NPASS Compound

Natural Product: NPC502297

Natural Product ID	NPC502297
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Methyl parvifloside
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{S},6~{R})-5-[(2~{S},3~{R},4~{S},5~{R},6~{R})-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-2-[[(1~{S},2~{S},4~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{R},16~{S})-6-methoxy-7,9,13-trimethyl-6-[(3~{R})-3-methyl-4-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-butyl]-5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-en-16-yl]oxy]tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 182191 0 0 0 0 0 0 0 0999 V2000 -8.0103 -1.5461 -3.8898 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5958 -1.8608 -2.6610 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7761 -1.1286 -1.5634 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.1081 -0.9174 -0.9648 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1533 -0.2003 -1.7125 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.4751 -0.1302 -0.9340 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.9794 -1.5587 -0.6886 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2961 0.5654 0.3934 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4827 0.6309 1.0701 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.4793 1.3785 0.5002 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.8231 2.4862 1.2814 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.4282 2.1804 2.4721 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.4933 1.8046 3.5880 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.2113 1.5206 4.7629 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.5091 1.1209 2.3117 C 0 0 1 0 0 0 0 0 0 0 0 0 -16.5900 1.3576 3.1233 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.8624 1.1149 0.8394 C 0 0 2 0 0 0 0 0 0 0 0 0 -17.0182 0.4475 0.5275 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.6435 0.5252 0.1235 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.8933 0.5521 -1.2524 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1604 0.1669 -1.7385 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8292 -0.1787 -1.9877 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8730 0.9681 -1.7578 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8587 0.3626 -0.8648 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9090 1.2881 -0.1808 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1058 2.0902 -1.1642 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6967 1.6435 -1.3113 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0096 1.1295 -0.2982 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3812 0.7090 -0.4899 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9794 -0.0072 0.6675 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3660 0.0551 0.7057 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0063 -1.0686 1.1156 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8489 -0.9257 2.1732 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9358 -0.0818 1.9847 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5221 1.3119 2.3843 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5395 2.2545 2.2541 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3072 -0.1101 0.5468 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6373 0.1507 0.2406 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8304 1.0242 -0.8230 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1616 0.2936 -1.9844 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4619 0.3888 -2.3547 C 0 0 2 0 0 0 0 0 0 0 0 0 9.9313 -0.6734 -3.2951 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7935 -1.9605 -2.7304 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4103 0.5142 -1.1780 C 0 0 1 0 0 0 0 0 0 0 0 0 11.7052 0.3140 -1.6548 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1928 1.9473 -0.6859 C 0 0 2 0 0 0 0 0 0 0 0 0 10.9502 2.2230 0.4196 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9941 3.1139 0.1391 C 0 0 2 0 0 0 0 0 0 0 0 0 13.2351 2.4918 0.3423 O 0 0 0 0 0 0 0 0 0 0 0 0 14.1827 3.2391 -0.3373 C 0 0 2 0 0 0 0 0 0 0 0 0 15.5882 2.7059 -0.1478 C 0 0 0 0 0 0 0 0 0 0 0 0 16.5033 3.5043 -0.8656 O 0 0 0 0 0 0 0 0 0 0 0 0 14.1778 4.6922 0.0500 C 0 0 1 0 0 0 0 0 0 0 0 0 13.6659 5.5162 -0.9534 O 0 0 0 0 0 0 0 0 0 0 0 0 13.3022 4.8546 1.2751 C 0 0 2 0 0 0 0 0 0 0 0 0 13.8226 4.2035 2.3835 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9049 4.3964 0.9141 C 0 0 1 0 0 0 0 0 0 0 0 0 11.3409 5.4327 0.1322 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7249 2.1619 -0.5637 C 0 0 1 0 0 0 0 0 0 0 0 0 8.3783 3.2701 -1.3820 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1640 -1.6055 0.1538 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8858 -1.8610 -1.0003 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7071 -1.8645 0.0229 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5239 -3.2311 0.2065 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8553 -3.9149 -0.7369 C 0 0 2 0 0 0 0 0 0 0 0 0 2.6771 -4.4017 -0.1739 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8533 -5.4311 0.7298 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8640 -6.5738 0.4550 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2069 -6.0045 0.8534 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9307 -5.4166 1.9215 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0270 -6.0776 -0.3924 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9672 -7.3769 -0.9504 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5282 -5.0848 -1.3888 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4962 -5.7397 -2.1161 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5200 0.7883 1.9252 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0496 0.4432 2.0961 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7687 1.0428 0.9842 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0452 2.4723 1.3863 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0014 0.3485 0.6147 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7604 -0.3843 1.6597 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8993 -1.1796 1.0401 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7165 -0.3696 0.1254 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6579 0.4796 0.9162 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5138 -1.2048 -0.8862 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8447 -1.6407 -0.4371 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9861 -3.1505 -0.3545 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6199 -2.3838 -4.5924 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7298 -0.5664 -4.2859 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1186 -1.6506 -4.0992 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9301 -0.3511 0.0105 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5007 -1.9187 -0.6254 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8768 0.8934 -1.8458 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4226 -0.5559 -2.6972 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1958 0.3802 -1.5739 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8918 -1.7898 0.3822 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3921 -2.2273 -1.3519 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0327 -1.6145 -1.0024 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8445 1.5651 0.1900 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5949 -0.0155 1.0546 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0660 1.8221 -0.4555 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.9717 