NPASS Compound

Natural Product: NPC137482

Natural Product ID	NPC137482
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	WMQWOVNVLJJJIH-SLPKFZDGSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 161169 0 0 0 0 0 0 0 0999 V2000 10.4535 -2.0261 -1.2334 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9095 -2.5826 0.0845 C 0 0 2 0 0 0 0 0 0 0 0 0 8.4178 -2.3300 0.0903 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8670 -3.0463 -1.1192 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4084 -2.9102 -1.2319 C 0 0 2 0 0 0 0 0 0 0 0 0 5.8925 -1.4943 -1.3315 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2322 -0.7812 -2.5966 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4469 -1.7155 -1.0788 C 0 0 1 0 0 0 0 0 0 0 0 0 4.4810 -3.0736 -0.3422 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5471 -2.9286 0.8299 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7170 -1.7630 0.4027 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8156 -1.1892 1.4034 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8333 -2.1870 1.9504 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5596 -1.9890 1.5090 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0903 -0.8076 1.2213 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4943 -0.7225 0.7868 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0670 0.6210 0.6243 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2137 1.7303 1.2445 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7693 1.5456 0.7352 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1435 0.3530 1.3761 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1364 0.6356 2.8444 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0799 -0.0558 0.6591 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0661 0.9745 0.2750 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1001 0.3829 -0.6684 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7974 -0.7958 -0.0715 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7144 -0.3777 1.0226 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3687 0.6774 1.0713 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2361 1.2154 0.1189 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3003 0.2680 -0.3740 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1103 1.1433 -1.3288 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9099 2.0826 -0.4267 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0483 2.6380 0.6657 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6190 2.3546 2.0416 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9972 2.6702 2.0611 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7495 2.3412 0.6299 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5400 2.9810 -1.2257 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9185 2.8600 -1.2822 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.6743 4.0018 -0.7198 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.6914 4.4703 -1.7421 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.9070 4.6786 -3.0189 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.5432 3.2867 -3.5106 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.3062 3.3865 -4.3846 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2111 3.8543 -3.6703 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3237 2.4268 -2.4975 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6246 5.3772 -3.9721 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.2457 5.6954 -1.3747 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4174 3.6654 0.4132 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8872 0.4839 -2.2220 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8105 -0.8500 -1.0029 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1997 -2.0011 -0.3134 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8911 -3.0072 -1.1901 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2954 -4.1958 -0.3292 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7191 -4.1165 1.0510 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2756 -3.6601 1.0262 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8363 -3.4447 2.4484 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0378 -2.6319 0.1671 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7179 -5.4333 1.5678 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6912 -4.2599 -0.2000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0338 -2.4470 -1.7199 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8249 -3.2063 0.0473 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7906 -3.8216 -2.0525 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1046 -3.8425 -3.3677 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6014 -1.8869 1.2468 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3262 -0.5445 1.1143 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8861 0.2676 2.0874 C 0 0 1 0 0 0 0 0 0 0 0 0 11.9214 1.2105 1.4898 C 0 0 1 0 0 0 0 0 0 0 0 0 11.3192 2.0123 0.3557 C 0 0 2 0 0 0 0 0 0 0 0 0 9.8765 2.2778 0.7390 C 0 0 1 0 0 0 0 0 0 0 0 0 9.6640 2.2183 2.2181 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2000 2.5419 2.4949 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9196 3.8178 1.9791 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8848 0.9442 2.7419 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5896 3.5709 0.3060 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2947 1.3090 -0.8408 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4660 1.9812 2.4857 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8678 -1.1751 -1.6105 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5067 -1.6620 -1.1063 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4914 -2.7980 -2.0218 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1046 -3.6711 0.0631 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9461 -2.6345 1.0437 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3149 -1.2099 -0.0340 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0821 -4.1415 -0.9239 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4507 -2.7614 -1.9894 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3025 -0.9760 -0.4266 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3835 -0.6726 -3.3116 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1814 -1.0986 -3.0699 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4479 0.2904 -2.2900 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8548 -1.7939 -2.0044 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1693 -3.8953 -0.9991 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9424 -3.8750 0.9601 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0699 -2.7760 1.7910 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1520 -2.0433 -0.5048 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3091 -0.7078 2.2689 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8589 -2.2453 3.0529 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1548 -3.1983 1.6003 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1959 -2.8599 1.4133 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0918 -1.3152 1.5550 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6583 -1.3554 -0.1514 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1027 0.9064 -0.4709 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2085 1.7273 2.3266 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5496 2.7090 0.8503 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2356 2.4982 0.9073 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7782 1.3969 -0.3646 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3793 1.5875 3.1636 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2032 0.7687 3.0366 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2459 -0.1810 3.4810 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7484 -0.5559 -0.3020 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5567 1.7887 -0.2729 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5482 1.4651 1.1631 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8638 1.1867 -0.8385 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6287 0.1937 -1.6362 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1141 0.1063 1.8324 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3793 -1.1473 1.4046 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3446 0.4586 0.6285 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6355 1.4938 -0.8014 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8787 -0.0430 0.5077 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3806 1.7574 -1.8948 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6635 1.4198 0.0458 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1401 3.7660 0.5676 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1681 3.0754 2.7769 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5330 1.3155 2.3602 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4091 2.3987 2.8945 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1298 1.9829 -0.5751 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0285 4.9051 -0.5190 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4669 3.7158 -1.9322 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9550 5.1645 -2.7330 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3591 2.9346 -4.1968 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4972 3.9987 -5.2945 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0123 2.3851 -4.7785 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8065 4.6096 -4.1428 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2064 6.2663 -4.1043 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7916 5.5816 -0.5579 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4364 2.6679 0.5445 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7608 0.7680 -3.1640 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8145 -1.7806 0.5525 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2058 -3.3669 -2.0015 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9557 -5.1523 -0.7952 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3006 -3.5078 1.7596 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7012 -4.5763 0.6758 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4606 -4.0233 3.1710 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9514 -2.3768 2.7120 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7882 -3.8004 2.6349 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2277 -6.0556 0.9954 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1055 -4.5737 -1.0457 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2201 -2.6888 -2.6566 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8979 -2.9083 -3.9229 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4103 -4.6062 -3.8407 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1149 -4.2514 -3.5990 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6846 -2.1356 1.1750 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2442 -2.3256 2.1910 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4354 -0.3658 2.7970 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7183 0.5756 1.0574 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8988 2.9418 0.1969 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1796 1.6125 0.1813 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3350 2.9229 2.7191 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9963 2.4903 3.5949 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5549 1.8051 1.9869 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6623 4.4198 2.3092 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3267 4.2053 0.3839 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1531 0.8112 -0.9614 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7362 1.3867 3.2233 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 40 45 1 0 39 46 1 0 38 47 1 0 30 48 1 0 29 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 54 56 1 0 53 57 1 0 52 58 1 0 51 59 1 0 9 60 1 0 5 61 1 6 61 62 1 0 2 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 69 72 1 0 68 73 1 0 67 74 1 0 66 75 1 0 60 5 1 0 72 65 1 0 25 8 1 0 35 28 1 0 44 37 1 0 56 50 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 76 1 0 1 77 1 0 1 78 1 0 2 79 1 6 3 80 1 0 3 81 1 0 4 82 1 0 4 83 1 0 6 84 1 1 7 85 1 0 7 86 1 0 7 87 1 0 8 88 1 6 9 89 1 6 10 90 1 0 10 91 1 0 11 92 1 6 12 93 1 1 13 94 1 0 13 95 1 0 14 96 1 0 16 97 1 0 16 98 1 0 17 99 1 6 18100 1 0 18101 1 0 19102 1 0 19103 1 0 21104 1 0 21105 1 0 21106 1 0 22107 1 6 23108 1 0 23109 1 0 24110 1 0 24111 1 0 26112 1 0 26113 1 0 26114 1 0 28115 1 6 29116 1 1 30117 1 6 31118 1 1 32119 1 6 33120 1 0 33121 1 0 34122 1 0 37123 1 1 38124 1 1 39125 1 6 40126 1 1 41127 1 6 42128 1 0 42129 1 0 43130 1 0 45131 1 0 46132 1 0 47133 1 0 48134 1 0 50135 1 1 51136 1 6 52137 1 6 53138 1 1 54139 1 6 55140 1 0 55141 1 0 55142 1 0 57143 1 0 58144 1 0 59145 1 0 62146 1 0 62147 1 0 62148 1 0 63149 1 0 63150 1 0 65151 1 1 66152 1 6 67153 1 6 68154 1 6 69155 1 1 70156 1 0 70157 1 0 71158 1 0 73159 1 0 74160 1 0 75161 1 0 M END

