NPASS Compound

Natural Product: NPC49343

Natural Product ID	NPC49343
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	AWAWHUMFOJGLOL-PUZQRMEDSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	10395853
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 131139 0 0 0 0 0 0 0 0999 V2000 8.2115 0.4596 2.8463 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5130 -0.6496 2.1263 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5254 -0.2069 1.1058 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5732 -1.3790 0.1206 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1370 -1.9237 0.1295 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3878 -0.6795 0.3655 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9275 -0.7949 0.7096 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1774 -1.6309 -0.2659 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7263 -1.3958 -0.1411 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1760 -0.3103 0.3153 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3028 -0.1904 0.3905 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6835 0.9502 -0.5285 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9023 2.2050 -0.2106 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5745 1.9793 -0.1884 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9823 0.8351 0.7599 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5467 1.2663 2.1497 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4442 0.6345 0.6468 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1699 1.5105 1.6515 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6437 1.3557 1.6419 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1027 -0.0895 1.5604 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7944 -0.7609 2.8514 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0278 1.2382 -0.3580 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7528 1.1000 -1.5111 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9486 0.2296 -1.3842 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0910 0.9048 -2.1429 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5776 1.3580 -3.5161 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3522 2.1980 -3.3586 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5064 3.5021 -4.0792 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5604 4.2564 -3.5710 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1018 2.3809 -1.9983 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3642 0.2461 -4.3292 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4719 2.0203 -1.4384 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8313 2.0500 -1.1234 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0922 2.1638 0.3349 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.1423 3.2230 0.5781 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5587 4.5541 0.0833 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9204 4.2713 -1.2770 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4858 3.0853 -1.7892 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5920 5.0415 0.9354 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3270 3.3012 1.9579 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5277 0.9428 0.8765 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6779 -1.0204 -1.9010 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8748 -2.0692 -1.0486 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9910 -2.9314 -1.5826 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5999 -4.3920 -1.5567 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0349 -4.7291 -0.1941 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.9443 -3.7662 0.2059 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2389 -3.1221 1.5541 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7268 -2.8029 -0.7769 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5912 -6.0182 -0.0753 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6503 -5.2225 -1.8689 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1924 -2.7035 -0.9162 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4861 -2.2878 0.6454 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4729 -1.4207 1.2006 C 0 0 2 0 0 0 0 0 0 0 0 0 9.4569 -2.2558 1.9054 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6908 -2.3856 1.0001 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2045 -0.9715 0.8387 C 0 0 1 0 0 0 0 0 0 0 0 0 12.5146 -0.9337 0.0607 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3057 -1.4829 -1.2150 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1502 -0.1665 0.1371 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8984 -0.6603 0.1537 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3022 0.5069 2.6520 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1003 0.2787 3.9372 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7167 1.4560 2.6751 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0727 -1.4244 2.7804 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8978 0.7323 0.6371 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8363 -1.0495 -0.8927 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9672 -2.3907 -0.8625 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0791 -2.6662 0.9209 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5009 0.0176 -0.4868 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7930 -1.2554 1.7138 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5364 -1.5050 -1.3160 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4073 -2.7074 0.0040 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0442 -2.2102 -0.4625 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7590 -1.1036 -0.0206 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6796 -0.0659 1.4181 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5123 0.6593 -1.5751 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0926 2.8953 -1.0781 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3004 2.7337 0.6775 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8677 1.6961 -1.2415 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0927 2.9043 0.0398 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0276 2.2384 2.3419 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5489 1.4786 2.1068 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6888 0.5039 2.9166 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8011 1.0091 -0.3607 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8166 1.3447 2.6867 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9212 2.5609 1.3970 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0360 1.7297 2.6286 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1130 1.9939 0.8646 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8076 -0.3592 3.2302 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8314 -1.8524 2.8514 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5380 -0.3917 3.6036 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0391 0.7248 -2.3045 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2605 0.1431 -0.3466 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9408 0.2565 -2.3150 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3676 1.9611 -4.0079 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4691 1.6839 -3.8106 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5501 4.0616 -4.0009 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7117 3.3457 -5.1550 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2399 5.1894 -3.4944 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9252 -0.5287 -4.0900 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2736 1.1164 -1.5218 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1744 2.4967 0.9044 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0818 3.0387 0.0566 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3981 5.2539 -0.0650 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1782 5.0940 -1.9534 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8281 4.1255 -1.1243 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7829 4.4899 0.9331 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9870 4.0183 2.1864 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4164 0.9389 1.8726 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2360 -1.7196 -0.0332 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1628 -2.6523 -2.6406 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8005 -4.5606 -2.2995 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8716 -4.5893 0.5432 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0095 -4.3449 0.3085 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3039 -3.2077 1.8274 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8511 -2.0851 1.5742 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6727 -3.6544 2.3733 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9263 -6.1640 -0.8209 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5161 -4.9591 -1.4603 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7731 -2.0414 -1.3987 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8025 -1.8257 2.8845 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1313 -3.3013 2.1126 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4415 -3.0729 1.4353 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3189 -2.7427 -0.0021 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3620 -0.5766 1.8595 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8124 0.1159 -0.0843 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2765 -1.5112 0.6161 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8789 -0.9873 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1946 0.9177 0.4571 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4764 -0.1144 -0.9478 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 12 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 27 30 1 0 26 31 1 0 25 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 36 39 1 0 35 40 1 0 34 41 1 0 24 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 47 49 1 0 46 50 1 0 45 51 1 0 44 52 1 0 4 53 1 0 54 53 1 6 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 57 60 1 0 60 61 1 0 54 2 1 0 20 3 1 0 30 23 1 0 38 33 1 0 49 43 1 0 61 54 1 0 20 6 1 0 17 7 1 0 15 10 1 0 1 62 1 0 1 63 1 0 1 64 1 0 2 65 1 1 3 66 1 6 4 67 1 6 5 68 1 0 5 69 1 0 6 70 1 6 7 71 1 1 8 72 1 0 8 73 1 0 9 74 1 0 11 75 1 0 11 76 1 0 12 77 1 6 13 78 1 0 13 79 1 0 14 80 1 0 14 81 1 0 16 82 1 0 16 83 1 0 16 84 1 0 17 85 1 6 18 86 1 0 18 87 1 0 19 88 1 0 19 89 1 0 21 90 1 0 21 91 1 0 21 92 1 0 23 93 1 6 24 94 1 1 25 95 1 6 26 96 1 6 27 97 1 6 28 98 1 0 28 99 1 0 29100 1 0 31101 1 0 33102 1 6 34103 1 1 35104 1 6 36105 1 6 37106 1 0 37107 1 0 39108 1 0 40109 1 0 41110 1 0 43111 1 1 44112 1 6 45113 1 6 46114 1 1 47115 1 1 48116 1 0 48117 1 0 48118 1 0 50119 1 0 51120 1 0 52121 1 0 55122 1 0 55123 1 0 56124 1 0 56125 1 0 57126 1 1 58127 1 0 58128 1 0 59129 1 0 60130 1 0 60131 1 0 M END

