NPASS Compound

Natural Product: NPC23052

Natural Product ID	NPC23052
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	LGUNXKLLKNZQCE-YYSHMIKPSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	54753679
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 142149 0 0 0 0 0 0 0 0999 V2000 -11.0495 0.5803 2.2061 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2537 0.1178 0.7870 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3162 -0.9536 0.7885 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6954 1.2256 -0.1257 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8055 1.2255 -1.3375 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3847 1.5575 -0.8509 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5397 1.6070 -2.0771 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0733 1.6504 -1.8466 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6398 0.4924 -1.0180 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6314 -0.7318 -1.9154 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5437 0.1857 0.1306 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0350 -0.5327 1.1169 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6717 -1.0644 1.2085 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7831 -0.5973 0.1005 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3315 -0.7270 0.3847 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9760 -0.3788 1.7691 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9495 -2.2188 0.1881 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5111 -2.4016 0.5751 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6174 -1.6144 -0.3341 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1016 -0.2647 -0.7553 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3185 0.8487 -0.0720 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7461 -0.1367 -2.2547 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5619 -0.0549 -0.7098 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9327 1.3917 -0.8892 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3769 1.3660 -1.4183 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2618 0.7308 -0.3803 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4837 1.7635 0.6994 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6523 -1.4752 0.1577 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7320 -2.0741 -0.4052 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7547 -1.0289 -0.7116 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1643 -1.5311 -0.9123 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1671 -3.0620 -1.0185 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4736 -3.5308 0.2239 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2516 -3.2131 1.4479 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6608 -2.6525 2.4043 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5984 -3.4982 1.6033 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2229 -3.1404 2.8262 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2022 -3.1360 0.3720 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5216 -3.5111 -2.1421 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8904 -1.2160 0.2182 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0195 -0.4844 -0.0158 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8707 0.9002 0.6263 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8547 1.0706 1.7410 C 0 0 2 0 0 0 0 0 0 0 0 0 8.2647 0.9016 1.1334 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2353 -0.1545 0.0795 C 0 0 1 0 0 0 0 0 0 0 0 0 9.4922 -0.9043 -0.1736 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5639 -0.2446 -0.5915 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2659 0.6887 0.0323 C 0 0 1 0 0 0 0 0 0 0 0 0 12.7674 0.2691 0.0546 C 0 0 1 0 0 0 0 0 0 0 0 0 13.4994 0.8313 -1.1406 C 0 0 2 0 0 0 0 0 0 0 0 0 13.6591 2.3315 -0.8449 C 0 0 1 0 0 0 0 0 0 0 0 0 12.2812 2.7527 -0.3164 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3005 1.8900 -0.7303 O 0 0 0 0 0 0 0 0 0 0 0 0 14.6488 2.5149 0.1052 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7616 0.7397 -2.3159 O 0 0 0 0 0 0 0 0 0 0 0 0 13.3224 0.8247 1.1924 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1888 -1.0955 0.4145 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5807 2.1644 0.6450 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7512 0.1070 2.7267 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1172 1.9142 -0.3094 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3745 -0.3574 -1.8775 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9395 0.6383 0.2258 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9409 -0.5218 0.3131 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4987 2.9759 -0.3467 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2605 3.3069 0.8239 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8933 3.9292 -1.2711 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1538 0.1107 2.6792 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9175 0.2890 2.8511 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9539 1.6704 2.2961 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2630 -0.4493 1.1215 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0590 -1.6704 1.5987 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4225 -1.4360 -0.1996 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5725 2.1871 0.3847 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7670 1.1211 -0.4160 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0849 2.0781 -1.9887 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8378 0.3093 -1.9243 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8017 2.5725 -2.6070 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8940 0.8236 -2.7744 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5849 1.5169 -2.8566 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7700 