NPASS Compound

Natural Product: NPC513922

Natural Product ID	NPC513922
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{S},6~{R})-5-hydroxy-6-(hydroxymethyl)-2-[(1~{R},2~{S},4~{S},5'~{R},6~{R},7~{S},8~{R},9~{S},10~{R},12~{S},13~{R},16~{S})-10-hydroxy-5',7,9,13-tetramethyl-spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-ene-6,2'-tetrahydropyran]-16-yl]oxy-4-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{S},6~{R})-5-hydroxy-6-(hydroxymethyl)-2-[(1~{R},2~{S},4~{S},5'~{R},6~{R},7~{S},8~{R},9~{S},10~{R},12~{S},13~{R},16~{S})-10-hydroxy-5',7,9,13-tetramethyl-spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-ene-6,2'-tetrahydropyran]-16-yl]oxy-4-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135143 0 0 0 0 0 0 0 0999 V2000 13.3275 -1.3115 0.0298 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8921 -0.8455 0.0853 C 0 0 2 0 0 0 0 0 0 0 0 0 11.2423 -1.3180 1.3608 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7633 -1.3789 1.3242 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0902 -0.9540 0.0938 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8541 -0.7899 -1.0244 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0581 -1.4345 -1.0344 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0052 -1.7942 -0.2546 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2476 -1.0561 -1.1494 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8148 -1.5730 -1.2404 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9958 -0.3767 -0.8520 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6318 -0.6750 -0.3211 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7968 -1.4494 -1.3202 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3673 -1.2529 -1.0221 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8819 -0.4997 -0.0694 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5957 -0.3788 0.1358 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0577 1.0269 -0.1374 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1968 1.3331 0.5636 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2605 1.7226 -0.2174 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4678 3.0806 0.0728 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1117 3.3451 1.2418 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3387 2.9640 2.4936 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1289 3.6395 2.5807 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5443 2.8456 1.3227 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7444 2.1997 2.5206 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6808 1.8435 0.1726 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8807 1.2322 0.1736 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7299 1.6885 -0.8395 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.8221 2.3064 -0.2301 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9421 2.2944 -1.0609 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.0257 3.1010 -0.3831 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3846 2.5939 0.8429 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.4956 0.8754 -1.2364 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.9226 0.7552 -2.5430 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3496 -0.1024 -0.9785 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.0632 -0.1827 0.3729 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1449 0.5252 -1.6926 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5527 0.9449 -2.9678 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5078 0.9282 0.1354 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6902 -0.0564 -0.8028 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5136 -1.3545 -0.2836 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5932 -1.9715 -1.0812 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6544 -3.3377 -1.1584 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1277 -4.0114 0.0835 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9864 -3.8854 -1.6142 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9663 -4.3748 -2.9132 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0352 -2.7674 -1.5718 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2999 -3.3607 -1.5920 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8335 -2.0886 -0.2336 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7707 -3.1475 0.7056 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0783 1.9968 0.1904 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9447 1.4501 1.3091 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7747 0.2844 0.8623 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0525 -0.5972 2.0327 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9724 0.6276 0.0219 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8347 1.6988 0.5568 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2770 1.4823 0.7251 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6825 1.6690 2.0705 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8378 0.1665 0.2823 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9170 -0.7553 1.4500 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1424 0.3139 -0.4670 C 0 0 1 0 0 0 0 0 0 0 0 0 8.3685 0.3817 0.3433 C 0 0 2 0 0 0 0 0 0 0 0 0 9.2303 1.5093 -0.2524 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3743 -2.3588 -0.2624 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8952 -0.6214 -0.6211 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7451 -1.1902 1.0628 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8304 0.2614 -0.0173 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6987 -2.3287 1.5781 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6300 -0.6661 2.1982 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4494 -2.4396 1.5520 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3800 -0.7980 2.2156 