35 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
14 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC89549
Formula: C31H26N2O5
Ingredient ID: NPC89549
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1cc2[nH]c3c(c2c(c1O)c1cc2c(cc1O)[nH]c1c2cccc1)cc(c(c3CC=C(C)C)O)C=O |
| Standard InCHI | InChI=1S/C31H26N2O5/c1-15(2)8-9-18-29-21(10-16(14-34)30(18)36)27-24(33-29)13-26(38-3)31(37)28(27)20-11-19-17-6-4-5-7-22(17)32-23(19)12-25(20)35/h4-8,10-14,32-33,35-37H,9H2,1-3H3 |
| Standard InCHIKey | VLOVIIQGYCTHED-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD201130] Database: NPASS [NPC89549] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
 |
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
 |
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC85932
Formula: C18H17NO5
Ingredient ID: NPC85932
| Common Name | n.a. |
| IUPAC Name | (1R,2R)-1,2,9-trihydroxy-3,3-dimethyl-2,7-dihydro-1H-pyrano[2,3-c]carbazole-10-carbaldehyde |
| Canonical SMILES | O=Cc1cc2c(cc1O)[nH]c1c2c2c(cc1)OC([C@@H]([C@@H]2O)O)(C)C |
| Standard InCHI | InChI=1S/C18H17NO5/c1-18(2)17(23)16(22)15-13(24-18)4-3-10-14(15)9-5-8(7-20)12(21)6-11(9)19-10/h3-7,16-17,19,21-23H,1-2H3/t16-,17-/m1/s1 |
| Standard InCHIKey | GUNFZVNYEJCMLK-IAGOWNOFSA-N |
| Ingredient External Links |
PubChem CID: 71623860 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD223277] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC76982
Formula: C13H9NO
Ingredient ID: NPC76982
| Common Name | 3-Formylcarbazole |
| IUPAC Name | 9H-carbazole-3-carbaldehyde |
| Canonical SMILES | O=Cc1ccc2c(c1)c1ccccc1[nH]2 |
| Standard InCHI | InChI=1S/C13H9NO/c15-8-9-5-6-13-11(7-9)10-3-1-2-4-12(10)14-13/h1-8,14H |
| Standard InCHIKey | WRBOHOGDAJPJOQ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 504067 ChEMBL ID: CHEMBL1172392 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD72434] Database: NPASS [NPC76982] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena excavata | Clausena | Rutaceae |
|
| Clausena lansium | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC7433
Formula: C13H9NO3
Ingredient ID: NPC7433
| Common Name | n.a. |
| IUPAC Name | 2,6-dihydroxy-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | O=Cc1cc2c(cc1O)[nH]c1c2cc(O)cc1 |
| Standard InCHI | InChI=1S/C13H9NO3/c15-6-7-3-9-10-4-8(16)1-2-11(10)14-12(9)5-13(7)17/h1-6,14,16-17H |
| Standard InCHIKey | RCFXXMDGOAHNQH-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 101508363 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD42215] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC6786
Formula: C18H15NO3
Ingredient ID: NPC6786
| Common Name | Claurailas D |
| IUPAC Name | 9-hydroxy-3,3-dimethyl-7H-pyrano[2,3-c]carbazole-10-carbaldehyde |
| Canonical SMILES | O=Cc1cc2c(cc1O)[nH]c1c2c2C=CC(Oc2cc1)(C)C |
| Standard InCHI | InChI=1S/C18H15NO3/c1-18(2)6-5-11-16(22-18)4-3-13-17(11)12-7-10(9-20)15(21)8-14(12)19-13/h3-9,19,21H,1-2H3 |
| Standard InCHIKey | FKVAMCZERBVNQE-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 51039828 ChEMBL ID: CHEMBL1689798 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD173081] Database: NPASS [NPC6786] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena harmandiana | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC4687
Formula: C15H13NO3
Ingredient ID: NPC4687
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1ccc2c(c1)[nH]c1c2cc(cc1)C(=O)OC |
| Standard InCHI | InChI=1S/C15H13NO3/c1-18-10-4-5-11-12-7-9(15(17)19-2)3-6-13(12)16-14(11)8-10/h3-8,16H,1-2H3 |
| Standard InCHIKey | UHYHEIKZOWURQD-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD168210] Database: NPASS [NPC4687] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC43787
Formula: C18H17NO
Ingredient ID: NPC43787
| Common Name | Grinimibine |
| IUPAC Name | 3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole |
| Canonical SMILES | Cc1cc2c(c3c1OC(C)(C)C=C3)[nH]c1c2cccc1 |
| Standard InCHI | InChI=1S/C18H17NO/c1-11-10-14-12-6-4-5-7-15(12)19-16(14)13-8-9-18(2,3)20-17(11)13/h4-10,19H,1-3H3 |
| Standard InCHIKey | GAEQWKVGMHUUKO-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 96943 ChEMBL ID: CHEMBL1477760 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD108499] Database: NPASS [NPC43787] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya siamensis | Murraya | Rutaceae |
|
| Clausena vestita | Clausena | Rutaceae | |
