Drug Information| Drug ID:   | NPD8251 |
| Drug Name:   | Metocurine Iodide |
| Molecular Formula:   | C40H48N2O6.2HI |
| Canonical SMILES:   | COc1ccc2cc1Oc1cc3c(cc1OC)CC[N+]([C@H]3Cc1ccc(Oc3c4[C@@H](C2)[N+](C)(C)CCc4cc(c3OC)OC)cc1)(C)C.[I-].[I-] |
| Standard InCHI:   | "InChI=1S/C40H48N2O6.2HI/c1-41(2)17-15-27-22-34(44-6)36-24-30(27)31(41)19-25-9-12-29(13-10-25)47-40-38-28(23-37(45-7)39(40)46-8)16-18-42(3,4)32(38)20-26-11-14-33(43-5)35(21-26)48-36;;/h9-14,21-24,31-32H,15-20H2,1-8H3;2*1H/q+2;;/p-2/t31-,32+;;/m0../s1" |
| Standard InCHIKey:   | DIGFQJFCDPKEPF-OIUSMDOTSA-L |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8251Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7714 | NPC8210 |
| Remote Similarity | 0.6806 | NPC167990 |
| Remote Similarity | 0.6806 | NPC313680 |
| Remote Similarity | 0.6543 | NPC30101 |
| Remote Similarity | 0.6543 | NPC160508 |
| Remote Similarity | 0.6341 | NPC256213 |
| Remote Similarity | 0.625 | NPC216252 |
| Remote Similarity | 0.625 | NPC495944 |
| Remote Similarity | 0.625 | NPC611577 |
| Remote Similarity | 0.5568 | NPC62993 |
| Remote Similarity | 0.5495 | NPC253571 |
| Remote Similarity | 0.5333 | NPC38977 |
| Remote Similarity | 0.5333 | NPC81463 |
| Remote Similarity | 0.5072 | NPC585609 |
| Remote Similarity | 0.507 | NPC63027 |
| Remote Similarity | 0.507 | NPC143956 |
| TTD   | DAP000824 |
| DrugBank   | DB00416 |
| ChEMBL   | CHEMBL1739 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164749507 |
| KEGG Drug   | D00761 |
| PubChem CID   | 0 |
| ChEBI   | 6901 |
| CAS Number   | 7601-55-0 |
| Molecular Weight   | 652.35 |
| ALogP   | -2.4356 |
| MLogP   | 4.98 |
| XLogP   | 5.716 |
| HDA   | 0 |
| HBD   | 0 |
| Rotatable Bonds   | 12 |
| TPSA   | 55.38 |
| RO5 Violation   | 1 |