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9912 -2.5400 -0.8585 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5745 -1.1938 -1.9828 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7160 -0.9669 -2.1483 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6396 -2.4792 -0.6687 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6383 -1.8251 -2.3179 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9669 0.3507 -1.6661 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7266 -1.3485 0.5680 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0389 -1.1098 -2.3533 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0991 -2.5254 -1.2406 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6498 -1.7892 -1.6597 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1129 -1.0801 -0.5648 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8795 -0.7340 1.1546 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2930 1.1225 -1.2224 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0195 1.6701 -1.2764 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1803 4.4731 1.3035 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9197 3.2779 3.4114 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1747 1.8940 2.6014 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4348 3.0960 3.0597 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2222 3.6998 1.1867 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5000 2.5656 3.0407 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6619 2.5353 -0.7377 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2124 2.4731 -1.4326 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7374 2.7686 -2.0388 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7421 4.1688 -0.2742 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9400 3.1143 -1.0450 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2937 2.8341 1.1213 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3330 0.6800 -0.5632 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8004 0.2909 -2.6365 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5227 -1.0812 -1.4283 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2554 -1.0980 0.7407 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2995 -0.1711 -1.7833 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6695 0.1066 -3.5129 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3331 0.4100 1.1251 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2087 -1.2106 0.7840 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9290 -3.6273 -1.9790 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7004 -4.9109 0.3351 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0614 -4.3641 -0.0463 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0429 -3.2879 0.9468 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3425 -4.6690 -0.8932 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3952 -3.7662 -3.4531 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8905 -2.0441 -2.3868 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9055 -2.9582 -0.9203 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6868 -1.4888 0.0738 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1154 -2.8697 1.5845 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4018 2.9143 0.5827 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6522 2.2869 -0.7000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4564 2.2557 1.8174 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2133 1.0253 2.0608 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0493 -1.6933 1.7790 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2515 -0.4807 2.8081 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9937 -0.4062 2.5475 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5372 0.9997 -0.9570 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6878 2.6616 -0.0169 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4235 1.9707 1.5773 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8838 2.2682 0.1776 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8978 1.9894 2.5569 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9653 -0.8398 1.8265 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3659 -0.3027 2.3011 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5809 -1.7945 1.2448 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0058 1.1222 -1.2042 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2815 0.6288 1.3977 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5079 2.3024 -0.5856 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8645 1.1446 -1.0760 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8937 1.9515 0.5137 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 6 6 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 30 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 26 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 17 51 1 0 51 52 1 0 52 53 1 0 53 54 1 1 53 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 57 59 1 0 59 60 1 1 59 61 1 0 61 62 1 0 62 63 1 0 7 2 1 0 61 9 1 0 62 5 1 0 59 11 1 0 55 12 1 0 53 15 1 0 39 19 1 0 49 41 1 0 37 28 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 1 3 68 1 0 3 69 1 0 4 70 1 0 4 71 1 0 7 72 1 0 7 73 1 0 9 74 1 6 10 75 1 0 10 76 1 0 11 77 1 6 12 78 1 1 13 79 1 0 13 80 1 0 14 81 1 0 16 82 1 0 16 83 1 0 17 84 1 6 19 85 1 6 21 86 1 1 22 87 1 0 22 88 1 0 23 89 1 0 24 90 1 6 25 91 1 0 26 92 1 6 28 93 1 6 30 94 1 6 31 95 1 0 31 96 1 0 32 97 1 0 33 98 1 1 34 99 1 0 35100 1 6 36101 1 0 37102 1 6 38103 1 0 39104 1 1 41105 1 1 43106 1 6 44107 1 0 44108 1 0 44109 1 0 45110 1 1 46111 1 0 47112 1 6 48113 1 0 49114 1 1 50115 1 0 51116 1 0 51117 1 0 52118 1 0 52119 1 0 54120 1 0 54121 1 0 54122 1 0 55123 1 6 56124 1 0 56125 1 0 57126 1 6 58127 1 0 60128 1 0 60129 1 0 60130 1 0 61131 1 6 62132 1 1 63133 1 0 63134 1 0 63135 1 0 M END

