NPASS Compound

Natural Product: NPC177309

Natural Product ID	NPC177309
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	SVUBTQYITUUHSZ-IJACOWRNSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	100936159
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 157165 0 0 0 0 0 0 0 0999 V2000 10.0563 3.7103 1.3038 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6521 2.9220 1.1066 C 0 0 2 0 0 0 0 0 0 0 0 0 8.6273 1.9087 2.1227 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6386 0.9639 2.4794 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0722 -0.2131 1.7627 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3682 -0.0066 0.5196 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1369 -0.5363 -0.6911 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0993 -0.8278 0.6624 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9979 -1.0394 2.1621 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8211 -0.1006 2.5595 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9488 -0.4187 1.4275 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6292 0.2334 1.2602 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8760 0.3013 2.5301 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5357 0.6662 2.2889 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1494 0.3706 1.1781 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5749 0.7527 0.9825 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3335 -0.5350 0.8926 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4079 -1.7642 0.9153 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2856 -1.6747 -0.0577 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5148 -0.3545 0.0584 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7200 0.3653 -1.2570 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9198 -0.6451 0.2478 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7131 -0.5865 -1.0372 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1362 -0.9771 -0.8863 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8428 -0.1886 0.2176 C 0 0 2 0 0 0 0 0 0 0 0 0 4.0212 1.2356 -0.1509 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1308 -0.6876 -0.2103 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4312 -1.0010 0.0751 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3620 0.0285 -0.4578 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9705 -0.4687 -1.7521 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7782 -1.7379 -1.4721 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1627 -2.4641 -0.3308 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3991 -3.9481 -0.4821 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8414 -4.3569 -1.6976 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7703 -2.2991 -0.3316 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0912 -1.3949 -1.2085 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8949 -1.9227 -2.2490 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.0586 -2.7111 -1.7280 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.1198 -2.4842 -2.8079 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.4935 -2.3869 -2.1938 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.4262 -2.1788 -3.2028 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6550 -1.2316 -3.4666 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5176 -0.8099 -2.8356 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.0284 -3.5348 -3.7142 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8045 -4.0828 -1.6620 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9472 -0.7369 -2.6574 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3393 0.3201 0.4909 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2921 1.6895 0.8241 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6384 2.2432 0.4724 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.5873 2.3137 1.6204 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9980 2.8514 2.8879 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4860 2.8711 2.8483 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9789 4.2158 2.3393 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9220 1.8719 2.1308 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4710 2.1041 3.9633 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6947 3.1085 1.2640 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4845 3.5037 -0.1316 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1417 -0.7126 2.7514 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1315 -1.1485 1.7331 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8065 -2.4273 1.4529 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6535 2.6324 -0.3510 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7327 1.8396 -0.6971 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8489 1.6250 -2.0530 C 0 0 1 0 0 0 0 0 0 0 0 0 11.1616 2.1698 -2.6029 C 0 0 1 0 0 0 0 0 0 0 0 0 12.3361 1.5934 -1.8526 C 0 0 2 0 0 0 0 0 0 0 0 0 11.9495 0.2633 -1.2270 C 0 0 1 0 0 0 0 0 0 0 0 0 10.9687 -0.4172 -2.1661 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7463 -1.8655 -1.7597 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9992 -2.4638 -1.6187 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7872 0.2796 -2.3294 O 0 0 0 0 0 0 0 0 0 0 0 0 13.0672 -0.5373 -1.1338 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7201 2.4936 -0.8745 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2702 1.7325 -3.9223 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0632 3.9495 2.3714 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9454 4.5638 0.6208 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8394 2.9908 1.0587 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9549 3.7919 1.3271 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9134 2.4977 3.1162 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6398 1.2862 2.0762 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8983 0.5676 3.5752 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6439 1.5282 2.8297 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1425 1.0553 0.3366 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1560 0.2160 -1.5356 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1806 -0.7651 -0.4547 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6021 -1.4050 -1.1666 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2023 -1.7894 0.1053 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6072 -2.0641 2.3446 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4008 -0.4178 3.5112 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1560 0.9532 2.5316 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7761 -1.5413 1.4264 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6493 1.2470 0.8093 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3543 1.0365 3.2261 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8429 -0.6841 3.0687 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0735 1.2139 3.0986 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7496 1.4326 0.1363 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9104 1.3499 1.8881 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9279 -0.6563 1.8474 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0848 -1.9918 1.9503 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0540 -2.6209 0.6089 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5944 -2.5266 0.1826 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6325 -1.8726 -1.0836 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7803 0.6383 -1.4458 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4673 -0.3472 -2.0712 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1560 1.3017 -1.2861 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0697 -1.7001 0.6293 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6707 0.4263 -1.4849 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2620 -1.2964 -1.7831 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3088 -2.0358 -0.7117 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6634 -0.6499 -1.8316 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0922 1.7208 -0.5330 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7078 1.2641 -1.0349 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3339 1.8290 0.7039 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5087 -1.0263 1.2006 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7927 0.9440 -0.7072 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6606 0.2387 -2.2198 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7180 -2.3675 -2.3856 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5955 -2.1687 0.6654 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4568 -4.2499 -0.3631 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8469 -4.4194 0.3754 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9395 -4.7490 -1.4787 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2876 -2.4776 -2.9665 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3872 -2.3094 -0.7486 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5405 -1.6713 -1.3689 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7159 -3.4179 -1.7894 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.2919 -2.9354 -3.8559 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4680 -0.4609 -3.3419 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5420 -1.3255 -4.5757 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8859 -4.4009 -3.2517 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2617 -4.4132 -0.8340 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3244 -1.1922 -3.4600 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4688 2.1828 0.2129 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1404 1.5608 -0.2932 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9973 1.2832 1.8446 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3793 3.8899 3.0446 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1643 2.7897 3.9337 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8165 4.9012 2.1062 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3337 4.6969 3.1090 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3426 4.0854 1.4415 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3683 1.7555 3.7886 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5457 2.6502 1.4647 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8174 3.4778 -1.0825 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3336 -2.6952 0.5185 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7928 -3.0054 1.4473 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2686 -2.8696 2.3416 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7286 2.2227 -0.7239 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7951 3.6443 -0.9123 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0086 2.1428 -2.5714 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1550 3.2810 -2.6234 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2046 1.3997 -2.5074 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5027 0.3927 -0.2344 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4651 -0.4687 -3.1750 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1568 -2.3427 -2.5597 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2328 -1.9625 -0.7840 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1002 -3.2926 -2.1583 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2380 -0.9171 -0.2338 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6997 3.4324 -1.1558 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6883 2.3685 -4.5263 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 39 42 1 0 42 43 1 0 39 44 1 6 38 45 1 0 30 46 1 0 29 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 51 55 1 0 50 56 1 0 49 57 1 0 9 58 1 0 5 59 1 6 59 60 1 0 2 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 67 70 1 0 66 71 1 0 65 72 1 0 64 73 1 0 58 5 1 0 70 63 1 0 25 8 1 0 35 28 1 0 43 37 1 0 54 48 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 74 1 0 1 75 1 0 1 76 1 0 2 77 1 6 3 78 1 0 3 79 1 0 4 80 1 0 4 81 1 0 6 82 1 6 7 83 1 0 7 84 1 0 7 85 1 0 8 86 1 6 9 87 1 6 10 88 1 0 10 89 1 0 11 90 1 1 12 91 1 6 13 92 1 0 13 93 1 0 14 94 1 0 16 95 1 0 16 96 1 0 17 97 1 1 18 98 1 0 18 99 1 0 19100 1 0 19101 1 0 21102 1 0 21103 1 0 21104 1 0 22105 1 1 23106 1 0 23107 1 0 24108 1 0 24109 1 0 26110 1 0 26111 1 0 26112 1 0 28113 1 1 29114 1 6 30115 1 6 31116 1 6 32117 1 1 33118 1 0 33119 1 0 34120 1 0 37121 1 6 38122 1 1 40123 1 0 40124 1 0 41125 1 0 42126 1 0 42127 1 0 44128 1 0 45129 1 0 46130 1 0 48131 1 6 49132 1 6 50133 1 1 51134 1 1 52135 1 1 53136 1 0 53137 1 0 53138 1 0 55139 1 0 56140 1 0 57141 1 0 60142 1 0 60143 1 0 60144 1 0 61145 1 0 61146 1 0 63147 1 6 64148 1 6 65149 1 6 66150 1 1 67151 1 6 68152 1 0 68153 1 0 69154 1 0 71155 1 0 72156 1 0 73157 1 0 M END