Standard InCHIKey	AWAWHUMFOJGLOL-PUZQRMEDSA-N
Standard InCHI	InChI=1S/C44H70O17/c1-19-30-28(61-44(19)12-7-21(15-45)17-55-44)14-26-24-6-5-22-13-23(8-10-42(22,3)25(24)9-11-43(26,30)4)57-41-38(60-40-36(53)34(51)31(48)20(2)56-40)37(33(50)29(16-46)58-41)59-39-35(52)32(49)27(47)18-54-39/h5,19-21,23-41,45-53H,6-18H2,1-4H3/t19-,20-,21-,23-,24+,25-,26-,27-,28-,29+,30-,31-,32-,33+,34+,35+,36+,37-,38+,39-,40-,41+,42-,43-,44+/m0/s1
SMILES	C[C@H]1[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@H](CC[C@]5(C)[C@H]4CC[C@]23C)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O[C@H]2[C@@H]([C@H]([C@H](CO2)O)O)O)O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O[C@@]21CC[C@@H](CO)CO2

Calculated Properties

Physi-Chem Properties

Molecular Weight:	870.46	Volume:	839.369 ? Van der Waals volume.
Dense:	1.037	LogP:	1.406 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.042 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.167 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	48.0
TPSA:	255.91 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.144	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.714	Fsp³:	0.955
MCE-18:	226.395 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.686	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.2	Promiscuous compounds:	0.014

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.699	MDCK Permeability:	-4.891
Pgp-inhibitor:	0.0	Pgp-substrate:	0.99
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.07	30% Bioavailability (F30%):	0.918
50% Bioavailability (F50%):	0.985

