10 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
5 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC92830
Formula: C10H8O4
Ingredient ID: NPC92830
| Common Name | 7-Hydroxy-8-Methoxychromen-2-One |
| IUPAC Name | 7-hydroxy-8-methoxychromen-2-one |
| Canonical SMILES | COc1c(O)ccc2c1oc(=O)cc2 |
| Standard InCHI | InChI=1S/C10H8O4/c1-13-10-7(11)4-2-6-3-5-8(12)14-9(6)10/h2-5,11H,1H3 |
| Standard InCHIKey | HAQWEMHXSIRYBE-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5316302 ZINC ID: ZINC000013481600 ChEMBL ID: CHEMBL2331585 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC92830] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Aconitum volubile | Aconitum | Ranunculaceae |
  |
| Derris malaccensis | Derris | Fabaceae |
|
| Artemisia annua | Artemisia | Asteraceae |
|
| Hydrangea macrophylla | Hydrangea | Hydrangeaceae |
|
Ingredient ID: NPC34770
Formula: C14H13NO4
Ingredient ID: NPC34770
| Common Name | Skimmianine |
| IUPAC Name | 4,7,8-trimethoxyfuro[2,3-b]quinoline |
| Canonical SMILES | COc1ccc2c(c1OC)nc1c(c2OC)cco1 |
| Standard InCHI | InChI=1S/C14H13NO4/c1-16-10-5-4-8-11(13(10)18-3)15-14-9(6-7-19-14)12(8)17-2/h4-7H,1-3H3 |
| Standard InCHIKey | SLSIBLKBHNKZTB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 6760 ZINC ID: ZINC000000035525 ChEMBL ID: CHEMBL21396 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC34770] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Glycosmis pseudoracemosa | Glycosmis | Rutaceae |
|
| Platonia insignis | Platonia | Clusiaceae |
|
| Ficus conraui | Ficus | Moraceae |
|
| Matricaria suffruticosa | Matricaria | Asteraceae |
|
| Dictamnus dasycarpus | Dictamnus | Rutaceae |
|
| Corydalis persica | Corydalis | Papaveraceae | |
| Salta triflora | Salta | Polygonaceae | |
| Trapa japonica | Trapa | Lythraceae |
|
| Inula grantioides | Inula | Asteraceae |
|
| Vernonia chloropappa | Vernonia | Asteraceae | |
| Diospyros peregrina | Diospyros | Ebenaceae |
|
| Diospyros elliptifolia | Diospyros | Ebenaceae | |
| Juniperus horizontalis | Juniperus | Cupressaceae |
|
| Acronychia laurifolia | Acronychia | Rutaceae |
|
| Diospyros abyssinica | Diospyros | Ebenaceae |
|
| Cratystylis conocephala | Cratystylis | Asteraceae | |
| Strychnos spinosa | Strychnos | Loganiaceae |
|
| Esenbeckia hartmanii | Esenbeckia | Rutaceae | |
| Talipariti tiliaceum | Talipariti | Malvaceae |
|
| Centaurea calcitrapa | Centaurea | Asteraceae |
|
| Beaucarnea recurvata | Beaucarnea | Asparagaceae | |
| Peperomia pellucida | Peperomia | Piperaceae |
|
| Amomum daniellii | Amomum | Zingiberaceae | |
| Aeollanthus buchnerianus | Aeollanthus | Lamiaceae | |
| Hesperocyparis goveniana var. abramsiana | Hesperocyparis | Cupressaceae | |
| Plectranthus caninus | Plectranthus | Lamiaceae |
|
| Wedelia prostrata | Wedelia | Asteraceae | |
| Erica glauca | Erica | Ericaceae | |
| Lathyrus tingitanus | Lathyrus | Fabaceae |
|
| Echium plantagineum | Echium | Boraginaceae |
|
| Rauvolfia salicifolia | Rauvolfia | Apocynaceae | |
| Balanophora japonica | Balanophora | Balanophoraceae |
|
| Aconitum volubile | Aconitum | Ranunculaceae |
|
| Leucas neufliseana | Leucas | Lamiaceae | |
| Espeletiopsis purpurascens | Espeletiopsis | Asteraceae | |
| Leptospermum recurvum | Leptospermum | Myrtaceae | |
| Cota tinctoria | Cota | Asteraceae |
 |
| Ipomoea nil | Ipomoea | Convolvulaceae |
|