| Clausena harmandiana | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Panax ginseng | Panax | Araliaceae |
 |
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae | |
| Murraya koenigii | Murraya | Rutaceae |
|
Ingredient ID: NPC3207
Formula: C14H11NO3
Ingredient ID: NPC3207
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COC(=O)c1cc2c(cc1O)[nH]c1c2cccc1 |
| Standard InCHI | InChI=1S/C14H11NO3/c1-18-14(17)10-6-9-8-4-2-3-5-11(8)15-12(9)7-13(10)16/h2-7,15-16H,1H3 |
| Standard InCHIKey | SJVKEEPWQLIYIJ-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD92425] Database: NPASS [NPC3207] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena vestita | Clausena | Rutaceae | |
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC310211
Formula: C15H13NO3
Ingredient ID: NPC310211
| Common Name | n.a. |
| IUPAC Name | 2,7-dimethoxy-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | COc1ccc2c(c1)[nH]c1c2cc(c(c1)OC)C=O |
| Standard InCHI | InChI=1S/C15H13NO3/c1-18-10-3-4-11-12-5-9(8-17)15(19-2)7-14(12)16-13(11)6-10/h3-8,16H,1-2H3 |
| Standard InCHIKey | KSAHTWWUVLYPSK-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5317755 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD71790] Database: NPASS [NPC310211] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena vestita | Clausena | Rutaceae | |
| Clausena excavata | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC308137
Formula: C14H11NO2
Ingredient ID: NPC308137
| Common Name | Glycosinine |
| IUPAC Name | 2-methoxy-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | O=Cc1cc2c(cc1OC)[nH]c1c2cccc1 |
| Standard InCHI | InChI=1S/C14H11NO2/c1-17-14-7-13-11(6-9(14)8-16)10-4-2-3-5-12(10)15-13/h2-8,15H,1H3 |
| Standard InCHIKey | SIUSRUNIJUFYPR-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 6483032 ChEMBL ID: CHEMBL1088189 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD73597] Database: NPASS [NPC308137] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC303951
Formula: C18H17NO2
Ingredient ID: NPC303951
| Common Name | Heptaphylline |
| IUPAC Name | 2-hydroxy-1-(3-methylbut-2-enyl)-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | O=Cc1cc2c(c(c1O)CC=C(C)C)[nH]c1c2cccc1 |
| Standard InCHI | InChI=1S/C18H17NO2/c1-11(2)7-8-14-17-15(9-12(10-20)18(14)21)13-5-3-4-6-16(13)19-17/h3-7,9-10,19,21H,8H2,1-2H3 |
| Standard InCHIKey | ICYHRFZZQCYWNF-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5318015 ChEMBL ID: CHEMBL1689799 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD100239] Database: NPASS [NPC303951] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena excavata | Clausena | Rutaceae |
|
| Clausena harmandiana | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Clausena heptaphylla | Clausena | Rutaceae |
|
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC300991
Formula: C18H15NO2
Ingredient ID: NPC300991
| Common Name | n.a. |
| IUPAC Name | 3,3-dimethyl-7H-pyrano[2,3-c]carbazole-10-carbaldehyde |
| Canonical SMILES | O=Cc1ccc2c(c1)c1c([nH]2)ccc2c1C=CC(O2)(C)C |
| Standard InCHI | InChI=1S/C18H15NO2/c1-18(2)8-7-12-16(21-18)6-5-15-17(12)13-9-11(10-20)3-4-14(13)19-15/h3-10,19H,1-2H3 |
| Standard InCHIKey | CRDPWFBUQAXUOR-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 71623858 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD219072] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC280799
Formula: C19H17NO3
Ingredient ID: NPC280799
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COC(=O)c1ccc2c(c1)c1c([nH]2)ccc2c1C=CC(O2)(C)C |
| Standard InCHI | InChI=1S/C19H17NO3/c1-19(2)9-8-12-16(23-19)7-6-15-17(12)13-10-11(18(21)22-3)4-5-14(13)20-15/h4-10,20H,1-3H3 |
| Standard InCHIKey | PCLJYOVKGSBXJW-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD225411] Database: NPASS [NPC280799] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena harmandiana | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC269367
Formula: C12H9NO2
Ingredient ID: NPC269367
| Common Name | Dictamnine |
| IUPAC Name | 4-methoxyfuro[2,3-b]quinoline |
| Canonical SMILES | COc1c2ccccc2nc2c1cco2 |
| Standard InCHI | InChI=1S/C12H9NO2/c1-14-11-8-4-2-3-5-10(8)13-12-9(11)6-7-15-12/h2-7H,1H3 |
| Standard InCHIKey | WIONIXOBNMDJFJ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 68085 ZINC ID: ZINC000000265517 ChEMBL ID: CHEMBL22533 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC269367] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Glycosmis pseudoracemosa | Glycosmis | Rutaceae |
