Hydrolyzable tannins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 192205 0 0 0 0 0 0 0 0999 V2000 9.6437 4.6197 -2.6652 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4227 3.2538 -2.5642 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8582 2.4797 -3.6037 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4938 3.0466 -4.7074 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7034 4.4235 -4.7812 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2703 5.1833 -3.7515 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4798 6.5736 -3.8166 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3433 4.9106 -5.9128 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9337 2.2456 -5.7553 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7718 2.7358 -1.3931 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4530 3.5463 -0.4496 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4319 1.4191 -1.1462 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8084 1.0110 0.0581 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5373 0.2799 -0.0841 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0198 -0.1697 1.2812 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1876 -1.4816 0.9044 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0778 -1.0578 0.2087 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1852 -1.8161 -0.4379 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3671 -3.0786 -0.4671 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9843 -1.3323 -1.1217 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8471 -2.0034 -0.5950 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4175 -1.7403 -1.0276 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5959 -0.7674 -2.0134 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5163 -0.1459 -2.4856 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8443 -0.3988 -2.0744 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8467 0.3573 -2.8234 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8107 1.1639 -2.4287 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5446 1.9712 -3.3217 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2987 1.9454 -4.6460 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3202 1.1143 -5.1027 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6111 0.3404 -4.2378 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6212 -0.5297 -4.6744 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0334 1.0502 -6.4546 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0400 2.7604 -5.5166 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4310 1.2601 -1.0886 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8920 1.8843 -0.2586 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5956 0.5911 -0.9744 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3317 0.8289 -3.4383 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8428 -0.4796 -2.4604 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5439 -2.3799 -0.5606 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7070 -3.2399 0.4844 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6353 -2.9281 1.4977 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8456 -3.7113 2.5844 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1066 -4.8755 2.6750 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1947 -5.2357 1.7124 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0004 -4.4000 0.6049 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0698 -4.8514 -0.3168 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4663 -6.4146 1.8352 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2980 -5.6966 3.7767 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5202 -1.7801 1.1980 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3851 -1.0924 0.1637 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5803 -1.4368 2.0657 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4314 -0.4131 1.6864 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7744 -1.0762 1.2225 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3588 0.0165 0.3127 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7288 1.1098 1.3072 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4995 1.5782 1.9913 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7516 2.6321 3.0219 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9012 3.3052 3.0249 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2163 3.1574 3.2690 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6882 2.0886 3.6327 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1305 4.3386 3.1055 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2474 5.0010 4.3445 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8489 6.2097 4.4831 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3537 6.7941 3.3629 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2417 6.1482 2.1610 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6233 4.8787 2.0010 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7592 4.3422 0.6455 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8253 3.8312 -0.1523 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1009 3.5425 -1.4924 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3176 3.7499 -2.0539 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3045 4.2602 -1.2610 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.0403 4.5462 0.0453 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.0246 5.0462 0.8950 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.5801 4.4913 -1.7697 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5411 3.4462 -3.4062 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5161 3.2487 0.2454 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4979 3.8464 0.0430 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5811 2.0288 0.8176 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.7368 6.7332 0.9939 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.9794 8.0247 3.4314 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9194 6.8028 5.7386 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8137 0.5221 2.5906 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3991 -0.4825 -0.4656 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1946 -0.5125 -1.8486 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0790 -0.0675 -2.2702 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1532 -1.0154 -2.8116 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3729 -1.4820 -2.4264 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2338 -1.9851 -3.3916 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8991 -2.0311 -4.7222 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6576 -1.5510 -5.0794 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7919 -1.0476 -4.1410 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3161 -1.6013 -6.4482 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.7732 -2.5447 -5.7084 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.4871 -2.4638 -2.9699 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5789 -2.3099 0.6372 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1415 -3.4867 1.0822 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9061 -3.3764 2.1045 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9589 -4.8059 0.5214 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1464 -5.0534 -0.5582 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9818 -6.3211 -1.0649 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6163 -7.4256 -0.5339 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4453 -7.1757 0.5645 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5998 -5.9122 1.0629 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0871 -8.2799 1.0992 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4581 -8.7022 -1.0386 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1266 -6.4949 -2.1714 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9394 -0.5946 2.1258 