NPASS Compound

Natural Product: NPC531283

Natural Product ID	NPC531283
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{S},4~{R},5~{R},6~{R})-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1~{S},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{R},16~{S})-7,9,13-trimethyl-5'-[[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-ene-6,2'-tetrahydropyran]-16-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{S},4~{R},5~{R},6~{R})-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1~{S},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{R},16~{S})-7,9,13-trimethyl-5'-[[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-ene-6,2'-tetrahydropyran]-16-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135143 0 0 0 0 0 0 0 0999 V2000 -12.0053 2.7639 0.9798 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6071 1.5545 1.7825 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.5958 0.3964 1.0286 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0663 -0.7015 1.6594 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6992 -0.7591 1.3816 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3121 -1.8034 0.5836 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7576 -1.1593 -0.7009 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3452 -2.1520 -1.5900 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5536 -0.3296 -0.2244 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9917 0.4293 0.8511 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4948 -1.3347 0.2026 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5257 -1.3704 -0.7661 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2471 -1.0775 -0.3040 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2346 -2.0894 -0.5722 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5249 -1.9454 -1.8954 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7570 -0.6332 -1.9404 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0061 0.0567 -3.2355 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3034 0.2236 -0.8235 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5525 0.8111 0.0697 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0725 0.7231 0.1226 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4528 0.3132 -1.2116 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8124 -0.2349 -1.0232 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8065 0.5004 -0.2260 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0127 -0.4268 -0.5407 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1965 0.0639 -0.1895 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8077 0.7196 -1.2879 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9695 2.1314 -0.8079 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2859 2.3695 -0.0723 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3193 1.9002 -1.1167 C 0 0 1 0 0 0 0 0 0 0 0 0 9.6173 2.5058 -0.8326 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3139 2.3337 0.2886 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8710 1.1092 0.6116 C 0 0 1 0 0 0 0 0 0 0 0 0 12.2660 1.1572 0.4133 O 0 0 0 0 0 0 0 0 0 0 0 0 13.0161 1.2940 1.5362 C 0 0 2 0 0 0 0 0 0 0 0 0 14.4588 1.4237 1.1706 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9148 0.2970 0.4849 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7774 0.0282 2.3918 C 0 0 1 0 0 0 0 0 0 0 0 0 13.7215 0.0882 3.4128 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3943 0.2366 2.9579 C 0 0 2 0 0 0 0 0 0 0 0 0 10.9867 -0.8870 3.6795 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4196 0.4994 1.8759 C 0 0 1 0 0 0 0 0 0 0 0 0 9.4335 1.3557 2.4552 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1575 0.4360 -1.1895 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9092 0.0137 -1.5855 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7674 0.7131 -2.4059 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4485 0.3869 -3.7375 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8964 -0.4686 -2.0529 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4566 -0.2973 -2.4063 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1714 0.8906 -3.2556 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7943 -1.5069 -3.0268 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3144 -1.4311 -3.0082 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3234 -0.9058 -1.7544 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7833 0.3018 -0.7381 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0554 -2.6181 0.3053 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1589 -2.5959 1.1700 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6328 -4.0394 1.2957 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7172 -4.1811 2.1237 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3647 -0.7906 3.1095 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.5962 -2.1215 3.4659 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.6277 -0.0272 3.4301 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.7042 -0.6585 2.8540 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.4442 1.4073 3.0261 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.7847 2.0654 4.0660 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.7663 2.5698 0.2086 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4919 3.4904 1.6944 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1233 3.2731 0.5530 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5573 1.7343 2.1014 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5181 -1.6046 1.1469 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1418 -2.4567 0.2589 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4930 -0.4812 -1.1425 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4554 -2.0099 -1.9630 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2501 0.2818 -1.0899 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2674 0.4388 1.5229 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1285 -1.0328 1.2016 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3899 -0.9562 0.8197 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6937 -3.1186 -0.5697 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4473 -2.0473 0.2130 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8609 -2.8085 -2.0334 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2849 -1.9526 -2.6938 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1408 -0.6463 -4.0896 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1754 0.7930 -3.4731 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9129 0.6928 -3.2285 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0776 1.4205 0.8376 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2488 -0.0463 0.8713 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3354 1.7199 0.3695 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3681 1.1830 -1.8862 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7280 -1.2767 -0.6361 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9853 1.5242 -0.5468 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5886 0.3690 0.8569 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7165 -1.4178 -0.1649 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9807 2.8245 -1.6771 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1637 2.4708 -0.1434 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3728 3.4234 0.1637 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3734 1.6756 0.7791 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9258 2.3224 -2.0988 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4291 3.6523 -0.8987 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2631 2.3055 -1.7782 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5563 0.4233 -0.2434 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7491 2.1425 2.2048 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1081 1.5189 2.0805 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6487 2.2890 0.5384 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1069 -0.1721 0.1483 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8968 -0.8635 1.7826 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4698 -0.5456 3.3003 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4744 1.1303 3.6297 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7542 -1.5082 3.7111 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8641 -0.4510 1.6573 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8780 0.8770 3.0962 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2945 0.0093 -0.1748 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9616 0.0073 -1.8251 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2515 1.6675 -2.4091 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4805 1.2564 -4.4181 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4594 -0.0205 -3.4963 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9054 -0.4181 -4.2378 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3114 -1.3981 -2.4524 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9234 0.9197 -4.0714 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0891 1.8543 -2.7213 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1997 0.7263 -3.7783 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1718 -2.4226 -2.5156 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1459 -1.5798 -4.0729 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1107 -0.9039 -3.9096 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0581 -2.4923 -3.1269 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1979 -1.6710 -0.9633 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1175 1.0945 -0.0309 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2017 0.5259 -1.7387 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8891 -2.2034 2.1578 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8046 -4.6869 1.6734 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8910 -4.4460 0.2892 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3647 -4.2636 3.0617 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5684 -0.3373 3.7527 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5409 -2.3051 3.3331 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8026 -0.0185 4.5349 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.2169 -0.0012 2.3185 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3934 1.9534 2.8457 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7709 3.0494 3.8432 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 1 0 9 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 6 16 18 1 0 18 19 2 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 26 25 1 1 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 34 37 1 0 37 38 1 0 37 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 29 43 1 0 43 44 1 0 26 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 48 49 1 6 48 50 1 0 50 51 1 0 51 52 1 0 18 53 1 0 11 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 4 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 60 62 1 0 62 63 1 0 62 2 1 0 55 6 1 0 53 13 1 0 52 16 1 0 52 21 1 0 48 22 1 0 47 24 1 0 44 26 1 0 41 32 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 1 4 68 1 6 6 69 1 6 7 70 1 6 8 71 1 0 9 72 1 6 10 73 1 0 11 74 1 1 13 75 1 1 14 76 1 0 14 77 1 0 15 78 1 0 15 79 1 0 17 80 1 0 17 81 1 0 17 82 1 0 19 83 1 0 20 84 1 0 20 85 1 0 21 86 1 6 22 87 1 1 23 88 1 0 23 89 1 0 24 90 1 1 27 91 1 0 27 92 1 0 28 93 1 0 28 94 1 0 29 95 1 6 30 96 1 0 30 97 1 0 32 98 1 6 34 99 1 1 35100 1 0 35101 1 0 36102 1 0 37103 1 6 38104 1 0 39105 1 1 40106 1 0 41107 1 6 42108 1 0 43109 1 0 43110 1 0 45111 1 6 46112 1 0 46113 1 0 46114 1 0 47115 1 6 49116 1 0 49117 1 0 49118 1 0 50119 1 0 50120 1 0 51121 1 0 51122 1 0 52123 1 1 53124 1 0 53125 1 0 55126 1 1 56127 1 0 56128 1 0 57129 1 0 58130 1 1 59131 1 0 60132 1 1 61133 1 0 62134 1 6 63135 1 0 M END