| Pycnarrhena australiana | Pycnarrhena | Menispermaceae | |
| Amomum reticulatum | Amomum | Zingiberaceae | |
| Zanthoxylum planispinum | Zanthoxylum | Rutaceae |
|
| Zanthoxylum avicennae | Zanthoxylum | Rutaceae |
|
| Hernandia sonora | Hernandia | Hernandiaceae |
|
| Helianthus niveus | Helianthus | Asteraceae |
|
| Hosta sieboldiana | Hosta | Asparagaceae |
|
| Plectranthus hereroensis | Plectranthus | Lamiaceae | |
| Udotea petiolata | Udotea | Udoteaceae | |
| Oricia suaveolens | Oricia | Rutaceae | |
| Melicope semecarpifolia | Melicope | Rutaceae |
|
| Cynoglossum viridiflorum | Cynoglossum | Boraginaceae | |
| Citrus trifoliata | Citrus | Rutaceae |
|
| Tecoma pentaphylla | Tecoma | Bignoniaceae | |
| Phellodendron chinense | Phellodendron | Rutaceae |
|
| Inula salsoloides | Inula | Asteraceae | |
| Eutrochium purpureum | Eutrochium | Asteraceae |
|
| Alchornea cordifolia | Alchornea | Euphorbiaceae |
|
| Caralluma russeliana | Caralluma | Apocynaceae | |
| Dalbergia monetaria | Dalbergia | Fabaceae |
|
| Zanthoxylum ailanthoides | Zanthoxylum | Rutaceae |
|
| Ursinia anthemoides | Ursinia | Asteraceae | |
| Imperata cylindrica | Imperata | Poaceae |
|
| Tetradium glabrifolium | Tetradium | Rutaceae | |
| Trollius macropetalus | Trollius | Ranunculaceae | |
| Polypodium aureum | Polypodium | Polypodiaceae | |
| Alpinia officinarum | Alpinia | Zingiberaceae |
|
| Casimiroa edulis | Casimiroa | Rutaceae |
|
| Tylophora asthmatica | Tylophora | Apocynaceae |
|
| Helianthus californicus | Helianthus | Asteraceae | |
| Phellodendron amurense | Phellodendron | Rutaceae |
|
| Morinda coreia | Morinda | Rubiaceae |
|
| Jacobaea cannabifolia | Jacobaea | Asteraceae | |
| Skimmia japonica | Skimmia | Rutaceae |
|
| Conium maculatum | Conium | Apiaceae |
|
| Aglaia pyramidata | Aglaia | Meliaceae | |
| Schrebera swietenoides | Schrebera | Oleaceae |
|
| Senecio gilliesi | Senecio | Asteraceae | |
| Derris malaccensis | Derris | Fabaceae |
|
| Celastrus monospermus | Celastrus | Celastraceae | |
| Beta vulgaris | Beta | Chenopodiaceae |
 |
| Solanum spirale | Solanum | Solanaceae |
|
| Agave deserti | Agave | Asparagaceae |
|
| Asclepias subulata | Asclepias | Apocynaceae |
|
| Strychnos potatorum | Strychnos | Loganiaceae |
|
| Zanthoxylum simulans | Zanthoxylum | Rutaceae |
|
| Phellodendron chinese | Phellodendron | Rutaceae | |
| Daphne tangutica | Daphne | Thymelaeaceae | |
| Jacobaea vulgaris | Jacobaea | Asteraceae | |
| Sophora leachiana | Sophora | Fabaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Sarcomelicope glauca | Sarcomelicope | Rutaceae | |
| Vernonia lilacina | Vernonia | Asteraceae | |
| Wikstroemia chamaedaphne | Wikstroemia | Thymelaeaceae |
|
| Vepris punctata | Vepris | Rutaceae | |
| Passiflora morifolia | Passiflora | Passifloraceae |
|
| Orixa japonica | Orixa | Rutaceae |
|
| Trifolium montanum | Trifolium | Fabaceae | |
| Limonium bicolor | Limonium | Plumbaginaceae | |
| Ruta graveolens | Ruta | Rutaceae |
|
| Hortonia floribunda | Hortonia | Monimiaceae | |
| Corynanthe pachyceras | Corynanthe | Rubiaceae | |
| Ulmus americana | Ulmus | Ulmaceae |
|
| Peucedanum praeruptorum | Peucedanum | Apiaceae |
|
| Reaumuria hirtella | Reaumuria | Tamaricaceae | |
| Vitellaria paradoxa | Vitellaria | Sapotaceae |
|
| Centaurea arenaria | Centaurea | Asteraceae | |
| Coleus esquirolii | Coleus | Lamiaceae | |
