NPASS Compound

Natural Product: NPC469431

Natural Product ID	NPC469431
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	YEKZYRCPUZIPAI-AWJWSBBDSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	46883014
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 115122 0 0 0 0 0 0 0 0999 V2000 11.2102 2.4300 1.0070 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0613 1.4132 0.9682 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6717 0.0793 0.6988 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7505 -0.9214 0.0768 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5632 -0.2334 -0.5449 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8270 -1.1547 -1.5275 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7609 -1.7073 -0.6607 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9548 -1.1304 0.7213 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6495 0.0478 0.4703 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5480 -0.8798 1.2555 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6633 -1.6608 0.2977 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3468 -1.3347 -1.0214 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1206 0.0847 -1.2807 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9584 0.8872 -1.6505 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7458 0.6476 -1.0865 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7502 -0.4366 -0.7449 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2255 -1.3315 0.3679 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8732 -0.8695 1.7399 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7187 0.0662 1.8429 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7465 -0.2514 0.7419 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3902 0.1183 -0.5600 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4342 -0.3911 -1.6474 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9177 0.1876 -1.5508 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5234 0.1556 -0.1758 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5613 0.4283 0.9312 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5659 1.0633 -0.0560 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7958 0.4769 0.1916 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4741 0.9956 1.4308 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8043 0.3072 1.5731 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5919 0.1550 0.3278 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7994 0.2547 -0.9434 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6162 0.9158 -0.8752 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5670 -1.0992 -1.6019 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0577 -0.9542 -2.8850 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7598 0.9305 0.2729 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9310 0.1817 0.2196 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7896 0.5337 1.3820 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8955 1.4469 0.9885 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7563 0.8512 -0.1111 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8736 0.1061 -1.0895 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5562 0.5041 -0.9578 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3027 0.3053 -2.5180 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1845 1.6659 -2.8829 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.7290 0.0557 0.4493 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6672 1.7148 2.1198 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.4070 -0.6612 1.8448 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5097 1.0301 2.5424 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7350 0.6928 2.5972 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3515 1.6454 -0.6997 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9196 -2.2525 -2.1360 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7907 -2.2531 -2.0074 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0038 0.9258 -1.1339 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1178 1.8845 -0.1018 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8482 3.4486 1.2149 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9665 2.1199 1.7532 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6634 2.4587 -0.0243 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6007 1.4543 1.9899 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0429 -0.3173 1.6877 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6194 0.2215 0.1017 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4735 -1.6869 0.8266 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3668 -1.4775 -0.6894 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5157 -0.6434 -2.4348 