Standard InCHIKey	WMQWOVNVLJJJIH-SLPKFZDGSA-N
Standard InCHI	InChI=1S/C52H86O23/c1-21(20-67-46-40(62)38(60)35(57)30(17-53)70-46)9-14-52(66-6)22(2)33-29(75-52)16-28-26-8-7-24-15-25(10-12-50(24,4)27(26)11-13-51(28,33)5)69-49-45(74-47-41(63)37(59)34(56)23(3)68-47)43(65)44(32(19-55)72-49)73-48-42(64)39(61)36(58)31(18-54)71-48/h7,21-23,25-49,53-65H,8-20H2,1-6H3/t21-,22+,23+,25+,26-,27+,28+,29+,30-,31-,32-,33+,34+,35-,36-,37-,38+,39+,40-,41-,42-,43+,44-,45-,46-,47+,48+,49-,50+,51+,52-/m1/s1
SMILES	C[C@H](CC[C@@]1([C@@H](C)[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@H](CC[C@]5(C)[C@H]4CC[C@]23C)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O)O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O1)OC)CO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1078.56	Volume:	1030.478 ? Van der Waals volume.
Dense:	1.047	LogP:	0.831 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.856 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.481 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	48.0
TPSA:	355.29 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	13.0	Rings:	9.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.072	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.859	Fsp³:	0.962
MCE-18:	177.157 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.619	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.345	Promiscuous compounds:	0.008

