NPASS Compound

Natural Product: NPC247210

Natural Product ID	NPC247210
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	JDGKHHCYVKBIIT-QJIFFCIDSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44566267
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 123129 0 0 0 0 0 0 0 0999 V2000 -7.1301 4.3910 0.5282 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3952 3.1321 -0.3126 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4236 3.6213 -1.7480 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6861 2.5418 0.1219 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5959 1.2193 0.8101 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7399 0.2108 0.0418 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4951 -0.9250 0.9624 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2306 -1.7110 0.8098 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9901 -0.8078 0.6654 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0612 0.0567 1.9073 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3573 -0.0801 -0.5631 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6977 -0.2663 -1.6658 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5453 -1.1897 -1.8319 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8522 -1.1842 -0.4855 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4609 -1.7577 -0.5647 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3472 -3.2079 -0.8335 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8000 -1.0650 -1.7696 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6797 -1.2750 -1.8143 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4070 -0.9122 -0.5476 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7305 -1.3733 0.6880 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2104 -2.7764 1.0275 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2229 -0.4917 1.8242 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8807 0.8206 1.5105 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7504 -1.2516 0.6628 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4655 -1.8361 1.8250 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8586 -1.1684 1.9142 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7002 -1.5398 0.6700 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0038 -3.0015 0.8682 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6890 -1.4499 -0.6026 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6915 -0.5269 -0.8215 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7515 -0.4517 0.2363 C 0 0 1 0 0 0 0 0 0 0 0 0 6.1415 -0.3547 -0.3667 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3340 -1.5765 -1.2263 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2134 -1.6676 -2.1995 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7670 -3.1105 -2.1923 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6218 -4.0297 -2.2900 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4406 -3.4799 -2.0820 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1999 -0.7774 -2.0843 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5310 -1.4237 -1.9179 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1333 -0.2151 0.5937 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8754 0.9500 0.3907 C 0 0 1 0 0 0 0 0 0 0 0 0 7.8538 1.8772 1.5831 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1708 2.5932 1.6892 C 0 0 2 0 0 0 0 0 0 0 0 0 9.6980 2.9680 0.3146 C 0 0 2 0 0 0 0 0 0 0 0 0 9.7470 1.7262 -0.5626 C 0 0 1 0 0 0 0 0 0 0 0 0 11.1715 1.4453 -1.0158 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7062 2.5437 -1.6740 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2068 0.6311 0.0979 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9630 3.4982 0.4094 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1328 1.8831 2.3892 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8136 2.8071 1.3484 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5670 0.7197 0.9698 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5136 0.8486 -0.5579 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2036 2.2361 -0.1210 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6466 -0.2758 -1.0433 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9117 -1.4896 -1.0973 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2111 0.5472 -1.9956 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7547 4.0352 1.5140 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1234 4.8683 0.7331 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4444 5.0812 0.0210 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9499 4.6124 -1.7793 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9845 2.9600 -2.4118 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3693 3.8042 -2.0483 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2207 3.2239 0.8465 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3705 2.5300 -0.7748 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6482 0.8072 0.8425 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3020 1.3439 1.8496 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7018 -0.7038 2.0442 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3036 -1.7227 0.7990 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1807 -2.4294 1.6062 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3617 -2.2795 -0.1591 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9613 -0.6359 2.7615 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1099 0.4486 2.0761 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3182 0.8361 1.9858 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9923 0.2937 -2.5892 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7928 -2.1743 -2.1957 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8591 -0.6957 -2.5498 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6494 -0.0673 -0.3407 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2893 -3.6386 -1.2858 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9480 -3.8250 0.0012 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6019 -3.4509 -1.6610 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0729 -0.0164 -1.8566 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1477 -1.6789 -2.6591 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9862 -2.2901 -2.1126 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0382 -0.6118 -2.6510 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5407 0.1988 -0.6196 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4069 -3.3781 0.0972 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5953 -3.2888 1.7624 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2342 -2.6640 1.4920 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3420 -0.5640 1.7975 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8468 -0.7932 2.8176 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6843 1.4195 1.4856 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9689 -0.1380 0.6821 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5143 -2.9198 1.8697 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9883 -1.5179 2.7838 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6056 -0.0908 1.9077 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2590 -1.5702 2.8394 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3468 -3.0784 1.9499 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1104 -3.6613 0.9175 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7914 -3.4091 0.2466 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2722 0.5225 -0.9137 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6504 -1.3509 0.8694 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2072 0.5178 -1.0465 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4614 -2.4917 -0.6074 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6495 -1.5236 -3.2412 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1033 -4.3749 -2.4469 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3210 -1.7215 -1.4078 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4762 1.4667 -0.4912 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6189 1.3411 2.5215 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0018 3.5750 2.2166 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0358 3.7339 -0.1401 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1506 1.9170 -1.4707 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7935 1.1797 -0.1332 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1775 0.6056 -1.7263 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6882 2.5038 -1.6800 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9781 4.4766 0.1665 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0230 0.9088 2.2727 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6372 3.2471 2.2137 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9834 1.3695 0.5344 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8055 1.0377 -1.6480 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4218 2.6152 -0.8530 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7806 2.4173 0.8439 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3317 0.2396 -2.9718 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 1 9 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 6 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 20 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 1 19 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 34 38 1 0 33 39 1 0 32 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 45 48 1 0 44 49 1 0 43 50 1 0 42 51 1 0 31 52 1 0 11 53 1 0 53 54 1 0 6 55 1 6 55 56 2 0 55 57 1 0 54 2 1 0 53 6 1 0 27 9 1 0 38 30 1 0 48 41 1 0 27 14 1 0 24 15 1 0 1 58 1 0 1 59 1 0 1 60 1 0 3 61 1 0 3 62 1 0 3 63 1 0 4 64 1 0 4 65 1 0 5 66 1 0 5 67 1 0 7 68 1 0 7 69 1 0 8 70 1 0 8 71 1 0 10 72 1 0 10 73 1 0 10 74 1 0 12 75 1 0 13 76 1 0 13 77 1 0 14 78 1 1 16 79 1 0 16 80 1 0 16 81 1 0 17 82 1 0 17 83 1 0 18 84 1 0 18 85 1 0 19 86 1 1 21 87 1 0 21 88 1 0 21 89 1 0 22 90 1 0 22 91 1 0 23 92 1 0 24 93 1 1 25 94 1 0 25 95 1 0 26 96 1 0 26 97 1 0 28 98 1 0 28 99 1 0 28100 1 0 30101 1 6 31102 1 1 32103 1 6 33104 1 1 34105 1 6 37106 1 0 39107 1 0 41108 1 6 42109 1 1 43110 1 1 44111 1 6 45112 1 6 46113 1 0 46114 1 0 47115 1 0 49116 1 0 50117 1 0 51118 1 0 52119 1 0 53120 1 6 54121 1 0 54122 1 0 57123 1 0 M END

