NPASS Compound

Natural Product: NPC31208

Natural Product ID	NPC31208
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	PFUDAMHTVMSQNA-WXZXAZFGSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2375774
PubChem CID	16143849
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000238] Tannins [CHEMONTID:0001710] Hydrolyzable tannins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 162173 0 0 0 0 0 0 0 0999 V2000 10.3159 -1.2951 2.1351 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3473 -2.0876 2.7223 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2202 -2.2770 1.7620 C 0 0 1 0 0 0 0 0 0 0 0 0 7.5949 -1.1006 1.3633 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5801 -1.5011 0.4604 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6514 -0.4513 0.2428 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3941 0.5326 1.1668 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0260 0.4819 2.2549 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4352 1.6285 0.9618 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7106 2.6381 0.0697 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8382 3.6799 -0.1550 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1095 4.6928 -1.0489 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6321 3.7103 0.5497 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3605 2.6971 1.4426 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2524 1.6677 1.6468 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1638 2.7297 2.1356 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4956 3.8955 2.4372 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8707 4.0411 2.1405 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5060 5.2054 2.4542 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8746 6.2783 3.0605 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4654 6.1445 3.3548 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1270 4.9536 3.0371 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4767 4.8451 3.3426 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1375 7.2039 3.9644 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5971 7.4283 3.3471 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5199 2.9079 1.4992 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9120 2.2712 0.5666 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7855 2.4333 1.8165 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2811 1.3066 1.1032 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6473 0.0302 1.6030 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8673 -0.5823 0.5732 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5552 -0.9436 0.7333 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0141 -0.7306 1.8699 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2827 -1.5451 -0.2770 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7088 -0.7679 -1.3331 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5150 -1.2635 -2.3327 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9040 -2.6109 -2.2522 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7123 -3.1022 -3.2558 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4591 -4.2463 -3.0530 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6433 -4.2771 -2.3536 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2403 -3.0820 -1.7429 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4949 -2.1122 -1.4786 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5978 -3.0145 -1.4602 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1717 -1.8725 -0.8775 C 0 0 2 0 0 0 0 0 0 0 0 0 8.6583 -2.1644 -0.6397 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7323 -3.0658 0.5679 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8486 -4.1414 0.3347 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2357 -0.9059 -0.2695 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2717 -0.3414 -0.9626 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7210 -0.9648 -1.9519 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8350 0.9383 -0.5673 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3701 1.6634 0.5069 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9578 2.8758 0.8251 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5333 3.6526 1.8954 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0148 3.3812 0.0786 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4782 2.6554 -0.9946 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8892 1.4479 -1.3081 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5352 3.1422 -1.7515 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5895 4.6020 0.4183 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2893 -5.4979 -2.2295 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7940 -6.6632 -2.7739 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4917 -7.8534 -2.6141 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6116 -6.6460 -3.4751 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9730 -5.4253 -3.5949 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7760 -5.3986 -4.3024 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0730 -7.8082 -4.0441 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4892 -3.3980 -1.2089 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8824 -4.7157 -1.1504 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6710 -2.8566 -0.2137 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9252 -0.4585 -3.3751 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4835 -0.8030 2.2708 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6406 -1.1870 1.6838 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1272 -0.2200 0.5768 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7538 1.1782 1.0990 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4044 2.1677 0.3232 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4409 2.9572 0.7465 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8670 2.8179 1.8922 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0305 3.9446 -0.1523 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1401 4.6690 0.2273 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6661 5.6117 -0.6703 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7975 6.3213 -0.2331 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1337 5.8483 -1.9000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0047 5.1173 -2.2911 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4893 4.1898 -1.4078 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4766 5.3747 -3.5447 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6736 6.7936 -2.7881 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4886 -0.3487 0.4450 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2160 -0.3544 -0.7015 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7554 -0.2608 -1.8156 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6964 -0.4688 -0.5799 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2402 0.8304 -0.6363 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5701 1.0189 -0.3823 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1173 2.3182 -0.4387 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3440 -0.0665 -0.0771 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7932 -1.3118 -0.0333 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4198 -1.5511 -0.2964 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0564 -2.9559 -0.3280 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1333 -3.6064 0.3685 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0209 -3.1572 1.2001 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1937 -3.0427 2.3801 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8392 -2.9157 0.5621 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6163 -2.5316 1.0479 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0343 -5.0328 0.2814 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8564 -5.7632 -0.5050 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8039 -5.0983 -1.2321 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8975 -3.7427 -1.1454 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8548 -3.0358 -1.8929 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6926 -5.8011 -2.0761 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7786 -7.1543 -0.6037 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5538 -2.4376 0.2863 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.6836 0.0973 0.1870 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7155 4.7503 0.3522 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0732 -1.8814 1.8740 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0329 -1.6877 3.7096 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7534 -3.1064 2.9436 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4378 -2.8675 2.2921 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1306 -2.3966 0.8917 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6659 2.5689 -0.4562 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1887 4.5129 -2.0517 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0316 0.8784 2.3463 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5561 5.2914 2.2145 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8250 4.7952 4.2826 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3695 7.0582 4.9519 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4513 7.8171 4.2750 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9556 1.4208 0.0249 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8741 0.3679 2.3669 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4070 0.2807 -1.3964 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1381 -1.0249 -1.5942 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1447 -2.5918 -1.5265 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7198 -3.5076 0.7293 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1150 -4.5382 -0.5184 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5601 1.2857 1.0866 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9546 3.6446 2.8095 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2938 0.9253 -2.1595 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4541 3.0987 -1.3389 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3106 4.6089 1.1529 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2316 -5.4901 -1.6696 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5034 -7.8837 -2.6383 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7202 -5.1906 -5.2791 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7369 -8.5468 -4.3064 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2497 -5.4878 -1.0522 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3811 -3.5304 0.5779 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6985 0.1864 -3.1774 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4596 -1.1065 2.4573 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5595 -0.3878 -0.3384 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2020 1.2053 2.1136 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5883 4.5085 1.1986 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3628 6.8115 -0.9148 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6044 3.6187 -1.6996 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5868 5.8364 -3.6873 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2586 7.5235 -2.4407 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5630 1.6554 -0.9080 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0895 2.5121 -0.5581 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9139 -2.4675 0.1843 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2323 -3.2801 1.7950 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2638 -5.5049 0.9085 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5189 -2.3715 -2.5621 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4205 -5.9131 -3.0369 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9840 -7.7347 0.2137 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5824 -2.8170 1.2324 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3389 0.6053 -0.4086 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0277 4.5446 -0.3909 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 1 0 10 11 2 0 11 12 1 0 11 13 1 0 13 14 2 0 14 15 1 0 14 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 2 0 22 23 1 0 21 24 1 0 20 25 1 0 18 26 1 0 26 27 2 0 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 2 0 32 34 1 0 34 35 2 0 35 36 1 0 36 37 2 0 37 38 1 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 2 0 41 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 45 48 1 0 48 49 1 0 49 50 2 0 49 51 1 0 51 52 2 0 52 53 1 0 53 54 1 0 53 55 2 0 55 56 1 0 56 57 2 0 56 58 1 0 55 59 1 0 40 60 1 0 60 61 2 0 61 62 1 0 61 63 1 0 63 64 2 0 64 65 1 0 63 66 1 0 37 67 1 0 67 68 1 0 67 69 2 0 36 70 1 0 30 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 76 77 2 0 76 78 1 0 78 79 2 0 79 80 1 0 80 81 1 0 80 82 2 0 82 83 1 0 83 84 2 0 83 85 1 0 82 86 1 0 73 87 1 0 87 88 1 0 88 89 2 0 88 90 1 0 90 91 2 0 91 92 1 0 92 93 1 0 92 94 2 0 94 95 1 0 95 96 2 0 96 97 1 0 97 98 2 0 98 99 1 0 99100 2 0 99101 1 0 101102 1 0 98103 1 0 103104 2 0 104105 1 0 105106 2 0 106107 1 0 105108 1 0 104109 1 0 95110 1 0 94111 1 0 13112 1 0 46 3 1 0 57 51 1 0 102 72 1 0 44 5 1 0 84 78 1 0 96 90 1 0 106 97 1 0 15 9 2 0 22 17 1 0 74 29 1 0 69 34 1 0 64 39 1 0 1113 1 0 2114 1 0 2115 1 0 3116 1 1 5117 1 1 10118 1 0 12119 1 0 15120 1 0 19121 1 0 23122 1 0 24123 1 0 25124 1 0 29125 1 6 30126 1 1 35127 1 0 44128 1 6 45129 1 6 46130 1 1 47131 1 0 52132 1 0 54133 1 0 57134 1 0 58135 1 0 59136 1 0 60137 1 0 62138 1 0 65139 1 0 66140 1 0 68141 1 0 69142 1 0 70143 1 0 72144 1 1 73145 1 6 74146 1 1 79147 1 0 81148 1 0 84149 1 0 85150 1 0 86151 1 0 91152 1 0 93153 1 0 102154 1 0 102155 1 0 103156 1 0 107157 1 0 108158 1 0 109159 1 0 110160 1 0 111161 1 0 112162 1 0 M END

