NPASS Compound

Natural Product: NPC160543

Natural Product ID	NPC160543
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	WYLNVJZLDIPDSS-WXZXAZFGSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2375776
PubChem CID	73347288
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000238] Tannins [CHEMONTID:0001710] Hydrolyzable tannins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 162173 0 0 0 0 0 0 0 0999 V2000 11.4075 -2.0497 -2.9437 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4255 -0.8160 -2.2780 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0433 -0.2856 -2.2206 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1430 -1.1696 -1.5436 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9355 -0.6441 -1.6063 C 0 0 1 0 0 0 0 0 0 0 0 0 6.7355 -1.2158 -1.6591 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0050 -2.3347 -1.4524 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6692 -3.3507 -1.0852 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5490 -2.3216 -1.6438 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7532 -3.4139 -1.6571 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3850 -3.2986 -1.7435 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5426 -4.3849 -1.7622 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7840 -2.0225 -1.8320 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6252 -0.9326 -1.8144 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9669 -1.0785 -1.7258 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0768 0.3326 -1.8892 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4342 -1.7828 -1.9290 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1412 -0.5921 -2.4081 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9781 0.1253 -1.6018 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5340 1.3061 -2.1513 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2595 1.7411 -3.4080 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4375 1.0479 -4.2058 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1214 -0.1285 -3.6761 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0025 -0.8815 -4.4940 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1047 1.3916 -5.4805 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8923 2.9418 -3.8332 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3532 -0.1447 -0.2473 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4026 -0.7502 0.4798 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3591 0.0376 0.4669 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4365 0.2291 1.2433 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3098 1.8068 1.4764 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1068 2.0296 1.8168 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0988 2.5416 2.4357 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3529 3.4299 3.3448 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3161 2.1983 2.2006 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1326 2.8901 1.3699 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4433 2.4387 1.0818 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2783 3.0874 0.2792 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7026 3.0384 -1.0223 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9729 2.7635 -1.4369 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0761 2.3543 -0.5184 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4383 2.8616 0.5153 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7663 1.2423 -0.9369 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8141 0.5065 -0.4956 C 0 0 2 0 0 0 0 0 0 0 0 0 9.1665 1.1007 -0.3881 C 0 0 2 0 0 0 0 0 0 0 0 0 9.9245 1.0812 -1.6928 C 0 0 2 0 0 0 0 0 0 0 0 0 9.4483 2.0494 -2.6014 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0313 0.4552 0.5824 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3328 0.9828 1.7893 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8328 2.0471 2.1459 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2726 0.2576 2.6699 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4925 0.6131 3.9818 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5005 -0.0367 4.7166 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6856 0.3713 6.0608 O 0 0 0 0 0 0 0 0 0 0 0 0 13.2791 -1.0441 4.1850 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0255 -1.3700 2.8638 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0534 -0.7510 2.1065 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8307 -2.3852 2.3699 O 0 0 0 0 0 0 0 0 0 0 0 0 14.2651 -1.7054 4.9177 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2792 2.7807 -2.8080 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3650 3.0383 -3.7873 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7109 3.0441 -5.1417 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0903 3.3067 -3.3955 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8001 3.3000 -2.0418 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4428 3.5888 -1.6858 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0808 3.5984 -4.3158 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8606 1.2566 1.6828 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1434 0.7622 1.4266 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0216 0.5626 2.5343 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7599 1.0244 2.7981 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5208 -0.6070 3.0869 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4041 2.2458 2.1922 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3986 2.3460 1.2411 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7490 0.9712 0.7681 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7309 -0.0200 0.5387 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3330 -1.2054 1.1007 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1647 -2.4923 0.8396 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3127 -2.8191 0.0329 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0092 -3.5478 1.5188 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2395 -3.1443 2.0298 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0068 -4.0955 2.7209 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2446 -3.7117 3.2350 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5813 -5.3598 2.8858 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3325 -5.8020 2.3622 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6041 -4.8036 1.6826 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9634 -7.0872 2.5744 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3580 -6.3340 3.5890 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8911 0.9142 0.0232 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6796 1.7368 -0.6826 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5617 2.9050 -0.9045 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8716 0.9972 -1.2821 