NPASS Compound

Natural Product: NPC206842

Natural Product ID	NPC206842
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	BBQWPDKSGYVBHY-UODLMIDRSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	10653150
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 130138 0 0 0 0 0 0 0 0999 V2000 10.8885 -0.5952 -2.4173 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4665 -0.5115 -1.0369 C 0 0 2 0 0 0 0 0 0 0 0 0 10.9825 -1.6071 -0.1297 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9339 -1.1498 0.8581 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0440 -0.1607 0.1448 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8445 0.2170 1.0273 C 0 0 1 0 0 0 0 0 0 0 0 0 8.1999 1.1461 2.1279 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9497 0.8297 -0.0275 C 0 0 1 0 0 0 0 0 0 0 0 0 7.2923 -0.0331 -1.2409 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0289 -0.8252 -1.5164 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0040 0.1666 -1.1080 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6079 -0.3174 -0.9660 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1236 -1.0290 -2.2080 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6878 -1.3373 -2.0345 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8584 -0.6142 -1.3169 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5688 -0.9917 -1.1956 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4881 0.1566 -1.5478 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6580 1.3102 -2.0240 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4457 1.7285 -1.1076 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2965 0.5858 -0.6058 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9886 0.4841 0.9013 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7639 0.9040 -0.7070 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2659 1.6373 0.4893 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7237 1.9240 0.4842 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5047 0.6488 0.2329 C 0 0 2 0 0 0 0 0 0 0 0 0 5.2834 -0.3468 1.3388 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2479 0.5903 -0.4968 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6075 0.4739 -0.6550 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2533 -0.5297 0.2278 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5319 0.0617 1.5753 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0487 1.4580 1.5859 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4671 2.3137 0.4902 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1536 2.9005 1.0128 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4195 3.5720 2.2239 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2747 1.6492 -0.6826 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4485 1.5324 1.6325 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9124 2.1199 2.7985 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8207 3.2628 2.4113 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.1535 2.6351 2.1954 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6132 2.6300 0.7583 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6927 3.9177 0.2790 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9646 1.2566 2.7520 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7917 1.2746 3.4898 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0969 3.3671 2.9216 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8295 4.2570 3.3869 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3818 -0.0229 2.4034 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4254 -1.0885 -0.2693 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3131 -2.4696 -0.4341 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2084 -3.2488 0.5001 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1924 -4.7043 0.0065 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9275 -4.6643 -1.3225 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5837 -3.4457 -2.1171 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5062 -3.8703 -3.5887 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3782 -2.8687 -1.7394 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2875 -4.6262 -1.0187 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8812 -5.1012 -0.2100 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6612 -3.2466 1.7829 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3546 -0.8425 -0.8738 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7150 0.9375 -0.3237 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0762 0.8152 -0.4314 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7428 -0.4520 -3.1398 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1688 0.2162 -2.6457 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3654 -1.5562 -2.6066 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5941 -0.5122 -1.0549 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8250 -2.1288 0.3810 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4871 -2.3802 -0.7831 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3129 -2.0372 1.1105 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3442 -0.7624 1.7945 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4757 -0.7760 1.3837 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1593 1.6687 2.0010 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4191 