| Scorzonera hispanica | Scorzonera | Asteraceae |
|
| Zanthoxylum bungeanum | Zanthoxylum | Rutaceae |
|
| Peucedanum oroselinum | Peucedanum | Apiaceae | |
| Ageratina saltillensis | Ageratina | Asteraceae | |
| Cynoglossum amabile | Cynoglossum | Boraginaceae |
|
| Litsea glutinosa | Litsea | Lauraceae |
|
| Vicia balansae | Vicia | Fabaceae | |
| Echinosophora koreensis | Echinosophora | Fabaceae | |
| Gutenbergia cordifolia | Gutenbergia | Asteraceae |
|
| Glycosmis cochinchinensis | Glycosmis | Rutaceae |
|
| Garcinia intermedia | Garcinia | Clusiaceae |
|
| Bellium bellidioides | Bellium | Asteraceae | |
| Elegia deusta | Elegia | Restionaceae | |
| Atalantia wightii | Atalantia | Rutaceae | |
| Sida veronicaefolia | Sida | Malvaceae |
|
| Salvia polystachya | Salvia | Lamiaceae |
|
| Toddalia asiatica | Toddalia | Rutaceae |
|
| Spiraea prunifolia | Spiraea | Rosaceae |
|
| Salvia munzii | Salvia | Lamiaceae | |
| Kielmeyera coriacea | Kielmeyera | Calophyllaceae |
|
| Solanum transcaucasicum | Solanum | Solanaceae | |
| Senecio densiflorus | Senecio | Asteraceae | |
| Grewia villosa | Grewia | Malvaceae |
|
| Consolida hohenackeri | Consolida | Ranunculaceae | |
| Angelica taiwaniana | Angelica | Apiaceae |
|
| Lithospermum officinale | Lithospermum | Boraginaceae |
|
| Zanthoxylum schinifolium | Zanthoxylum | Rutaceae |
|
| Euonymus europaeus | Euonymus | Celastraceae |
|
| Persicaria tinctoria | Persicaria | Polygonaceae |
|
| Sarcococca vagans | Sarcococca | Buxaceae |
|
| Trachelospermum lucidum | Trachelospermum | Apocynaceae |
|
| Phyllodium pulchellum | Phyllodium | Fabaceae |
|
| Zanthoxylum nitidum | Zanthoxylum | Rutaceae |
|
| Mikania scandens | Mikania | Asteraceae |
|
| Cotylelobium scabriusculum | Cotylelobium | Dipterocarpaceae | |
| Cynara humilis | Cynara | Asteraceae |
|
Ingredient ID: NPC32557
Formula: C19H18O7
Ingredient ID: NPC32557
| Common Name | n.a. |
| IUPAC Name | 5-hydroxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| Canonical SMILES | COc1ccc(cc1)c1oc2c(OC)c(OC)cc(c2c(=O)c1OC)O |
| Standard InCHI | InChI=1S/C19H18O7/c1-22-11-7-5-10(6-8-11)16-19(25-4)15(21)14-12(20)9-13(23-2)17(24-3)18(14)26-16/h5-9,20H,1-4H3 |
| Standard InCHIKey | SQOMVBRIXCJFKW-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5466138 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD52451] Database: NPASS [NPC32557] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Aconitum volubile | Aconitum | Ranunculaceae |
|
| Derris malaccensis | Derris | Fabaceae |
|
| Sophora mollis | Sophora | Fabaceae |
|
Ingredient ID: NPC245210
Formula: C17H17NO6
Ingredient ID: NPC245210
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O[C@@H](C(O)(C)C)COc1c2ccoc2nc2c1cc1OCOc1c2 |
| Standard InCHI | InChI=1S/C17H17NO6/c1-17(2,20)14(19)7-22-15-9-3-4-21-16(9)18-11-6-13-12(5-10(11)15)23-8-24-13/h3-6,14,19-20H,7-8H2,1-2H3/t14-/m1/s1 |
| Standard InCHIKey | WRQKGGQCQJIVGY-CQSZACIVSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD132622] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Aconitum volubile | Aconitum | Ranunculaceae |
|
| Derris malaccensis | Derris | Fabaceae |
|
Ingredient ID: NPC217176
Formula: C14H13NO4
Ingredient ID: NPC217176
| Common Name | Kokusaginine |
| IUPAC Name | 4,6,7-trimethoxyfuro[2,3-b]quinoline |
| Canonical SMILES | COc1cc2c(cc1OC)nc1c(c2OC)cco1 |