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6400 0.8513 -2.6110 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2931 -0.1065 -3.4058 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0450 -0.2277 -4.7656 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1676 -0.8792 -2.7293 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3923 -0.7358 -1.4129 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7475 0.2642 -0.5842 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2992 0.3957 0.7467 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7045 0.5477 1.9626 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4354 1.1439 2.3143 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8197 0.5240 3.3830 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7132 2.1095 1.9096 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6884 2.9171 1.8408 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5094 0.3528 3.1168 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8112 0.0475 3.1236 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4531 -0.0951 1.9338 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6762 0.0920 0.7941 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3270 0.0061 -0.4607 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.7746 -0.4025 1.8428 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.5168 -0.1453 4.3559 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2478 -1.5915 -0.7292 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8859 -1.8868 -3.3987 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6694 -1.9150 -3.8847 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0596 -0.1488 -2.9052 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9248 -1.0092 -1.2869 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6589 -0.3134 -3.2892 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9578 0.0687 -2.5523 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1420 -4.4356 -1.5901 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5513 -5.0835 -1.0171 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5935 -0.1871 -1.6957 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7265 0.7056 -1.0285 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2091 1.8841 -1.5005 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4741 -0.3669 -5.2671 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0927 2.4181 -5.6822 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5436 3.4459 -3.2521 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4130 -0.1495 2.2796 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5852 2.1217 0.3659 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8676 3.8227 0.8791 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5715 -0.0548 0.4092 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0222 2.1394 -0.0169 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9756 1.4315 -1.4808 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6738 2.4859 -2.1024 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9388 1.4127 4.4190 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1461 -0.2550 6.7492 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9081 -1.0949 1.1014 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4566 -2.9672 1.5811 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1342 -1.2540 5.0744 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3407 2.5858 -3.0293 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3266 2.2446 -5.7123 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7379 3.5518 -2.4431 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2445 4.5145 -4.8051 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3519 -0.2462 1.4027 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1261 0.4472 3.4521 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8949 -1.0889 3.7471 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0562 2.9254 0.3954 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1838 0.5448 1.8345 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3900 -0.3595 -0.4588 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5997 -2.1413 1.9106 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0731 -4.1310 2.7776 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6543 -5.1504 1.2696 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8365 -7.4153 3.5761 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0749 -6.0486 4.2469 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9290 1.5146 -3.1248 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0197 0.5765 -5.4167 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9141 3.9257 1.3818 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4422 3.2367 2.9562 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9497 0.4796 4.0705 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2876 0.2474 -0.5628 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3780 -0.6156 2.6061 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4339 -1.0660 4.8354 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4817 -2.5171 -1.0491 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3382 -2.5790 -3.9289 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 11 13 2 0 13 14 1 0 14 15 2 0 14 16 1 0 13 17 1 0 17 18 1 0 18 19 2 0 19 20 1 0 20 21 2 0 21 22 1 0 22 23 2 0 23 24 1 0 22 25 1 0 21 26 1 0 19 27 1 0 27 28 2 0 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 2 0 33 35 1 0 35 36 1 0 36 37 2 0 37 38 1 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 2 0 41 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 45 48 1 0 48 49 1 0 49 50 2 0 49 51 1 0 51 52 2 0 52 53 1 0 53 54 1 0 53 55 2 0 55 56 1 0 56 57 2 0 56 58 1 0 55 59 1 0 40 60 1 0 60 61 2 0 61 62 1 0 61 63 1 0 63 64 2 0 64 65 1 0 63 66 1 0 37 67 1 0 67 68 1 0 67 69 2 0 69 70 1 0 69 71 1 0 31 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 77 78 2 0 77 79 1 0 79 80 2 0 80 81 1 0 81 82 1 0 81 83 2 0 83 84 1 0 84 85 2 0 84 86 1 0 83 87 1 0 74 88 1 0 88 89 1 0 89 90 2 0 89 91 1 0 91 92 2 0 92 93 1 0 93 94 1 0 93 95 2 0 95 96 1 0 96 97 2 0 97 98 1 0 98 99 2 0 99100 1 0 100101 2 0 100102 1 0 102103 1 0 99104 1 0 104105 2 0 105106 1 0 106107 2 0 107108 1 0 106109 1 0 105110 1 0 96111 1 0 95112 1 0 46 3 1 0 57 51 1 0 103 73 1 0 44 5 1 0 85 79 1 0 97 91 1 0 107 98 1 0 15 9 1 0 23 18 1 0 75 30 1 0 70 35 2 0 64 39 1 0 1113 1 0 2114 1 0 2115 1 0 3116 1 6 5117 1 6 10118 1 0 12119 1 0 15120 1 0 16121 1 0 20122 1 0 24123 1 0 25124 1 0 26125 1 0 30126 1 1 31127 1 6 36128 1 0 44129 1 1 45130 1 1 46131 1 1 47132 1 0 52133 1 0 54134 1 0 57135 1 0 58136 1 0 59137 1 0 60138 1 0 62139 1 0 65140 1 0 66141 1 0 68142 1 0 70143 1 0 71144 1 0 73145 1 6 74146 1 1 75147 1 6 80148 1 0 82149 1 0 85150 1 0 86151 1 0 87152 1 0 92153 1 0 94154 1 0 103155 1 0 103156 1 0 104157 1 0 108158 1 0 109159 1 0 110160 1 0 111161 1 0 112162 1 0 M END