2.6331 -1.4996 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7298 -0.7801 -2.5600 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8650 -1.6604 -1.3782 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4728 -0.6115 -2.6617 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6922 -0.7695 1.9771 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2345 -0.8881 2.2177 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7464 -2.1801 1.1402 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9656 -1.3133 -0.7630 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1535 -1.2945 2.4100 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9044 -0.1458 1.9370 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5355 0.4227 2.2555 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1335 -2.4627 -0.8944 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5933 -2.8368 0.8497 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2814 -3.4818 0.4378 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4308 -2.0945 1.6386 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5346 -2.2412 -1.2470 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2291 1.4815 -0.7974 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9578 1.5339 0.5176 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4879 0.3910 0.5737 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6538 0.0187 -2.8779 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1593 -1.0156 -2.6014 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1188 0.7572 -2.4165 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9735 -0.5591 -1.6503 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2993 1.7728 -1.7314 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8499 2.0087 0.0049 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6765 2.4129 -1.5493 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3506 0.7744 -2.3478 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4185 2.3667 0.4875 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6384 1.3722 1.7010 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6853 2.5645 0.6701 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4148 -2.5626 -1.3461 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7515 -0.2094 0.0779 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5878 -1.1352 -1.8358 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1939 -3.4513 -1.0129 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4818 -4.6616 0.1678 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6184 -2.3242 3.3179 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1767 -3.9806 3.5651 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2240 -2.7406 2.6639 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0579 -3.3323 -2.9630 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1151 -0.3057 -1.1048 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8328 1.0566 0.9898 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7772 2.0767 2.1472 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9631 0.6734 1.9698 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9007 0.2968 -0.8723 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3124 -1.7725 -0.8813 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7604 -1.3701 0.8467 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9901 1.0177 1.0416 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7910 -0.8337 0.0404 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4655 0.3289 -1.2009 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9263 2.8870 -1.7630 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3794 2.9134 0.7549 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0626 3.7410 -0.8053 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2423 1.7155 0.2054 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0105 1.4427 -2.9651 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7356 0.0783 1.7307 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0616 2.7043 1.2964 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6280 -0.2601 2.9890 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1315 2.7832 0.1454 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8357 -0.8163 -2.6357 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1019 1.1889 1.2033 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0453 -1.0619 -0.6234 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6617 -1.2313 1.1099 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1864 4.8620 -1.0324 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 6 9 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 20 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 1 19 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 2 0 34 36 1 0 36 37 1 0 33 38 1 0 32 39 1 0 31 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 51 54 1 0 50 55 1 0 49 56 1 0 45 57 1 0 44 58 1 0 43 59 1 0 42 60 1 0 30 61 1 0 11 62 1 0 62 63 1 0 6 64 1 1 64 65 2 0 64 66 1 0 63 2 1 0 62 6 1 0 26 9 1 0 38 29 1 0 57 41 1 0 26 14 1 0 53 48 1 0 23 15 1 0 1 67 1 0 1 68 1 0 1 69 1 0 3 70 1 0 3 71 1 0 3 72 1 0 4 73 1 0 4 74 1 0 5 75 1 0 5 76 1 0 7 77 1 0 7 78 1 0 8 79 1 0 8 80 1 0 10 81 1 0 10 82 1 0 10 83 1 0 12 84 1 0 13 85 1 0 13 86 1 0 14 87 1 6 16 88 1 0 16 89 1 0 16 90 1 0 17 91 1 0 17 92 1 0 18 93 1 0 18 94 1 0 19 95 1 6 21 96 1 0 21 97 1 0 21 98 1 0 22 99 1 0 22100 1 0 22101 1 0 23102 1 6 24103 1 0 24104 1 0 25105 1 0 25106 1 0 27107 1 0 27108 1 0 27109 1 0 29110 1 6 30111 1 1 31112 1 6 32113 1 1 33114 1 6 37115 1 0 37116 1 0 37117 1 0 39118 1 0 41119 1 6 42120 1 1 43121 1 1 44122 1 1 45123 1 6 46124 1 0 46125 1 0 48126 1 1 49127 1 1 50128 1 6 51129 1 6 52130 1 0 52131 1 0 54132 1 0 55133 1 0 56134 1 0 58135 1 0 59136 1 0 60137 1 0 61138 1 0 62139 1 1 63140 1 0 63141 1 0 66142 1 0 M END