Standard InCHIKey	XNHZDPAJXHYTSI-BFGMSUTKSA-N
Standard InCHI	InChI=1S/C45H72O18/c1-18-8-11-45(56-17-18)19(2)30-26(63-45)13-25-23-7-6-21-12-22(9-10-43(21,4)24(23)14-29(48)44(25,30)5)58-42-39(62-40-36(54)34(52)31(49)20(3)57-40)38(33(51)28(16-47)60-42)61-41-37(55)35(53)32(50)27(15-46)59-41/h6,18-20,22-42,46-55H,7-17H2,1-5H3/t18-,19+,20+,22+,23-,24+,25+,26+,27-,28-,29-,30+,31+,32-,33+,34-,35+,36-,37-,38+,39-,40+,41+,42-,43+,44-,45-/m1/s1
SMILES	C[C@@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC=C5C[C@@H](O[C@@H]6O[C@H](CO)[C@H](O)[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@H]6O[C@@H]6O[C@@H](C)[C@H](O)[C@@H](O)[C@H]6O)CC[C@]5(C)[C@H]4C[C@@H](O)[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	900.47	Volume:	865.455 ? Van der Waals volume.
Dense:	1.04	LogP:	1.449 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.29 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.191 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	48.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.133	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.829	Fsp³:	0.956
MCE-18:	232.909 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.63	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.224	Promiscuous compounds:	0.032