|
| Ficus conraui | Ficus | Moraceae |
|
| Dictamnus dasycarpus | Dictamnus | Rutaceae |
|
| Machilus odoratissima | Machilus | Lauraceae |
|
| Corydalis persica | Corydalis | Papaveraceae | |
| Salta triflora | Salta | Polygonaceae | |
| Sideritis perfoliata | Sideritis | Lamiaceae |
|
| Inula grantioides | Inula | Asteraceae |
|
| Arachniodes mutica | Arachniodes | Dryopteridaceae | |
| Vernonia chloropappa | Vernonia | Asteraceae | |
| Jasione montana | Jasione | Campanulaceae | |
| Juniperus horizontalis | Juniperus | Cupressaceae |
|
| Psiadia anchusifolia | Psiadia | Asteraceae | |
| Acronychia laurifolia | Acronychia | Rutaceae |
|
| Strychnos spinosa | Strychnos | Loganiaceae |
|
| Esenbeckia hartmanii | Esenbeckia | Rutaceae | |
| Talipariti tiliaceum | Talipariti | Malvaceae |
|
| Amomum daniellii | Amomum | Zingiberaceae | |
| Plectranthus caninus | Plectranthus | Lamiaceae |
|
| Lathyrus tingitanus | Lathyrus | Fabaceae |
|
| Rauvolfia salicifolia | Rauvolfia | Apocynaceae | |
| Balanophora japonica | Balanophora | Balanophoraceae |
|
| Angelica sinensis | Angelica | Apiaceae |
|
| Cota tinctoria | Cota | Asteraceae |
 |
| Pycnarrhena australiana | Pycnarrhena | Menispermaceae | |
| Zanthoxylum planispinum | Zanthoxylum | Rutaceae |
|
| Clausena vestita | Clausena | Rutaceae | |
| Zanthoxylum avicennae | Zanthoxylum | Rutaceae |
|
| Hosta sieboldiana | Hosta | Asparagaceae |
|
| Flueggea microcarpa | Flueggea | Phyllanthaceae |
|
| Inula salsoloides | Inula | Asteraceae | |
| Millettia pachycarpa | Millettia | Fabaceae |
|
| Eutrochium purpureum | Eutrochium | Asteraceae |
|
| Alchornea cordifolia | Alchornea | Euphorbiaceae |
|
| Zanthoxylum ailanthoides | Zanthoxylum | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Tetradium glabrifolium | Tetradium | Rutaceae | |
| Morinda coreia | Morinda | Rubiaceae |
|
| Boenninghausenia albiflora | Boenninghausenia | Rutaceae |
|
| Iris sanguinea | Iris | Iridaceae | |
| Jacobaea cannabifolia | Jacobaea | Asteraceae | |
| Mycetia nutans | Mycetia | Rubiaceae |
|
| Conium maculatum | Conium | Apiaceae |
|
| Aglaia pyramidata | Aglaia | Meliaceae | |
| Schrebera swietenoides | Schrebera | Oleaceae |
|
| Senecio gilliesi | Senecio | Asteraceae | |
| Celastrus monospermus | Celastrus | Celastraceae | |
| Solanum spirale | Solanum | Solanaceae |
|
| Agave deserti | Agave | Asparagaceae |
|
| Asclepias subulata | Asclepias | Apocynaceae |
|
| Strychnos potatorum | Strychnos | Loganiaceae |
|
| Zanthoxylum simulans | Zanthoxylum | Rutaceae |
|
| Daphne tangutica | Daphne | Thymelaeaceae | |
| Sophora leachiana | Sophora | Fabaceae |
|
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Vernonia lilacina | Vernonia | Asteraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae | |
| Passiflora morifolia | Passiflora | Passifloraceae |
|
| Trifolium montanum | Trifolium | Fabaceae | |
| Hortonia floribunda | Hortonia | Monimiaceae | |
| Corynanthe pachyceras | Corynanthe | Rubiaceae | |
| Machilus zuihoensis | Machilus | Lauraceae |
|
| Vitellaria paradoxa | Vitellaria | Sapotaceae |
|
| Zanthoxylum decaryi | Zanthoxylum | Rutaceae |
|
| Peucedanum oroselinum | Peucedanum | Apiaceae | |
| Ageratina saltillensis | Ageratina | Asteraceae | |
| Cynoglossum amabile | Cynoglossum | Boraginaceae |
|
| Zanthoxylum chiloperone | Zanthoxylum | Rutaceae | |
| Glinus oppositifolius | Glinus | Molluginaceae |
|
| Vicia balansae | Vicia | Fabaceae | |
| Jurinea maxima | Jurinea | Asteraceae | |
| Atalantia wightii | Atalantia | Rutaceae | |
| Pilocarpus grandiflorus | Pilocarpus | Rutaceae | |
| Salvia polystachya | Salvia | Lamiaceae |
|
| Toddalia asiatica | Toddalia | Rutaceae |
|
| Grewia villosa | Grewia | Malvaceae |
|
| Gentiana strictiflora | Gentiana | Gentianaceae | |
| Euonymus europaeus | Euonymus | Celastraceae |
|
| Persicaria tinctoria | Persicaria | Polygonaceae |
|
| Rosa transmorrisonensis | Rosa | Rosaceae | |
| Zanthoxylum nitidum | Zanthoxylum | Rutaceae |
|
Ingredient ID: NPC252251
Formula: C32H28N2O4
Ingredient ID: NPC252251
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1cc2[nH]c3c(c2cc1C)c(c(cc3)O)c1c(O)c(C)cc2c1[nH]c1c2c2C=CC(Oc2cc1)(C)C |
| Standard InCHI | InChI=1S/C32H28N2O4/c1-15-12-18-22(14-25(15)37-5)33-21-6-8-23(35)28(27(18)21)29-30-19(13-16(2)31(29)36)26-17-10-11-32(3,4)38-24(17)9-7-20(26)34-30/h6-14,33-36H,1-5H3 |