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8434 -2.7964 -0.6276 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5060 -1.8578 1.3262 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5400 -1.3077 2.2796 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3903 0.1997 1.2119 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8949 -2.7422 0.4954 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4660 1.0568 -2.0955 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7384 1.4948 -0.3936 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7207 -1.0893 -1.6689 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6648 -2.3065 0.2188 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6378 -1.7526 2.4085 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7319 -0.3740 2.2699 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0805 1.0990 1.8460 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1870 -0.0858 2.8135 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5812 -1.3433 0.7539 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3584 -1.5095 -1.5378 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8433 -0.2032 -2.6518 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5932 -0.4400 -2.2041 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9749 1.2046 -2.0290 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9351 -0.8640 -0.0288 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4742 1.5078 1.1973 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0217 -0.0278 1.8606 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7680 -0.6084 0.2563 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5432 2.0850 1.3827 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5808 -0.6863 2.0667 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9931 -0.9059 0.3273 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4392 0.8222 -1.6809 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8656 -1.7321 -1.0433 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5731 -1.5575 -1.7119 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5173 -0.1270 -2.9844 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7132 -0.9142 0.2400 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2245 0.9922 2.2256 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4572 2.4142 0.6672 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2335 1.6749 -0.6503 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9352 -0.9657 -0.8494 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7381 -0.3065 -3.2271 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3760 0.0627 -2.6771 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0619 2.1245 -2.8759 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0261 0.3223 1.3318 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5790 2.6581 2.4264 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0955 -0.4773 2.5120 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0068 0.4522 3.1426 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0040 -0.1810 2.9639 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8817 2.1540 0.1167 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2895 1.9681 -0.6309 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6832 1.9651 -1.7159 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5772 -1.7194 -3.0428 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7679 -2.9051 -2.5043 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1712 -2.9912 -1.7533 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1904 -2.8167 -2.7814 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6126 -1.7883 -2.5563 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0606 -2.9492 -1.2163 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0884 1.9448 0.3486 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3440 2.8846 -0.4920 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 30 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 39 44 1 0 38 45 1 0 37 46 1 0 29 47 1 0 28 48 1 0 21 49 1 0 12 50 1 0 6 51 1 0 5 52 1 0 52 53 1 0 53 2 1 0 9 5 1 0 12 7 1 0 17 11 1 0 21 16 1 0 25 20 1 0 32 27 1 0 41 36 1 0 1 54 1 0 1 55 1 0 1 56 1 0 2 57 1 0 3 58 1 0 3 59 1 0 4 60 1 0 4 61 1 0 6 62 1 0 7 63 1 0 8 64 1 0 10 65 1 0 10 66 1 0 11 67 1 0 15 68 1 0 15 69 1 0 16 70 1 0 17 71 1 0 18 72 1 0 18 73 1 0 19 74 1 0 19 75 1 0 20 76 1 0 22 77 1 0 22 78 1 0 23 79 1 0 23 80 1 0 24 81 1 0 25 82 1 0 25 83 1 0 27 84 1 0 28 85 1 0 29 86 1 0 30 87 1 0 31 88 1 0 33 89 1 0 33 90 1 0 34 91 1 0 36 92 1 0 37 93 1 0 38 94 1 0 39 95 1 0 40 96 1 0 42 97 1 0 42 98 1 0 43 99 1 0 44100 1 0 45101 1 0 46102 1 0 47103 1 0 48104 1 0 49105 1 0 49106 1 0 49107 1 0 50108 1 0 50109 1 0 50110 1 0 51111 1 0 51112 1 0 51113 1 0 53114 1 0 53115 1 0 M END

