NPASS Compound

Natural Product: NPC194630

Natural Product ID	NPC194630
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	DQLBLHWGFPEMQR-FYBADMPJSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 118125 0 0 0 0 0 0 0 0999 V2000 -12.5021 -1.4742 0.3790 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0058 -1.5039 0.6093 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.6193 -1.1268 1.9986 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2921 -0.5123 2.1639 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4469 -0.3614 0.9728 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1090 -1.1155 1.0814 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2789 -2.5922 0.9821 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4092 -0.5192 -0.1260 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9391 0.9152 -0.0724 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6937 1.7223 0.3301 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6480 0.9819 -0.4055 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2236 1.2789 -0.0599 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8775 2.7347 -0.2807 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4197 2.9746 -0.0610 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6667 2.1558 -1.1006 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7728 2.5320 -1.0809 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6645 1.5464 -1.8007 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8123 0.7460 -2.7426 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2785 -0.0352 -2.0898 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9233 0.6771 -0.9155 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4348 0.1662 0.4028 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4014 0.4554 -1.0133 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7097 -1.0128 -0.9526 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1779 -1.3219 -0.9424 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9171 -0.4472 0.0207 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4790 -0.7471 1.4189 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3295 1.6372 -3.7134 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3906 0.8532 -0.9137 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7550 0.9726 -0.9464 C 0 0 1 0 0 0 0 0 0 0 0 0 4.4058 1.3393 0.3406 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3325 0.2520 0.8649 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3557 0.0525 -0.2025 C 0 0 2 0 0 0 0 0 0 0 0 0 5.6099 -0.3076 -1.4836 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9696 -1.7603 -1.8244 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5446 -2.5953 -0.7724 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2479 -0.2729 -1.3396 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3468 -0.8452 0.0962 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6330 -0.3483 0.0581 C 0 0 1 0 0 0 0 0 0 0 0 0 9.2102 -0.4882 1.4530 C 0 0 1 0 0 0 0 0 0 0 0 0 10.5893 0.1397 1.4634 C 0 0 2 0 0 0 0 0 0 0 0 0 11.4420 -0.6077 0.4505 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7053 -0.5979 -0.8749 C 0 0 1 0 0 0 0 0 0 0 0 0 11.4984 -1.4920 -1.8344 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7759 -0.9567 -1.9618 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4532 -1.1504 -0.7702 O 0 0 0 0 0 0 0 0 0 0 0 0 12.6769 -0.0124 0.2511 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0980 0.0559 2.7460 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3987 0.1490 2.3916 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5669 -0.8829 1.1069 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2768 2.4226 0.0883 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9933 2.7387 1.2161 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9355 0.9536 0.8582 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9923 -0.7029 -0.2298 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3550 -0.5038 -0.3374 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.6504 -1.7627 -0.6941 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8866 -0.4625 0.5334 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9704 -2.2582 0.9780 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6169 -2.5073 0.3433 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4322 -0.4436 2.3866 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7408 -2.0546 2.6316 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4031 0.4991 2.6553 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7170 -1.1098 2.9313 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6775 -0.7656 2.0416 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4628 -3.1151 0.4386 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4311 -2.9922 2.0046 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2432 -2.8133 0.4393 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7376 -1.0539 -1.0187 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2770 1.2039 -1.0916 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6193 1.6999 1.4150 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8241 2.7775 -0.0137 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8602 1.0482 -1.4910 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0472 1.0424 0.9896 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5354 3.4107 0.2989 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0953 2.9530 -1.3596 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2085 4.0444 -0.3094 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1321 2.4355 -2.0770 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0815 2.5967 0.0037 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8811 3.5595 -1.4678 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3373 2.1598 -2.4644 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4310 0.0094 -3.3310 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0497 -1.0629 -1.7804 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0485 -0.2287 -2.8912 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3139 0.8314 0.8806 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2320 0.0316 1.1624 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0643 -0.8142 0.2593 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7013 0.7936 -2.0490 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2463 -1.5260 -0.0932 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2853 -1.4803 -1.8657 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2890 -2.3910 -0.6462 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6344 -1.2101 -1.9382 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7893 -0.0047 2.1673 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4035 -0.9000 1.5016 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9350 -1.7477 1.6796 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2743 1.2499 -4.6026 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0222 1.6795 -1.7768 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6914 1.5967 1.1476 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7638 0.6657 1.8131 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8327 1.0324 -0.4136 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9090 0.3119 -2.3384 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0294 -1.8816 -2.0575 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3858 -2.0822 -2.7204 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3156 -3.4767 -1.1563 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6905 0.7133 -0.2097 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3141 -1.5621 1.7191 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4517 1.2011 1.1313 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5130 -1.6515 0.7729 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6154 0.4105 -1.3132 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9837 -1.5514 -2.8200 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5494 -2.4959 -1.3681 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6908 -0.0076 -2.2586 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3735 -0.6984 0.2985 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9970 -0.3344 2.7105 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6044 -0.1685 3.2927 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8690 -1.2450 1.9775 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4670 2.4748 -0.8737 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1806 3.5634 1.7594 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6678 0.5294 -0.1174 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6533 -0.8244 -1.3622 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 18 27 1 0 17 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 32 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 41 46 1 0 40 47 1 0 39 48 1 0 31 49 1 0 30 50 1 0 14 51 1 0 9 52 1 0 5 53 1 6 53 54 1 0 54 2 1 0 52 5 1 0 25 8 1 0 36 29 1 0 45 38 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 55 1 0 1 56 1 0 1 57 1 0 2 58 1 6 3 59 1 0 3 60 1 0 4 61 1 0 4 62 1 0 6 63 1 1 7 64 1 0 7 65 1 0 7 66 1 0 8 67 1 6 9 68 1 6 10 69 1 0 10 70 1 0 11 71 1 6 12 72 1 1 13 73 1 0 13 74 1 0 14 75 1 6 15 76 1 6 16 77 1 0 16 78 1 0 17 79 1 6 18 80 1 6 19 81 1 0 19 82 1 0 21 83 1 0 21 84 1 0 21 85 1 0 22 86 1 6 23 87 1 0 23 88 1 0 24 89 1 0 24 90 1 0 26 91 1 0 26 92 1 0 26 93 1 0 27 94 1 0 29 95 1 6 30 96 1 1 31 97 1 1 32 98 1 6 33 99 1 6 34100 1 0 34101 1 0 35102 1 0 38103 1 6 39104 1 1 40105 1 6 41106 1 1 42107 1 6 43108 1 0 43109 1 0 44110 1 0 46111 1 0 47112 1 0 48113 1 0 49114 1 0 50115 1 0 51116 1 0 54117 1 0 54118 1 0 M END

