NPASS Compound

Natural Product: NPC97924

Natural Product ID	NPC97924
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	FFZOOOCGCNFHAQ-GWOIDVGPSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL508647
PubChem CID	16130897
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000238] Tannins [CHEMONTID:0001710] Hydrolyzable tannins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 188203 0 0 0 0 0 0 0 0999 V2000 12.3346 1.5194 4.9901 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6610 2.0557 3.9154 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1942 3.2080 3.3813 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3494 3.7630 3.9262 C 0 0 0 0 0 0 0 0 0 0 0 0 14.0059 3.2084 5.0053 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4734 2.0520 5.5459 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1229 1.4960 6.6288 O 0 0 0 0 0 0 0 0 0 0 0 0 15.1598 3.7892 5.5242 O 0 0 0 0 0 0 0 0 0 0 0 0 13.8833 4.9210 3.3760 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4719 1.3864 3.4018 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1736 0.2738 3.9293 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6232 1.8228 2.4158 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5026 1.1063 1.9644 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5072 0.8184 0.5851 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9464 0.5404 0.1234 C 0 0 2 0 0 0 0 0 0 0 0 0 6.4043 -0.2384 1.1890 C 0 0 1 0 0 0 0 0 0 0 0 0 6.3011 0.6517 2.4276 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2691 -0.2977 3.6267 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0829 -1.5320 3.2922 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9281 -2.7619 2.9455 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8614 -3.3389 2.3576 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6868 -3.5606 3.2104 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8115 -4.1969 4.4592 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8074 -4.8776 5.0881 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6116 -4.9219 4.4402 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4865 -4.3130 3.2327 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5429 -3.6000 2.5543 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1228 -3.1527 1.2249 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9993 -1.9046 0.7353 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2236 -1.7033 -0.3811 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5819 -2.7069 -1.0702 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7148 -3.9885 -0.6074 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4609 -4.2047 0.5077 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6437 -5.4835 1.0283 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1035 -5.0360 -1.2631 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8133 -2.4485 -2.2113 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9648 -0.3940 -0.9278 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6066 -0.0447 -0.6474 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3110 0.1119 -1.7014 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6193 0.4190 -1.4526 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0072 0.5885 -0.1417 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1513 0.4561 0.9098 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1938 0.1255 0.6304 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9891 -0.0084 1.7365 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5388 0.6317 2.2274 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6858 0.3935 -2.5030 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4839 0.1667 -3.6987 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9269 0.6139 -2.0772 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2172 0.5933 -2.7328 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0592 -0.3262 -1.9897 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5062 0.2128 -1.7678 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3791 1.5018 -1.1455 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7378 2.3751 -2.3076 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8616 3.8232 -1.9780 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3886 3.8904 -0.6773 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6879 4.9701 0.0730 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5064 6.1162 -0.3935 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2219 4.8475 1.4526 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2927 5.2801 2.4073 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5321 5.2536 3.7608 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7631 4.7691 4.1363 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6761 4.3467 3.2211 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4066 4.3851 1.8511 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5540 3.9525 1.0472 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6712 2.8979 0.2219 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.9257 2.6628 -0.3959 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.0122 3.4594 -0.1881 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.8870 4.5319 0.6512 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6834 4.7669 1.2517 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.4903 5.8455 2.1205 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.9619 5.3937 0.9067 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.2582 3.2454 -0.7893 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6459 1.9276 -0.1633 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9065 0.6924 0.0096 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4569 2.2077 -0.6916 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9017 3.8671 3.6286 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0103 4.7389 5.5304 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6366 5.6705 4.7189 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5909 1.9051 -2.7667 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2580 -0.8553 -1.3484 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8356 -1.7412 -0.3865 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8291 -1.6483 0.2280 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6977 -2.9310 -0.0867 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5421 -2.6475 0.9606 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5458 -3.5048 1.2567 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6931 -4.6327 0.5021 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8325 -4.8909 -0.5347 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7629 -4.0386 -0.8781 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8239 -4.4924 -1.8850 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2391 -3.7904 -2.8844 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4669 -4.3545 -3.8740 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2246 -5.7000 -3.9092 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7780 -6.4470 -2.9239 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5455 -5.8758 -1.9430 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0760 -6.6519 -0.9264 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5497 -7.8228 -2.9199 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4410 -6.2640 -4.9247 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1432 -2.2932 -2.9485 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9069 -1.7489 -3.6969 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2211 -1.6722 -2.1473 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0049 -6.0326 -1.3189 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.7184 -5.5016 0.8063 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3934 -3.2072 2.3275 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9549 -0.7790 0.9753 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6331 0.3851 1.1303 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3093 -1.0466 1.0180 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2655 -4.3219 2.5260 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4991 -5.5720 4.9674 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0313 -5.4752 6.3105 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3011 1.6029 2.4693 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3157 0.1087 -1.1461 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8010 0.5992 -2.2406 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8003 1.4326 -2.1016 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1501 0.4156 -3.6640 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1429 -0.1903 -4.3628 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1226 -0.2177 -5.7364 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1446 0.3907 -6.4101 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1474 0.9957 -5.6970 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2121 1.0324 -4.2781 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4222 1.5804 -3.6958 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6263 2.3466 -2.6096 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8010 2.9894 -2.2895 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9040 2.8740 -3.0869 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7883 2.0969 -4.1921 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6078 1.4673 -4.4969 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5195 0.6487 -5.6148 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8793 1.9126 -5.0577 O 0 0 0 0 0 0 0 0 0 0 0 0 13.0954 3.5356 -2.7607 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7985 2.3122 -1.3367 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9839 3.1262 -1.1425 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1072 1.2464 -0.5096 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1351 1.6257 -6.4081 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2079 0.4141 -7.8092 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1290 -0.8234 -6.4485 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9520 0.6086 5.4538 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7375 3.6811 2.5442 H 0 0 0 0 0 0 0 0 0 0 0 0 14.5269 2.0333 7.3914 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0836 3.6379 5.2159 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0811 4.9847 2.3770 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5760 0.1194 2.6211 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7710 -0.3728 0.5567 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5471 1.5816 0.1843 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2365 -0.9640 1.5312 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3439 1.2092 2.4581 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2420 -0.0652 4.1946 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4994 0.1037 4.3798 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8332 -4.0964 4.8682 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0216 -6.1946 0.7221 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1036 -5.1615 -2.2538 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1113 -2.8554 -2.2595 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0196 0.0150 -2.6993 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0364 0.8315 0.0517 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9122 0.6147 2.5334 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1646 1.3768 2.5236 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0408 0.2733 -3.7635 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6023 -0.2181 -0.8744 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8264 0.3692 -2.8567 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5680 1.5267 -0.3799 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5168 2.1978 -3.1156 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4594 4.3367 -2.7246 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8156 4.2259 -2.0093 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3307 5.6767 2.0260 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0265 1.8008 -1.0632 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7024 6.4885 1.9916 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.5036 5.8062 0.1596 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.0863 3.7673 -0.5099 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4453 3.1907 3.1396 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8244 5.2363 5.9184 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4447 6.6882 4.7704 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3241 -1.7081 1.5186 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0396 -3.6985 -4.6576 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4590 -7.1842 -0.3592 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8718 -8.3687 -3.7167 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7801 -6.5031 -5.8383 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9380 -6.4010 -1.5441 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5383 -6.3358 1.3419 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2251 -3.5797 3.2529 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5756 -4.9917 2.7481 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9440 -6.1425 4.3223 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6313 -6.3110 6.2911 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3056 -0.6610 -3.7982 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7966 3.6059 -1.3684 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2913 0.0210 -5.8209 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8042 2.0967 -4.6802 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0183 4.4852 -2.3585 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8429 2.1926 -7.1999 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2622 -0.4623 -8.3298 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3475 -1.6839 -6.9814 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 2 0 6 7 1 0 5 8 1 0 4 9 1 0 2 10 1 0 10 11 2 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 20 22 1 0 22 23 2 0 23 24 1 0 24 25 2 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 2 0 31 32 1 0 32 33 2 0 33 34 1 0 32 35 1 0 31 36 1 0 30 37 1 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 2 0 41 42 1 0 42 43 2 0 43 44 1 0 42 45 1 0 40 46 1 0 46 47 2 0 46 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 2 0 56 58 1 0 58 59 2 0 59 60 1 0 60 61 2 0 61 62 1 0 62 63 2 0 63 64 1 0 64 65 2 0 65 66 1 0 66 67 2 0 67 68 1 0 68 69 2 0 69 70 1 0 68 71 1 0 67 72 1 0 65 73 1 0 73 74 2 0 73 75 1 0 62 76 1 0 61 77 1 0 60 78 1 0 53 79 1 0 51 80 1 0 80 81 1 0 81 82 2 0 81 83 1 0 83 84 2 0 84 85 1 0 85 86 2 0 86 87 1 0 87 88 2 0 88 89 1 0 89 90 2 0 90 91 1 0 91 92 2 0 92 93 1 0 93 94 2 0 94 95 1 0 93 96 1 0 92 97 1 0 90 98 1 0 98 99 2 0 98100 1 0 87101 1 0 86102 1 0 85103 1 0 29104 1 0 104105 2 0 104106 1 0 26107 1 0 25108 1 0 24109 1 0 17110 1 0 15111 1 0 111112 1 0 112113 2 0 112114 1 0 114115 2 0 115116 1 0 116117 2 0 117118 1 0 118119 2 0 119120 1 0 120121 2 0 121122 1 0 122123 2 0 123124 1 0 124125 2 0 125126 1 0 124127 1 0 123128 1 0 121129 1 0 129130 2 0 129131 1 0 118132 1 0 117133 1 0 116134 1 0 6 1 1 0 110 13 1 0 119114 1 0 125120 1 0 131 14 1 0 106 16 1 0 27 22 1 0 33 28 1 0 43 38 1 0 79 49 1 0 88 83 1 0 94 89 1 0 100 50 1 0 75 52 1 0 63 58 1 0 69 64 1 0 1135 1 0 3136 1 0 7137 1 0 8138 1 0 9139 1 0 13140 1 1 14141 1 1 15142 1 6 16143 1 1 17144 1 6 18145 1 0 18146 1 0 23147 1 0 34148 1 0 35149 1 0 36150 1 0 39151 1 0 41152 1 0 44153 1 0 45154 1 0 49155 1 6 50156 1 1 51157 1 6 52158 1 1 53159 1 6 54160 1 0 54161 1 0 59162 1 0 66163 1 0 70164 1 0 71165 1 0 72166 1 0 76167 1 0 77168 1 0 78169 1 0 84170 1 0 91171 1 0 95172 1 0 96173 1 0 97174 1 0 101175 1 0 102176 1 0 103177 1 0 107178 1 0 108179 1 0 109180 1 0 115181 1 0 122182 1 0 126183 1 0 127184 1 0 128185 1 0 132186 1 0 133187 1 0 134188 1 0 M END

