NPASS drugs

Drug Information

Drug ID:	NPD4577
Drug Name:	Nalmefene Hydrochloride
Molecular Formula:	C21H25NO3.ClH
Canonical SMILES:	C=C1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)CC2CC2)ccc1O)O.Cl
Standard InCHI:	"InChI=1S/C21H25NO3.ClH/c1-12-6-7-21(24)16-10-14-4-5-15(23)18-17(14)20(21,19(12)25-18)8-9-22(16)11-13-2-3-13;/h4-5,13,16,19,23-24H,1-3,6-11H2;1H/t16-,19+,20+,21-;/m1./s1"
Standard InCHIKey:	GYWMRGWFQPSQLK-OPHZJPRHSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4577

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	76164
0.1-0.2	133258
0.2-0.3	2278
0.3-0.4	24
0.4-0.5	7
0.5-0.6	0
0.6-0.7	8
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7067	NPC611959
Remote Similarity	0.6234	NPC254045
Remote Similarity	0.6234	NPC201055
Remote Similarity	0.6234	NPC265000
Remote Similarity	0.6234	NPC64576
Remote Similarity	0.6234	NPC151470
Remote Similarity	0.6234	NPC603205
Remote Similarity	0.6234	NPC603486
Remote Similarity	0.6234	NPC611632

Drug Structure

NPD4577 OpenBabel08211705262D 28 32 0 0 1 0 0 0 0 0999 V2000 6.3421 -5.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7018 -5.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4512 -5.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0502 -1.7477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7989 -1.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7989 -5.6378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0502 -5.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0502 -3.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5528 -3.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3015 -3.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1205 -5.0897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5476 -5.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2931 -5.3402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0502 -2.6123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5476 -1.7477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3015 -3.9087 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7989 -3.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5476 -2.6123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5476 -4.3410 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7989 -3.9087 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.0502 -4.3410 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5528 -4.3410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.2964 -1.3155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3015 -4.7733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2743 -3.4764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1531 -1.8956 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 6.2732 -0.4512 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5794 -5.5919 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 12 2 0 0 0 0 2 3 1 0 0 0 0 2 13 1 0 0 0 0 3 13 1 0 0 0 0 4 5 2 0 0 0 0 4 14 1 0 0 0 0 5 15 1 0 0 0 0 6 7 1 0 0 0 0 6 12 1 0 0 0 0 7 21 1 0 0 0 0 8 9 1 0 0 0 0 8 20 1 0 0 0 0 9 22 1 0 0 0 0 10 14 1 0 0 0 0 10 16 1 0 0 0 0 11 13 1 0 0 0 0 11 22 1 0 0 0 0 12 19 1 0 0 0 0 14 17 2 0 0 0 0 15 18 2 0 0 0 0 15 23 1 0 0 0 0 16 21 1 6 0 0 0 16 22 1 0 0 0 0 17 18 1 0 0 0 0 17 20 1 0 0 0 0 18 25 1 0 0 0 0 19 20 1 1 0 0 0 19 25 1 0 0 0 0 20 21 1 1 0 0 0 21 24 1 6 0 0 0 23 27 1 0 0 0 0 24 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	339.18
ALogP	-0.4408
MLogP	3.33
XLogP	1.554
HDA	2
HBD	2
Rotatable Bonds	4
TPSA	52.93
RO5 Violation	0