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.679	MDCK Permeability:	-5.084
Pgp-inhibitor:	0.0	Pgp-substrate:	0.701
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.823
20% Bioavailability (F20%):	0.203	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.003
Plasma Protein Binding (PPB):	51.7%	Volume Distribution (VD):	-0.362
Fu:	34.695% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.018
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.997	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.821
HLM stability:	0.007 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.336

Half-life (T1/2):

3.485

ADMET: Toxicity

hERG Blockers:	0.006	hERG Blockers (10um):	0.013
Human Hepatotoxicity (H-HT):	0.512	Drug-induced Liver Injury (DILI):	0.929
AMES Toxicity:	0.963	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.027	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.354	Drug-induced Nephrotoxicity:	0.888
Genotoxicity:	0.021	RPMI-8226 Immunitoxicity:	0.262
A549 Cytotoxicity:	0.895	Hek293 Cytotoxicity:	0.668
BCF:	1.614 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.456 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.696 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.987 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9290	Zanthoxylum piperitum	Species	Rutaceae	Eukaryota	n.a.	leaf	n.a.	PMID[15388977]
NPO9290	Zanthoxylum piperitum	Species	Rutaceae	Eukaryota	n.a.	stem	n.a.	PMID[17202689]
NPO9290	Zanthoxylum piperitum	Species	Rutaceae	Eukaryota	n.a.	pericarp	n.a.	PMID[20628994]
NPO12297	Nigella sativa	Species	Ranunculaceae	Eukaryota	seeds	n.a.	n.a.	PMID[25299458]
NPO12297	Nigella sativa	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[36128855]
NPO12297	Nigella sativa	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[36677629]
NPO12297	Nigella sativa	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[39375628]
NPO12297	Nigella sativa	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[39519627]
NPO12297	Nigella sativa	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[Article]
NPO12297	Nigella sativa	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO11245	Pelvetia canaliculata	Species	Fucaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9290	Zanthoxylum piperitum	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO9290	Zanthoxylum piperitum	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO12297	Nigella sativa	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO9290	Zanthoxylum piperitum	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO9290	Zanthoxylum piperitum	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO8744	Clematis recta	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO5375	Hyptis oblongifolia	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO3356	Bryophyllum fedtschenkoi	Species	Spathidiidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO9290	Zanthoxylum piperitum	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12297	Nigella sativa	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO11245	Pelvetia canaliculata	Species	Fucaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC137482 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23696
0.1-0.2	22383
0.2-0.3	2803
0.3-0.4	730
0.4-0.5	118
0.5-0.6	57
0.6-0.7	25
0.7-0.8	0
0.8-0.85	8
0.85-0.9	5
0.9-0.95	0
0.95-1	3