| Standard InCHIKey | PLMGKTMPOCPSEV-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD220571] Database: NPASS [NPC252251] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC250351
Formula: C36H32N2O4
Ingredient ID: NPC250351
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Cc1cc2c(c(c1O)c1c(O)c(C)cc3c1c1ccc4c(c1[nH]3)C=CC(O4)(C)C)[nH]c1c2c2C=CC(Oc2cc1)(C)C |
| Standard InCHI | InChI=1S/C36H32N2O4/c1-17-15-22-27-19-11-13-35(3,4)41-25(19)10-8-23(27)37-32(22)30(34(17)40)29-28-21-7-9-26-20(12-14-36(5,6)42-26)31(21)38-24(28)16-18(2)33(29)39/h7-16,37-40H,1-6H3 |
| Standard InCHIKey | OVICAAMRDFNGHT-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD201131] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC249583
Formula: C14H11NO2
Ingredient ID: NPC249583
| Common Name | Clauszoline K |
| IUPAC Name | 7-methoxy-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | COc1ccc2c(c1)[nH]c1c2cc(cc1)C=O |
| Standard InCHI | InChI=1S/C14H11NO2/c1-17-10-3-4-11-12-6-9(8-16)2-5-13(12)15-14(11)7-10/h2-8,15H,1H3 |
| Standard InCHIKey | IBDBRUPJUXYODT-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 10537169 ChEMBL ID: CHEMBL1927326 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD111674] Database: NPASS [NPC249583] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena vestita | Clausena | Rutaceae | |
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC247803
Formula: C14H11NO3
Ingredient ID: NPC247803
| Common Name | 2-Hydroxy-3-Formyl-7-Methoxycarbazole |
| IUPAC Name | 2-hydroxy-7-methoxy-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | COc1ccc2c(c1)[nH]c1c2cc(c(c1)O)C=O |
| Standard InCHI | InChI=1S/C14H11NO3/c1-18-9-2-3-10-11-4-8(7-16)14(17)6-13(11)15-12(10)5-9/h2-7,15,17H,1H3 |
| Standard InCHIKey | JLWFCPLXNANORV-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 189687 ChEMBL ID: CHEMBL463264 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD72932] Database: NPASS [NPC247803] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya siamensis | Murraya | Rutaceae |
|
| Clausena vestita | Clausena | Rutaceae | |
| Clausena excavata | Clausena | Rutaceae |
|
| Tetradium ruticarpum | Tetradium | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC246651
Formula: C19H17NO4
Ingredient ID: NPC246651
| Common Name | n.a. |
| IUPAC Name | methyl 8-hydroxy-3,3-dimethyl-7H-pyrano[2,3-c]carbazole-10-carboxylate |
| Canonical SMILES | COC(=O)c1cc(O)c2c(c1)c1c([nH]2)ccc2c1C=CC(O2)(C)C |
| Standard InCHI | InChI=1S/C19H17NO4/c1-19(2)7-6-11-15(24-19)5-4-13-16(11)12-8-10(18(22)23-3)9-14(21)17(12)20-13/h4-9,20-21H,1-3H3 |
| Standard InCHIKey | RSIOHXJKTPYYMI-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 71623859 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD221154] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC23294
Formula: C18H17NO3
Ingredient ID: NPC23294
| Common Name | 7-Hydroxyheptaphylline |
| IUPAC Name | 2,7-dihydroxy-1-(3-methylbut-2-enyl)-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | O=Cc1cc2c(c(c1O)CC=C(C)C)[nH]c1c2ccc(c1)O |
| Standard InCHI | InChI=1S/C18H17NO3/c1-10(2)3-5-14-17-15(7-11(9-20)18(14)22)13-6-4-12(21)8-16(13)19-17/h3-4,6-9,19,21-22H,5H2,1-2H3 |
| Standard InCHIKey | NRWURNOYKGONNZ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 15767846 ChEMBL ID: CHEMBL1689801 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD184104] Database: NPASS [NPC23294] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena harmandiana | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC228273
Formula: C19H19NO4
Ingredient ID: NPC228273
| Common Name | n.a. |
| IUPAC Name | methyl 1,6-dihydroxy-5-(3-methylbut-2-enyl)-9H-carbazole-3-carboxylate |
| Canonical SMILES | COC(=O)c1cc(O)c2c(c1)c1c([nH]2)ccc(c1CC=C(C)C)O |
| Standard InCHI | InChI=1S/C19H19NO4/c1-10(2)4-5-12-15(21)7-6-14-17(12)13-8-11(19(23)24-3)9-16(22)18(13)20-14/h4,6-9,20-22H,5H2,1-3H3 |
| Standard InCHIKey | XYOGEVAARAVQHR-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 71623800 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD214869] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC218034
Formula: C14H11NO3
Ingredient ID: NPC218034
| Common Name | n.a. |
| IUPAC Name | 2-hydroxy-6-methoxy-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | COc1ccc2c(c1)c1cc(C=O)c(cc1[nH]2)O |
| Standard InCHI | InChI=1S/C14H11NO3/c1-18-9-2-3-12-11(5-9)10-4-8(7-16)14(17)6-13(10)15-12/h2-7,15,17H,1H3 |