1.9332 2.2589 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2099 0.5899 3.1059 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2762 1.8743 -0.1746 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5389 0.5928 -2.1200 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9894 -1.7839 -0.9861 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0129 -0.9985 -2.6197 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0228 1.0132 -1.8106 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4330 -1.0111 -0.1169 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2995 -0.4204 -3.1323 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6705 -2.0047 -2.2867 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2475 -2.2388 -2.5334 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7633 -1.8961 -1.8089 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7082 -1.3270 -0.1452 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0931 -0.2046 -2.4097 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3356 1.2037 -3.0813 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3710 2.1899 -2.0580 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0146 2.3411 -0.2908 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1100 2.4116 -1.6734 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0449 1.5219 1.2850 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6101 -0.2497 1.4121 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0609 0.1691 1.0767 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8864 1.5948 -1.5850 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0246 1.1771 1.4684 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7350 2.6298 0.5030 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0226 2.2954 1.4882 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0405 2.6496 -0.2851 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8219 0.0336 2.2313 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2256 -0.4355 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5706 -1.3776 1.0432 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7077 0.0369 -1.7080 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4794 -1.3311 0.4005 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3000 -0.5575 2.1319 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7040 1.9201 2.5590 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1509 3.1623 0.3100 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7112 3.6234 0.3188 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4674 2.0646 1.2955 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7555 3.3889 2.9150 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0832 2.4259 3.4718 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4403 3.6606 1.4333 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6615 2.2280 0.7702 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0258 1.9835 0.1079 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1176 4.0832 -0.5004 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7926 1.0089 3.4719 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9318 0.5379 1.9117 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0076 4.3001 2.6542 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2674 5.0374 3.1203 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3160 -0.9909 2.6455 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2606 -2.7262 -0.0935 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2511 -2.9313 0.4944 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6753 -5.3719 0.7336 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7485 -5.5686 -1.8998 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4218 -2.7072 -2.0825 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2200 -3.0301 -4.2248 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4730 -4.2572 -3.9396 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7679 -4.7073 -3.6981 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8013 -5.3383 -1.4284 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7427 -5.3580 -1.1762 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6784 -3.2257 1.7460 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6098 0.8979 0.5382 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4401 1.6736 -1.0578 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 39 42 1 0 42 43 1 0 39 44 1 1 38 45 1 0 30 46 1 0 29 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 51 55 1 0 50 56 1 0 49 57 1 0 9 58 1 0 5 59 1 6 59 60 1 0 60 2 1 0 58 5 1 0 25 8 1 0 35 28 1 0 43 37 1 0 54 48 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 61 1 0 1 62 1 0 1 63 1 0 2 64 1 6 3 65 1 0 3 66 1 0 4 67 1 0 4 68 1 0 6 69 1 1 7 70 1 0 7 71 1 0 7 72 1 0 8 73 1 6 9 74 1 6 10 75 1 0 10 76 1 0 11 77 1 6 12 78 1 1 13 79 1 0 13 80 1 0 14 81 1 0 16 82 1 0 16 83 1 0 17 84 1 6 18 85 1 0 18 86 1 0 19 87 1 0 19 88 1 0 21 89 1 0 21 90 1 0 21 91 1 0 22 92 1 6 23 93 1 0 23 94 1 0 24 95 1 0 24 96 1 0 26 97 1 0 26 98 1 0 26 99 1 0 28100 1 6 29101 1 1 30102 1 1 31103 1 1 32104 1 6 33105 1 0 33106 1 0 34107 1 0 37108 1 1 38109 1 6 40110 1 0 40111 1 0 41112 1 0 42113 1 0 42114 1 0 44115 1 0 45116 1 0 46117 1 0 48118 1 1 49119 1 1 50120 1 1 51121 1 6 52122 1 6 53123 1 0 53124 1 0 53125 1 0 55126 1 0 56127 1 0 57128 1 0 60129 1 0 60130 1 0 M END