Standard InCHIKey	PFUDAMHTVMSQNA-WXZXAZFGSA-N
Standard InCHI	InChI=1S/C68H50O44/c69-13-35-46(88)55(107-59(93)15-1-23(70)39(81)24(71)2-15)57-67(103-35)112-62(96)18-5-27(74)41(83)34(8-18)102-51-21(11-30(77)44(86)49(51)91)65(99)110-58-56(108-60(94)16-3-25(72)40(82)26(73)4-16)54-36(14-101-63(97)19-9-28(75)42(84)47(89)37(19)38-20(64(98)106-54)10-29(76)43(85)48(38)90)104-68(58)111-61(95)17-6-32(79)53(33(80)7-17)105-52-22(66(100)109-57)12-31(78)45(87)50(52)92/h1-12,35-36,46,54-58,67-92H,13-14H2/t35-,36-,46-,54-,55+,56+,57-,58-,67+,68+/m1/s1
SMILES	OC[C@H]1O[C@H]2OC(=O)c3cc(O)c(c(c3)Oc3c(cc(c(c3O)O)O)C(=O)O[C@H]3[C@H](OC(=O)c4cc(c(Oc5c(C(=O)O[C@@H]2[C@H]([C@@H]1O)OC(=O)c1cc(O)c(c(c1)O)O)cc(O)c(c5O)O)c(O)c4)O)O[C@H]1[C@H]([C@@H]3OC(=O)c2cc(O)c(c(c2)O)O)OC(=O)c2cc(O)c(c(c2c2c(C(=O)OC1)cc(c(c2O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1570.17	Volume:	1384.409 ? Van der Waals volume.
Dense:	1.134	LogP:	-2.383 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	-3.06 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.185 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	92.0
TPSA:	732.84 ? Topological Polar Surface Area.	H-Bond Acceptor:	44.0
H-Bond Donor:	24.0	Rings:	13.0
Heavy Atoms:	44.0