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.223	MDCK Permeability:	-5.119
Pgp-inhibitor:	0.0	Pgp-substrate:	0.953
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.009
20% Bioavailability (F20%):	0.2	30% Bioavailability (F30%):	0.97
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.04
Plasma Protein Binding (PPB):	45.886%	Volume Distribution (VD):	-0.446
Fu:	43.462% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.14
BSEP inhibitor:	0.007

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.003
CYP3A4-inhibitor:	0.926	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.999
HLM stability:	0.225 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.164

Half-life (T1/2):

3.422

ADMET: Toxicity

hERG Blockers:	0.018	hERG Blockers (10um):	0.052
Human Hepatotoxicity (H-HT):	0.349	Drug-induced Liver Injury (DILI):	0.974
AMES Toxicity:	0.951	Rat Oral Acute Toxicity:	0.009
Maximum Recommended Daily Dose:	0.017	Skin Sensitization:	1.0
Carcinogencity:	0.069	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.999
Hematotoxicity:	0.128	Drug-induced Nephrotoxicity:	0.816
Genotoxicity:	0.006	RPMI-8226 Immunitoxicity:	0.457
A549 Cytotoxicity:	0.943	Hek293 Cytotoxicity:	0.906
BCF:	1.246 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.279 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.408 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.661 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO22063	Solanum lycocarpum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[17249729]
NPO22063	Solanum lycocarpum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO22063	Solanum lycocarpum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC513922 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23984
0.1-0.2	22409
0.2-0.3	2749
0.3-0.4	498
0.4-0.5	100
0.5-0.6	71
0.6-0.7	38
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8557	High Similarity	NPC300557
0.8351	Intermediate Similarity	NPC602423
0.7619	Intermediate Similarity	NPC309278
0.7075	Intermediate Similarity	NPC480555
0.7075	Intermediate Similarity	NPC150372
0.7027	Intermediate Similarity	NPC477811
0.699	Remote Similarity	NPC113044
0.699	Remote Similarity	NPC283829
0.699	Remote Similarity	NPC161676
0.6792	Remote Similarity	NPC470433
0.6792	Remote Similarity	NPC46190
0.6792	Remote Similarity	NPC171073
0.6752	Remote Similarity	NPC477808
0.6735	Remote Similarity	NPC181845
0.6726	Remote Similarity	NPC480553
0.6697	Remote Similarity	NPC102016
0.6697	Remote Similarity	NPC95051
0.6667	Remote Similarity	NPC14704
0.6635	Remote Similarity	NPC470432
0.6635	Remote Similarity	NPC230507
0.6569	Remote Similarity	NPC206003
0.6569	Remote Similarity	NPC473610
0.6549	Remote Similarity	NPC480554
0.6429	Remote Similarity	NPC269297
0.6429	Remote Similarity	NPC222202
0.6404	Remote Similarity	NPC218571
0.6404	Remote Similarity	NPC487615
0.6393	Remote Similarity	NPC305771
0.6393	Remote Similarity	NPC94072
0.6393	Remote Similarity	NPC169816
0.6372	Remote Similarity	NPC475333
0.6372	Remote Similarity	NPC224098
0.6372	Remote Similarity	NPC208383
0.6316	Remote Similarity	NPC194207
0.6316	Remote Similarity	NPC22779
0.6273	Remote Similarity	NPC248746
0.6273	Remote Similarity	NPC477809
0.6239	Remote Similarity	NPC31896
0.6216	Remote Similarity	NPC6806
0.6167	Remote Similarity	NPC480556
0.6148	Remote Similarity	NPC15918
0.6147	Remote Similarity	NPC475351
0.6087	Remote Similarity	NPC13193
0.605	Remote Similarity	NPC232054
0.5963	Remote Similarity	NPC141433
0.5929	Remote Similarity	NPC42171
0.5913	Remote Similarity	NPC475319
0.5887	Remote Similarity	NPC210569
0.5877	Remote Similarity	NPC150057
0.5877	Remote Similarity	NPC147753
0.5872	Remote Similarity	NPC125324
0.5854	Remote Similarity	NPC224314
0.5854	Remote Similarity	NPC477807
0.5804	Remote Similarity	NPC40440
0.569	Remote Similarity	NPC97700
0.569	Remote Similarity	NPC184617
0.569	Remote Similarity	NPC30856
0.5652	Remote Similarity	NPC249553
0.5652	Remote Similarity	NPC124677
0.5652	Remote Similarity	NPC182900
0.5625	Remote Similarity	NPC305423
0.5586	Remote Similarity	NPC6295
0.5556	Remote Similarity	NPC73243
0.5556	Remote Similarity	NPC244086
0.5556	Remote Similarity	NPC84956
0.5546	Remote Similarity	NPC32361
0.5537	Remote Similarity	NPC83137
0.5526	Remote Similarity	NPC42482
0.5526	Remote Similarity	NPC473601
0.5526	Remote Similarity	NPC98696
0.5517	Remote Similarity	NPC48886
0.5517	Remote Similarity	NPC51172
0.5517	Remote Similarity	NPC49032
0.5517	Remote Similarity	NPC94881
0.5492	Remote Similarity	NPC233433
0.547	Remote Similarity	NPC475182
0.5463	Remote Similarity	NPC477451
0.5462	Remote Similarity	NPC247037
0.5462	Remote Similarity	NPC475550
0.5391	Remote Similarity	NPC197231
0.5385	Remote Similarity	NPC263359
0.5377	Remote Similarity	NPC485594
0.5366	Remote Similarity	NPC132080
0.5345	Remote Similarity	NPC469347
0.5328	Remote Similarity	NPC108072
0.5328	Remote Similarity	NPC249265
0.5315	Remote Similarity	NPC19400
0.531	Remote Similarity	NPC485595
0.5285	Remote Similarity	NPC23808
0.5285	Remote Similarity	NPC87998
0.5278	Remote Similarity	NPC297348
0.5278	Remote Similarity	NPC249204
0.5278	Remote Similarity	NPC48339
0.5278	Remote Similarity	NPC141769
0.5278	Remote Similarity	NPC477547
0.525	Remote Similarity	NPC115165
0.5194	Remote Similarity	NPC220836
0.5179	Remote Similarity	NPC306131
0.5179	Remote Similarity	NPC200802
0.5175	Remote Similarity	NPC94272
0.5167	Remote Similarity	NPC294129
0.5164	Remote Similarity	NPC473518
0.5164	Remote Similarity	NPC116756
0.5159	Remote Similarity	NPC167183
0.5154	Remote Similarity	NPC79900
0.5152	Remote Similarity	NPC244431
0.5138	Remote Similarity	NPC325828
0.5128	Remote Similarity	NPC161738
0.5122	Remote Similarity	NPC232037
0.5091	Remote Similarity	NPC234352
0.5086	Remote Similarity	NPC160426
0.5082	Remote Similarity	NPC486386
0.5081	Remote Similarity	NPC470864
0.504	Remote Similarity	NPC476112
0.504	Remote Similarity	NPC307534

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC513922 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7697
0.1-0.2	1387
0.2-0.3	57
0.3-0.4	5
0.4-0.5	2
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5877	Remote Similarity	NPD8450	Suspended
0.5138	Remote Similarity	NPD8171	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data