| Standard InCHI | InChI=1S/C14H13NO4/c1-16-11-6-9-10(7-12(11)17-2)15-14-8(4-5-19-14)13(9)18-3/h4-7H,1-3H3 |
| Standard InCHIKey | JBRXRVFXQIKPEA-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 10227 ZINC ID: ZINC000000900216 ChEMBL ID: CHEMBL278779 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC217176] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Aeollanthus buchnerianus | Aeollanthus | Lamiaceae | |
| Echium plantagineum | Echium | Boraginaceae |
|
| Aconitum volubile | Aconitum | Ranunculaceae |
|
| Leptospermum recurvum | Leptospermum | Myrtaceae | |
| Hernandia sonora | Hernandia | Hernandiaceae |
|
| Helianthus niveus | Helianthus | Asteraceae |
|
| Oricia suaveolens | Oricia | Rutaceae | |
| Melicope semecarpifolia | Melicope | Rutaceae |
|
| Cynoglossum viridiflorum | Cynoglossum | Boraginaceae | |
| Derris malaccensis | Derris | Fabaceae |
|
| Strychnos potatorum | Strychnos | Loganiaceae |
|
| Euphorbia hirta | Euphorbia | Euphorbiaceae |
|
| Daphne tangutica | Daphne | Thymelaeaceae | |
| Sarcomelicope glauca | Sarcomelicope | Rutaceae | |
| Vepris punctata | Vepris | Rutaceae | |
| Orixa japonica | Orixa | Rutaceae |
|
| Limonium bicolor | Limonium | Plumbaginaceae | |
| Ruta graveolens | Ruta | Rutaceae |
|
| Vitellaria paradoxa | Vitellaria | Sapotaceae |
|
| Zanthoxylum bungeanum | Zanthoxylum | Rutaceae |
|
| Glycosmis cochinchinensis | Glycosmis | Rutaceae |
|
Ingredient ID: NPC19242
Formula: C20H24O4
Ingredient ID: NPC19242
| Common Name | n.a. |
| IUPAC Name | 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-8-methoxychromen-2-one |
| Canonical SMILES | COc1c(OC/C=C(/CCC=C(C)C)C)ccc2c1oc(=O)cc2 |
| Standard InCHI | InChI=1S/C20H24O4/c1-14(2)6-5-7-15(3)12-13-23-17-10-8-16-9-11-18(21)24-19(16)20(17)22-4/h6,8-12H,5,7,13H2,1-4H3/b15-12+ |
| Standard InCHIKey | MJWGWXGEAHRWOV-NTCAYCPXSA-N |
| Ingredient External Links |
PubChem CID: 5316012 ZINC ID: ZINC000001664038 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC19242] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Aconitum volubile | Aconitum | Ranunculaceae |
|
| Derris malaccensis | Derris | Fabaceae |
|
| Zanthoxylum schinifolium | Zanthoxylum | Rutaceae |
|
Ingredient ID: NPC173250
Formula: C14H11NO5
Ingredient ID: NPC173250
| Common Name | Flindersiamine |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1c2OCOc2cc2c1nc1occc1c2OC |
| Standard InCHI | InChI=1S/C14H11NO5/c1-16-11-7-3-4-18-14(7)15-10-8(11)5-9-12(13(10)17-2)20-6-19-9/h3-5H,6H2,1-2H3 |
| Standard InCHIKey | IMJCEVWDXKCHOI-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 68221 ZINC ID: ZINC000000900182 ChEMBL ID: CHEMBL503519 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC173250] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Aconitum volubile | Aconitum | Ranunculaceae |
|
| Oricia suaveolens | Oricia | Rutaceae | |
| Derris malaccensis | Derris | Fabaceae |
|
| Vepris punctata | Vepris | Rutaceae |
Ingredient ID: NPC168922
Formula: C13H9NO4
Ingredient ID: NPC168922
| Common Name | Maculine |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1c2cc3OCOc3cc2nc2c1cco2 |
| Standard InCHI | InChI=1S/C13H9NO4/c1-15-12-7-2-3-16-13(7)14-9-5-11-10(4-8(9)12)17-6-18-11/h2-5H,6H2,1H3 |
| Standard InCHIKey | VPNYHHBCMOYPCJ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 68232 ZINC ID: ZINC000000900237 ChEMBL ID: CHEMBL503675 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC168922] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Aeollanthus buchnerianus | Aeollanthus | Lamiaceae | |