Standard InCHIKey	GJLJBRRNGJSLJS-ZGOLRGPWSA-N
Standard InCHI	InChI=1S/C45H72O18/c1-19-30-27(63-45(19)12-7-21(18-57-45)17-56-40-36(53)34(51)32(49)28(15-46)60-40)14-26-24-6-5-22-13-23(8-10-43(22,3)25(24)9-11-44(26,30)4)59-42-38(55)35(52)39(29(16-47)61-42)62-41-37(54)33(50)31(48)20(2)58-41/h5,19-21,23-42,46-55H,6-18H2,1-4H3/t19-,20-,21-,23-,24+,25-,26-,27-,28+,29+,30-,31-,32+,33+,34-,35+,36+,37+,38+,39+,40-,41-,42+,43-,44-,45+/m0/s1
SMILES	C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O[C@H]3CC[C@@]4(C)C(=CC[C@H]5[C@@H]6C[C@@H]7O[C@]8(CC[C@@H](CO[C@H]9O[C@H](CO)[C@@H](O)[C@H](O)[C@H]9O)CO8)[C@@H](C)[C@@H]7[C@@]6(C)CC[C@@H]54)C3)O[C@@H]2CO)[C@H](O)[C@H](O)[C@H]1O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	900.47	Volume:	865.455 ? Van der Waals volume.
Dense:	1.04	LogP:	1.178 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.935 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.379 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	48.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.127	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.728	Fsp³:	0.956
MCE-18:	229.091 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.665	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.207	Promiscuous compounds:	0.008

