Drug Information| Drug ID:   | NPD7985 |
| Drug Name:   | "tocofersolan (oral liquid pediatric formulation), Orphan Europe" |
| Molecular Formula:   | C35H58O6 |
| Canonical SMILES:   | OCCOC(=O)CCC(=O)Oc1c(C)c(C)c2c(c1C)CC[C@@](O2)(C)CCC[C@@H](CCC[C@@H](CCCC(C)C)C)C |
| Standard InCHI:   | "InChI=1S/C35H58O6/c1-24(2)12-9-13-25(3)14-10-15-26(4)16-11-20-35(8)21-19-30-29(7)33(27(5)28(6)34(30)41-35)40-32(38)18-17-31(37)39-23-22-36/h24-26,36H,9-23H2,1-8H3/t25-,26-,35-/m1/s1" |
| Standard InCHIKey:   | AOBORMOPSGHCAX-AZAGJHQNSA-N |
| Max Developmental Stage:   | Registered |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7985Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7077 | NPC572741 |
| Remote Similarity | 0.6885 | NPC238075 |
| Remote Similarity | 0.6885 | NPC479916 |
| Remote Similarity | 0.6885 | NPC602914 |
| Remote Similarity | 0.6111 | NPC279118 |
| Remote Similarity | 0.6111 | NPC607481 |
| Remote Similarity | 0.5541 | NPC584998 |
| Remote Similarity | 0.5316 | NPC493133 |
| Remote Similarity | 0.5294 | NPC126759 |
| Remote Similarity | 0.5294 | NPC242580 |
| Remote Similarity | 0.5294 | NPC236070 |
| Remote Similarity | 0.5294 | NPC17425 |
| Remote Similarity | 0.5294 | NPC602820 |
| Remote Similarity | 0.5294 | NPC608398 |
| Remote Similarity | 0.507 | NPC533033 |
| Molecular Weight   | 574.42 |
| ALogP   | 3.2041 |
| MLogP   | 4.65 |
| XLogP   | 10.66 |
| HDA   | 4 |
| HBD   | 1 |
| Rotatable Bonds   | 29 |
| TPSA   | 82.06 |
| RO5 Violation   | 2 |