| Echium plantagineum | Echium | Boraginaceae |
|
| Aconitum volubile | Aconitum | Ranunculaceae |
|
| Leptospermum recurvum | Leptospermum | Myrtaceae | |
| Hernandia sonora | Hernandia | Hernandiaceae |
|
| Helianthus niveus | Helianthus | Asteraceae |
|
| Oricia suaveolens | Oricia | Rutaceae | |
| Cynoglossum viridiflorum | Cynoglossum | Boraginaceae | |
| Derris malaccensis | Derris | Fabaceae |
|
| Vepris punctata | Vepris | Rutaceae |
Ingredient ID: NPC140296
Formula: C14H13NO4
Ingredient ID: NPC140296
| Common Name | n.a. |
| IUPAC Name | 4,6,8-trimethoxyfuro[2,3-b]quinoline |
| Canonical SMILES | COc1cc(OC)c2c(c1)c(OC)c1c(n2)occ1 |
| Standard InCHI | InChI=1S/C14H13NO4/c1-16-8-6-10-12(11(7-8)17-2)15-14-9(4-5-19-14)13(10)18-3/h4-7H,1-3H3 |
| Standard InCHIKey | SHAVHFJCSQWTFF-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 68222 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD128832] Database: NPASS [NPC140296] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Aeollanthus buchnerianus | Aeollanthus | Lamiaceae | |
| Echium plantagineum | Echium | Boraginaceae |
|
| Aconitum volubile | Aconitum | Ranunculaceae |
|
| Leptospermum recurvum | Leptospermum | Myrtaceae | |
| Hernandia sonora | Hernandia | Hernandiaceae |
|
| Helianthus niveus | Helianthus | Asteraceae |
|
| Cynoglossum viridiflorum | Cynoglossum | Boraginaceae | |
| Derris malaccensis | Derris | Fabaceae |
|
Ingredient ID: NPC120900
Formula: C20H24O4
Ingredient ID: NPC120900
| Common Name | n.a. |
| IUPAC Name | 7-(3,7-dimethylocta-2,6-dienoxy)-8-methoxychromen-2-one |
| Canonical SMILES | COc1c(OCC=C(CCC=C(C)C)C)ccc2c1oc(=O)cc2 |
| Standard InCHI | InChI=1S/C20H24O4/c1-14(2)6-5-7-15(3)12-13-23-17-10-8-16-9-11-18(21)24-19(16)20(17)22-4/h6,8-12H,5,7,13H2,1-4H3 |
| Standard InCHIKey | MJWGWXGEAHRWOV-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 233381 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD217827] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Aconitum volubile | Aconitum | Ranunculaceae |
|
| Derris malaccensis | Derris | Fabaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC120900 | C20H24O4 | 7-(3,7-dimethylocta-2,6-dienoxy)-8-methoxychromen-2-one | 328.1674592 | 2.8641 | 3.22 | 4.63 | 1 | 0 | 44.76 | 7 | 2 | 24 | 0 |
| NPC140296 | C14H13NO4 | 259.0844579 | -0.3095 | 2.45 | 1.624 | 1 | 0 | 53.72 | 6 | 3 | 19 | 0 | |
| NPC168922 | C13H9NO4 | Maculine | 243.05 | -0.5086 | 2.34 | 1.551 | 1 | 0 | 53.72 | 2 | 4 | 18 | 0 |
| NPC173250 | C14H11NO5 | Flindersiamine | 273.06 | -0.5604 | 2.34 | 1.107 | 1 | 0 | 62.95 | 4 | 4 | 20 | 0 |
| NPC19242 | C20H24O4 | 328.1674592 | 2.8641 | 3.22 | 4.63 | 1 | 0 | 44.76 | 11 | 2 | 24 | 0 | |
| NPC217176 | C14H13NO4 | Kokusaginine | 259.08 | -0.3095 | 2.45 | 1.624 | 1 | 0 | 53.72 | 6 | 3 | 19 | 0 |
| NPC245210 | C17H17NO6 | 331.1055873 | -0.9762 | 2.56 | 1.047 | 3 | 2 | 94.18 | 4 | 4 | 24 | 0 | |
| NPC32557 | C19H18O7 | 358.1052529 | -1.5112 | 2.78 | 2.401 | 2 | 1 | 83.45 | 10 | 3 | 26 | 0 | |
| NPC34770 | C14H13NO4 | Skimmianine | 259.08 | -0.3095 | 2.45 | 1.624 | 1 | 0 | 53.72 | 6 | 3 | 19 | 0 |
| NPC92830 | C10H8O4 | 7-Hydroxy-8-Methoxychromen-2-One | 192.04 | -0.2421 | 2.12 | 1.088 | 1 | 1 | 55.76 | 3 | 2 | 14 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
