NPASS Compound

Natural Product: NPC205613

Natural Product ID	NPC205613
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	YNHIXLNNNNXLFF-YENJAGDHSA-N
IUPAC Name	n.a.
Synonyms	epicatechin-(4beta->8)-epicatechin-(4beta->8)-parameritannin A-1
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1213880
PubChem CID	46919853
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000334] Flavonoids [CHEMONTID:0001586] Biflavonoids and polyflavonoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 198216 0 0 0 0 0 0 0 0999 V2000 -4.1601 -7.3793 -2.0065 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2770 -6.2880 -1.1558 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4991 -5.8468 -0.7001 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5832 -4.7535 0.1458 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7914 -4.2931 0.6294 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4241 -4.1183 0.5181 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1756 -4.5544 0.0696 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1161 -5.6335 -0.7631 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0704 -3.8716 0.5064 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9984 -3.2311 1.7772 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3464 -3.2602 2.4605 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4084 -2.9274 1.4038 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0219 -1.6998 0.6685 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7172 -1.1970 0.7362 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7170 -1.8754 1.4666 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3439 -0.0390 0.1118 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9595 0.5064 0.0464 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2006 0.0873 -1.1668 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1168 1.2301 -1.9192 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0333 -0.6790 -0.8006 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7662 0.1078 0.1559 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1523 0.2847 1.3858 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2315 0.4967 1.3132 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8884 0.6727 2.5051 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2649 0.8996 2.5815 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1636 0.6301 3.7039 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1972 0.4186 3.7398 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8786 0.2406 2.5311 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3508 0.1116 2.6361 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9676 1.4456 2.7180 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6996 1.6135 3.9335 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9591 1.7338 1.6400 C 0 0 2 0 0 0 0 0 0 0 0 0 5.8088 0.6022 1.4189 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1905 -0.6072 1.0794 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9807 -0.8194 1.7000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3294 -1.9973 1.4005 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0904 -2.2932 1.9937 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8789 -2.9078 0.5149 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0889 -2.6480 -0.0789 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7894 -1.4922 0.1806 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0765 -1.1369 -0.3778 C 0 0 2 0 0 0 0 0 0 0 0 0 7.4057 -1.5469 -1.7547 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4161 -1.3407 -2.6957 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6225 -0.7489 -2.2215 C 0 0 2 0 0 0 0 0 0 0 0 0 9.4982 -0.3992 -1.1811 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4802 -1.0721 0.0175 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2502 -1.4852 0.5024 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1071 -2.1564 1.6739 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8421 -2.5360 2.0859 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2449 -2.4358 2.4109 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4759 -2.0302 1.9398 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6119 -1.3525 0.7529 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5877 -2.3350 2.7146 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2581 0.4152 -3.0691 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1422 0.3330 -4.4507 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8029 1.4194 -5.2248 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5614 2.6427 -4.6585 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6711 2.7527 -3.2871 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0131 1.6529 -2.5222 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4200 4.0079 -2.7497 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2102 3.7592 -5.4413 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6541 -3.5446 -0.9694 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8530 2.8715 2.0200 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8931 2.6240 2.8847 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7535 3.6550 3.2830 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5457 4.9206 2.7984 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5235 5.1832 1.9437 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6735 4.1416 1.5556 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3538 6.4723 1.4829 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4037 5.9532 3.1947 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8263 0.3915 4.9727 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8697 -1.0338 -1.9536 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6512 -0.1288 -2.6272 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4351 -0.5138 -3.7097 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4649 -1.8191 -4.1568 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6756 -2.7361 -3.4789 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9031 -2.3436 -2.4075 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6942 -4.0474 -3.9159 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2627 -2.1680 -5.2416 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3270 0.6433 -0.6114 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5947 0.1809 -0.6950 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9931 -1.0091 -0.0597 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3067 -1.4347 -0.1854 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4031 -0.5974 -0.5057 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.0081 -1.0167 -1.7621 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3142 -2.3445 -1.9685 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8949 -2.8187 -3.1486 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1837 -1.9425 -4.1620 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8969 -0.6289 -3.9946 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3187 -0.1736 -2.8146 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1798 0.2693 -4.9992 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7666 -2.4018 -5.3541 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8831 0.8351 -0.5287 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7125 0.8412 -1.4402 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3711 2.0671 -2.1358 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8523 1.9548 -3.4451 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6848 0.6849 -3.9831 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5324 3.0957 -4.1396 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7004 4.3490 -3.6046 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2029 4.4896 -2.3336 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5240 3.3448 -1.6317 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0236 3.5116 -0.3560 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7045 4.6821 0.3675 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9576 5.9320 -0.4519 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3686 5.8669 -1.8198 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3261 6.2550 -0.4610 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4810 4.8077 1.6294 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8037 5.1872 2.7856 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4385 5.3316 3.9994 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7985 5.0921 4.0737 