MedChem Properties

QED Drug-Likeness Score:	0.067	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.824	Fsp³:	0.176
MCE-18:	294.75 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	1	PAINS Alert:	1
Colloidal aggregators:	1.0	Fluc inhibitor:	0.119 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.497 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.667 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.605	Promiscuous compounds:	0.962

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-8.894	MDCK Permeability:	-4.621
Pgp-inhibitor:	0.0	Pgp-substrate:	0.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.248	30% Bioavailability (F30%):	0.887
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	71.527%	Volume Distribution (VD):	0.021
Fu:	11.268% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.815
OATP1B3 inhibitor:	0.806	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.015
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

3.329

Half-life (T1/2):

9.106

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.974
Human Hepatotoxicity (H-HT):	0.363	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	1.0	Rat Oral Acute Toxicity:	0.012
Maximum Recommended Daily Dose:	0.666	Skin Sensitization:	1.0
Carcinogencity:	0.117	Eye Corrosion:	0.0
Eye Irritation:	0.06	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.0	Drug-induced Nephrotoxicity:	0.237
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.0
A549 Cytotoxicity:	1.0	Hek293 Cytotoxicity:	0.384
BCF:	-0.811 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	2.929 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	3.672 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.032 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20417	Tamarix nilotica	Species	Tamaricaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20405847]
NPO20417	Tamarix nilotica	Species	Tamaricaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23675651]
NPO20417	Tamarix nilotica	Species	Tamaricaceae	Eukaryota	Leaves	n.a.	n.a.	PMID[26938659]
NPO20417	Tamarix nilotica	Species	Tamaricaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20417	Tamarix nilotica	Species	Tamaricaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO20417	Tamarix nilotica	Species	Tamaricaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
CC50	4

Activity Type	# Activity
Cell line	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	CC50	=	62000.0	nM	PubChem BioAssay data set
NPT2394	Cell line	HSC-4	Homo sapiens	CC50	=	26600.0	nM	PubChem BioAssay data set
NPT2385	Cell line	HSC-3	Homo sapiens	CC50	=	20800.0	nM	PMID[19651905]
NPT924	Cell line	HSC-2	Homo sapiens	CC50	=	20200.0	nM	DrugMatrix in vitro pharmacology data

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC31208 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27064
0.1-0.2	22244
0.2-0.3	420
0.3-0.4	62
0.4-0.5	33
0.5-0.6	8
0.6-0.7	11
0.7-0.8	0
0.8-0.85	1
0.85-0.9	3
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC160543
0.8947	High Similarity	NPC93065
0.8571	High Similarity	NPC194439
0.8571	High Similarity	NPC33724
0.8211	Intermediate Similarity	NPC488884
0.7822	Intermediate Similarity	NPC220876
0.7717	Intermediate Similarity	NPC223534
0.7692	Intermediate Similarity	NPC112211
0.7692	Intermediate Similarity	NPC254925
0.7579	Intermediate Similarity	NPC187632
0.7579	Intermediate Similarity	NPC240200
0.7579	Intermediate Similarity	NPC488885
0.7391	Intermediate Similarity	NPC40078
0.7228	Intermediate Similarity	NPC488887
0.7228	Intermediate Similarity	NPC488886
0.7083	Intermediate Similarity	NPC290289
0.6979	Remote Similarity	NPC483712
0.6979	Remote Similarity	NPC158214
0.6979	Remote Similarity	NPC214202
0.6952	Remote Similarity	NPC469652
0.6952	Remote Similarity	NPC486025
0.6952	Remote Similarity	NPC486024
0.6804	Remote Similarity	NPC97924
0.6273	Remote Similarity	NPC260521
0.6228	Remote Similarity	NPC174140
0.6168	Remote Similarity	NPC471091
0.6055	Remote Similarity	NPC469649
0.5824	Remote Similarity	NPC43918
0.5824	Remote Similarity	NPC261411
0.5824	Remote Similarity	NPC190204
0.5761	Remote Similarity	NPC469651
0.5714	Remote Similarity	NPC47521
0.5545	Remote Similarity	NPC116108
0.5481	Remote Similarity	NPC269625
0.5312	Remote Similarity	NPC311389

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC31208 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6856
0.1-0.2	2291
0.2-0.3	3
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data