Standard InCHIKey	FFZOOOCGCNFHAQ-GWOIDVGPSA-N
Standard InCHI	InChI=1S/C82H54O52/c83-23-1-14(2-24(84)45(23)93)71(112)133-81-70-68(130-77(118)20-9-30(90)50(98)57(105)39(20)41-22(79(120)132-70)11-32(92)52(100)59(41)107)65-35(126-81)13-123-74(115)17-6-27(87)53(101)60(108)42(17)43-44(80(121)128-65)66(63(111)62(110)61(43)109)124-33-4-15(3-25(85)46(33)94)72(113)134-82-69-67(129-76(117)19-8-29(89)49(97)56(104)38(19)40-21(78(119)131-69)10-31(91)51(99)58(40)106)64-34(125-82)12-122-73(114)16-5-26(86)47(95)54(102)36(16)37-18(75(116)127-64)7-28(88)48(96)55(37)103/h1-11,34-35,64-65,67-70,81-111H,12-13H2/t34-,35-,64-,65-,67+,68+,69-,70-,81-,82+/m1/s1
SMILES	c1c(cc(c(c1O)O)O)C(=O)O[C@@H]1[C@H]2[C@H]([C@H]3[C@@H](COC(=O)c4cc(c(c(c4-c4c(c(c(c(c4O)O)O)Oc4cc(cc(c4O)O)C(=O)O[C@H]4[C@H]5[C@H]([C@H]6[C@@H](COC(=O)c7cc(c(c(c7-c7c(cc(c(c7O)O)O)C(=O)O6)O)O)O)O4)OC(=O)c4cc(c(c(c4-c4c(cc(c(c4O)O)O)C(=O)O5)O)O)O)C(=O)O3)O)O)O)O1)OC(=O)c1cc(c(c(c1-c1c(cc(c(c1O)O)O)C(=O)O2)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1870.16	Volume:	1641.557 ? Van der Waals volume.
Dense:	1.139	LogP:	-1.757 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	-3.621 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.884 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	112.0
TPSA:	877.36 ? Topological Polar Surface Area.	H-Bond Acceptor:	52.0
H-Bond Donor:	29.0	Rings:	16.0
Heavy Atoms:	52.0