| Standard InCHIKey | INFFNJXOAJWVCS-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5278451 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD185408] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena excavata | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC210828
Formula: C13H9NO2
Ingredient ID: NPC210828
| Common Name | n.a. |
| IUPAC Name | 2-hydroxy-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | O=Cc1cc2c(cc1O)[nH]c1c2cccc1 |
| Standard InCHI | InChI=1S/C13H9NO2/c15-7-8-5-10-9-3-1-2-4-11(9)14-12(10)6-13(8)16/h1-7,14,16H |
| Standard InCHIKey | NEAHWGSQUXSRNW-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 504068 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD69879] Database: NPASS [NPC210828] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena vestita | Clausena | Rutaceae | |
| Clausena excavata | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC209174
Formula: C36H32N2O4
Ingredient ID: NPC209174
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Cc1cc2c(c(c1O)c1c(O)c(C)cc3c1[nH]c1c3c3C=CC(Oc3cc1)(C)C)[nH]c1c2c2C=CC(Oc2cc1)(C)C |
| Standard InCHI | InChI=1S/C36H32N2O4/c1-17-15-21-27-19-11-13-35(3,4)41-25(19)9-7-23(27)37-31(21)29(33(17)39)30-32-22(16-18(2)34(30)40)28-20-12-14-36(5,6)42-26(20)10-8-24(28)38-32/h7-16,37-40H,1-6H3 |
| Standard InCHIKey | CZPITFOVEOGBRD-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD222711] Database: NPASS [NPC209174] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC201697
Formula: C23H23NO2
Ingredient ID: NPC201697
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Cc1cc2c(c3c1OC(C)(C)C=C3)[nH]c1c2c2C=CC(Oc2cc1)(C)C |
| Standard InCHI | InChI=1S/C23H23NO2/c1-13-12-16-19-14-8-10-22(2,3)25-18(14)7-6-17(19)24-20(16)15-9-11-23(4,5)26-21(13)15/h6-12,24H,1-5H3 |
| Standard InCHIKey | XXJKHGCPQSVPCM-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD216367] Database: NPASS [NPC201697] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC199277
Formula: C13H11NO2
Ingredient ID: NPC199277
| Common Name | 2-Methoxy-9H-Carbazol-3-Ol |
| IUPAC Name | 2-methoxy-9H-carbazol-3-ol |
| Canonical SMILES | COc1cc2[nH]c3c(c2cc1O)cccc3 |
| Standard InCHI | InChI=1S/C13H11NO2/c1-16-13-7-11-9(6-12(13)15)8-4-2-3-5-10(8)14-11/h2-7,14-15H,1H3 |
| Standard InCHIKey | KDLDZUFUKYBJCQ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 15182256 ChEMBL ID: CHEMBL2037028 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD220022] Database: NPASS [NPC199277] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC174760
Formula: C15H13NO4
Ingredient ID: NPC174760
| Common Name | Clausine K |
| IUPAC Name | 2,7-dimethoxy-9H-carbazole-3-carboxylic acid |
| Canonical SMILES | COc1ccc2c(c1)[nH]c1c2cc(c(c1)OC)C(=O)O |
| Standard InCHI | InChI=1S/C15H13NO4/c1-19-8-3-4-9-10-6-11(15(17)18)14(20-2)7-13(10)16-12(9)5-8/h3-7,16H,1-2H3,(H,17,18) |
| Standard InCHIKey | LDKCHJXUOLZQQV-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 504070 ChEMBL ID: CHEMBL1689806 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD72373] Database: NPASS [NPC174760] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena vestita | Clausena | Rutaceae | |
| Clausena excavata | Clausena | Rutaceae |
|
| Clausena harmandiana | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC169402
Formula: C16H15NO4
Ingredient ID: NPC169402
| Common Name | n.a. |
| IUPAC Name | methyl 2,7-dimethoxy-9H-carbazole-3-carboxylate |
| Canonical SMILES | COc1ccc2c(c1)[nH]c1c2cc(c(c1)OC)C(=O)OC |
| Standard InCHI | InChI=1S/C16H15NO4/c1-19-9-4-5-10-11-7-12(16(18)21-3)15(20-2)8-14(11)17-13(10)6-9/h4-8,17H,1-3H3 |
| Standard InCHIKey | BWOCIAHZUOFDLV-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5315952 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD22588] Database: NPASS [NPC169402] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena vestita | Clausena | Rutaceae | |
| Clausena excavata | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC161833
Formula: C18H17NO3
Ingredient ID: NPC161833
| Common Name | n.a. |
| IUPAC Name | 2,6-dihydroxy-5-(3-methylbut-2-enyl)-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | O=Cc1cc2c(cc1O)[nH]c1c2c(CC=C(C)C)c(cc1)O |
| Standard InCHI | InChI=1S/C18H17NO3/c1-10(2)3-4-12-16(21)6-5-14-18(12)13-7-11(9-20)17(22)8-15(13)19-14/h3,5-9,19,21-22H,4H2,1-2H3 |