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1653 0.0617 2.2135 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7339 0.0399 0.8216 C 0 0 2 0 0 0 0 0 0 0 0 0 10.0862 0.2809 0.6837 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8800 -0.7749 0.1900 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2760 -1.8739 -0.0729 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3082 -0.6930 -0.0320 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9999 -1.8389 -0.4393 C 0 0 0 0 0 0 0 0 0 0 0 0 14.3524 -1.8109 -0.7017 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0745 -0.6528 -0.5727 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4053 0.4754 -0.1734 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0378 0.4556 0.0947 C 0 0 0 0 0 0 0 0 0 0 0 0 15.1284 1.6707 -0.0369 O 0 0 0 0 0 0 0 0 0 0 0 0 16.4524 -0.6074 -0.8335 O 0 0 0 0 0 0 0 0 0 0 0 0 15.0037 -2.9600 -1.0976 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9637 -0.5863 3.1763 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3802 0.0357 4.3489 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0101 1.2275 4.4935 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1827 -0.5825 5.3739 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6257 -1.8750 5.3104 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3802 -2.3960 6.3505 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7151 -1.6577 7.4716 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2670 -0.3643 7.5192 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5194 0.1528 6.4944 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6177 0.3831 8.6624 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4776 -2.2701 8.4704 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8010 -3.7007 6.2543 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3204 5.2959 -1.8774 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7164 1.3966 -3.5714 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8307 7.0857 -3.0033 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1972 5.4656 -5.7796 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2678 1.8728 -6.4099 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6577 1.8811 0.7360 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9210 -0.7866 -0.4917 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2885 0.5187 1.7116 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8875 -1.8486 1.9046 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8745 -2.1561 0.4013 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0131 -2.7124 0.2225 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2749 2.6085 -2.8023 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9147 -1.3222 -5.2318 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7370 1.0726 -7.1692 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0343 2.6667 -5.5980 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5505 0.9926 -3.8759 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3197 -0.8479 -3.2406 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5770 -3.4174 3.3205 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2673 -5.1510 -1.2568 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1028 -6.6234 2.6383 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0958 -5.2730 4.6819 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0616 0.0835 0.7464 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4090 -1.0968 2.1236 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4855 0.3754 -0.2660 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2988 0.5124 2.1060 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7596 1.9540 1.2101 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8959 3.3706 2.9225 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5397 2.2230 4.0717 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8097 4.4198 5.1724 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2216 3.1534 -2.0494 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8474 4.4856 1.1486 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7813 5.0219 -2.6007 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9333 3.9237 -4.0638 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0720 7.6810 0.9503 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8765 8.1080 3.9092 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1297 6.3245 6.5820 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6971 -1.4750 -1.3643 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8262 -0.6837 -4.4898 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2497 -2.5044 -6.9341 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0537 -3.5148 -5.5523 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3398 -2.0782 -3.3837 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6239 -4.2040 -1.0142 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2457 -5.7265 1.9260 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0959 -8.3223 1.2251 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2363 -9.3371 -1.1845 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0855 -7.3804 -2.6259 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9520 1.1128 2.5364 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4444 -0.9904 0.4275 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4118 -2.7397 -0.5265 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5738 1.3780 0.3959 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0598 1.6415 0.3699 H 0 0 0 0 0 0 0 0 0 0 0 0 16.8652 -1.4675 -1.2134 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6311 -3.5537 -1.8247 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3668 -2.4537 4.4455 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1941 1.1786 6.5834 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4318 1.0216 8.6145 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2806 -2.8135 8.1200 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7418 -3.9457 6.5500 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 2 0 6 7 1 0 5 8 1 0 4 9 1 0 2 10 1 0 10 11 2 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 20 21 2 0 21 22 1 0 22 23 2 0 23 24 1 0 24 25 2 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 2 0 31 32 1 0 30 33 1 0 29 34 1 0 27 35 1 0 35 36 2 0 35 37 1 0 24 38 1 0 23 39 1 0 22 40 1 0 40 41 1 0 41 42 1 0 42 43 2 0 43 44 1 0 44 45 2 0 45 46 1 0 46 47 1 0 45 48 1 0 44 49 1 0 42 50 1 0 50 51 2 0 50 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 2 0 60 62 1 0 62 63 2 0 63 64 1 0 64 65 2 0 65 66 1 0 66 67 2 0 67 68 1 0 68 69 2 0 69 70 1 0 70 71 2 0 71 72 1 0 72 73 2 0 73 74 1 0 72 75 1 0 71 76 1 0 69 77 1 0 77 78 2 0 77 79 1 0 66 80 1 0 65 81 1 0 64 82 1 0 57 83 1 0 55 84 1 0 84 85 1 0 85 86 2 0 85 87 1 0 87 88 2 0 88 89 1 0 89 90 2 0 90 91 1 0 91 92 2 0 91 93 1 0 90 94 1 0 89 95 1 0 54 96 1 0 96 97 1 0 97 98 2 0 97 99 1 0 99100 2 0 100101 1 0 101102 2 0 102103 1 0 103104 2 0 103105 1 0 102106 1 0 101107 1 0 15108 1 0 108109 1 0 109110 1 0 110111 1 0 111112 1 0 112113 2 0 112114 1 0 114115 2 0 115116 1 0 116117 2 0 117118 1 0 118119 2 0 118120 1 0 117121 1 0 116122 1 0 109123 1 0 123124 1 0 124125 2 0 124126 1 0 126127 2 0 127128 1 0 128129 2 0 129130 1 0 130131 2 0 130132 1 0 129133 1 0 128134 1 0 6 1 1 0 110 13 1 0 119114 1 0 131126 1 0 37 14 1 0 46 41 2 0 83 53 1 0 92 87 1 0 104 99 1 0 25 20 1 0 31 26 1 0 79 56 1 0 67 62 1 0 73 68 1 0 1135 1 0 3136 1 0 7137 1 0 8138 1 0 9139 1 0 13140 1 1 14141 1 6 15142 1 1 16143 1 0 16144 1 0 21145 1 0 28146 1 0 32147 1 0 33148 1 0 34149 1 0 38150 1 0 39151 1 0 43152 1 0 47153 1 0 48154 1 0 49155 1 0 53156 1 6 54157 1 1 55158 1 6 56159 1 1 57160 1 6 58161 1 0 58162 1 0 63163 1 0 70164 1 0 74165 1 0 75166 1 0 76167 1 0 80168 1 0 81169 1 0 82170 1 0 88171 1 0 92172 1 0 93173 1 0 94174 1 0 95175 1 0 100176 1 0 104177 1 0 105178 1 0 106179 1 0 107180 1 0 109181 1 1 110182 1 6 115183 1 0 119184 1 0 120185 1 0 121186 1 0 122187 1 0 127188 1 0 131189 1 0 132190 1 0 133191 1 0 134192 1 0 M END

