NPASS drugs

Drug Information

Drug ID:	NPD4663
Drug Name:	Nalbuphine Hydrochloride
Molecular Formula:	C21H27NO4.ClH
Canonical SMILES:	O[C@H]1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)CC2CCC2)ccc1O)O.Cl
Standard InCHI:	"InChI=1S/C21H27NO4.ClH/c23-14-5-4-13-10-16-21(25)7-6-15(24)19-20(21,17(13)18(14)26-19)8-9-22(16)11-12-2-1-3-12;/h4-5,12,15-16,19,23-25H,1-3,6-11H2;1H/t15-,16+,19-,20-,21+;/m0./s1"
Standard InCHIKey:	YZLZPSJXMWGIFH-BCXQGASESA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4663

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	72633
0.1-0.2	136367
0.2-0.3	2676
0.3-0.4	41
0.4-0.5	13
0.5-0.6	9
0.6-0.7	0
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7067	NPC611959
Remote Similarity	0.5823	NPC254045
Remote Similarity	0.5823	NPC201055
Remote Similarity	0.5823	NPC265000
Remote Similarity	0.5823	NPC64576
Remote Similarity	0.5823	NPC151470
Remote Similarity	0.5823	NPC603205
Remote Similarity	0.5823	NPC603486
Remote Similarity	0.5823	NPC611632
Remote Similarity	0.525	NPC97086

Drug Structure

NPD4663 OpenBabel08211705262D 30 34 0 0 1 0 0 0 0 0999 V2000 0.4352 -2.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4352 -1.9943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2724 -2.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4744 -0.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2831 -0.6519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3232 -3.6117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1065 -2.8030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2906 -1.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2652 -0.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0736 -0.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8644 -1.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2724 -1.9943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8823 -1.0272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4998 -1.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1319 -3.8284 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4819 -1.4022 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0990 -1.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9077 -2.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7240 -3.2364 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5073 -2.4277 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.6986 -2.2110 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6732 -1.1856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.3085 -1.6773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3486 -4.6371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8898 -1.9943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8136 -3.1420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3304 -2.7380 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 7.6774 -0.9257 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1292 -4.9400 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4872 -2.7283 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 3 1 0 0 0 0 2 12 1 0 0 0 0 3 12 1 0 0 0 0 4 5 2 0 0 0 0 4 13 1 0 0 0 0 5 14 1 0 0 0 0 6 7 1 0 0 0 0 6 15 1 0 0 0 0 7 21 1 0 0 0 0 8 9 1 0 0 0 0 8 20 1 0 0 0 0 9 22 1 0 0 0 0 10 13 1 0 0 0 0 10 16 1 0 0 0 0 11 12 1 0 0 0 0 11 22 1 0 0 0 0 13 17 2 0 0 0 0 14 18 2 0 0 0 0 14 23 1 0 0 0 0 15 19 1 0 0 0 0 15 24 1 1 0 0 0 16 21 1 6 0 0 0 16 22 1 0 0 0 0 17 18 1 0 0 0 0 17 20 1 0 0 0 0 18 26 1 0 0 0 0 19 20 1 1 0 0 0 19 26 1 0 0 0 0 20 21 1 1 0 0 0 21 25 1 6 0 0 0 23 28 1 0 0 0 0 24 29 1 0 0 0 0 25 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	357.19
ALogP	-2.1018
MLogP	3.22
XLogP	1.447
HDA	3
HBD	3
Rotatable Bonds	5
TPSA	73.16
RO5 Violation	0