| Standard InCHIKey | KQGVMMURIUNLDR-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 71623801 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD216935] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC160381
Formula: C14H11NO2
Ingredient ID: NPC160381
| Common Name | Methyl Carbazole-3-Carboxylate |
| IUPAC Name | methyl 9H-carbazole-3-carboxylate |
| Canonical SMILES | COC(=O)c1ccc2c(c1)c1ccccc1[nH]2 |
| Standard InCHI | InChI=1S/C14H11NO2/c1-17-14(16)9-6-7-13-11(8-9)10-4-2-3-5-12(10)15-13/h2-8,15H,1H3 |
| Standard InCHIKey | LZXXHWWSVRIDGR-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 504069 ChEMBL ID: CHEMBL446253 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD83334] Database: NPASS [NPC160381] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena vestita | Clausena | Rutaceae | |
| Clausena excavata | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Clausena anisata | Clausena | Rutaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC150239
Formula: C19H19NO3
Ingredient ID: NPC150239
| Common Name | 7-Methoxyheptaphylline |
| IUPAC Name | 2-hydroxy-7-methoxy-1-(3-methylbut-2-enyl)-9H-carbazole-3-carbaldehyde |
| Canonical SMILES | O=Cc1cc2c(c(c1O)CC=C(C)C)[nH]c1c2ccc(c1)OC |
| Standard InCHI | InChI=1S/C19H19NO3/c1-11(2)4-6-15-18-16(8-12(10-21)19(15)22)14-7-5-13(23-3)9-17(14)20-18/h4-5,7-10,20,22H,6H2,1-3H3 |
| Standard InCHIKey | RJWKVZMWLOWCMX-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 189688 ChEMBL ID: CHEMBL464275 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD66004] Database: NPASS [NPC150239] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Clausena harmandiana | Clausena | Rutaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC141504
Formula: C28H20N2O7
Ingredient ID: NPC141504
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COC(=O)Oc1cc2c(c(c1c1c(O)c(C=O)cc3c1[nH]c1c3ccc(c1)OC)O)[nH]c1c2cccc1 |
| Standard InCHI | InChI=1S/C28H20N2O7/c1-35-14-7-8-16-17-9-13(12-31)26(32)23(24(17)30-20(16)10-14)22-21(37-28(34)36-2)11-18-15-5-3-4-6-19(15)29-25(18)27(22)33/h3-12,29-30,32-33H,1-2H3 |
| Standard InCHIKey | IPQLJRZESJFSPV-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD218494] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC135887
Formula: C14H13NO3
Ingredient ID: NPC135887
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1ccc2c(c1)[nH]c1c2cc(c(c1)OC)O |
| Standard InCHI | InChI=1S/C14H13NO3/c1-17-8-3-4-9-10-6-13(16)14(18-2)7-12(10)15-11(9)5-8/h3-7,15-16H,1-2H3 |
| Standard InCHIKey | KGJAJEPCUUXSFQ-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD214307] Database: NPASS [NPC135887] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Ingredient ID: NPC131885
Formula: C13H11NO3
Ingredient ID: NPC131885
| Common Name | Gamma-Fagarine |
| IUPAC Name | 4,8-dimethoxyfuro[2,3-b]quinoline |
| Canonical SMILES | COc1cccc2c1nc1occc1c2OC |
| Standard InCHI | InChI=1S/C13H11NO3/c1-15-10-5-3-4-8-11(10)14-13-9(6-7-17-13)12(8)16-2/h3-7H,1-2H3 |
| Standard InCHIKey | KFBCTNNQFGONHB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 107936 ChEMBL ID: CHEMBL252925 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD41459] Database: NPASS [NPC131885] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Glycosmis pseudoracemosa | Glycosmis | Rutaceae |
|
| Ficus conraui | Ficus | Moraceae |
|
| Dictamnus dasycarpus | Dictamnus | Rutaceae |
|
| Corydalis persica | Corydalis | Papaveraceae | |
| Salta triflora | Salta | Polygonaceae | |
| Trapa japonica | Trapa | Lythraceae |
|
| Inula grantioides | Inula | Asteraceae |
|
| Vernonia chloropappa | Vernonia | Asteraceae | |
| Diospyros peregrina | Diospyros | Ebenaceae |
|
| Diospyros elliptifolia | Diospyros | Ebenaceae | |
| Juniperus horizontalis | Juniperus | Cupressaceae |
|
| Acronychia laurifolia | Acronychia | Rutaceae |
|
| Diospyros abyssinica | Diospyros | Ebenaceae |
|
| Cratystylis conocephala | Cratystylis | Asteraceae | |
| Strychnos spinosa | Strychnos | Loganiaceae |
|
| Esenbeckia hartmanii | Esenbeckia | Rutaceae | |
| Talipariti tiliaceum | Talipariti | Malvaceae |
|
| Beaucarnea recurvata | Beaucarnea | Asparagaceae | |
| Amomum daniellii | Amomum | Zingiberaceae | |
| Aeollanthus buchnerianus | Aeollanthus | Lamiaceae | |
| Plectranthus caninus | Plectranthus | Lamiaceae |
|
| Lathyrus tingitanus | Lathyrus | Fabaceae |
|
| Echium plantagineum | Echium | Boraginaceae |
|
| Rauvolfia salicifolia | Rauvolfia | Apocynaceae | |