Standard InCHIKey	YEKZYRCPUZIPAI-AWJWSBBDSA-N
Standard InCHI	InChI=1S/C39H62O14/c1-17-7-10-39(48-16-17)18(2)28-24(53-39)12-23-21-6-5-19-11-20(8-9-37(19,3)22(21)13-27(42)38(23,28)4)49-35-33(47)31(45)34(26(15-41)51-35)52-36-32(46)30(44)29(43)25(14-40)50-36/h17-26,28-36,40-41,43-47H,5-16H2,1-4H3/t17-,18+,19-,20+,21-,22+,23+,24+,25-,26-,28+,29-,30+,31-,32-,33-,34-,35-,36+,37+,38-,39-/m1/s1
SMILES	CC1CCC2(C(C3C(O2)CC4C3(C(=O)CC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)O)O)O)O)C)C)C)OC1

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO16699	Agave utahensis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19645463]
NPO16699	Agave utahensis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO16699	Agave utahensis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC469431 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25052
0.1-0.2	21751
0.2-0.3	2578
0.3-0.4	290
0.4-0.5	88
0.5-0.6	51
0.6-0.7	31
0.7-0.8	1
0.8-0.85	2
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8989	High Similarity	NPC92890
0.8265	Intermediate Similarity	NPC233433
0.8235	Intermediate Similarity	NPC325828
0.7714	Intermediate Similarity	NPC220836
0.7475	Intermediate Similarity	NPC475319
0.7429	Intermediate Similarity	NPC94086
0.7429	Intermediate Similarity	NPC473817
0.7419	Intermediate Similarity	NPC107962
0.7396	Intermediate Similarity	NPC202898
0.7234	Intermediate Similarity	NPC215408
0.7174	Intermediate Similarity	NPC250393
0.7021	Intermediate Similarity	NPC107188
0.6863	Remote Similarity	NPC97700
0.6863	Remote Similarity	NPC184617
0.6863	Remote Similarity	NPC30856
0.6832	Remote Similarity	NPC249553
0.6633	Remote Similarity	NPC6295
0.6596	Remote Similarity	NPC234352
0.6562	Remote Similarity	NPC206003
0.6562	Remote Similarity	NPC473610
0.6542	Remote Similarity	NPC108072
0.6489	Remote Similarity	NPC297348
0.6489	Remote Similarity	NPC249204
0.6489	Remote Similarity	NPC48339
0.6489	Remote Similarity	NPC141769
0.6489	Remote Similarity	NPC477547
0.6422	Remote Similarity	NPC132080
0.6327	Remote Similarity	NPC19400
0.6204	Remote Similarity	NPC475625
0.6204	Remote Similarity	NPC116756
0.619	Remote Similarity	NPC182900
0.6186	Remote Similarity	NPC477451
0.6176	Remote Similarity	NPC160426
0.6162	Remote Similarity	NPC211354
0.6147	Remote Similarity	NPC232037
0.6139	Remote Similarity	NPC470432
0.6139	Remote Similarity	NPC230507
0.6126	Remote Similarity	NPC92297
0.6117	Remote Similarity	NPC475351
0.6102	Remote Similarity	NPC305771
0.6102	Remote Similarity	NPC94072
0.6102	Remote Similarity	NPC169816
0.6091	Remote Similarity	NPC470864
0.5943	Remote Similarity	NPC477809
0.5938	Remote Similarity	NPC485594
0.5909	Remote Similarity	NPC161035
0.5909	Remote Similarity	NPC170438
0.5847	Remote Similarity	NPC15918
0.5833	Remote Similarity	NPC128572
0.5826	Remote Similarity	NPC470866
0.5816	Remote Similarity	NPC177834
0.5763	Remote Similarity	NPC273002
0.5741	Remote Similarity	NPC6806
0.5727	Remote Similarity	NPC115165
0.5714	Remote Similarity	NPC181845
0.5702	Remote Similarity	NPC477811
0.5673	Remote Similarity	NPC125324
0.5619	Remote Similarity	NPC195297
0.5614	Remote Similarity	NPC83137
0.5607	Remote Similarity	NPC161738
0.5588	Remote Similarity	NPC121453
0.5556	Remote Similarity	NPC475643
0.5524	Remote Similarity	NPC485595
0.5455	Remote Similarity	NPC471464
0.5446	Remote Similarity	NPC294686
0.5417	Remote Similarity	NPC473505
0.5408	Remote Similarity	NPC24960
0.5405	Remote Similarity	NPC480555
0.5405	Remote Similarity	NPC150372
0.5345	Remote Similarity	NPC476112
0.5345	Remote Similarity	NPC307534
0.5315	Remote Similarity	NPC51172
0.5315	Remote Similarity	NPC49032
0.5263	Remote Similarity	NPC475550
0.5217	Remote Similarity	NPC473518
0.5192	Remote Similarity	NPC222731
0.5189	Remote Similarity	NPC264101
0.5182	Remote Similarity	NPC473601
0.5179	Remote Similarity	NPC300557
0.5172	Remote Similarity	NPC232611
0.5164	Remote Similarity	NPC477807
0.5135	Remote Similarity	NPC470433
0.5135	Remote Similarity	NPC46190
0.5135	Remote Similarity	NPC171073
0.513	Remote Similarity	NPC269297
0.513	Remote Similarity	NPC222202
0.5126	Remote Similarity	NPC31896
0.5102	Remote Similarity	NPC277715
0.5088	Remote Similarity	NPC98018
0.5088	Remote Similarity	NPC284104
0.5088	Remote Similarity	NPC103616
0.5085	Remote Similarity	NPC470862
0.5048	Remote Similarity	NPC474399
0.5042	Remote Similarity	NPC480553

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC469431 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7435
0.1-0.2	1631
0.2-0.3	74
0.3-0.4	6
0.4-0.5	2
0.5-0.6	0
0.6-0.7	0
0.7-0.8	1
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.8235	Intermediate Similarity	NPD8171	Phase 2
0.7717	Intermediate Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data