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.749	MDCK Permeability:	-4.846
Pgp-inhibitor:	0.0	Pgp-substrate:	0.951
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.002
20% Bioavailability (F20%):	0.014	30% Bioavailability (F30%):	0.864
50% Bioavailability (F50%):	0.937

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.002
Plasma Protein Binding (PPB):	62.068%	Volume Distribution (VD):	-0.383
Fu:	29.835% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.019
BSEP inhibitor:	0.007

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.035	CYP3A4-substrate:	0.007
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.004
HLM stability:	0.007 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.281

Half-life (T1/2):

3.449

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.021
Human Hepatotoxicity (H-HT):	0.543	Drug-induced Liver Injury (DILI):	0.989
AMES Toxicity:	0.978	Rat Oral Acute Toxicity:	0.012
Maximum Recommended Daily Dose:	0.008	Skin Sensitization:	1.0
Carcinogencity:	0.266	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.635	Drug-induced Nephrotoxicity:	0.995
Genotoxicity:	0.507	RPMI-8226 Immunitoxicity:	0.385
A549 Cytotoxicity:	0.928	Hek293 Cytotoxicity:	0.829
BCF:	1.643 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.434 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.564 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.915 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO19123	Polygonatum zanlanscianense	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[15620239]
NPO19123	Polygonatum zanlanscianense	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19123	Polygonatum zanlanscianense	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO19123	Polygonatum zanlanscianense	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO19123	Polygonatum zanlanscianense	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC531283 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22902
0.1-0.2	23038
0.2-0.3	3026
0.3-0.4	632
0.4-0.5	125
0.5-0.6	78
0.6-0.7	24
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC6806
0.8587	High Similarity	NPC470432
0.8587	High Similarity	NPC230507
0.798	Intermediate Similarity	NPC249553
0.77	Intermediate Similarity	NPC477809
0.7609	Intermediate Similarity	NPC181845
0.7549	Intermediate Similarity	NPC480555
0.7549	Intermediate Similarity	NPC150372
0.7333	Intermediate Similarity	NPC475550
0.7282	Intermediate Similarity	NPC300557
0.7282	Intermediate Similarity	NPC182900
0.7255	Intermediate Similarity	NPC470433
0.7255	Intermediate Similarity	NPC46190
0.7255	Intermediate Similarity	NPC171073
0.7196	Intermediate Similarity	NPC194207
0.7196	Intermediate Similarity	NPC22779
0.7184	Intermediate Similarity	NPC248746
0.717	Intermediate Similarity	NPC269297
0.717	Intermediate Similarity	NPC222202
0.7156	Intermediate Similarity	NPC477811
0.7129	Intermediate Similarity	NPC113044
0.7129	Intermediate Similarity	NPC283829
0.7129	Intermediate Similarity	NPC14704
0.7129	Intermediate Similarity	NPC161676
0.7103	Intermediate Similarity	NPC475333
0.7103	Intermediate Similarity	NPC224098
0.7103	Intermediate Similarity	NPC208383
0.7087	Intermediate Similarity	NPC602423
0.7	Intermediate Similarity	NPC480553
0.6944	Remote Similarity	NPC309278
0.6875	Remote Similarity	NPC232054
0.6818	Remote Similarity	NPC480554
0.6792	Remote Similarity	NPC42171
0.6696	Remote Similarity	NPC480556
0.6638	Remote Similarity	NPC224314
0.6633	Remote Similarity	NPC325828
0.6491	Remote Similarity	NPC31896
0.6442	Remote Similarity	NPC15249
0.6442	Remote Similarity	NPC25455