Standard InCHIKey	DQLBLHWGFPEMQR-FYBADMPJSA-N
Standard InCHI	InChI=1S/C39H64O15/c1-16-5-8-39(49-15-16)17(2)28-25(54-39)10-20-18-9-22(42)21-11-24(23(43)12-38(21,4)19(18)6-7-37(20,28)3)50-35-33(48)31(46)34(27(14-41)52-35)53-36-32(47)30(45)29(44)26(13-40)51-36/h16-36,40-48H,5-15H2,1-4H3/t16-,17+,18-,19+,20+,21-,22-,23-,24-,25+,26-,27-,28+,29-,30+,31-,32-,33-,34+,35-,36+,37+,38-,39-/m1/s1
SMILES	C[C@@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5C[C@H]([C@H]6C[C@H]([C@@H](C[C@]6(C)[C@H]5CC[C@]34C)O)O[C@H]3[C@@H]([C@H]([C@H]([C@@H](CO)O3)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	772.42	Volume:	746.502 ? Van der Waals volume.
Dense:	1.035	LogP:	1.543 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.158 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.259 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	42.0
TPSA:	237.45 ? Topological Polar Surface Area.	H-Bond Acceptor:	15.0
H-Bond Donor:	9.0	Rings:	8.0
Heavy Atoms:	15.0

MedChem Properties

QED Drug-Likeness Score:	0.153	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.458	Fsp³:	1.0
MCE-18:	207.692 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.646	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.057 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.255	Promiscuous compounds:	0.017

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.06	MDCK Permeability:	-5.113
Pgp-inhibitor:	0.0	Pgp-substrate:	0.425
PAMPA:	0.998 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.582
20% Bioavailability (F20%):	0.955	30% Bioavailability (F30%):	0.998
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.027	MRP1:	0.19
Plasma Protein Binding (PPB):	53.564%	Volume Distribution (VD):	-0.455
Fu:	38.56% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.194
BSEP inhibitor:	0.019

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.005	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.019
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.837
HLM stability:	0.022 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.463

Half-life (T1/2):