| Balanophora japonica | Balanophora | Balanophoraceae |
|
| Espeletiopsis purpurascens | Espeletiopsis | Asteraceae | |
| Leptospermum recurvum | Leptospermum | Myrtaceae | |
| Cota tinctoria | Cota | Asteraceae |
|
| Pycnarrhena australiana | Pycnarrhena | Menispermaceae | |
| Amomum reticulatum | Amomum | Zingiberaceae | |
| Zanthoxylum planispinum | Zanthoxylum | Rutaceae |
|
| Clausena vestita | Clausena | Rutaceae | |
| Zanthoxylum avicennae | Zanthoxylum | Rutaceae |
|
| Hernandia sonora | Hernandia | Hernandiaceae |
|
| Helianthus niveus | Helianthus | Asteraceae |
|
| Hosta sieboldiana | Hosta | Asparagaceae |
|
| Plectranthus hereroensis | Plectranthus | Lamiaceae | |
| Poa sphondylodes | Poa | Poaceae | |
| Cynoglossum viridiflorum | Cynoglossum | Boraginaceae | |
| Zanthoxylum integrifoliolum | Zanthoxylum | Rutaceae |
|
| Phellodendron chinense | Phellodendron | Rutaceae |
|
| Inula salsoloides | Inula | Asteraceae | |
| Eutrochium purpureum | Eutrochium | Asteraceae |
|
| Alchornea cordifolia | Alchornea | Euphorbiaceae |
|
| Caralluma russeliana | Caralluma | Apocynaceae | |
| Dalbergia monetaria | Dalbergia | Fabaceae |
|
| Ursinia anthemoides | Ursinia | Asteraceae | |
| Imperata cylindrica | Imperata | Poaceae |
|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Tetradium glabrifolium | Tetradium | Rutaceae | |
| Polypodium aureum | Polypodium | Polypodiaceae | |
| Alpinia officinarum | Alpinia | Zingiberaceae |
|
| Casimiroa edulis | Casimiroa | Rutaceae |
|
| Helianthus californicus | Helianthus | Asteraceae | |
| Phellodendron amurense | Phellodendron | Rutaceae |
|
| Morinda coreia | Morinda | Rubiaceae |
|
| Iris sanguinea | Iris | Iridaceae | |
| Jacobaea cannabifolia | Jacobaea | Asteraceae | |
| Conium maculatum | Conium | Apiaceae |
|
| Aglaia pyramidata | Aglaia | Meliaceae | |
| Schrebera swietenoides | Schrebera | Oleaceae |
|
| Senecio gilliesi | Senecio | Asteraceae | |
| Celastrus monospermus | Celastrus | Celastraceae | |
| Solanum spirale | Solanum | Solanaceae |
|
| Agave deserti | Agave | Asparagaceae |
|
| Asclepias subulata | Asclepias | Apocynaceae |
|
| Zanthoxylum simulans | Zanthoxylum | Rutaceae |
|
| Phellodendron chinese | Phellodendron | Rutaceae | |
| Sophora leachiana | Sophora | Fabaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Vernonia lilacina | Vernonia | Asteraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae | |
| Passiflora morifolia | Passiflora | Passifloraceae |
|
| Orixa japonica | Orixa | Rutaceae |
|
| Trifolium montanum | Trifolium | Fabaceae | |
| Ruta graveolens | Ruta | Rutaceae |
|
| Hortonia floribunda | Hortonia | Monimiaceae | |
| Corynanthe pachyceras | Corynanthe | Rubiaceae | |
| Centaurea arenaria | Centaurea | Asteraceae | |
| Aegle marmelos | Aegle | Rutaceae |
|
| Scorzonera hispanica | Scorzonera | Asteraceae |
|
| Peucedanum oroselinum | Peucedanum | Apiaceae | |
| Ageratina saltillensis | Ageratina | Asteraceae | |
| Cynoglossum amabile | Cynoglossum | Boraginaceae |
|
| Saussurea stella | Saussurea | Asteraceae | |
| Vicia balansae | Vicia | Fabaceae | |
| Gutenbergia cordifolia | Gutenbergia | Asteraceae |
|
| Glycosmis cochinchinensis | Glycosmis | Rutaceae |
|
| Atalantia wightii | Atalantia | Rutaceae | |
| Salvia polystachya | Salvia | Lamiaceae |
|
| Spiraea prunifolia | Spiraea | Rosaceae |
|
| Grewia villosa | Grewia | Malvaceae |
|
| Euonymus europaeus | Euonymus | Celastraceae |
|
| Persicaria tinctoria | Persicaria | Polygonaceae |
|
| Phyllodium pulchellum | Phyllodium | Fabaceae |
|
| Mikania scandens | Mikania | Asteraceae |
|
| Cotylelobium scabriusculum | Cotylelobium | Dipterocarpaceae |
Ingredient ID: NPC116238
Formula: C15H13NO3
Ingredient ID: NPC116238
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COC(=O)c1cc2c(cc1OC)[nH]c1c2cccc1 |
| Standard InCHI | InChI=1S/C15H13NO3/c1-18-14-8-13-10(7-11(14)15(17)19-2)9-5-3-4-6-12(9)16-13/h3-8,16H,1-2H3 |
| Standard InCHIKey | BYDOYRHWHKPKQP-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD163546] Database: NPASS [NPC116238] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Otholobium pubescens | Otholobium | Fabaceae | |
| Iris sanguinea | Iris | Iridaceae | |
| Rhododendron edgeworthii | Rhododendron | Ericaceae | |
| Populus candicans | Populus | Salicaceae | |
| Gutenbergia marginata | Gutenbergia | Asteraceae | |