3.1150 2.8035 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7944 2.6195 3.8544 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9649 0.8498 3.3129 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.0229 0.6392 5.1270 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.0362 0.1596 2.5861 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.6761 0.6431 3.7908 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.9260 2.1610 0.4674 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.7932 1.0895 0.5023 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.5641 -0.5174 0.4646 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.4221 1.3844 -1.4478 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6483 -0.5771 -2.9869 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4182 1.3174 -2.7123 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3877 1.8526 -1.3286 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3143 -0.4200 -1.4404 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4897 1.9740 0.4383 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5910 2.0044 -2.1593 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1616 3.1821 -0.9009 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2303 1.7447 -2.2626 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0422 1.5535 -0.8468 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4787 -0.0306 -1.3650 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6214 -1.0355 0.8481 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1714 -1.7839 1.4434 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7522 -0.4468 2.6554 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6865 1.6171 1.6888 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0482 1.3425 3.3903 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1379 3.1547 2.1946 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5837 0.4260 -0.0542 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8167 1.4050 -1.0864 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5621 1.3609 -2.9213 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3390 -0.6088 -4.2347 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0015 -0.5564 -3.5199 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9204 -2.3637 -2.9891 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2386 -0.2149 -0.3772 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3135 -0.0076 -0.9294 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5939 2.5672 -1.5170 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9442 3.3745 -0.9361 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9694 3.1938 -1.4293 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7348 1.6746 -0.4461 H 0 0 0 0 0 0 0 0 0 0 0 0 15.9065 2.8183 0.9220 H 0 0 0 0 0 0 0 0 0 0 0 0 16.6201 3.1889 -1.7957 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2032 5.0918 0.2640 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3094 5.5794 -1.7231 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2374 5.9677 1.4427 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9108 4.8850 3.1136 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3132 4.2386 1.8372 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3249 5.2074 -0.8195 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5476 2.5435 0.4719 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1643 3.6157 -1.8700 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5702 -2.2064 1.0052 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5737 -2.5434 -0.8107 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3274 -1.4712 -0.9136 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5429 -3.2340 -1.5633 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5511 -5.0239 1.7389 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3656 -7.4247 -0.0448 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9916 -6.2015 -0.1268 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4595 -6.9838 1.4037 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0801 -7.0743 1.2086 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7714 -5.9061 2.0879 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0895 -5.9384 -0.1078 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6054 -7.9861 -0.4960 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2513 -4.8080 -2.1853 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0726 -5.0013 -2.6536 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6049 1.8614 1.7748 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1005 0.3889 2.7683 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0530 -0.6391 2.1230 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2736 0.8578 3.0644 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4544 3.1969 0.7780 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0914 2.7231 1.4826 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6213 2.6126 2.4277 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7277 -0.4471 -0.1790 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0901 0.2653 2.4950 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0798 -1.1368 2.1152 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4395 -2.0804 0.5922 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5304 -1.5150 1.8925 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5689 0.7931 0.3873 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2046 1.3762 1.3310 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9545 -0.1427 1.8191 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9311 -2.0474 -1.2428 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2155 -1.1450 0.4829 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1308 -3.4901 -1.4220 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9437 -3.3637 0.1535 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1048 -3.6479 0.0740 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 3 2 1 6 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 12 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 3 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 34 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 50 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 55 57 1 0 57 58 1 0 46 59 1 0 59 60 1 0 37 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 67 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 71 73 1 0 73 74 1 0 30 75 1 0 75 76 1 0 76 77 1 0 77 78 1 1 77 79 1 0 79 80 1 0 80 81 1 0 81 82 1 0 82 83 1 1 82 84 1 0 84 85 1 0 85 86 1 0 85 3 1 0 19 10 1 0 84 22 1 0 82 24 1 0 79 25 1 0 77 28 1 0 63 32 1 0 73 65 1 0 59 39 1 0 57 48 1 0 1 87 1 0 1 88 1 0 1 89 1 0 4 90 1 0 4 91 1 0 5 92 1 0 5 93 1 0 6 94 1 6 7 95 1 0 7 96 1 0 7 97 1 0 8 98 1 0 8 99 1 0 10100 1 6 12101 1 1 13102 1 0 13103 1 0 14104 1 0 15105 1 1 16106 1 0 17107 1 6 18108 1 0 19109 1 1 20110 1 0 22111 1 6 23112 1 0 23113 1 0 24114 1 6 25115 1 1 26116 1 0 26117 1 0 27118 1 0 29119 1 0 29120 1 0 30121 1 1 32122 1 1 34123 1 1 35124 1 0 35125 1 0 36126 1 0 37127 1 6 39128 1 6 41129 1 6 42130 1 0 42131 1 0 43132 1 0 44133 1 1 45134 1 0 46135 1 6 48136 1 6 50137 1 6 51138 1 0 51139 1 0 52140 1 0 53141 1 1 54142 1 0 55143 1 1 56144 1 0 57145 1 1 58146 1 0 59147 1 1 60148 1 0 61149 1 1 62150 1 0 63151 1 6 65152 1 6 67153 1 1 68154 1 0 68155 1 0 68156 1 0 69157 1 1 70158 1 0 71159 1 1 72160 1 0 73161 1 6 74162 1 0 75163 1 0 75164 1 0 76165 1 0 76166 1 0 78167 1 0 78168 1 0 78169 1 0 79170 1 6 80171 1 0 80172 1 0 81173 1 0 81174 1 0 83175 1 0 83176 1 0 83177 1 0 84178 1 6 85179 1 1 86180 1 0 86181 1 0 86182 1 0 M END