0.6339	Remote Similarity	NPC32361
0.625	Remote Similarity	NPC247037
0.6216	Remote Similarity	NPC73243
0.6216	Remote Similarity	NPC244086
0.6216	Remote Similarity	NPC84956
0.6174	Remote Similarity	NPC23808
0.6174	Remote Similarity	NPC87998
0.6168	Remote Similarity	NPC305423
0.6167	Remote Similarity	NPC477808
0.6117	Remote Similarity	NPC250393
0.6116	Remote Similarity	NPC210569
0.6038	Remote Similarity	NPC107962
0.6	Remote Similarity	NPC486114
0.6	Remote Similarity	NPC107188
0.5982	Remote Similarity	NPC475182
0.5968	Remote Similarity	NPC305771
0.5968	Remote Similarity	NPC94072
0.5968	Remote Similarity	NPC169816
0.595	Remote Similarity	NPC477807
0.5948	Remote Similarity	NPC249265
0.5941	Remote Similarity	NPC485594
0.5929	Remote Similarity	NPC97700
0.5929	Remote Similarity	NPC30856
0.5929	Remote Similarity	NPC102016
0.5929	Remote Similarity	NPC95051
0.5913	Remote Similarity	NPC13193
0.5909	Remote Similarity	NPC98696
0.5833	Remote Similarity	NPC94272
0.5833	Remote Similarity	NPC6295
0.5798	Remote Similarity	NPC308140
0.578	Remote Similarity	NPC141433
0.5726	Remote Similarity	NPC15918
0.5714	Remote Similarity	NPC244431
0.5714	Remote Similarity	NPC263359
0.5678	Remote Similarity	NPC218571
0.5678	Remote Similarity	NPC487615
0.5652	Remote Similarity	NPC184617
0.563	Remote Similarity	NPC83137
0.5607	Remote Similarity	NPC121453
0.5583	Remote Similarity	NPC132080
0.5565	Remote Similarity	NPC150057
0.5565	Remote Similarity	NPC147753
0.5556	Remote Similarity	NPC19400
0.5526	Remote Similarity	NPC122819
0.5508	Remote Similarity	NPC116756
0.5487	Remote Similarity	NPC161738
0.5464	Remote Similarity	NPC100451
0.5421	Remote Similarity	NPC477451
0.5417	Remote Similarity	NPC470864
0.5413	Remote Similarity	NPC306131
0.5413	Remote Similarity	NPC200802
0.5405	Remote Similarity	NPC485595
0.5378	Remote Similarity	NPC475625
0.5357	Remote Similarity	NPC195297
0.5345	Remote Similarity	NPC124677
0.5339	Remote Similarity	NPC115165
0.5333	Remote Similarity	NPC232037
0.5327	Remote Similarity	NPC234352
0.5321	Remote Similarity	NPC206003
0.5321	Remote Similarity	NPC473610
0.5315	Remote Similarity	NPC295980
0.531	Remote Similarity	NPC160426
0.5285	Remote Similarity	NPC287885
0.5273	Remote Similarity	NPC211354
0.5263	Remote Similarity	NPC475351
0.5259	Remote Similarity	NPC92890
0.5254	Remote Similarity	NPC294129
0.5234	Remote Similarity	NPC297348
0.5234	Remote Similarity	NPC249204
0.5234	Remote Similarity	NPC48339
0.5234	Remote Similarity	NPC141769
0.5234	Remote Similarity	NPC477547
0.5221	Remote Similarity	NPC70204
0.5217	Remote Similarity	NPC42482
0.5217	Remote Similarity	NPC40440
0.5207	Remote Similarity	NPC254255
0.5203	Remote Similarity	NPC233433
0.52	Remote Similarity	NPC470866
0.5167	Remote Similarity	NPC486386
0.5152	Remote Similarity	NPC486119
0.5124	Remote Similarity	NPC473518
0.5122	Remote Similarity	NPC476112
0.5122	Remote Similarity	NPC307534
0.5116	Remote Similarity	NPC79900
0.5102	Remote Similarity	NPC235126
0.5102	Remote Similarity	NPC242419
0.51	Remote Similarity	NPC22140
0.51	Remote Similarity	NPC243728
0.51	Remote Similarity	NPC158088
0.5086	Remote Similarity	NPC486388
0.5082	Remote Similarity	NPC63609
0.5042	Remote Similarity	NPC128572

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC531283 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7372
0.1-0.2	1682
0.2-0.3	84
0.3-0.4	8
0.4-0.5	0
0.5-0.6	3
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6633	Remote Similarity	NPD8171	Phase 2
0.5981	Remote Similarity	NPD8170	Phase 2
0.5565	Remote Similarity	NPD8450	Suspended
0.5526	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data