Standard InCHIKey	JDGKHHCYVKBIIT-QJIFFCIDSA-N
Standard InCHI	InChI=1S/C42H66O15/c1-37(2)13-15-42(36(52)53)16-14-40(5)20(21(42)17-37)7-8-24-38(3)11-10-25(39(4,19-44)23(38)9-12-41(24,40)6)55-35-30(49)31(29(48)32(57-35)33(50)51)56-34-28(47)27(46)26(45)22(18-43)54-34/h7,21-32,34-35,43-49H,8-19H2,1-6H3,(H,50,51)(H,52,53)/t21-,22+,23+,24+,25-,26-,27-,28+,29-,30+,31-,32-,34-,35+,38-,39-,40+,41+,42-/m0/s1
SMILES	CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H]([C@@](C)(CO)[C@@H]5CC[C@@]34C)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O3)O)O[C@H]3[C@@H]([C@H]([C@H]([C@@H](CO)O3)O)O)O)O)[C@@H]2C1)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	810.44	Volume:	799.037 ? Van der Waals volume.
Dense:	1.014	LogP:	1.357 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.122 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.337 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	40.0
TPSA:	253.13 ? Topological Polar Surface Area.	H-Bond Acceptor:	15.0
H-Bond Donor:	9.0	Rings:	7.0
Heavy Atoms:	15.0

MedChem Properties

QED Drug-Likeness Score:	0.126	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.888	Fsp³:	0.905
MCE-18:	154.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.891	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.21	Promiscuous compounds:	0.133