Standard InCHIKey	SVUBTQYITUUHSZ-IJACOWRNSA-N
Standard InCHI	InChI=1S/C51H84O22/c1-22(19-65-44-38(59)37(58)35(56)31(17-52)69-44)9-14-51(64-6)23(2)33-30(73-51)16-29-27-8-7-25-15-26(10-12-48(25,4)28(27)11-13-49(29,33)5)68-46-42(72-45-39(60)36(57)34(55)24(3)67-45)40(61)41(32(18-53)70-46)71-47-43(62)50(63,20-54)21-66-47/h7,22-24,26-47,52-63H,8-21H2,1-6H3/t22-,23+,24+,26+,27-,28+,29+,30+,31-,32-,33+,34+,35-,36-,37+,38-,39-,40+,41-,42-,43+,44-,45+,46-,47+,48+,49+,50-,51-/m1/s1
SMILES	C[C@H](CC[C@@]1([C@@H](C)[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@H](CC[C@]5(C)[C@H]4CC[C@]23C)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O[C@H]2[C@@H]([C@@](CO)(CO2)O)O)O)O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O1)OC)CO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1048.55	Volume:	1004.392 ? Van der Waals volume.
Dense:	1.044	LogP:	1.67 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.657 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.845 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	47.0
TPSA:	335.06 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	12.0	Rings:	9.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.077	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.865	Fsp³:	0.961
MCE-18:	176.8 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.518	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.292	Promiscuous compounds:	0.106

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.506	MDCK Permeability:	-5.154
Pgp-inhibitor:	0.0	Pgp-substrate:	0.751
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.496
20% Bioavailability (F20%):	0.553	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.019
Plasma Protein Binding (PPB):	59.767%	Volume Distribution (VD):	-0.39
Fu:	32.299% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.034
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.002
CYP3A4-inhibitor:	0.998	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.233
HLM stability:	0.07 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.1

Half-life (T1/2):