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4777 4.7166 2.9361 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8322 4.5719 1.7107 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8422 4.4778 3.0205 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4838 5.2268 5.2863 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3572 5.4750 -4.3623 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8491 1.7755 -0.7234 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0106 1.8294 -1.2685 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5968 -4.5290 2.9544 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9841 -3.8961 2.5874 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4083 -3.2597 3.6500 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5742 -3.8886 4.4179 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0041 -5.1697 4.1420 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4242 -5.8267 3.0632 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5430 -5.1862 2.3203 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8603 -7.1202 2.7881 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9788 -5.7989 4.8993 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0799 -8.2956 -1.5722 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4214 -6.3373 -0.9931 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9364 -4.1936 1.6260 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1327 -5.9691 -1.1134 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3644 -2.5319 3.2858 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3912 -2.8098 1.9151 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1463 1.6483 -0.1186 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8159 -0.6152 -1.7946 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2718 1.9707 -1.2783 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6628 -1.6226 -0.3054 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5993 1.7791 2.9393 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6846 0.7705 4.6526 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5389 -0.3668 3.7128 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2103 2.2817 2.6679 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7109 0.7877 4.4585 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4377 1.9962 0.6758 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5021 -2.9455 1.5115 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3306 -3.8282 0.3018 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1099 0.0001 -0.3785 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7586 -2.6186 -1.7474 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0229 -0.4526 -2.4777 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2508 -1.3992 -2.9094 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6504 -3.5080 2.2780 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1221 -2.9669 3.3434 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5852 -1.0306 0.3723 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6386 -3.1918 3.2479 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3433 -0.6526 -4.8893 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7268 1.3094 -6.2903 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0983 1.7907 -1.4461 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0635 4.7824 -2.7653 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9277 4.2828 -5.9160 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0899 -3.9305 -1.7023 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0627 1.6230 3.2737 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5588 3.4353 3.9595 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8813 4.3949 0.8778 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9072 7.1983 2.0192 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5118 6.8136 2.6903 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8223 -0.3862 5.6121 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6362 0.9081 -2.2774 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0448 0.2251 -4.2217 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2776 -3.0594 -1.8660 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1468 -4.2846 -4.7320 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8939 -2.2640 -6.1799 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1607 -0.6358 0.3273 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1333 -3.0969 -1.2298 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1123 -3.8731 -3.2581 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1143 0.8638 -2.7280 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9138 0.1580 -5.6897 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1373 -2.9116 -5.9877 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5119 0.9940 0.5355 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9554 0.0497 -2.2438 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8313 0.3044 -4.3127 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1330 3.0216 -5.1430 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6369 4.6540 0.5998 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4570 6.7783 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0381 6.3904 -2.5664 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3944 6.4057 -1.9216 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4703 6.7972 -1.2937 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7315 5.3874 2.7635 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9005 5.6314 4.9107 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3870 4.2783 0.8294 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2526 3.7447 3.5557 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7253 6.1787 5.5921 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7930 5.6335 -5.2767 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3535 1.9399 0.1105 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8721 2.6348 -0.6700 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2357 -4.5686 3.6890 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6810 -2.2459 3.9520 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0356 -3.3928 5.2644 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0074 -5.6890 1.4786 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6077 -7.8970 3.3716 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1138 -5.6780 5.8930 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 4 6 2 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 14 15 1 0 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 2 0 24 25 1 0 24 26 1 0 26 27 2 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 2 0 36 37 1 0 36 38 1 0 38 39 2 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 2 0 48 49 1 0 48 50 1 0 50 51 2 0 51 52 1 0 51 53 1 0 44 54 1 0 54 55 2 0 55 56 1 0 56 57 2 0 57 58 1 0 58 59 2 0 58 60 1 0 57 61 1 0 39 62 1 0 32 63 1 0 63 64 2 0 64 65 1 0 65 66 2 0 66 67 1 0 67 68 2 0 67 69 1 0 66 70 1 0 27 71 1 0 20 72 1 0 72 73 2 0 73 74 1 0 74 75 2 0 75 76 1 0 76 77 2 0 76 78 1 0 75 79 1 0 16 80 2 0 80 81 1 0 81 82 2 0 82 83 1 0 83 84 1 0 84 85 1 0 85 86 2 0 86 87 1 0 87 88 2 0 88 89 1 0 89 90 2 0 89 91 1 0 88 92 1 0 84 93 1 0 93 94 1 0 94 95 1 0 95 96 1 0 96 97 1 0 96 98 2 0 98 99 1 0 99100 2 0 100101 1 0 101102 1 0 102103 1 0 103104 1 0 104105 1 0 104106 1 0 103107 1 0 107108 2 0 108109 1 0 109110 2 0 110111 1 0 111112 2 0 111113 1 0 110114 1 0 99115 1 0 93116 1 0 80117 1 0 11118 1 0 10119 1 1 119120 2 0 120121 1 0 121122 2 0 122123 1 0 123124 2 0 123125 1 0 122126 1 0 8 2 1 0 15 10 1 0 23 17 1 0 35 29 1 0 47 41 1 0 59 54 1 0 68 63 1 0 77 72 1 0 94 81 1 0 101 95 2 0 112107 1 0 124119 1 0 12 6 1 0 82 13 1 0 90 85 1 0 105100 1 0 28 22 2 0 40 34 2 0 52 46 2 0 1127 1 0 3128 1 0 5129 1 0 8130 1 0 11131 1 1 12132 1 1 17133 1 6 18134 1 6 19135 1 0 20136 1 1 25137 1 0 26138 1 0 29139 1 1 30140 1 1 31141 1 0 32142 1 6 37143 1 0 38144 1 0 41145 1 6 42146 1 1 43147 1 0 44148 1 6 49149 1 0 50150 1 0 52151 1 0 53152 1 0 55153 1 0 56154 1 0 59155 1 0 60156 1 0 61157 1 0 62158 1 0 64159 1 0 65160 1 0 68161 1 0 69162 1 0 70163 1 0 71164 1 0 73165 1 0 74166 1 0 77167 1 0 78168 1 0 79169 1 0 84170 1 1 86171 1 0 87172 1 0 90173 1 0 91174 1 0 92175 1 0 93176 1 1 94177 1 6 97178 1 0 98179 1 0 103180 1 1 104181 1 1 105182 1 0 105183 1 0 106184 1 0 108185 1 0 109186 1 0 112187 1 0 113188 1 0 114189 1 0 115190 1 0 116191 1 0 117192 1 0 118193 1 0 120194 1 0 121195 1 0 124196 1 0 125197 1 0 126198 1 0 M END