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.193	MDCK Permeability:	-5.185
Pgp-inhibitor:	0.0	Pgp-substrate:	0.003
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.046
20% Bioavailability (F20%):	0.171	30% Bioavailability (F30%):	0.025
50% Bioavailability (F50%):	0.956

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.993
Plasma Protein Binding (PPB):	78.548%	Volume Distribution (VD):	-0.567
Fu:	15.649% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.985
OATP1B3 inhibitor:	0.002	BCRP inhibitor:	0.0
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.001	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.003
HLM stability:	0.202 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.301

Half-life (T1/2):

2.484

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.793	Drug-induced Liver Injury (DILI):	0.97
AMES Toxicity:	0.757	Rat Oral Acute Toxicity:	0.027
Maximum Recommended Daily Dose:	0.005	Skin Sensitization:	1.0
Carcinogencity:	0.427	Eye Corrosion:	0.0
Eye Irritation:	0.004	Respiratory Toxicity:	0.064
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.995
Hematotoxicity:	0.871	Drug-induced Nephrotoxicity:	0.994
Genotoxicity:	0.692	RPMI-8226 Immunitoxicity:	0.038
A549 Cytotoxicity:	0.283	Hek293 Cytotoxicity:	0.084
BCF:	0.488 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.367 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.876 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.915 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO28255	Caryocar glabrum	Species	Caryocaraceae	Eukaryota	Fruits	n.a.	n.a.	PMID[16499316]
NPO28255	Caryocar glabrum	Species	Caryocaraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO28255	Caryocar glabrum	Species	Caryocaraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC247210 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22197
0.1-0.2	23258
0.2-0.3	3169
0.3-0.4	773
0.4-0.5	320
0.5-0.6	82
0.6-0.7	36
0.7-0.8	0
0.8-0.85	3
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8434	Intermediate Similarity	NPC204407
0.8409	Intermediate Similarity	NPC270667
0.8242	Intermediate Similarity	NPC114441
0.7701	Intermediate Similarity	NPC606107
0.7579	Intermediate Similarity	NPC6377
0.7579	Intermediate Similarity	NPC208381
0.7447	Intermediate Similarity	NPC136877
0.732	Intermediate Similarity	NPC22956
0.7216	Intermediate Similarity	NPC472949
0.7188	Intermediate Similarity	NPC59804
0.7157	Intermediate Similarity	NPC276093
0.71	Intermediate Similarity	NPC180550
0.71	Intermediate Similarity	NPC35405
0.7083	Intermediate Similarity	NPC12288
0.6957	Remote Similarity	NPC286347
0.6923	Remote Similarity	NPC28198
0.6923	Remote Similarity	NPC476123
0.6875	Remote Similarity	NPC164194
0.6832	Remote Similarity	NPC114304
0.6739	Remote Similarity	NPC57362
0.6737	Remote Similarity	NPC294112
0.6699	Remote Similarity	NPC139044
0.6636	Remote Similarity	NPC323341
0.6636	Remote Similarity	NPC133818
0.6604	Remote Similarity	NPC324875
0.6604	Remote Similarity	NPC292677
0.6602	Remote Similarity	NPC159309
0.6602	Remote Similarity	NPC86222
0.66	Remote Similarity	NPC127056
0.66	Remote Similarity	NPC109079
0.65	Remote Similarity	NPC174679
0.65	Remote Similarity	NPC25605
0.65	Remote Similarity	NPC279554
0.6421	Remote Similarity	NPC31839
0.64	Remote Similarity	NPC603870
0.6392	Remote Similarity	NPC284807
0.6355	Remote Similarity	NPC114484
0.6211	Remote Similarity	NPC283849
0.6186	Remote Similarity	NPC471385
0.6168	Remote Similarity	NPC257468
0.614	Remote Similarity	NPC166422