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.019
Plasma Protein Binding (PPB):	62.292%	Volume Distribution (VD):	-0.421
Fu:	30.227% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.169
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.004	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.006
CYP3A4-inhibitor:	0.455	CYP3A4-substrate:	0.107
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.048 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.535

Half-life (T1/2):

2.463

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.01
Human Hepatotoxicity (H-HT):	0.664	Drug-induced Liver Injury (DILI):	0.975
AMES Toxicity:	0.983	Rat Oral Acute Toxicity:	0.011
Maximum Recommended Daily Dose:	0.006	Skin Sensitization:	1.0
Carcinogencity:	0.61	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.003
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.998
Hematotoxicity:	0.593	Drug-induced Nephrotoxicity:	0.997
Genotoxicity:	0.059	RPMI-8226 Immunitoxicity:	0.397
A549 Cytotoxicity:	0.99	Hek293 Cytotoxicity:	0.909
BCF:	1.488 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.371 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.462 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.854 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21524113]
NPO7703	Xanthorrhoea preissii	Species	Asphodelaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8173	Lupinus multiflorus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6023	Neurolaena venturana	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO6023	Neurolaena venturana	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7703	Xanthorrhoea preissii	Species	Asphodelaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO2383	Mimosa acacioides	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO5425	Polygala nyikensis	Species	Polygalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10340	Crepis rubra	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO9062	Lilium longiflorum Thunb.	Strain	Liliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO8173	Lupinus multiflorus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC49343 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23948
0.1-0.2	22391
0.2-0.3	2629
0.3-0.4	626
0.4-0.5	121
0.5-0.6	79
0.6-0.7	44
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8571	High Similarity	NPC602423
0.84	Intermediate Similarity	NPC300557
0.783	Intermediate Similarity	NPC309278
0.7664	Intermediate Similarity	NPC475333
0.7664	Intermediate Similarity	NPC224098
0.7664	Intermediate Similarity	NPC208383
0.7596	Intermediate Similarity	NPC248746
0.7368	Intermediate Similarity	NPC480556
0.7168	Intermediate Similarity	NPC31896
0.7054	Intermediate Similarity	NPC218571
0.7054	Intermediate Similarity	NPC487615
0.7048	Intermediate Similarity	NPC113044
0.7048	Intermediate Similarity	NPC283829
0.7048	Intermediate Similarity	NPC161676
0.7009	Intermediate Similarity	NPC470433
0.7009	Intermediate Similarity	NPC46190
0.7009	Intermediate Similarity	NPC171073
0.6981	Remote Similarity	NPC475351
0.6972	Remote Similarity	NPC480555
0.6972	Remote Similarity	NPC150372
0.6957	Remote Similarity	NPC232054
0.693	Remote Similarity	NPC477811
0.6887	Remote Similarity	NPC14704
0.6881	Remote Similarity	NPC6806
0.6857	Remote Similarity	NPC470432
0.6857	Remote Similarity	NPC230507
0.6807	Remote Similarity	NPC477808
0.6754	Remote Similarity	NPC480554
0.675	Remote Similarity	NPC210569
0.6638	Remote Similarity	NPC480553
0.6637	Remote Similarity	NPC269297
0.6637	Remote Similarity	NPC222202
0.6634	Remote Similarity	NPC181845
0.6607	Remote Similarity	NPC102016
0.6607	Remote Similarity	NPC95051
0.6577	Remote Similarity	NPC42171
0.6577	Remote Similarity	NPC51172
0.6577	Remote Similarity	NPC49032
0.6522	Remote Similarity	NPC194207
