NPASS drugs

Drug Information

Drug ID:	NPD2969
Drug Name:	Codeine Sulfate
Molecular Formula:	C18H21NO3.H2O4S
Canonical SMILES:	OS(=O)(=O)O.COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@@H]4C=C[C@@H]1O)C
Standard InCHI:	"InChI=1S/C18H21NO3.H2O4S/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19;1-5(2,3)4/h3-6,11-13,17,20H,7-9H2,1-2H3;(H2,1,2,3,4)/t11-,12+,13-,17-,18-;/m0./s1"
Standard InCHIKey:	REJWPZYIFAQSIK-FFHNEAJVSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2969

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	47683
0.1-0.2	160091
0.2-0.3	3819
0.3-0.4	91
0.4-0.5	14
0.5-0.6	15
0.6-0.7	16
0.7-0.8	2
0.8-0.85	2
0.85-0.9	0
0.9-0.95	7
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9219	NPC43069
High Similarity	0.9219	NPC235802
High Similarity	0.9219	NPC262786
High Similarity	0.9219	NPC163601
High Similarity	0.9219	NPC2073
High Similarity	0.9219	NPC319632
High Similarity	0.9219	NPC612004
Intermediate Similarity	0.8116	NPC140577
Intermediate Similarity	0.8116	NPC146628
Intermediate Similarity	0.7467	NPC44953
Intermediate Similarity	0.7317	NPC26746
Remote Similarity	0.64	NPC328423
Remote Similarity	0.64	NPC74436
Remote Similarity	0.64	NPC232533
Remote Similarity	0.64	NPC298343
Remote Similarity	0.64	NPC566104
Remote Similarity	0.64	NPC607466
Remote Similarity	0.64	NPC608460
Remote Similarity	0.6351	NPC318674
Remote Similarity	0.6351	NPC305440
Remote Similarity	0.6351	NPC214629
Remote Similarity	0.6351	NPC67346
Remote Similarity	0.6351	NPC174783
Remote Similarity	0.6351	NPC599847
Remote Similarity	0.6316	NPC485664
Remote Similarity	0.6235	NPC143927
Remote Similarity	0.6067	NPC320999
Remote Similarity	0.5974	NPC23347
Remote Similarity	0.5974	NPC203778
Remote Similarity	0.5974	NPC322178
Remote Similarity	0.5641	NPC160593
Remote Similarity	0.5641	NPC581397
Remote Similarity	0.5432	NPC580459
Remote Similarity	0.5385	NPC115906
Remote Similarity	0.5385	NPC608430
Remote Similarity	0.5375	NPC550752
Remote Similarity	0.5366	NPC311781
Remote Similarity	0.5366	NPC238919
Remote Similarity	0.5366	NPC70075
Remote Similarity	0.525	NPC327766
Remote Similarity	0.525	NPC33179
Remote Similarity	0.5181	NPC243483

Drug Structure

NPD2969 OpenBabel08211702562D 30 33 0 0 1 0 0 0 0 0999 V2000 0.4543 -5.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0039 -0.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4086 -1.6752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4086 -5.1298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1566 -5.5617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1566 -1.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4086 -3.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9126 -3.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6606 -2.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4086 -2.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4086 -4.2661 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6606 -3.8342 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9046 -5.1298 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.9046 -1.6752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1566 -2.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9046 -2.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9046 -4.2661 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1566 -3.8342 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9126 -4.2661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6526 -5.5617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6526 -1.2434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6306 -3.4023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6364 -0.9087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7277 -1.8173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6364 -2.7260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5450 -1.8173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6364 -1.8173 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 5.3647 -5.0729 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8495 -0.4543 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2734 -2.6042 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 19 1 0 0 0 0 2 21 1 0 0 0 0 3 6 2 0 0 0 0 3 10 1 0 0 0 0 4 5 2 0 0 0 0 4 11 1 0 0 0 0 5 13 1 0 0 0 0 6 14 1 0 0 0 0 7 8 1 0 0 0 0 8 19 1 0 0 0 0 9 10 1 0 0 0 0 10 15 2 0 0 0 0 11 12 1 0 0 0 0 11 18 1 1 0 0 0 12 9 1 6 0 0 0 12 19 1 0 0 0 0 13 17 1 0 0 0 0 13 20 1 1 0 0 0 14 16 2 0 0 0 0 14 21 1 0 0 0 0 15 16 1 0 0 0 0 15 18 1 0 0 0 0 16 22 1 0 0 0 0 17 18 1 1 0 0 0 17 22 1 0 0 0 0 18 7 1 6 0 0 0 20 28 1 0 0 0 0 23 27 1 0 0 0 0 23 29 1 0 0 0 0 24 27 1 0 0 0 0 24 30 1 0 0 0 0 25 27 2 0 0 0 0 26 27 2 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	299.15
ALogP	-0.3086
MLogP	3
XLogP	1.315
HDA	2
HBD	1
Rotatable Bonds	4
TPSA	41.93
RO5 Violation	0