Drug Information| Drug ID:   | NPD5124 |
| Drug Name:   | Calanolide A |
| Molecular Formula:   | C22H26O5 |
| Canonical SMILES:   | CCCc1cc(=O)oc2c1c1OC(C)(C)C=Cc1c1c2[C@@H](O)[C@@H]([C@H](O1)C)C |
| Standard InCHI:   | "InChI=1S/C22H26O5/c1-6-7-13-10-15(23)26-21-16(13)20-14(8-9-22(4,5)27-20)19-17(21)18(24)11(2)12(3)25-19/h8-12,18,24H,6-7H2,1-5H3/t11-,12-,18+/m1/s1" |
| Standard InCHIKey:   | NIDRYBLTWYFCFV-FMTVUPSXSA-N |
| Max Developmental Stage:   | Phase 1 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5124Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC141822 |
| High Similarity | 1.0 | NPC1220 |
| High Similarity | 1.0 | NPC205797 |
| High Similarity | 1.0 | NPC142563 |
| High Similarity | 1.0 | NPC241165 |
| High Similarity | 1.0 | NPC602236 |
| High Similarity | 1.0 | NPC607427 |
| High Similarity | 1.0 | NPC607509 |
| Intermediate Similarity | 0.7941 | NPC505625 |
| Intermediate Similarity | 0.7941 | NPC513757 |
| Intermediate Similarity | 0.7941 | NPC603144 |
| Intermediate Similarity | 0.7746 | NPC571700 |
| Intermediate Similarity | 0.7746 | NPC596099 |
| Remote Similarity | 0.6944 | NPC469965 |
| Remote Similarity | 0.6933 | NPC139595 |
| Remote Similarity | 0.6933 | NPC60704 |
| Remote Similarity | 0.6892 | NPC201820 |
| Remote Similarity | 0.6667 | NPC293642 |
| Remote Similarity | 0.6667 | NPC495385 |
| Remote Similarity | 0.6282 | NPC35501 |
| Remote Similarity | 0.6282 | NPC137262 |
| Remote Similarity | 0.6282 | NPC144512 |
| Remote Similarity | 0.6282 | NPC278600 |
| Remote Similarity | 0.6282 | NPC37428 |
| Remote Similarity | 0.6282 | NPC47040 |
| Remote Similarity | 0.6282 | NPC602052 |
| Remote Similarity | 0.6282 | NPC608910 |
| Remote Similarity | 0.6282 | NPC610179 |
| Remote Similarity | 0.5974 | NPC38153 |
| Remote Similarity | 0.5974 | NPC505233 |
| Remote Similarity | 0.5625 | NPC273548 |
| Remote Similarity | 0.5625 | NPC149061 |
| Remote Similarity | 0.5625 | NPC592156 |
| Remote Similarity | 0.5443 | NPC291551 |
| TTD   | |
| DrugBank   | DB04886 |
| ChEMBL   | CHEMBL267447 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | 65552 |
| CAS Number   | 142632-32-4 |
| Molecular Weight   | 370.18 |
| ALogP   | 0.2774 |
| MLogP   | 3.33 |
| XLogP   | 3.505 |
| HDA   | 2 |
| HBD   | 1 |
| Rotatable Bonds   | 8 |
| TPSA   | 64.99 |
| RO5 Violation   | 0 |