NPASS Compound

Natural Product: NPC170666

Natural Product ID	NPC170666
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GAMQIEGJRMEAEJ-BLEIWCCUSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	11968587
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 160168 0 0 0 0 0 0 0 0999 V2000 7.7271 4.1398 2.6422 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7418 5.1193 1.4788 C 0 0 1 0 0 0 0 0 0 0 0 0 9.0413 5.8309 1.3518 C 0 0 2 0 0 0 0 0 0 0 0 0 10.0344 5.2467 0.4117 C 0 0 2 0 0 0 0 0 0 0 0 0 9.3760 4.4855 -0.7055 C 0 0 2 0 0 0 0 0 0 0 0 0 8.3007 3.6350 -0.1055 C 0 0 1 0 0 0 0 0 0 0 0 0 7.2849 4.5295 0.2913 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8624 2.6378 -0.9390 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8907 1.3847 -0.3717 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7321 0.3571 -1.0817 C 0 0 2 0 0 0 0 0 0 0 0 0 8.6921 -0.8876 -0.1995 C 0 0 2 0 0 0 0 0 0 0 0 0 8.8637 -2.0776 -1.0841 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5502 -0.9347 0.6040 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4431 -0.6651 -0.2204 C 0 0 2 0 0 0 0 0 0 0 0 0 6.4676 0.8578 -0.4240 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9324 1.2264 -1.6541 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2336 -0.9392 0.3097 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4206 -1.8225 -0.3852 C 0 0 2 0 0 0 0 0 0 0 0 0 3.2555 -1.0963 -1.0312 C 0 0 1 0 0 0 0 0 0 0 0 0 2.3835 -2.0098 -1.8304 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7941 -2.6180 -2.8982 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6840 -3.4819 -3.2572 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1743 -4.6738 -4.0743 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2576 -5.0960 -5.0379 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3812 -4.0416 -6.1318 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0001 -2.7266 -5.4342 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5888 -2.8305 -4.1637 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7557 -3.9509 -6.4328 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8250 -6.2720 -5.6595 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0033 -5.7619 -3.1875 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5892 -0.4366 -0.0190 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9558 -1.2540 0.9125 C 0 0 2 0 0 0 0 0 0 0 0 0 2.6865 -2.4516 1.3271 C 0 0 1 0 0 0 0 0 0 0 0 0 3.9202 -2.8381 0.5566 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7681 -4.1262 0.0399 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0056 -2.4411 2.7093 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6774 -1.3902 0.4431 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2837 -0.5806 1.0917 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7505 0.4778 0.1442 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1563 0.9077 0.4037 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1127 -0.2718 0.3669 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9347 -0.9779 -0.9230 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7366 -1.0928 1.5709 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6926 -2.2313 1.6376 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1076 -1.7604 1.8951 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5467 -0.6990 0.9235 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0429 -1.3760 -0.3469 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4711 0.3032 0.6254 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9057 1.2671 -0.4442 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3422 1.5362 -0.3447 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1965 1.0145 0.5224 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6164 1.4598 0.4140 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6863 2.8054 1.0845 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0853 3.3323 0.9573 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5363 3.4252 -0.4805 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2696 4.7003 1.5714 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9571 2.3758 1.7716 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9487 1.0006 1.2146 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5765 0.4422 0.8854 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.1330 -0.3844 2.0421 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7504 -0.9373 1.9600 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7012 0.0488 1.5447 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2764 0.8113 2.7859 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3381 0.2983 3.2426 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8379 -0.4867 -0.2819 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3445 -0.2766 -1.4257 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6268 -1.6013 -0.1382 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3074 -1.4847 1.6382 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0111 -1.5814 3.1629 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0422 -2.8907 1.1402 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0182 0.7498 -1.3526 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2979 3.8043 -1.4715 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0288 4.4848 1.0302 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6480 5.7938 2.6364 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7389 3.6986 2.7923 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3766 4.6037 3.5903 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9591 3.3573 2.3991 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9637 5.9014 1.7220 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9037 6.9189 1.1520 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5913 6.1109 -0.0652 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8746 5.2761 -1.3503 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6648 3.1676 0.8478 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2569 1.4450 0.6854 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2392 0.1237 -2.0702 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5677 -0.8106 0.4823 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8806 -1.8131 -2.1812 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8313 -2.6048 -0.8939 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0704 -2.8397 -0.9519 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6811 -1.1179 -1.1783 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9066 1.3736 0.3630 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1069 1.7883 -1.5240 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0125 -2.2252 -1.1999 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6785 -0.3395 -1.7053 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8565 -2.6786 -1.0680 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4888 -1.3401 -2.1326 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3842 -3.9474 -2.5275 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2798 -4.4538 -4.6559 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2335 -5.2701 -4.5383 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7608 -4.2572 -7.0034 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9056 -2.6324 -5.3887 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4412 -1.9085 -6.0002 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1920 -3.7503 -5.5622 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8789 -7.0526 -5.0228 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0339 -5.8041 -2.9756 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8991 -0.5538 1.8026 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9691 -3.3180 1.2502 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7634 -2.9896 1.3128 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6745 -4.4859 -0.1140 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1594 -1.4985 2.9870 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2430 -0.0303 1.9166 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5690 0.2023 -0.9216 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1369 1.4221 0.2628 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2149 1.3377 1.4218 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4516 1.7158 -0.2961 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5506 -1.8693 -1.0939 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8811 -1.3297 -0.9757 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0635 -0.2916 -1.7571 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9519 -0.4319 2.4443 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7555 -2.8482 0.7184 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4116 -2.9021 2.4670 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7743 -2.6539 1.7082 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2412 -1.5112 2.9573 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1381 -1.4320 -0.4260 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7151 -2.4583 -0.3277 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7035 -0.8723 -1.2699 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3532 0.9171 1.5677 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5623 1.0256 -1.4586 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3932 2.2492 -0.2079 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7411 2.2597 -1.0877 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8270 1.6532 -0.6737 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9373 3.4569 0.5771 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4565 2.7375 2.1581 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7001 3.8341 -1.0829 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9242 2.4772 -0.8776 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4165 4.1307 -0.4964 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8195 5.4864 0.8973 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3828 4.8888 1.5476 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8910 4.7437 2.5960 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5836 2.4413 2.8126 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9754 2.7745 1.7503 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4333 0.3202 1.9406 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6290 0.9887 0.3177 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8340 -1.2693 2.0941 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4857 -1.2346 3.0267 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7072 -1.9128 1.4253 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3645 0.4645 3.2572 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0831 0.7376 3.5446 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1903 1.9205 2.5784 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9505 -0.1348 3.8557 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1029 -2.0230 -0.9337 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6565 -2.3047 3.6523 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0438 -1.8723 3.3290 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1117 -0.5342 3.5182 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4796 -2.8790 0.1805 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9076 -3.5245 1.0236 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3515 -3.4514 1.8380 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4071 0.3444 -2.1554 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1108 3.8006 -2.4454 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8325 4.4967 0.4507 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9795 5.8380 3.3581 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 14 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 25 28 1 0 24 29 1 0 23 30 1 0 19 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 32 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 6 41 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 6 46 48 1 0 48 49 1 0 49 50 1 0 50 51 2 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 54 56 1 0 54 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 1 60 64 1 0 59 65 1 6 65 66 2 0 65 67 1 0 43 68 1 0 68 69 1 0 68 70 1 0 10 71 1 0 5 72 1 0 4 73 1 0 3 74 1 0 7 2 1 0 15 9 1 0 34 18 1 0 68 38 1 0 27 22 1 0 48 41 1 0 62 51 1 0 62 46 1 0 59 52 1 0 1 75 1 0 1 76 1 0 1 77 1 0 2 78 1 1 3 79 1 6 4 80 1 6 5 81 1 6 6 82 1 1 9 83 1 1 10 84 1 6 11 85 1 1 12 86 1 0 12 87 1 0 12 88 1 0 14 89 1 6 15 90 1 1 16 91 1 0 18 92 1 6 19 93 1 6 20 94 1 0 20 95 1 0 22 96 1 1 23 97 1 6 24 98 1 1 25 99 1 6 26100 1 0 26101 1 0 28102 1 0 29103 1 0 30104 1 0 32105 1 1 33106 1 1 34107 1 1 35108 1 0 36109 1 0 38110 1 1 39111 1 0 39112 1 0 40113 1 0 40114 1 0 42115 1 0 42116 1 0 42117 1 0 43118 1 1 44119 1 0 44120 1 0 45121 1 0 45122 1 0 47123 1 0 47124 1 0 47125 1 0 48126 1 1 49127 1 0 49128 1 0 50129 1 0 52130 1 6 53131 1 0 53132 1 0 55133 1 0 55134 1 0 55135 1 0 56136 1 0 56137 1 0 56138 1 0 57139 1 0 57140 1 0 58141 1 0 58142 1 0 60143 1 0 61144 1 0 61145 1 0 63146 1 0 63147 1 0 63148 1 0 64149 1 0 67150 1 0 69151 1 0 69152 1 0 69153 1 0 70154 1 0 70155 1 0 70156 1 0 71157 1 0 72158 1 0 73159 1 0 74160 1 0 M END