2.862

ADMET: Toxicity

hERG Blockers:	0.018	hERG Blockers (10um):	0.031
Human Hepatotoxicity (H-HT):	0.654	Drug-induced Liver Injury (DILI):	0.968
AMES Toxicity:	0.965	Rat Oral Acute Toxicity:	0.017
Maximum Recommended Daily Dose:	0.027	Skin Sensitization:	1.0
Carcinogencity:	0.192	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.003
Drug-induced Neurotoxicity:	0.005	Ototoxicity:	0.999
Hematotoxicity:	0.511	Drug-induced Nephrotoxicity:	0.872
Genotoxicity:	0.006	RPMI-8226 Immunitoxicity:	0.27
A549 Cytotoxicity:	0.961	Hek293 Cytotoxicity:	0.925
BCF:	1.192 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.283 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.501 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.715 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO6165	Prunus salicina	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28202328]
NPO6165	Prunus salicina	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO6165	Prunus salicina	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO6165	Prunus salicina	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO6165	Prunus salicina	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO8088	Tanacetum densum	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO8221	Cladonia crispata	Species	Cladoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC194630 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27487
0.1-0.2	19384
0.2-0.3	2550
0.3-0.4	251
0.4-0.5	86
0.5-0.6	68
0.6-0.7	24
0.7-0.8	1
0.8-0.85	1
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9136	High Similarity	NPC121453
0.8191	Intermediate Similarity	NPC473518
0.7356	Intermediate Similarity	NPC325828
0.7071	Intermediate Similarity	NPC115165
0.6842	Remote Similarity	NPC195297
0.6731	Remote Similarity	NPC83137
0.6703	Remote Similarity	NPC294686
0.6632	Remote Similarity	NPC107962
0.6421	Remote Similarity	NPC107188
0.6392	Remote Similarity	NPC485595
0.6383	Remote Similarity	NPC250393
0.6383	Remote Similarity	NPC222731
0.6381	Remote Similarity	NPC232611
0.6364	Remote Similarity	NPC277715
0.63	Remote Similarity	NPC473601
0.6262	Remote Similarity	NPC470862
0.6154	Remote Similarity	NPC97700
0.6154	Remote Similarity	NPC184617
0.6154	Remote Similarity	NPC30856
0.6154	Remote Similarity	NPC24960
0.6147	Remote Similarity	NPC31896
0.6111	Remote Similarity	NPC476112
0.6111	Remote Similarity	NPC307534
0.6061	Remote Similarity	NPC470432
0.6061	Remote Similarity	NPC230507
0.6061	Remote Similarity	NPC6295
0.6022	Remote Similarity	NPC485594
0.6019	Remote Similarity	NPC477809
0.5979	Remote Similarity	NPC206003
0.5979	Remote Similarity	NPC473610
0.5895	Remote Similarity	NPC297348
0.5895	Remote Similarity	NPC249204
0.5895	Remote Similarity	NPC48339
0.5895	Remote Similarity	NPC141769
0.5895	Remote Similarity	NPC477547
0.5833	Remote Similarity	NPC234352
0.5789	Remote Similarity	NPC181845
0.5776	Remote Similarity	NPC210569
0.5766	Remote Similarity	NPC132080
0.5758	Remote Similarity	NPC54619
0.5758	Remote Similarity	NPC19400
0.5663	Remote Similarity	NPC273290
0.5663	Remote Similarity	NPC232044
0.566	Remote Similarity	NPC6806
0.5631	Remote Similarity	NPC160426
0.5625	Remote Similarity	NPC477811
0.5614	Remote Similarity	NPC470867
0.5612	Remote Similarity	NPC477451
0.56	Remote Similarity	NPC211354
0.5577	Remote Similarity	NPC475351
0.5566	Remote Similarity	NPC92890
0.5545	Remote Similarity	NPC32361
0.5545	Remote Similarity	NPC475625
0.5545	Remote Similarity	NPC116756
0.5543	Remote Similarity	NPC144790
0.5543	Remote Similarity	NPC149400
0.5495	Remote Similarity	NPC232037
0.5476	Remote Similarity	NPC296734
0.5463	Remote Similarity	NPC480555
0.5463	Remote Similarity	NPC151134
0.5463	Remote Similarity	NPC150372
0.5447	Remote Similarity	NPC481190
0.5446	Remote Similarity	NPC470864
0.5368	Remote Similarity	NPC481420
0.5368	Remote Similarity	NPC473774
0.5368	Remote Similarity	NPC481419
0.5368	Remote Similarity	NPC481417
0.5368	Remote Similarity	NPC481421
0.5321	Remote Similarity	NPC128572
0.5315	Remote Similarity	NPC475550
0.528	Remote Similarity	NPC330026
0.5246	Remote Similarity	NPC263359
0.5229	Remote Similarity	NPC300557
0.5217	Remote Similarity	NPC233433
0.5214	Remote Similarity	NPC470866
0.521	Remote Similarity	NPC477807
0.5185	Remote Similarity	NPC470433
0.5185	Remote Similarity	NPC46190
0.5185	Remote Similarity	NPC171073
0.5179	Remote Similarity	NPC269297
0.5179	Remote Similarity	NPC222202
0.5143	Remote Similarity	NPC125324
0.5122	Remote Similarity	NPC244431
0.5114	Remote Similarity	NPC305808
0.51	Remote Similarity	NPC177834
0.5089	Remote Similarity	NPC51520
0.5089	Remote Similarity	NPC303069
0.5086	Remote Similarity	NPC480553
0.5053	Remote Similarity	NPC88962
0.505	Remote Similarity	NPC131693
0.505	Remote Similarity	NPC475436
0.5047	Remote Similarity	NPC113044
0.5047	Remote Similarity	NPC283829
0.5047	Remote Similarity	NPC161676
0.5046	Remote Similarity	NPC475643
0.5046	Remote Similarity	NPC602423

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC194630 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7692
0.1-0.2	1374
0.2-0.3	76
0.3-0.4	4
0.4-0.5	1
0.5-0.6	0
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7356	Intermediate Similarity	NPD8171	Phase 2
0.6392	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data