Standard InCHIKey	BBQWPDKSGYVBHY-UODLMIDRSA-N
Standard InCHI	InChI=1S/C44H70O16/c1-20-8-13-44(54-17-20)21(2)30-28(60-44)15-27-25-7-6-23-14-24(9-11-41(23,4)26(25)10-12-42(27,30)5)56-39-36(59-38-33(49)32(48)31(47)22(3)55-38)34(50)35(29(16-45)57-39)58-40-37(51)43(52,18-46)19-53-40/h6,20-22,24-40,45-52H,7-19H2,1-5H3/t20-,21+,22+,24+,25-,26+,27+,28+,29-,30+,31+,32-,33-,34+,35-,36-,37+,38+,39-,40+,41+,42+,43-,44-/m1/s1
SMILES	C[C@@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@H](CC[C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O[C@H]3[C@@H]([C@@](CO)(CO3)O)O)O)O[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	854.47	Volume:	830.579 ? Van der Waals volume.
Dense:	1.029	LogP:	3.263 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.732 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.95 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	47.0
TPSA:	235.68 ? Topological Polar Surface Area.	H-Bond Acceptor:	16.0
H-Bond Donor:	8.0	Rings:	9.0
Heavy Atoms:	16.0

MedChem Properties

QED Drug-Likeness Score:	0.158	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.714	Fsp³:	0.955
MCE-18:	228.837 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.629	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.191	Promiscuous compounds:	0.112

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.121	MDCK Permeability:	-5.089
Pgp-inhibitor:	0.0	Pgp-substrate:	0.704
PAMPA:	0.989 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.004
20% Bioavailability (F20%):	0.425	30% Bioavailability (F30%):	0.966
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.061
Plasma Protein Binding (PPB):	69.451%	Volume Distribution (VD):	-0.4
Fu:	26.971% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.593
BSEP inhibitor:	0.127

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.009
CYP3A4-inhibitor:	0.999	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.784
HLM stability:	0.895 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.621

Half-life (T1/2):