Standard InCHIKey	LGUNXKLLKNZQCE-YYSHMIKPSA-N
Standard InCHI	InChI=1S/C48H76O18/c1-43(2)15-17-48(42(58)59)18-16-46(6)22(23(48)19-43)9-10-27-45(5)13-12-28(44(3,4)26(45)11-14-47(27,46)7)64-41-35(56)36(34(55)37(66-41)38(57)60-8)65-40-33(54)31(52)30(51)25(63-40)21-62-39-32(53)29(50)24(49)20-61-39/h9,23-37,39-41,49-56H,10-21H2,1-8H3,(H,58,59)/t23-,24+,25+,26-,27+,28-,29-,30+,31-,32+,33+,34-,35+,36-,37-,39-,40-,41+,45-,46+,47+,48-/m0/s1
SMILES	CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@@]34C)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](C(=O)OC)O3)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]4[C@@H]([C@H]([C@@H](CO4)O)O)O)O3)O)O)O)O)[C@@H]2C1)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	940.5	Volume:	920.627 ? Van der Waals volume.
Dense:	1.022	LogP:	1.454 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.067 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.426 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	46.0
TPSA:	280.82 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	9.0	Rings:	8.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.09	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.291	Fsp³:	0.917
MCE-18:	173.935 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.921	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.18	Promiscuous compounds:	0.21