Standard InCHIKey	LELFYNPFJFAEND-YLVKXZTISA-N
Standard InCHI	InChI=1S/C82H58O52/c83-28-1-18(2-29(84)49(28)97)71(112)129-67-65-43(125-81(133-75(116)22-9-36(91)53(101)37(92)10-22)69(67)131-73(114)20-5-32(87)51(99)33(88)6-20)17-123-77(118)26-15-42(58(106)62(110)48(26)47-25(79(120)127-65)13-40(95)56(104)61(47)109)124-64-27(14-41(96)57(105)63(64)111)80(121)134-82-70(132-74(115)21-7-34(89)52(100)35(90)8-21)68(130-72(113)19-3-30(85)50(98)31(86)4-19)66-44(126-82)16-122-76(117)23-11-38(93)54(102)59(107)45(23)46-24(78(119)128-66)12-39(94)55(103)60(46)108/h1-15,43-44,65-70,81-111H,16-17H2/t43-,44-,65-,66-,67+,68+,69-,70-,81+,82+/m1/s1
SMILES	c1c(cc(c(c1O)O)O)C(=O)O[C@H]1[C@H]2[C@@H](COC(=O)c3cc(c(c(c3-c3c(cc(c(c3O)O)O)C(=O)O2)O)O)Oc2c(cc(c(c2O)O)O)C(=O)O[C@H]2[C@@H]([C@H]([C@H]3[C@@H](COC(=O)c4cc(c(c(c4-c4c(cc(c(c4O)O)O)C(=O)O3)O)O)O)O2)OC(=O)c2cc(c(c(c2)O)O)O)OC(=O)c2cc(c(c(c2)O)O)O)O[C@H]([C@@H]1OC(=O)c1cc(c(c(c1)O)O)O)OC(=O)c1cc(c(c(c1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1874.19	Volume:	1658.67 ? Van der Waals volume.
Dense:	1.13	LogP:	-0.956 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	-2.061 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.951 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	20.0	Rigid Bonds:	98.0
TPSA:	877.36 ? Topological Polar Surface Area.	H-Bond Acceptor:	52.0
H-Bond Donor:	29.0	Rings:	14.0
Heavy Atoms:	52.0