2.559

ADMET: Toxicity

hERG Blockers:	0.057	hERG Blockers (10um):	0.132
Human Hepatotoxicity (H-HT):	0.529	Drug-induced Liver Injury (DILI):	0.967
AMES Toxicity:	0.917	Rat Oral Acute Toxicity:	0.049
Maximum Recommended Daily Dose:	0.074	Skin Sensitization:	1.0
Carcinogencity:	0.212	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.006
Drug-induced Neurotoxicity:	0.002	Ototoxicity:	0.994
Hematotoxicity:	0.089	Drug-induced Nephrotoxicity:	0.578
Genotoxicity:	0.039	RPMI-8226 Immunitoxicity:	0.349
A549 Cytotoxicity:	0.9	Hek293 Cytotoxicity:	0.941
BCF:	1.899 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.587 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.878 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.249 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20907	Costus afer	Species	Costaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20907	Costus afer	Species	Costaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO20907	Costus afer	Species	Costaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC206842 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24112
0.1-0.2	22406
0.2-0.3	2651
0.3-0.4	458
0.4-0.5	114
0.5-0.6	53
0.6-0.7	30
0.7-0.8	0
0.8-0.85	6
0.85-0.9	7
0.9-0.95	3
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9062	High Similarity	NPC470433
0.9062	High Similarity	NPC46190
0.9062	High Similarity	NPC171073
0.8812	High Similarity	NPC475333
0.8812	High Similarity	NPC224098
0.8812	High Similarity	NPC208383
0.8788	High Similarity	NPC480555
0.8788	High Similarity	NPC150372
0.8529	High Similarity	NPC269297
0.8529	High Similarity	NPC222202
0.84	Intermediate Similarity	NPC248746
0.8286	Intermediate Similarity	NPC480554
0.8131	Intermediate Similarity	NPC480553
0.8091	Intermediate Similarity	NPC480556
0.8019	Intermediate Similarity	NPC194207
0.8019	Intermediate Similarity	NPC22779
0.7961	Intermediate Similarity	NPC42171
0.7857	Intermediate Similarity	NPC224314
0.7818	Intermediate Similarity	NPC232054
0.7647	Intermediate Similarity	NPC113044
0.7647	Intermediate Similarity	NPC283829
0.7647	Intermediate Similarity	NPC161676
0.7624	Intermediate Similarity	NPC470432
0.7624	Intermediate Similarity	NPC230507
0.7431	Intermediate Similarity	NPC32361
0.7429	Intermediate Similarity	NPC602423
0.729	Intermediate Similarity	NPC300557
0.7157	Intermediate Similarity	NPC19400
0.7037	Intermediate Similarity	NPC477809
0.6981	Remote Similarity	NPC14704
0.6972	Remote Similarity	NPC124677
0.6964	Remote Similarity	NPC13193
0.6952	Remote Similarity	NPC485595
0.6952	Remote Similarity	NPC6295
0.69	Remote Similarity	NPC181845
0.6891	Remote Similarity	NPC477808
0.6847	Remote Similarity	NPC73243
0.6847	Remote Similarity	NPC244086
0.6847	Remote Similarity	NPC84956
0.6818	Remote Similarity	NPC6806
0.6726	Remote Similarity	NPC247037
0.6696	Remote Similarity	NPC249265
0.6667	Remote Similarity	NPC309278
0.6607	Remote Similarity	NPC475182
0.6496	Remote Similarity	NPC23808
0.6496	Remote Similarity	NPC87998
0.6481	Remote Similarity	NPC94272
0.6372	Remote Similarity	NPC471464
0.6303	Remote Similarity	NPC477811
0.6293	Remote Similarity	NPC475550
0.6283	Remote Similarity	NPC122819
0.6273	Remote Similarity	NPC141433
0.6273	Remote Similarity	NPC195297
0.6216	Remote Similarity	NPC305423
0.6116	Remote Similarity	NPC308140
0.6055	Remote Similarity	NPC306131
0.6055	Remote Similarity	NPC200802
0.6017	Remote Similarity	NPC486386
0.6	Remote Similarity	NPC165439
0.5984	Remote Similarity	NPC287885
0.5929	Remote Similarity	NPC160426
0.5926	Remote Similarity	NPC477451
0.5917	Remote Similarity	NPC254255
0.5854	Remote Similarity	NPC31896
0.5826	Remote Similarity	NPC98696
0.5826	Remote Similarity	NPC40440
0.5776	Remote Similarity	NPC265275
0.5763	Remote Similarity	NPC128572
0.5714	Remote Similarity	NPC102016
0.5714	Remote Similarity	NPC95051
0.5702	Remote Similarity	NPC70204
0.561	Remote Similarity	NPC218571
0.561	Remote Similarity	NPC487615
0.5596	Remote Similarity	NPC297348
0.5596	Remote Similarity	NPC249204
0.5596	Remote Similarity	NPC48339
0.5596	Remote Similarity	NPC141769
0.5596	Remote Similarity	NPC477547
0.5545	Remote Similarity	NPC100451
0.5538	Remote Similarity	NPC210569
0.5526	Remote Similarity	NPC107962
0.5487	Remote Similarity	NPC211354
0.5462	Remote Similarity	NPC469348
0.5455	Remote Similarity	NPC325828
0.5455	Remote Similarity	NPC294129
0.5446	Remote Similarity	NPC250393
0.5417	Remote Similarity	NPC249553
0.5417	Remote Similarity	NPC274200
0.5413	Remote Similarity	NPC485594
0.5398	Remote Similarity	NPC206003
0.5398	Remote Similarity	NPC473610
0.5378	Remote Similarity	NPC475643
0.5339	Remote Similarity	NPC475351
0.531	Remote Similarity	NPC222731
0.5303	Remote Similarity	NPC15918
0.5299	Remote Similarity	NPC305771
0.5299	Remote Similarity	NPC94072
0.5299	Remote Similarity	NPC169816
0.5294	Remote Similarity	NPC42482
0.5267	Remote Similarity	NPC477807
0.5214	Remote Similarity	NPC15249
0.5214	Remote Similarity	NPC25455
0.5203	Remote Similarity	NPC97700
0.5203	Remote Similarity	NPC30856
0.52	Remote Similarity	NPC475625
0.5196	Remote Similarity	NPC235126
0.5196	Remote Similarity	NPC242419
0.5164	Remote Similarity	NPC182900
0.5086	Remote Similarity	NPC107188
0.5074	Remote Similarity	NPC263359
0.5042	Remote Similarity	NPC475670
0.5041	Remote Similarity	NPC486388

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC206842 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7682
0.1-0.2	1404
0.2-0.3	55
0.3-0.4	5
0.4-0.5	1
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6283	Remote Similarity	NPD8449	Approved
0.5455	Remote Similarity	NPD8171	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data