Drug Information| Drug ID:   | NPD7906 |
| Drug Name:   | Naloxegol Oxalate |
| Molecular Formula:   | C34H53NO11.C2H2O4 |
| Canonical SMILES:   | OC(=O)C(=O)O.COCCOCCOCCOCCOCCOCCOCCO[C@H]1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)CC=C)ccc1O)O |
| Standard InCHI:   | "InChI=1S/C34H53NO11.C2H2O4/c1-3-9-35-10-8-33-30-26-4-5-27(36)31(30)46-32(33)28(6-7-34(33,37)29(35)25-26)45-24-23-44-22-21-43-20-19-42-18-17-41-16-15-40-14-13-39-12-11-38-2;3-1(4)2(5)6/h3-5,28-29,32,36-37H,1,6-25H2,2H3;(H,3,4)(H,5,6)/t28-,29+,32-,33-,34+;/m0./s1" |
| Standard InCHIKey:   | MNYIRXLCPODKLG-VUTNLTPYSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD7906Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6024 | NPC254045 |
| Remote Similarity | 0.6024 | NPC201055 |
| Remote Similarity | 0.6024 | NPC265000 |
| Remote Similarity | 0.6024 | NPC64576 |
| Remote Similarity | 0.6024 | NPC151470 |
| Remote Similarity | 0.6024 | NPC603205 |
| Remote Similarity | 0.6024 | NPC603486 |
| Remote Similarity | 0.6024 | NPC611632 |
| Remote Similarity | 0.5111 | NPC611959 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 651.36 |
| ALogP   | -1.8192 |
| MLogP   | 3.88 |
| XLogP   | -0.056 |
| HDA   | 10 |
| HBD   | 2 |
| Rotatable Bonds   | 27 |
| TPSA   | 126.77 |
| RO5 Violation   | 1 |