Standard InCHIKey	YNHIXLNNNNXLFF-YENJAGDHSA-N
Standard InCHI	InChI=1S/C90H72O36/c91-33-19-49(106)59-57(21-33)120-80(28-2-8-37(94)44(101)14-28)75(115)66(59)62-52(109)25-53(110)63-67(76(116)81(122-85(62)63)29-3-9-38(95)45(102)15-29)64-54(111)26-55(112)65-69(78(118)82(123-86(64)65)30-4-10-39(96)46(103)16-30)72-74(114)71-68(61-51(108)24-42(99)35-23-56(113)79(121-84(35)61)27-1-7-36(93)43(100)13-27)77(117)83(31-5-11-40(97)47(104)17-31)124-87(71)73-70-60-50(107)20-34(92)22-58(60)125-90(89(70)119,126-88(72)73)32-6-12-41(98)48(105)18-32/h1-22,24-26,56,66-70,75-83,89,91-119H,23H2/t56-,66-,67-,68+,69-,70-,75-,76-,77-,78-,79-,80-,81-,82-,83-,89-,90+/m1/s1
SMILES	Oc1cc(O)c2c(c1)O[C@@]1([C@@H]([C@H]2c2c(O1)c([C@@H]1[C@@H](O)[C@H](Oc3c1c(O)cc(c3[C@@H]1[C@@H](O)[C@H](Oc3c1c(O)cc(c3[C@@H]1[C@@H](O)[C@H](Oc3c1c(O)cc(c3)O)c1ccc(c(c1)O)O)O)c1ccc(c(c1)O)O)O)c1ccc(c(c1)O)O)c(c1c2O[C@H](c2ccc(c(c2)O)O)[C@@H]([C@H]1c1c(O)cc(c2c1O[C@@H]([C@@H](C2)O)c1ccc(c(c1)O)O)O)O)O)O)c1ccc(c(c1)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1728.38	Volume:	1624.158 ? Van der Waals volume.
Dense:	1.064	LogP:	0.91 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.08 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-6.18 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	105.0
TPSA:	651.28 ? Topological Polar Surface Area.	H-Bond Acceptor:	36.0
H-Bond Donor:	29.0	Rings:	19.0
Heavy Atoms:	36.0

MedChem Properties

QED Drug-Likeness Score:	0.057	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.72	Fsp³:	0.2
MCE-18:	410.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	1	PAINS Alert:	1
Colloidal aggregators:	0.999	Fluc inhibitor:	0.042 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.307 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.662 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.633	Promiscuous compounds:	0.125

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-9.976	MDCK Permeability:	-4.299
Pgp-inhibitor:	0.0	Pgp-substrate:	0.003
PAMPA:	0.001 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	85.749%	Volume Distribution (VD):	0.655
Fu:	11.298% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.002
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	1.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

6.739

Half-life (T1/2):