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.026	MDCK Permeability:	-5.255
Pgp-inhibitor:	0.0	Pgp-substrate:	0.002
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.273
20% Bioavailability (F20%):	0.32	30% Bioavailability (F30%):	0.969
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.118
Plasma Protein Binding (PPB):	74.066%	Volume Distribution (VD):	-0.491
Fu:	20.15% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.16

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.998	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.094
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.056

Half-life (T1/2):

3.493

ADMET: Toxicity

hERG Blockers:	0.008	hERG Blockers (10um):	0.017
Human Hepatotoxicity (H-HT):	0.558	Drug-induced Liver Injury (DILI):	0.903
AMES Toxicity:	0.452	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.017	Skin Sensitization:	0.998
Carcinogencity:	0.053	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.006
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.991
Hematotoxicity:	0.19	Drug-induced Nephrotoxicity:	0.976
Genotoxicity:	0.077	RPMI-8226 Immunitoxicity:	0.123
A549 Cytotoxicity:	0.067	Hek293 Cytotoxicity:	0.13
BCF:	1.002 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.002 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.948 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.856 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO22964	Teucrium fruticans	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[36947520]
NPO22964	Teucrium fruticans	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO24581	Lobophytum catalai	Species	Alcyoniidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO22964	Teucrium fruticans	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO22964	Teucrium fruticans	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO24581	Lobophytum catalai	Species	Alcyoniidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO25464	Uroleucon nigrotuberculatum	Species	Aphididae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO23790	Crinum glaucum	Species	Amaryllidaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC23052 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19630
0.1-0.2	25772
0.2-0.3	3172
0.3-0.4	854
0.4-0.5	314
0.5-0.6	64
0.6-0.7	36
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8218	Intermediate Similarity	NPC180550
0.8218	Intermediate Similarity	NPC35405
0.7524	Intermediate Similarity	NPC104400
0.7524	Intermediate Similarity	NPC10320
0.7333	Intermediate Similarity	NPC469945
0.7216	Intermediate Similarity	NPC283849
0.7143	Intermediate Similarity	NPC488516
0.713	Intermediate Similarity	NPC166422
0.7064	Intermediate Similarity	NPC481082
0.7064	Intermediate Similarity	NPC164419
0.6983	Remote Similarity	NPC219180
0.6981	Remote Similarity	NPC6377
0.6981	Remote Similarity	NPC208381
0.6909	Remote Similarity	NPC73829
0.6726	Remote Similarity	NPC324875
0.6726	Remote Similarity	NPC292677
0.6721	Remote Similarity	NPC161717
0.661	Remote Similarity	NPC323341
0.6542	Remote Similarity	NPC136877
0.6535	Remote Similarity	NPC28198
0.6535	Remote Similarity	NPC476123
0.6535	Remote Similarity	NPC606107
0.6514	Remote Similarity	NPC488561
0.6509	Remote Similarity	NPC270667
0.6505	Remote Similarity	NPC100383
0.6481	Remote Similarity	NPC56713
0.6422	Remote Similarity	NPC114441
0.6422	Remote Similarity	NPC127056
0.6404	Remote Similarity	NPC79718
0.6404	Remote Similarity	NPC488515
0.6339	Remote Similarity	NPC114304
0.6316	Remote Similarity	NPC257468
0.6311	Remote Similarity	NPC54636
0.6281	Remote Similarity	NPC251263
0.6273	Remote Similarity	NPC480424
0.6271	Remote Similarity	NPC280941
0.6271	Remote Similarity	NPC235772
0.6207	Remote Similarity	NPC276093
0.619	Remote Similarity	NPC471385
0.6134	Remote Similarity	NPC62725
0.6121	Remote Similarity	NPC119794
0.6102	Remote Similarity	NPC488564
0.6075	Remote Similarity	NPC284807
0.6066	Remote Similarity	NPC471384
0.6055	Remote Similarity	NPC164194
0.6038	Remote Similarity	NPC242611
0.5962	Remote Similarity	NPC204407
0.595	Remote Similarity	NPC476992
0.5943	Remote Similarity	NPC286347
0.5893	Remote Similarity	NPC174679
0.5893	Remote Similarity	NPC25605
0.5893	Remote Similarity	NPC279554
0.5893	Remote Similarity	NPC59804
0.5882	Remote Similarity	NPC75318
0.5841	Remote Similarity	NPC109079
0.5826	Remote Similarity	NPC223301
0.5826	Remote Similarity	NPC171544
0.5812	Remote Similarity	NPC139044
0.5812	Remote Similarity	NPC471383
0.5806	Remote Similarity	NPC133818
0.5789	Remote Similarity	NPC472949
0.5785	Remote Similarity	NPC475486
0.575	Remote Similarity	NPC323359
0.5739	Remote Similarity	NPC22956
0.5714	Remote Similarity	NPC484832
0.5691	Remote Similarity	NPC288205
0.5691	Remote Similarity	NPC51465
0.5667	Remote Similarity	NPC37134
0.5593	Remote Similarity	NPC488526
0.5574	Remote Similarity	NPC488209
0.5565	Remote Similarity	NPC173583
0.5505	Remote Similarity	NPC31839
0.5504	Remote Similarity	NPC481080
0.5492	Remote Similarity	NPC291903
0.5487	Remote Similarity	NPC127853
0.547	Remote Similarity	NPC80843
0.5462	Remote Similarity	NPC473383
0.541	Remote Similarity	NPC104372
0.54	Remote Similarity	NPC120840
0.5391	Remote Similarity	NPC12288
0.5391	Remote Similarity	NPC123199
0.5357	Remote Similarity	NPC294112
0.5308	Remote Similarity	NPC488560
0.5303	Remote Similarity	NPC13998
0.5285	Remote Similarity	NPC145899
0.5273	Remote Similarity	NPC177246
0.5263	Remote Similarity	NPC475472
0.5234	Remote Similarity	NPC79643
0.52	Remote Similarity	NPC295823
0.52	Remote Similarity	NPC174720
0.52	Remote Similarity	NPC475467
0.5185	Remote Similarity	NPC236638
0.5185	Remote Similarity	NPC294453
0.5185	Remote Similarity	NPC481081
0.5182	Remote Similarity	NPC488212
0.5175	Remote Similarity	NPC191410
0.5172	Remote Similarity	NPC48499
0.5172	Remote Similarity	NPC40085
0.5164	Remote Similarity	NPC258885
0.5147	Remote Similarity	NPC309223
0.5126	Remote Similarity	NPC295371
0.5118	Remote Similarity	NPC11242
0.5115	Remote Similarity	NPC475140
0.5088	Remote Similarity	NPC473538
0.5078	Remote Similarity	NPC475119
0.5074	Remote Similarity	NPC111466
0.5042	Remote Similarity	NPC480420
0.5039	Remote Similarity	NPC473824
0.5038	Remote Similarity	NPC488211
0.5036	Remote Similarity	NPC250247

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC23052 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6384
0.1-0.2	2716
0.2-0.3	44
0.3-0.4	5
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5085	Remote Similarity	NPD8295	Clinical (unspecified phase)

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data