Standard InCHIKey	XOWJJLXQZQKLIS-RRYCUNFRSA-N
Standard InCHI	InChI=1S/C58H96O28/c1-22(21-76-51-43(70)41(68)37(64)31(17-59)79-51)9-14-58(75-6)23(2)35-30(86-58)16-29-27-8-7-25-15-26(10-12-56(25,4)28(27)11-13-57(29,35)5)78-55-50(85-52-44(71)40(67)36(63)24(3)77-52)46(73)48(34(20-62)82-55)83-54-47(74)49(39(66)33(19-61)81-54)84-53-45(72)42(69)38(65)32(18-60)80-53/h7,22-24,26-55,59-74H,8-21H2,1-6H3/t22-,23+,24+,26+,27-,28+,29+,30+,31-,32-,33-,34-,35+,36+,37-,38-,39-,40-,41+,42+,43-,44-,45-,46+,47-,48-,49+,50-,51-,52+,53+,54+,55-,56+,57+,58-/m1/s1
SMILES	CO[C@]1(CC[C@@H](C)CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]2C[C@H]3[C@@H]4CC=C5C[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@H]7O)[C@H](O)[C@H]6O[C@@H]6O[C@@H](C)[C@H](O)[C@@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]2[C@@H]1C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1240.61	Volume:	1169.649 ? Van der Waals volume.
Dense:	1.061	LogP:	0.003 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.032 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.01 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	19.0	Rigid Bonds:	54.0
TPSA:	434.44 ? Topological Polar Surface Area.	H-Bond Acceptor:	28.0
H-Bond Donor:	16.0	Rings:	10.0
Heavy Atoms:	28.0