Standard InCHIKey	GAMQIEGJRMEAEJ-BLEIWCCUSA-N
Standard InCHI	InChI=1S/C53H86O21/c1-22-32(56)35(59)38(62)44(69-22)74-42-33(57)23(2)70-46(40(42)64)73-41-27(21-68-43-37(61)34(58)26(54)20-67-43)71-45(39(63)36(41)60)72-31-13-14-50(7)28(49(31,5)6)12-15-51(8)29(50)11-10-24-25-18-48(3,4)16-17-53(25,47(65)66)30(55)19-52(24,51)9/h10,22-23,25-46,54-64H,11-21H2,1-9H3,(H,65,66)/t22-,23-,25-,26+,27+,28-,29+,30?,31-,32+,33-,34-,35+,36+,37+,38+,39+,40+,41+,42+,43-,44-,45-,46-,50-,51+,52+,53+/m0/s1
SMILES	C[C@H]1[C@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@H]([C@H](C)O[C@H]([C@@H]1O)O[C@@H]1[C@@H](CO[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O[C@H]([C@@H]([C@H]1O)O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)[C@@H]2CC=C2[C@@H]4CC(C)(C)CC[C@@]4(C(C[C@@]32C)O)C(=O)O)C1(C)C)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1058.57	Volume:	1027.557 ? Van der Waals volume.
Dense:	1.03	LogP:	1.084 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.827 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.853 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	51.0
TPSA:	333.67 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	12.0	Rings:	9.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.103	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.778	Fsp³:	0.943
MCE-18:	197.146 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.743	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.195	Promiscuous compounds:	0.046

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.175	MDCK Permeability:	-5.113
Pgp-inhibitor:	0.0	Pgp-substrate:	0.255
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.735
20% Bioavailability (F20%):	0.185	30% Bioavailability (F30%):	0.985
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.011
Plasma Protein Binding (PPB):	58.01%	Volume Distribution (VD):	-0.38
Fu:	29.846% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.931	CYP3A4-substrate:	0.153
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.635
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.344

Half-life (T1/2):