MedChem Properties

QED Drug-Likeness Score:	0.064	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.221	Fsp³:	0.146
MCE-18:	380.872 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	1	PAINS Alert:	1
Colloidal aggregators:	1.0	Fluc inhibitor:	0.03 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.058 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.667 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.746	Promiscuous compounds:	0.979

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-9.441	MDCK Permeability:	-4.966
Pgp-inhibitor:	0.0	Pgp-substrate:	0.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.912	30% Bioavailability (F30%):	0.996
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	79.955%	Volume Distribution (VD):	-0.062
Fu:	9.158% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.876
OATP1B3 inhibitor:	0.691	BCRP inhibitor:	0.021
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.032
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.001
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.569

Half-life (T1/2):

11.652

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.998
Human Hepatotoxicity (H-HT):	0.444	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	1.0	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.959	Skin Sensitization:	1.0
Carcinogencity:	0.052	Eye Corrosion:	0.0
Eye Irritation:	0.263	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.0	Drug-induced Nephrotoxicity:	0.489
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.0
A549 Cytotoxicity:	1.0	Hek293 Cytotoxicity:	0.275
BCF:	-1.437 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	2.921 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	3.814 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.126 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO19774	Rubus idaeus	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[ 10835233]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	Fruit	n.a.	n.a.	DOI[10.1016/S0963-9969(99)00095-2]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[21381697]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[37570937]
NPO19700	Aconitum talassicum	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	n.a.	n.a.	n.a.	Database[COCONUT]
NPO26422	Rubus chingii	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO18930	Rubus coreanus	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	Fruits	n.a.		Database[FooDB]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	Fruit	n.a.	n.a.	Database[FooDB]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	Leaf	n.a.	n.a.	Database[FooDB]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	Seed	n.a.	n.a.	Database[FooDB]
NPO19774	Rubus idaeus	Species	n.a.	n.a.		n.a.	n.a.	Database[FooDB]
NPO19700	Aconitum talassicum	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	n.a.	n.a.	n.a.	Database[HerDing]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	n.a.	n.a.		Database[Phenol-Explorer]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	Fruits	n.a.		Database[Phenol-Explorer]
NPO19700	Aconitum talassicum	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	n.a.	n.a.	n.a.	Database[TCMID]
NPO19700	Aconitum talassicum	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO26422	Rubus chingii	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO18930	Rubus coreanus	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO26422	Rubus chingii	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO24812	Jaspis coriacea	Species	Ancorinidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO25161	Peteravenia malvaefolia	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[UNPD]
NPO24873	Anaphalis subumbellata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10415	Paraphaeosphaeria minitans	Species	Didymosphaeriaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO19774	Rubus idaeus	Species	n.a.	n.a.	n.a.	n.a.	n.a.	Database[UNPD]
NPO19700	Aconitum talassicum	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO26422	Rubus chingii	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO18930	Rubus coreanus	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference
NPO19774	Rubus idaeus	n.a.	Fruits	76.1	n.a.	n.a.	mg/100g of FW	Database [Phenol-Explorer]