MedChem Properties

QED Drug-Likeness Score:	0.054	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.346	Fsp³:	0.966
MCE-18:	199.789 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.559	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.427	Promiscuous compounds:	0.008

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.105	MDCK Permeability:	-4.949
Pgp-inhibitor:	0.0	Pgp-substrate:	0.793
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.695
20% Bioavailability (F20%):	0.021	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.0
Plasma Protein Binding (PPB):	42.761%	Volume Distribution (VD):	-0.378
Fu:	41.315% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.004
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.996	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.428
HLM stability:	0.212 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.959

Half-life (T1/2):

4.232

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.002
Human Hepatotoxicity (H-HT):	0.544	Drug-induced Liver Injury (DILI):	0.965
AMES Toxicity:	0.989	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.011	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.476	Drug-induced Nephrotoxicity:	0.951
Genotoxicity:	0.01	RPMI-8226 Immunitoxicity:	0.295
A549 Cytotoxicity:	0.953	Hek293 Cytotoxicity:	0.721
BCF:	1.291 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.37 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.626 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.788 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9436	Dioscorea parviflora	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9436	Dioscorea parviflora	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO9436	Dioscorea parviflora	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC502297 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25054
0.1-0.2	21348
0.2-0.3	2473
0.3-0.4	733
0.4-0.5	121
0.5-0.6	66
0.6-0.7	33
0.7-0.8	0
0.8-0.85	2
0.85-0.9	4
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9223	High Similarity	NPC194207
0.9223	High Similarity	NPC22779
0.8962	High Similarity	NPC480553
0.8796	High Similarity	NPC232054
0.8774	High Similarity	NPC480554
0.8559	High Similarity	NPC480556
0.8208	Intermediate Similarity	NPC480555
0.8208	Intermediate Similarity	NPC150372
0.7925	Intermediate Similarity	NPC470433
0.7925	Intermediate Similarity	NPC46190
0.7925	Intermediate Similarity	NPC171073
0.7909	Intermediate Similarity	NPC309278
0.7748	Intermediate Similarity	NPC475333
0.7748	Intermediate Similarity	NPC224098
0.7748	Intermediate Similarity	NPC208383
0.7542	Intermediate Similarity	NPC224314
0.75	Intermediate Similarity	NPC269297
0.75	Intermediate Similarity	NPC222202
0.7477	Intermediate Similarity	NPC14704
0.7364	Intermediate Similarity	NPC248746
0.7168	Intermediate Similarity	NPC73243
0.7168	Intermediate Similarity	NPC244086
0.7168	Intermediate Similarity	NPC84956
0.7156	Intermediate Similarity	NPC113044
0.7156	Intermediate Similarity	NPC283829
0.7156	Intermediate Similarity	NPC161676
0.7143	Intermediate Similarity	NPC42171
0.708	Intermediate Similarity	NPC475182
0.7043	Intermediate Similarity	NPC247037
0.6991	Remote Similarity	NPC300557
0.6864	Remote Similarity	NPC249265
0.6825	Remote Similarity	NPC263359
0.6814	Remote Similarity	NPC602423
0.6807	Remote Similarity	NPC23808
0.6807	Remote Similarity	NPC87998
0.6774	Remote Similarity	NPC477808
0.6754	Remote Similarity	NPC477809
0.6696	Remote Similarity	NPC6806
0.6695	Remote Similarity	NPC13193
