NPASS drugs

Drug Information

Drug ID:	NPD2489
Drug Name:	Morphine Hydrochloride
Molecular Formula:	C17H19NO3.ClH
Canonical SMILES:	O[C@H]1C=C[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1O.Cl
Standard InCHI:	"InChI=1S/C17H19NO3.ClH/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18;/h2-5,10-11,13,16,19-20H,6-8H2,1H3;1H/t10-,11+,13-,16-,17-;/m0./s1"
Standard InCHIKey:	XCKKIKBIPZJUET-VYKNHSEDSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2489

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	69582
0.1-0.2	137564
0.2-0.3	4455
0.3-0.4	81
0.4-0.5	29
0.5-0.6	2
0.6-0.7	14
0.7-0.8	5
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	8

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC485664
High Similarity	0.9833	NPC328423
High Similarity	0.9833	NPC74436
High Similarity	0.9833	NPC232533
High Similarity	0.9833	NPC298343
High Similarity	0.9833	NPC566104
High Similarity	0.9833	NPC607466
High Similarity	0.9833	NPC608460
Intermediate Similarity	0.7941	NPC243483
Intermediate Similarity	0.75	NPC23347
Intermediate Similarity	0.75	NPC203778
Intermediate Similarity	0.75	NPC322178
Intermediate Similarity	0.7353	NPC160593
Remote Similarity	0.6761	NPC43069
Remote Similarity	0.6761	NPC235802
Remote Similarity	0.6761	NPC262786
Remote Similarity	0.6761	NPC163601
Remote Similarity	0.6761	NPC2073
Remote Similarity	0.6761	NPC319632
Remote Similarity	0.6761	NPC612004
Remote Similarity	0.675	NPC143927
Remote Similarity	0.6714	NPC97086
Remote Similarity	0.6575	NPC140577
Remote Similarity	0.6575	NPC146628
Remote Similarity	0.64	NPC43726
Remote Similarity	0.64	NPC147161
Remote Similarity	0.6076	NPC44953
Remote Similarity	0.5506	NPC26746
Remote Similarity	0.5309	NPC258640

Drug Structure

NPD2489 OpenBabel08211702172D 24 27 0 0 1 0 0 0 0 0999 V2000 0.4442 -4.9467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3548 -1.6378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3548 -5.0152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0861 -1.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0861 -5.4374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3548 -3.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8922 -3.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6235 -2.9045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3548 -2.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3548 -4.1708 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6235 -3.7485 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8174 -1.6378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8174 -5.0152 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0861 -2.9045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8174 -2.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8174 -4.1708 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0861 -3.7485 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8922 -4.1707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.5487 -1.2156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5487 -5.4374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5271 -3.3263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4392 -1.1220 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 4.8922 -0.4442 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2449 -4.9596 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 18 1 0 0 0 0 2 4 2 0 0 0 0 2 9 1 0 0 0 0 3 5 2 0 0 0 0 3 10 1 0 0 0 0 4 12 1 0 0 0 0 5 13 1 0 0 0 0 6 7 1 0 0 0 0 7 18 1 0 0 0 0 8 9 1 0 0 0 0 9 14 2 0 0 0 0 10 11 1 0 0 0 0 10 17 1 1 0 0 0 11 8 1 6 0 0 0 11 18 1 0 0 0 0 12 15 2 0 0 0 0 12 19 1 0 0 0 0 13 16 1 0 0 0 0 13 20 1 1 0 0 0 14 15 1 0 0 0 0 14 17 1 0 0 0 0 15 21 1 0 0 0 0 16 17 1 1 0 0 0 16 21 1 0 0 0 0 17 6 1 6 0 0 0 19 23 1 0 0 0 0 20 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	285.14
ALogP	-0.7171
MLogP	2.89
XLogP	0.796
HDA	2
HBD	2
Rotatable Bonds	3
TPSA	52.93
RO5 Violation	0