0.614	Remote Similarity	NPC219180
0.614	Remote Similarity	NPC251263
0.6111	Remote Similarity	NPC79718
0.6075	Remote Similarity	NPC471383
0.6058	Remote Similarity	NPC473884
0.6058	Remote Similarity	NPC488561
0.6034	Remote Similarity	NPC54636
0.602	Remote Similarity	NPC100383
0.6	Remote Similarity	NPC323359
0.5963	Remote Similarity	NPC119794
0.5946	Remote Similarity	NPC488564
0.5929	Remote Similarity	NPC476992
0.59	Remote Similarity	NPC473538
0.5865	Remote Similarity	NPC56713
0.5842	Remote Similarity	NPC191410
0.5841	Remote Similarity	NPC11242
0.5841	Remote Similarity	NPC62725
0.5841	Remote Similarity	NPC480936
0.5818	Remote Similarity	NPC603832
0.5784	Remote Similarity	NPC475472
0.5743	Remote Similarity	NPC475633
0.5727	Remote Similarity	NPC481082
0.5727	Remote Similarity	NPC164419
0.5702	Remote Similarity	NPC480939
0.5701	Remote Similarity	NPC475171
0.5688	Remote Similarity	NPC104400
0.5688	Remote Similarity	NPC10320
0.5636	Remote Similarity	NPC118440
0.5631	Remote Similarity	NPC480938
0.5614	Remote Similarity	NPC475486
0.56	Remote Similarity	NPC224121
0.5556	Remote Similarity	NPC80843
0.5545	Remote Similarity	NPC11551
0.5545	Remote Similarity	NPC473383
0.5506	Remote Similarity	NPC480946
0.5506	Remote Similarity	NPC130577
0.5506	Remote Similarity	NPC142415
0.5506	Remote Similarity	NPC102683
0.55	Remote Similarity	NPC177246
0.5487	Remote Similarity	NPC114692
0.5463	Remote Similarity	NPC157868
0.5444	Remote Similarity	NPC270768
0.5444	Remote Similarity	NPC59263
0.5444	Remote Similarity	NPC210106
0.5439	Remote Similarity	NPC477191
0.541	Remote Similarity	NPC21691
0.5403	Remote Similarity	NPC161717
0.5398	Remote Similarity	NPC95437
0.5391	Remote Similarity	NPC477192
0.537	Remote Similarity	NPC482748
0.5366	Remote Similarity	NPC478596
0.5364	Remote Similarity	NPC242840
0.5364	Remote Similarity	NPC469945
0.5351	Remote Similarity	NPC236657
0.5328	Remote Similarity	NPC4749
0.5328	Remote Similarity	NPC478597
0.5326	Remote Similarity	NPC120840
0.531	Remote Similarity	NPC131469
0.5294	Remote Similarity	NPC478600
0.5294	Remote Similarity	NPC478599
0.5275	Remote Similarity	NPC275809
0.5268	Remote Similarity	NPC44716
0.5259	Remote Similarity	NPC187618
0.5259	Remote Similarity	NPC488209
0.5243	Remote Similarity	NPC242611
0.5221	Remote Similarity	NPC258885
0.5221	Remote Similarity	NPC475591
0.5221	Remote Similarity	NPC236870
0.5217	Remote Similarity	NPC281148
0.5217	Remote Similarity	NPC158141
0.5217	Remote Similarity	NPC110308
0.5189	Remote Similarity	NPC473481
0.5182	Remote Similarity	NPC488516
0.5175	Remote Similarity	NPC73829
0.5161	Remote Similarity	NPC478598
0.5161	Remote Similarity	NPC298554
0.514	Remote Similarity	NPC22676
0.5133	Remote Similarity	NPC40775
0.5133	Remote Similarity	NPC251768
0.513	Remote Similarity	NPC302887
0.5128	Remote Similarity	NPC120116
0.5124	Remote Similarity	NPC471384
0.5118	Remote Similarity	NPC111466
0.5104	Remote Similarity	NPC96580
0.5089	Remote Similarity	NPC192791
0.5089	Remote Similarity	NPC75417
0.5054	Remote Similarity	NPC231063
0.5054	Remote Similarity	NPC282395
0.5047	Remote Similarity	NPC475611
0.5044	Remote Similarity	NPC605226
0.5043	Remote Similarity	NPC475504

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC247210 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6810
0.1-0.2	2272
0.2-0.3	61
0.3-0.4	6
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5278	Remote Similarity	NPD8295	Clinical (unspecified phase)

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data