0.6667	Remote Similarity	NPC470432
0.6667	Remote Similarity	NPC230507
0.6557	Remote Similarity	NPC308140
0.6555	Remote Similarity	NPC32361
0.6518	Remote Similarity	NPC94272
0.6518	Remote Similarity	NPC6295
0.6449	Remote Similarity	NPC181845
0.6446	Remote Similarity	NPC470864
0.6379	Remote Similarity	NPC475643
0.6293	Remote Similarity	NPC98696
0.625	Remote Similarity	NPC19400
0.621	Remote Similarity	NPC477811
0.6202	Remote Similarity	NPC210569
0.6198	Remote Similarity	NPC486386
0.619	Remote Similarity	NPC470866
0.6167	Remote Similarity	NPC102016
0.6167	Remote Similarity	NPC95051
0.6134	Remote Similarity	NPC124677
0.6121	Remote Similarity	NPC305423
0.6098	Remote Similarity	NPC254255
0.6087	Remote Similarity	NPC485595
0.605	Remote Similarity	NPC122819
0.6	Remote Similarity	NPC470862
0.594	Remote Similarity	NPC305771
0.594	Remote Similarity	NPC94072
0.594	Remote Similarity	NPC169816
0.5935	Remote Similarity	NPC475550
0.592	Remote Similarity	NPC218571
0.592	Remote Similarity	NPC487615
0.5906	Remote Similarity	NPC287885
0.5897	Remote Similarity	NPC141433
0.5897	Remote Similarity	NPC195297
0.5766	Remote Similarity	NPC165439
0.576	Remote Similarity	NPC475625
0.5752	Remote Similarity	NPC234352
0.575	Remote Similarity	NPC42482
0.5714	Remote Similarity	NPC15918
0.5714	Remote Similarity	NPC160426
0.5659	Remote Similarity	NPC31896
0.5645	Remote Similarity	NPC184617
0.5635	Remote Similarity	NPC116756
0.562	Remote Similarity	NPC486388
0.561	Remote Similarity	NPC471464
0.5588	Remote Similarity	NPC244431
0.5581	Remote Similarity	NPC132080
0.5574	Remote Similarity	NPC485603
0.5565	Remote Similarity	NPC477451
0.5546	Remote Similarity	NPC306991
0.5492	Remote Similarity	NPC40440
0.544	Remote Similarity	NPC128572
0.544	Remote Similarity	NPC485604
0.5424	Remote Similarity	NPC306131
0.5424	Remote Similarity	NPC211354
0.5424	Remote Similarity	NPC200802
0.5391	Remote Similarity	NPC297348
0.5391	Remote Similarity	NPC249204
0.5391	Remote Similarity	NPC48339
0.5391	Remote Similarity	NPC141769
0.5391	Remote Similarity	NPC477547
0.536	Remote Similarity	NPC249553
0.5349	Remote Similarity	NPC232037
0.5333	Remote Similarity	NPC107962
0.5323	Remote Similarity	NPC265275
0.5317	Remote Similarity	NPC150057
0.5317	Remote Similarity	NPC147753
0.5259	Remote Similarity	NPC248202
0.5255	Remote Similarity	NPC79900
0.5231	Remote Similarity	NPC232611
0.5224	Remote Similarity	NPC470867
0.5221	Remote Similarity	NPC477807
0.521	Remote Similarity	NPC206003
0.521	Remote Similarity	NPC473610
0.5207	Remote Similarity	NPC295980
0.5161	Remote Similarity	NPC475351
0.5152	Remote Similarity	NPC476112
0.5152	Remote Similarity	NPC307534
0.5128	Remote Similarity	NPC325828
0.5122	Remote Similarity	NPC70204
0.5118	Remote Similarity	NPC182900
0.5108	Remote Similarity	NPC208832
0.5086	Remote Similarity	NPC485594
0.5081	Remote Similarity	NPC470748
0.5068	Remote Similarity	NPC481189
0.5041	Remote Similarity	NPC15249
0.5041	Remote Similarity	NPC25455
0.504	Remote Similarity	NPC485605
0.5039	Remote Similarity	NPC97700
0.5039	Remote Similarity	NPC30856
0.5038	Remote Similarity	NPC83137

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC502297 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7708
0.1-0.2	1375
0.2-0.3	58
0.3-0.4	5
0.4-0.5	1
0.5-0.6	2
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.605	Remote Similarity	NPD8449	Approved
0.5317	Remote Similarity	NPD8450	Suspended
0.5128	Remote Similarity	NPD8171	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data