0.6522	Remote Similarity	NPC22779
0.6475	Remote Similarity	NPC15918
0.646	Remote Similarity	NPC97700
0.646	Remote Similarity	NPC30856
0.6452	Remote Similarity	NPC305771
0.6452	Remote Similarity	NPC94072
0.6452	Remote Similarity	NPC169816
0.6348	Remote Similarity	NPC475550
0.6321	Remote Similarity	NPC206003
0.6321	Remote Similarity	NPC473610
0.632	Remote Similarity	NPC244431
0.6311	Remote Similarity	NPC224314
0.6306	Remote Similarity	NPC473601
0.6228	Remote Similarity	NPC150057
0.6228	Remote Similarity	NPC147753
0.6195	Remote Similarity	NPC477809
0.619	Remote Similarity	NPC263359
0.6174	Remote Similarity	NPC294129
0.6126	Remote Similarity	NPC305423
0.6121	Remote Similarity	NPC475319
0.6102	Remote Similarity	NPC232037
0.6083	Remote Similarity	NPC132080
0.5983	Remote Similarity	NPC115165
0.5948	Remote Similarity	NPC151134
0.5946	Remote Similarity	NPC125324
0.5917	Remote Similarity	NPC249265
0.5897	Remote Similarity	NPC475247
0.5882	Remote Similarity	NPC116756
0.5868	Remote Similarity	NPC476112
0.5868	Remote Similarity	NPC307534
0.5794	Remote Similarity	NPC477807
0.5785	Remote Similarity	NPC108072
0.5752	Remote Similarity	NPC141433
0.575	Remote Similarity	NPC32361
0.575	Remote Similarity	NPC473518
0.575	Remote Similarity	NPC13193
0.5703	Remote Similarity	NPC79900
0.5691	Remote Similarity	NPC233433
0.561	Remote Similarity	NPC83137
0.5593	Remote Similarity	NPC48886
0.5593	Remote Similarity	NPC94881
0.5588	Remote Similarity	NPC329807
0.5556	Remote Similarity	NPC470866
0.5546	Remote Similarity	NPC128572
0.5546	Remote Similarity	NPC475182
0.55	Remote Similarity	NPC73243
0.55	Remote Similarity	NPC244086
0.55	Remote Similarity	NPC184617
0.55	Remote Similarity	NPC84956
0.5495	Remote Similarity	NPC250393
0.5478	Remote Similarity	NPC70204
0.5476	Remote Similarity	NPC167183
0.547	Remote Similarity	NPC98696
0.5468	Remote Similarity	NPC481189
0.5462	Remote Similarity	NPC249553
0.5462	Remote Similarity	NPC471464
0.5462	Remote Similarity	NPC182900
0.5447	Remote Similarity	NPC232611
0.5446	Remote Similarity	NPC486119
0.544	Remote Similarity	NPC256983
0.5429	Remote Similarity	NPC329727
0.541	Remote Similarity	NPC247037
0.5405	Remote Similarity	NPC477451
0.5398	Remote Similarity	NPC19400
0.5391	Remote Similarity	NPC94086
0.5391	Remote Similarity	NPC94272
0.5391	Remote Similarity	NPC6295
0.5391	Remote Similarity	NPC473817
0.5385	Remote Similarity	NPC220836
0.5339	Remote Similarity	NPC40440
0.5333	Remote Similarity	NPC124677
0.5308	Remote Similarity	NPC473505
0.5286	Remote Similarity	NPC329820
0.5263	Remote Similarity	NPC306131
0.5263	Remote Similarity	NPC200802
0.5259	Remote Similarity	NPC485595
0.5242	Remote Similarity	NPC475625
0.5238	Remote Similarity	NPC23808
0.5238	Remote Similarity	NPC87998
0.5231	Remote Similarity	NPC248202
0.5214	Remote Similarity	NPC475670
0.521	Remote Similarity	NPC42482
0.5188	Remote Similarity	NPC32707
0.5182	Remote Similarity	NPC485594
0.5169	Remote Similarity	NPC160426
0.5167	Remote Similarity	NPC469347
0.5159	Remote Similarity	NPC470864
0.5146	Remote Similarity	NPC100451
0.5126	Remote Similarity	NPC112274
0.5124	Remote Similarity	NPC122819
0.5089	Remote Similarity	NPC297348
0.5089	Remote Similarity	NPC249204
0.5089	Remote Similarity	NPC48339
0.5089	Remote Similarity	NPC177834
0.5089	Remote Similarity	NPC141769
0.5089	Remote Similarity	NPC477547
0.5075	Remote Similarity	NPC208832
0.505	Remote Similarity	NPC207617
0.505	Remote Similarity	NPC607440
0.5039	Remote Similarity	NPC308140
0.5036	Remote Similarity	NPC330026

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC49343 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7598
0.1-0.2	1468
0.2-0.3	74
0.3-0.4	6
0.4-0.5	2
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6228	Remote Similarity	NPD8450	Suspended
0.5124	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data