Standard InCHIKey	WYLNVJZLDIPDSS-WXZXAZFGSA-N
Standard InCHI	InChI=1S/C68H50O44/c69-13-35-46(88)55(107-59(93)15-1-23(70)39(81)24(71)2-15)57-67(103-35)111-61(95)17-6-32(79)53(33(80)7-17)105-52-22(12-31(78)45(87)50(52)92)66(100)110-58-56(108-60(94)16-3-25(72)40(82)26(73)4-16)54-36(14-101-63(97)19-9-28(75)42(84)47(89)37(19)38-20(64(98)106-54)10-29(76)43(85)48(38)90)104-68(58)112-62(96)18-5-27(74)41(83)34(8-18)102-51-21(65(99)109-57)11-30(77)44(86)49(51)91/h1-12,35-36,46,54-58,67-92H,13-14H2/t35-,36-,46-,54-,55+,56+,57-,58-,67+,68+/m1/s1
SMILES	OC[C@H]1O[C@H]2OC(=O)c3cc(O)c(c(c3)O)Oc3c(cc(c(c3O)O)O)C(=O)O[C@H]3[C@H](OC(=O)c4cc(Oc5c(C(=O)O[C@@H]2[C@H]([C@@H]1O)OC(=O)c1cc(O)c(c(c1)O)O)cc(O)c(c5O)O)c(O)c(c4)O)O[C@H]1[C@H]([C@@H]3OC(=O)c2cc(O)c(c(c2)O)O)OC(=O)c2cc(O)c(c(c2c2c(C(=O)OC1)cc(c(c2O)O)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20417	Tamarix nilotica	Species	Tamaricaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20405847]
NPO20417	Tamarix nilotica	Species	Tamaricaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23675651]
NPO20417	Tamarix nilotica	Species	Tamaricaceae	Eukaryota	Leaves	n.a.	n.a.	PMID[26938659]
NPO20417	Tamarix nilotica	Species	Tamaricaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20417	Tamarix nilotica	Species	Tamaricaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO20417	Tamarix nilotica	Species	Tamaricaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
CC50	4

Activity Type	# Activity
Cell line	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	CC50	=	70800.0	nM	PMID[1479381]
NPT2394	Cell line	HSC-4	Homo sapiens	CC50	=	24500.0	nM	PMID[1479381]
NPT2385	Cell line	HSC-3	Homo sapiens	CC50	=	21900.0	nM	PMID[25456077]
NPT924	Cell line	HSC-2	Homo sapiens	CC50	=	18500.0	nM	PMID[24941130]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC160543 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27064
0.1-0.2	22244
0.2-0.3	420
0.3-0.4	62
0.4-0.5	33
0.5-0.6	8
0.6-0.7	11
0.7-0.8	0
0.8-0.85	1
0.85-0.9	3
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC31208
0.8947	High Similarity	NPC93065
0.8571	High Similarity	NPC194439
0.8571	High Similarity	NPC33724
0.8211	Intermediate Similarity	NPC488884
0.7822	Intermediate Similarity	NPC220876
0.7717	Intermediate Similarity	NPC223534
0.7692	Intermediate Similarity	NPC112211
0.7692	Intermediate Similarity	NPC254925
0.7579	Intermediate Similarity	NPC187632
0.7579	Intermediate Similarity	NPC240200
0.7579	Intermediate Similarity	NPC488885
0.7391	Intermediate Similarity	NPC40078
0.7228	Intermediate Similarity	NPC488887
0.7228	Intermediate Similarity	NPC488886
0.7083	Intermediate Similarity	NPC290289
0.6979	Remote Similarity	NPC483712
0.6979	Remote Similarity	NPC158214
0.6979	Remote Similarity	NPC214202
0.6952	Remote Similarity	NPC469652
0.6952	Remote Similarity	NPC486025
0.6952	Remote Similarity	NPC486024
0.6804	Remote Similarity	NPC97924
0.6273	Remote Similarity	NPC260521
0.6228	Remote Similarity	NPC174140
0.6168	Remote Similarity	NPC471091
0.6055	Remote Similarity	NPC469649
0.5824	Remote Similarity	NPC43918
0.5824	Remote Similarity	NPC261411
0.5824	Remote Similarity	NPC190204
0.5761	Remote Similarity	NPC469651
0.5714	Remote Similarity	NPC47521
0.5545	Remote Similarity	NPC116108
0.5481	Remote Similarity	NPC269625
0.5312	Remote Similarity	NPC311389

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC160543 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6856
0.1-0.2	2291
0.2-0.3	3
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data