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1
Activity	5

Activity Type	# Activity
Cell line	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT737	Cell line	HUVEC	Homo sapiens	Inhibition	=	41.5	%	PMID[27237777]
NPT737	Cell line	HUVEC	Homo sapiens	Activity	=	37.6	%	PMID[27237777]
NPT82	Cell line	MDA-MB-231	Homo sapiens	Activity	=	40.7	%	PMID[28835347]
NPT83	Cell line	MCF7	Homo sapiens	Activity	=	33.7	%	PMID[28835347]
NPT82	Cell line	MDA-MB-231	Homo sapiens	Activity	=	63.0	%	PMID[28835347]
NPT83	Cell line	MCF7	Homo sapiens	Activity	=	69.0	%	PMID[28835347]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC97924 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28394
0.1-0.2	21034
0.2-0.3	299
0.3-0.4	61
0.4-0.5	22
0.5-0.6	11
0.6-0.7	7
0.7-0.8	0
0.8-0.85	5
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.878	High Similarity	NPC471091
0.8462	Intermediate Similarity	NPC223534
0.8312	Intermediate Similarity	NPC40078
0.8272	Intermediate Similarity	NPC187632
0.8272	Intermediate Similarity	NPC240200
0.8049	Intermediate Similarity	NPC488885
0.7857	Intermediate Similarity	NPC194439
0.7857	Intermediate Similarity	NPC33724
0.7561	Intermediate Similarity	NPC483712
0.7561	Intermediate Similarity	NPC158214
0.7561	Intermediate Similarity	NPC214202
0.75	Intermediate Similarity	NPC488884
0.747	Intermediate Similarity	NPC290289
0.7416	Intermediate Similarity	NPC488887
0.7416	Intermediate Similarity	NPC488886
0.7283	Intermediate Similarity	NPC469652
0.7283	Intermediate Similarity	NPC486025
0.7283	Intermediate Similarity	NPC486024
0.7222	Intermediate Similarity	NPC47521
0.7128	Intermediate Similarity	NPC93065
0.7128	Intermediate Similarity	NPC220876
0.7123	Intermediate Similarity	NPC43918
0.7123	Intermediate Similarity	NPC261411
0.7123	Intermediate Similarity	NPC190204
0.7027	Intermediate Similarity	NPC469651
0.7021	Intermediate Similarity	NPC260521
0.6905	Remote Similarity	NPC112211
0.6905	Remote Similarity	NPC254925
0.6804	Remote Similarity	NPC31208
0.6804	Remote Similarity	NPC160543
0.66	Remote Similarity	NPC174140
0.6421	Remote Similarity	NPC469649
0.6344	Remote Similarity	NPC116108
0.5957	Remote Similarity	NPC189312
0.5676	Remote Similarity	NPC114791
0.5676	Remote Similarity	NPC104222
0.5676	Remote Similarity	NPC210501
0.5676	Remote Similarity	NPC318826
0.5676	Remote Similarity	NPC141331
0.5542	Remote Similarity	NPC149300
0.5402	Remote Similarity	NPC8940
0.5094	Remote Similarity	NPC201814
0.5059	Remote Similarity	NPC302170
0.5059	Remote Similarity	NPC311389

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC97924 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6511
0.1-0.2	2633
0.2-0.3	6
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data