2.923

ADMET: Toxicity

hERG Blockers:	0.011	hERG Blockers (10um):	0.022
Human Hepatotoxicity (H-HT):	0.587	Drug-induced Liver Injury (DILI):	0.844
AMES Toxicity:	0.961	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.004	Skin Sensitization:	1.0
Carcinogencity:	0.119	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.254	Drug-induced Nephrotoxicity:	0.828
Genotoxicity:	0.087	RPMI-8226 Immunitoxicity:	0.298
A549 Cytotoxicity:	0.93	Hek293 Cytotoxicity:	0.851
BCF:	1.722 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.556 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.895 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.183 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1391	Zanthoxylum rubescens	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1391	Zanthoxylum rubescens	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO1556	Gundelia tournefortii	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO1391	Zanthoxylum rubescens	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC177309 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24640
0.1-0.2	21676
0.2-0.3	2711
0.3-0.4	597
0.4-0.5	129
0.5-0.6	47
0.6-0.7	28
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9223	High Similarity	NPC194207
0.9223	High Similarity	NPC22779
0.8972	High Similarity	NPC232054
0.8208	Intermediate Similarity	NPC480555
0.8208	Intermediate Similarity	NPC150372
0.7925	Intermediate Similarity	NPC470433
0.7925	Intermediate Similarity	NPC46190
0.7925	Intermediate Similarity	NPC171073
0.7909	Intermediate Similarity	NPC475333
0.7909	Intermediate Similarity	NPC224098
0.7909	Intermediate Similarity	NPC208383
0.7748	Intermediate Similarity	NPC309278
0.7632	Intermediate Similarity	NPC480553
0.75	Intermediate Similarity	NPC269297
0.75	Intermediate Similarity	NPC222202
0.7458	Intermediate Similarity	NPC480556
0.7456	Intermediate Similarity	NPC480554
0.7364	Intermediate Similarity	NPC248746
0.7321	Intermediate Similarity	NPC73243
0.7321	Intermediate Similarity	NPC244086
0.7321	Intermediate Similarity	NPC84956
0.7193	Intermediate Similarity	NPC247037
0.7155	Intermediate Similarity	NPC249265
0.7143	Intermediate Similarity	NPC42171
0.708	Intermediate Similarity	NPC475182
0.7	Intermediate Similarity	NPC113044
0.7	Intermediate Similarity	NPC283829
0.7	Intermediate Similarity	NPC161676
0.6967	Remote Similarity	NPC224314
0.6949	Remote Similarity	NPC23808
0.6949	Remote Similarity	NPC87998
0.6842	Remote Similarity	NPC300557
0.6696	Remote Similarity	NPC6806
0.6667	Remote Similarity	NPC470432
0.6667	Remote Similarity	NPC230507
0.6667	Remote Similarity	NPC602423
0.6609	Remote Similarity	NPC477809
0.6557	Remote Similarity	NPC308140
0.6555	Remote Similarity	NPC32361
0.6555	Remote Similarity	NPC13193
0.6518	Remote Similarity	NPC94272
0.6518	Remote Similarity	NPC6295
0.6508	Remote Similarity	NPC477808
0.6471	Remote Similarity	NPC486386
0.6449	Remote Similarity	NPC181845
0.6379	Remote Similarity	NPC475643
0.6364	Remote Similarity	NPC254255
0.6293	Remote Similarity	NPC98696
0.6271	Remote Similarity	NPC124677
0.6261	Remote Similarity	NPC14704
0.625	Remote Similarity	NPC19400
0.6167	Remote Similarity	NPC102016
0.6167	Remote Similarity	NPC95051
0.6087	Remote Similarity	NPC485595
0.6048	Remote Similarity	NPC218571
0.6048	Remote Similarity	NPC487615
0.5983	Remote Similarity	NPC305423
0.5952	Remote Similarity	NPC477811
0.594	Remote Similarity	NPC263359
0.5935	Remote Similarity	NPC475550
0.5917	Remote Similarity	NPC122819
0.5897	Remote Similarity	NPC195297
0.5781	Remote Similarity	NPC287885
0.5766	Remote Similarity	NPC165439
0.5763	Remote Similarity	NPC141433
0.5738	Remote Similarity	NPC471464
0.5714	Remote Similarity	NPC160426
0.5659	Remote Similarity	NPC31896
0.5635	Remote Similarity	NPC116756
0.5565	Remote Similarity	NPC128572
0.5492	Remote Similarity	NPC40440
0.5492	Remote Similarity	NPC486388
0.5447	Remote Similarity	NPC265275
0.5431	Remote Similarity	NPC477451
0.5426	Remote Similarity	NPC470864
0.5417	Remote Similarity	NPC306991
0.5368	Remote Similarity	NPC210569
0.536	Remote Similarity	NPC249553
0.5338	Remote Similarity	NPC470866
0.5294	Remote Similarity	NPC306131
0.5294	Remote Similarity	NPC211354
0.5294	Remote Similarity	NPC200802
0.5259	Remote Similarity	NPC297348
0.5259	Remote Similarity	NPC249204
0.5259	Remote Similarity	NPC48339
0.5259	Remote Similarity	NPC141769
0.5259	Remote Similarity	NPC477547
0.5231	Remote Similarity	NPC232611
0.5207	Remote Similarity	NPC107962
0.5161	Remote Similarity	NPC475351
0.5143	Remote Similarity	NPC305771
0.5143	Remote Similarity	NPC94072
0.5143	Remote Similarity	NPC169816
0.5128	Remote Similarity	NPC325828
0.5118	Remote Similarity	NPC182900
0.5086	Remote Similarity	NPC485594
0.5083	Remote Similarity	NPC206003
0.5083	Remote Similarity	NPC473610
0.5078	Remote Similarity	NPC150057
0.5078	Remote Similarity	NPC147753
0.5039	Remote Similarity	NPC97700
0.5039	Remote Similarity	NPC30856
0.5038	Remote Similarity	NPC470862

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC177309 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7697
0.1-0.2	1389
0.2-0.3	54
0.3-0.4	6
0.4-0.5	1
0.5-0.6	3
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5917	Remote Similarity	NPD8449	Approved
0.5128	Remote Similarity	NPD8171	Phase 2
0.5078	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data