| Griselinia scandens | Griselinia | Griseliniaceae | |
| Podocalyx loranthoides | Podocalyx | Picrodendraceae | |
| Trixis grisebachii | Trixis | Asteraceae | |
| Helicia erratica | Helicia | Proteaceae |
|
| Croton hutchinsonianus | Croton | Euphorbiaceae | |
| Cicer cuneatum | Cicer | Fabaceae | |
| Bulbine asphodeloides | Bulbine | Asphodelaceae |
|
| Ipomoea carnea | Ipomoea | Convolvulaceae |
|
| Yucca elata | Yucca | Asparagaceae |
|
| Hyptis urticoides | Hyptis | Lamiaceae | |
| Monachosorum maximowiczii | Monachosorum | Dennstaedtiaceae | |
| Sarcophyton infundibuliforme | Sarcophyton | Orchidaceae | |
| Delphinium speciosum | Delphinium | Ranunculaceae | |
| Nardia scalaris | Nardia | Solenostomataceae |
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC116238 | C15H13NO3 | 255.09 | -0.461 | 2.67 | 3.535 | 3 | 1 | 51.32 | 5 | 3 | 19 | 0 | |
| NPC131885 | C13H11NO3 | Gamma-Fagarine | 229.07 | -0.2577 | 2.45 | 2.068 | 1 | 0 | 44.49 | 4 | 3 | 17 | 0 |
| NPC135887 | C14H13NO3 | 243.09 | -0.9843 | 2.56 | 1.805 | 1 | 2 | 54.48 | 5 | 3 | 18 | 0 | |
| NPC141504 | C28H20N2O7 | 496.127051 | -1.4436 | 3.55 | 4.778 | 9 | 4 | 133.87 | 6 | 6 | 37 | 0 | |
| NPC150239 | C19H19NO3 | 7-Methoxyheptaphylline | 309.14 | 0.7525 | 3.11 | 3.799 | 2 | 2 | 62.32 | 8 | 3 | 23 | 0 |
| NPC160381 | C14H11NO2 | Methyl Carbazole-3-Carboxylate | 225.08 | -0.4092 | 2.67 | 3.425 | 3 | 1 | 42.09 | 3 | 3 | 17 | 0 |
| NPC161833 | C18H17NO3 | 295.1208434 | 0.344 | 3 | 3.28 | 4 | 3 | 73.32 | 3 | 3 | 22 | 0 | |
| NPC169402 | C16H15NO4 | 285.1 | -0.5128 | 2.67 | 2.88 | 3 | 1 | 60.55 | 7 | 3 | 21 | 0 | |
| NPC174760 | C15H13NO4 | Clausine K | 271.08 | -0.7638 | 2.56 | 2.559 | 3 | 2 | 71.55 | 6 | 3 | 20 | 0 |
| NPC199277 | C13H11NO2 | 2-Methoxy-9H-Carbazol-3-Ol | 213.08 | -0.9325 | 2.56 | 2.46 | 1 | 2 | 45.25 | 3 | 3 | 16 | 0 |
| NPC201697 | C23H23NO2 | 345.17 | 2.0372 | 3.66 | 4.642 | 1 | 1 | 34.25 | 5 | 5 | 26 | 0 | |
| NPC209174 | C36H32N2O4 | 556.24 | 1.3382 | 4.76 | 5.652 | 2 | 4 | 90.5 | 9 | 8 | 42 | 1 | |
| NPC210828 | C13H9NO2 | 211.06 | -1.0731 | 2.56 | 2.984 | 2 | 2 | 53.09 | 2 | 3 | 16 | 0 | |
| NPC218034 | C14H11NO3 | 241.0738932 | -1.1249 | 2.56 | 2.329 | 4 | 2 | 62.32 | 2 | 3 | 18 | 0 | |
| NPC228273 | C19H19NO4 | 325.1314081 | 0.5476 | 3 | 3.187 | 5 | 3 | 82.55 | 4 | 3 | 24 | 0 | |
| NPC23294 | C18H17NO3 | 7-Hydroxyheptaphylline | 295.12 | 0.344 | 3 | 3.28 | 2 | 3 | 73.32 | 7 | 3 | 22 | 0 |
| NPC246651 | C19H17NO4 | 323.115758 | 0.0383 | 3 | 3.117 | 5 | 2 | 71.55 | 2 | 4 | 24 | 0 | |
| NPC247803 | C14H11NO3 | 2-Hydroxy-3-Formyl-7-Methoxycarbazole | 241.07 | -1.1249 | 2.56 | 2.329 | 2 | 2 | 62.32 | 4 | 3 | 18 | 0 |
| NPC249583 | C14H11NO2 | Clauszoline K | 225.08 | -0.6646 | 2.67 | 2.863 | 2 | 1 | 42.09 | 3 | 3 | 17 | 0 |
| NPC250351 | C36H32N2O4 | 556.2362075 | 1.3382 | 4.76 | 5.652 | 6 | 4 | 90.5 | 1 | 8 | 42 | 1 | |
| NPC252251 | C32H28N2O4 | 504.2 | 0.3786 | 4.32 | 4.771 | 2 | 4 | 90.5 | 9 | 7 | 38 | 0 | |
| NPC269367 | C12H9NO2 | Dictamnine | 199.06 | -0.2059 | 2.45 | 2.723 | 1 | 0 | 35.26 | 2 | 3 | 15 | 0 |
| NPC280799 | C19H17NO3 | 307.12 | 0.4986 | 3.11 | 3.651 | 3 | 1 | 51.32 | 5 | 4 | 23 | 0 | |
| NPC300991 | C18H15NO2 | 277.1102787 | 0.295 | 3.11 | 3.744 | 3 | 1 | 42.09 | 1 | 4 | 21 | 0 | |
| NPC303951 | C18H17NO2 | Heptaphylline | 279.13 | 0.8043 | 3.11 | 4.454 | 2 | 2 | 53.09 | 6 | 3 | 21 | 0 |
| NPC308137 | C14H11NO2 | Glycosinine | 225.08 | -0.6646 | 2.67 | 3.074 | 2 | 1 | 42.09 | 3 | 3 | 17 | 0 |
| NPC310211 | C15H13NO3 | 255.09 | -0.7164 | 2.67 | 2.419 | 2 | 1 | 51.32 | 5 | 3 | 19 | 0 | |
| NPC3207 | C14H11NO3 | 241.07 | -0.8695 | 2.56 | 3.445 | 3 | 2 | 62.32 | 4 | 3 | 18 | 0 | |
| NPC43787 | C18H17NO | Grinimibine | 263.13 | 1.1294 | 3.22 | 4.416 | 1 | 1 | 25.02 | 3 | 4 | 20 | 0 |
| NPC4687 | C15H13NO3 | 255.09 | -0.461 | 2.67 | 2.77 | 3 | 1 | 51.32 | 5 | 3 | 19 | 0 | |
| NPC6786 | C18H15NO3 | Claurailas D | 293.11 | -0.1653 | 3 | 3.21 | 2 | 2 | 62.32 | 4 | 4 | 22 | 0 |
| NPC7433 | C13H9NO3 | 227.0582431 | -1.5334 | 2.45 | 1.81 | 4 | 3 | 73.32 | 1 | 3 | 17 | 0 | |
| NPC76982 | C13H9NO | 3-Formylcarbazole | 195.07 | -0.6128 | 2.67 | 3.518 | 2 | 1 | 32.86 | 1 | 3 | 15 | 0 |
| NPC85932 | C18H17NO5 | 327.1106726 | -1.6545 | 2.78 | 1.77 | 6 | 4 | 102.78 | 1 | 4 | 24 | 0 | |
| NPC89549 | C31H26N2O5 | 506.18 | -0.5885 | 4.1 | 4.908 | 3 | 5 | 118.57 | 11 | 6 | 38 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