13.442

ADMET: Toxicity

hERG Blockers:	0.015	hERG Blockers (10um):	0.992
Human Hepatotoxicity (H-HT):	0.998	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	0.941	Rat Oral Acute Toxicity:	0.994
Maximum Recommended Daily Dose:	1.0	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	1.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.004	Drug-induced Nephrotoxicity:	0.305
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.357
A549 Cytotoxicity:	1.0	Hek293 Cytotoxicity:	1.0
BCF:	0.834 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.957 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.142 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.477 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32726	machilus philippinensis	Species	Lauraceae	Eukaryota	leaves	n.a.	n.a.	PMID[20568785]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	IC50	=	18400.0	nM	PMID[26317881]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC205613 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26358
0.1-0.2	21941
0.2-0.3	1364
0.3-0.4	92
0.4-0.5	25
0.5-0.6	23
0.6-0.7	24
0.7-0.8	0
0.8-0.85	5
0.85-0.9	0
0.9-0.95	0
0.95-1	3

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC212614
0.9865	High Similarity	NPC106601
0.9865	High Similarity	NPC151474
0.8481	Intermediate Similarity	NPC86630
0.8462	Intermediate Similarity	NPC147743
0.8462	Intermediate Similarity	NPC4809
0.8462	Intermediate Similarity	NPC73517
0.8193	Intermediate Similarity	NPC159526
0.7568	Intermediate Similarity	NPC246202
0.7568	Intermediate Similarity	NPC224161
0.7568	Intermediate Similarity	NPC46335
0.7568	Intermediate Similarity	NPC279406
0.7568	Intermediate Similarity	NPC486519
0.75	Intermediate Similarity	NPC78074
0.75	Intermediate Similarity	NPC478616
0.75	Intermediate Similarity	NPC478340
0.75	Intermediate Similarity	NPC478339
0.7432	Intermediate Similarity	NPC58190
0.7432	Intermediate Similarity	NPC108811
0.7432	Intermediate Similarity	NPC170103
0.7432	Intermediate Similarity	NPC236202
0.7432	Intermediate Similarity	NPC262911
0.7432	Intermediate Similarity	NPC202742
0.7412	Intermediate Similarity	NPC478337
0.7412	Intermediate Similarity	NPC478338
0.7215	Intermediate Similarity	NPC272552
0.7215	Intermediate Similarity	NPC226108
0.7215	Intermediate Similarity	NPC322899
0.7	Intermediate Similarity	NPC478617
0.6905	Remote Similarity	NPC471404
0.6829	Remote Similarity	NPC44192
0.6707	Remote Similarity	NPC46283
0.6707	Remote Similarity	NPC469944
0.6707	Remote Similarity	NPC278548
0.6707	Remote Similarity	NPC134911
0.6667	Remote Similarity	NPC226809
0.6296	Remote Similarity	NPC313116
0.6296	Remote Similarity	NPC603340
0.6282	Remote Similarity	NPC96576
0.6163	Remote Similarity	NPC20050
0.6145	Remote Similarity	NPC70409
0.6145	Remote Similarity	NPC204770
0.6145	Remote Similarity	NPC600551
0.6145	Remote Similarity	NPC601980
0.6145	Remote Similarity	NPC602065
0.6145	Remote Similarity	NPC611024
0.6049	Remote Similarity	NPC294558
0.6049	Remote Similarity	NPC18185
0.6049	Remote Similarity	NPC263940
0.6024	Remote Similarity	NPC155564
0.6	Remote Similarity	NPC600630
0.6	Remote Similarity	NPC607896
0.6	Remote Similarity	NPC611369
0.5909	Remote Similarity	NPC306267
0.5882	Remote Similarity	NPC211561
0.5667	Remote Similarity	NPC135021
0.5568	Remote Similarity	NPC302549
0.5542	Remote Similarity	NPC601999
0.5517	Remote Similarity	NPC601997
0.5517	Remote Similarity	NPC609211
0.5517	Remote Similarity	NPC610665
0.5513	Remote Similarity	NPC178054
0.5484	Remote Similarity	NPC9309
0.5408	Remote Similarity	NPC484331
0.5354	Remote Similarity	NPC12326
0.5263	Remote Similarity	NPC261619
0.5263	Remote Similarity	NPC61477
0.5263	Remote Similarity	NPC78770
0.5263	Remote Similarity	NPC219876
0.5263	Remote Similarity	NPC126029
0.5263	Remote Similarity	NPC15658
0.5233	Remote Similarity	NPC184245
0.5233	Remote Similarity	NPC187801
0.5233	Remote Similarity	NPC610920
0.5149	Remote Similarity	NPC484330
0.5098	Remote Similarity	NPC185231

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC205613 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5737
0.1-0.2	3393
0.2-0.3	16
0.3-0.4	2
0.4-0.5	0
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5263	Remote Similarity	NPD1612	Clinical (unspecified phase)
0.5263	Remote Similarity	NPD1613	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data