MedChem Properties

QED Drug-Likeness Score:	0.042	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.793	Fsp³:	0.146
MCE-18:	348.319 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	1	PAINS Alert:	1
Colloidal aggregators:	1.0	Fluc inhibitor:	0.068 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.374 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.667 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.748	Promiscuous compounds:	0.98

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-9.973	MDCK Permeability:	-4.408
Pgp-inhibitor:	0.0	Pgp-substrate:	0.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	75.188%	Volume Distribution (VD):	-0.032
Fu:	8.703% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.99
OATP1B3 inhibitor:	0.859	BCRP inhibitor:	0.413
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	1.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

3.399

Half-life (T1/2):

9.847

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	1.0
Human Hepatotoxicity (H-HT):	0.049	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	1.0	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.997	Skin Sensitization:	1.0
Carcinogencity:	0.015	Eye Corrosion:	0.0
Eye Irritation:	0.523	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.0	Drug-induced Nephrotoxicity:	0.0
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.0
A549 Cytotoxicity:	1.0	Hek293 Cytotoxicity:	0.667
BCF:	-1.164 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.212 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	3.886 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.297 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1524	Rosa rugosa	Species	Rosaceae	Eukaryota	Flowers	n.a.	n.a.	DOI[10.1016/j.foodcont.2014.02.001]
NPO1524	Rosa rugosa	Species	Rosaceae	Eukaryota	Flowers	n.a.	n.a.	PMID[20467822]
NPO1590	Sinningia aggregata	Species	Gesneriaceae	Eukaryota	Tubers	n.a.	n.a.	PMID[20684540]
NPO1524	Rosa rugosa	Species	Rosaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[24063567]
NPO1524	Rosa rugosa	Species	Rosaceae	Eukaryota	Roots	n.a.	n.a.	PMID[24461297]
NPO1524	Rosa rugosa	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[34332066]
NPO1590	Sinningia aggregata	Species	Gesneriaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7084	Montezuma speciosissima	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8829	Baccharis obtusifolia	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1524	Rosa rugosa	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1524	Rosa rugosa	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO1524	Rosa rugosa	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO1524	Rosa rugosa	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO1524	Rosa rugosa	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO1590	Sinningia aggregata	Species	Gesneriaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO8829	Baccharis obtusifolia	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7084	Montezuma speciosissima	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[UNPD]
NPO1524	Rosa rugosa	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	10

Activity Type	# Activity
Others	10

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	Activity	=	111.0	%	PMID[2413172]
NPT2	Others	Unspecified	n.a.	Activity	=	6.0	%	PMID[2413172]
NPT2	Others	Unspecified	n.a.	Activity	=	5.0	%	PMID[2413172]
NPT2	Others	Unspecified	n.a.	Activity	=	7.0	%	PMID[2413172]
NPT2	Others	Unspecified	n.a.	Activity	=	16.0	%	PMID[2413172]
NPT2	Others	Unspecified	n.a.	Activity	=	55.0	%	PMID[2413172]
NPT2	Others	Unspecified	n.a.	Activity	=	54.0	%	PMID[2413172]
NPT2	Others	Unspecified	n.a.	Activity	=	12.0	%	PMID[2413172]
NPT2	Others	Unspecified	n.a.	Activity	=	2.0	%	PMID[2413172]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC158214 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28828
0.1-0.2	20660
0.2-0.3	241
0.3-0.4	53
0.4-0.5	29
0.5-0.6	13
0.6-0.7	7
0.7-0.8	0
0.8-0.85	5
0.85-0.9	2
0.9-0.95	0
0.95-1	3

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC483712
1.0	High Similarity	NPC214202
0.9595	High Similarity	NPC290289
0.8947	High Similarity	NPC223534
0.8553	High Similarity	NPC40078
0.8272	Intermediate Similarity	NPC187632
0.8272	Intermediate Similarity	NPC240200
0.8272	Intermediate Similarity	NPC488885
0.8072	Intermediate Similarity	NPC194439
0.8072	Intermediate Similarity	NPC33724
0.7975	Intermediate Similarity	NPC112211
0.7975	Intermediate Similarity	NPC254925
0.7701	Intermediate Similarity	NPC488884
0.7614	Intermediate Similarity	NPC488887
0.7614	Intermediate Similarity	NPC488886
0.7561	Intermediate Similarity	NPC97924
0.7471	Intermediate Similarity	NPC116108
0.7361	Intermediate Similarity	NPC43918
0.7361	Intermediate Similarity	NPC261411
0.7361	Intermediate Similarity	NPC190204
0.7283	Intermediate Similarity	NPC469652
0.7283	Intermediate Similarity	NPC486025
0.7283	Intermediate Similarity	NPC486024
0.726	Intermediate Similarity	NPC469651
0.7222	Intermediate Similarity	NPC47521
0.7128	Intermediate Similarity	NPC93065
0.7128	Intermediate Similarity	NPC220876
0.6979	Remote Similarity	NPC31208
0.6979	Remote Similarity	NPC160543
0.6957	Remote Similarity	NPC469649
0.6939	Remote Similarity	NPC174140
0.6739	Remote Similarity	NPC471091
0.6667	Remote Similarity	NPC260521
0.6512	Remote Similarity	NPC269625
0.589	Remote Similarity	NPC114791
0.589	Remote Similarity	NPC104222
0.589	Remote Similarity	NPC210501
0.589	Remote Similarity	NPC318826
0.589	Remote Similarity	NPC141331
0.5581	Remote Similarity	NPC8940
0.5408	Remote Similarity	NPC483711
0.5357	Remote Similarity	NPC149300
0.5238	Remote Similarity	NPC302170
0.5238	Remote Similarity	NPC311389
0.5164	Remote Similarity	NPC3474
0.5152	Remote Similarity	NPC189312
0.5122	Remote Similarity	NPC41845

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC158214 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6772
0.1-0.2	2373
0.2-0.3	5
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data