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC194207
1.0	High Similarity	NPC22779
0.95	High Similarity	NPC232054
0.8878	High Similarity	NPC480555
0.8878	High Similarity	NPC150372
0.8571	High Similarity	NPC470433
0.8571	High Similarity	NPC46190
0.8571	High Similarity	NPC171073
0.835	Intermediate Similarity	NPC475333
0.835	Intermediate Similarity	NPC224098
0.835	Intermediate Similarity	NPC309278
0.835	Intermediate Similarity	NPC208383
0.8208	Intermediate Similarity	NPC480553
0.8077	Intermediate Similarity	NPC269297
0.8077	Intermediate Similarity	NPC222202
0.8019	Intermediate Similarity	NPC480554
0.7941	Intermediate Similarity	NPC248746
0.7838	Intermediate Similarity	NPC480556
0.7714	Intermediate Similarity	NPC73243
0.7714	Intermediate Similarity	NPC244086
0.7714	Intermediate Similarity	NPC84956
0.7692	Intermediate Similarity	NPC42171
0.7619	Intermediate Similarity	NPC475182
0.757	Intermediate Similarity	NPC247037
0.7549	Intermediate Similarity	NPC113044
0.7549	Intermediate Similarity	NPC283829
0.7549	Intermediate Similarity	NPC161676
0.7456	Intermediate Similarity	NPC224314
0.7364	Intermediate Similarity	NPC249265
0.7358	Intermediate Similarity	NPC300557
0.7297	Intermediate Similarity	NPC23808
0.7297	Intermediate Similarity	NPC87998
0.7196	Intermediate Similarity	NPC6806
0.7184	Intermediate Similarity	NPC470432
0.7184	Intermediate Similarity	NPC230507
0.717	Intermediate Similarity	NPC602423
0.7103	Intermediate Similarity	NPC477809
0.7027	Intermediate Similarity	NPC32361
0.7027	Intermediate Similarity	NPC13193
0.7019	Intermediate Similarity	NPC94272
0.7019	Intermediate Similarity	NPC6295
0.7018	Intermediate Similarity	NPC308140
0.697	Remote Similarity	NPC181845
0.6949	Remote Similarity	NPC477808
0.6852	Remote Similarity	NPC475643
0.6731	Remote Similarity	NPC19400
0.6729	Remote Similarity	NPC14704
0.6637	Remote Similarity	NPC486386
0.6606	Remote Similarity	NPC98696
0.6577	Remote Similarity	NPC124677
0.6542	Remote Similarity	NPC485595
0.6522	Remote Similarity	NPC254255
0.646	Remote Similarity	NPC102016
0.646	Remote Similarity	NPC95051
0.6422	Remote Similarity	NPC305423
0.6356	Remote Similarity	NPC477811
0.6348	Remote Similarity	NPC475550
0.6339	Remote Similarity	NPC122819
0.633	Remote Similarity	NPC195297
0.6214	Remote Similarity	NPC165439
0.619	Remote Similarity	NPC263359
0.6186	Remote Similarity	NPC218571
0.6186	Remote Similarity	NPC487615
0.6182	Remote Similarity	NPC141433
0.6167	Remote Similarity	NPC287885
0.6126	Remote Similarity	NPC160426
0.6	Remote Similarity	NPC471464
0.5902	Remote Similarity	NPC31896
0.5882	Remote Similarity	NPC116756
0.5877	Remote Similarity	NPC486388
0.5833	Remote Similarity	NPC477451
0.5812	Remote Similarity	NPC128572
0.5804	Remote Similarity	NPC306991
0.5785	Remote Similarity	NPC470864
0.5739	Remote Similarity	NPC40440
0.5726	Remote Similarity	NPC249553
0.569	Remote Similarity	NPC265275
0.5676	Remote Similarity	NPC306131
0.5676	Remote Similarity	NPC211354
0.5676	Remote Similarity	NPC200802
0.5648	Remote Similarity	NPC297348
0.5648	Remote Similarity	NPC249204
0.5648	Remote Similarity	NPC48339
0.5648	Remote Similarity	NPC141769
0.5648	Remote Similarity	NPC477547
0.5581	Remote Similarity	NPC210569
0.5575	Remote Similarity	NPC107962
0.5556	Remote Similarity	NPC470866
0.5505	Remote Similarity	NPC325828
0.5463	Remote Similarity	NPC485594
0.5462	Remote Similarity	NPC182900
0.5447	Remote Similarity	NPC232611
0.5446	Remote Similarity	NPC206003
0.5446	Remote Similarity	NPC473610
0.5417	Remote Similarity	NPC150057
0.5417	Remote Similarity	NPC147753
0.5385	Remote Similarity	NPC475351
0.536	Remote Similarity	NPC470862
0.5345	Remote Similarity	NPC70204
0.5338	Remote Similarity	NPC305771
0.5338	Remote Similarity	NPC94072
0.5338	Remote Similarity	NPC169816
0.5308	Remote Similarity	NPC477807
0.5299	Remote Similarity	NPC470748
0.5263	Remote Similarity	NPC107188
0.5259	Remote Similarity	NPC15249
0.5259	Remote Similarity	NPC25455
0.5246	Remote Similarity	NPC97700
0.5246	Remote Similarity	NPC30856
0.5221	Remote Similarity	NPC222731
0.5167	Remote Similarity	NPC485603
0.5146	Remote Similarity	NPC100451
0.5124	Remote Similarity	NPC469348
0.5122	Remote Similarity	NPC294129
0.512	Remote Similarity	NPC475625
0.5118	Remote Similarity	NPC83137
0.5113	Remote Similarity	NPC15918
0.5088	Remote Similarity	NPC250393
0.5083	Remote Similarity	NPC42482
0.5082	Remote Similarity	NPC274200
0.5044	Remote Similarity	NPC294686
0.5044	Remote Similarity	NPC234352
0.5043	Remote Similarity	NPC295980
0.5041	Remote Similarity	NPC485604

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC137482 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7580
0.1-0.2	1486
0.2-0.3	74
0.3-0.4	6
0.4-0.5	0
0.5-0.6	2
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6339	Remote Similarity	NPD8449	Approved
0.5505	Remote Similarity	NPD8171	Phase 2
0.5417	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data