5.027

ADMET: Toxicity

hERG Blockers:	0.007	hERG Blockers (10um):	0.026
Human Hepatotoxicity (H-HT):	0.436	Drug-induced Liver Injury (DILI):	0.703
AMES Toxicity:	0.547	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.004	Skin Sensitization:	0.992
Carcinogencity:	0.01	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.132	Drug-induced Nephrotoxicity:	0.911
Genotoxicity:	0.016	RPMI-8226 Immunitoxicity:	0.118
A549 Cytotoxicity:	0.128	Hek293 Cytotoxicity:	0.174
BCF:	1.268 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.877 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.584 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.58 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	small food enterprises (Zvijezda d.d., Zagreb, Croatia)	n.a.	DOI[10.1002/EJLT.200900231]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1007/s11746-997-0093-1]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[16660462]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	flower petals	n.a.	n.a.	PMID[17480100]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22537213]
NPO17777	Helianthus tuberosus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23501116]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	Flowers	n.a.	n.a.	PMID[6361218]
NPO17777	Helianthus tuberosus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO17777	Helianthus tuberosus	Species	Asteraceae	Eukaryota	Tubers	n.a.		Database[FooDB]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.		Database[FooDB]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO17777	Helianthus tuberosus	Species	Asteraceae	Eukaryota	Tuber	n.a.	n.a.	Database[FooDB]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	Shoot	n.a.	n.a.	Database[FooDB]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	Seed	n.a.	n.a.	Database[FooDB]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	Root	n.a.	n.a.	Database[FooDB]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	Pollen Or Spore	n.a.	n.a.	Database[FooDB]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	Pericarp	n.a.	n.a.	Database[FooDB]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	Oil	n.a.	n.a.	Database[FooDB]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	Flower Essent. Oil	n.a.	n.a.	Database[FooDB]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	Flower	n.a.	n.a.	Database[FooDB]
NPO17777	Helianthus tuberosus	Species	Asteraceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO17777	Helianthus tuberosus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO17777	Helianthus tuberosus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO17777	Helianthus tuberosus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC170666 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23462
0.1-0.2	22589
0.2-0.3	2613
0.3-0.4	788
0.4-0.5	293
0.5-0.6	84
0.6-0.7	20
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7619	Intermediate Similarity	NPC488516
0.7345	Intermediate Similarity	NPC475486
0.7157	Intermediate Similarity	NPC242611
0.6842	Remote Similarity	NPC488515
0.6727	Remote Similarity	NPC480424
0.6581	Remote Similarity	NPC75318
0.6571	Remote Similarity	NPC31839
0.6557	Remote Similarity	NPC166422
0.6466	Remote Similarity	NPC481082
0.6466	Remote Similarity	NPC164419
0.646	Remote Similarity	NPC80843
0.6457	Remote Similarity	NPC161717
0.6423	Remote Similarity	NPC251263
0.6364	Remote Similarity	NPC288205
0.6364	Remote Similarity	NPC51465
0.632	Remote Similarity	NPC54636
0.6303	Remote Similarity	NPC324875
0.6303	Remote Similarity	NPC292677
0.629	Remote Similarity	NPC219180
0.6202	Remote Similarity	NPC471385
0.6083	Remote Similarity	NPC37134
0.608	Remote Similarity	NPC323341
0.6033	Remote Similarity	NPC291903
0.5952	Remote Similarity	NPC133818
0.5926	Remote Similarity	NPC283849
0.5913	Remote Similarity	NPC56713
0.5897	Remote Similarity	NPC76497
0.5862	Remote Similarity	NPC114441
0.5827	Remote Similarity	NPC471384
0.582	Remote Similarity	NPC276093
0.5812	Remote Similarity	NPC6377
0.5812	Remote Similarity	NPC208381
0.5794	Remote Similarity	NPC473824
0.5785	Remote Similarity	NPC257468
0.575	Remote Similarity	NPC104400
0.575	Remote Similarity	NPC10320
0.575	Remote Similarity	NPC180550
0.575	Remote Similarity	NPC35405
0.5738	Remote Similarity	NPC79718
0.5726	Remote Similarity	NPC488209
0.5691	Remote Similarity	NPC145899
0.5649	Remote Similarity	NPC481080
0.56	Remote Similarity	NPC488564
0.5591	Remote Similarity	NPC475119
0.5546	Remote Similarity	NPC488561
0.5537	Remote Similarity	NPC114304
0.5528	Remote Similarity	NPC73829
0.5517	Remote Similarity	NPC270667
0.5515	Remote Similarity	NPC302543
0.5508	Remote Similarity	NPC25605
0.5507	Remote Similarity	NPC250247
0.5495	Remote Similarity	NPC606107
0.5462	Remote Similarity	NPC127056
0.5441	Remote Similarity	NPC236638
0.5441	Remote Similarity	NPC294453
0.5435	Remote Similarity	NPC220160
0.5401	Remote Similarity	NPC309223
0.5378	Remote Similarity	NPC174679
0.5378	Remote Similarity	NPC279554
0.5357	Remote Similarity	NPC28198
0.5357	Remote Similarity	NPC476123
0.5344	Remote Similarity	NPC243680
0.5338	Remote Similarity	NPC488560
0.5333	Remote Similarity	NPC110633
0.5328	Remote Similarity	NPC136768
0.5328	Remote Similarity	NPC469945
0.5323	Remote Similarity	NPC139044
0.5294	Remote Similarity	NPC136877
0.5294	Remote Similarity	NPC475514
0.5278	Remote Similarity	NPC601365
0.5271	Remote Similarity	NPC62725
0.5254	Remote Similarity	NPC76999
0.5238	Remote Similarity	NPC484832
0.5234	Remote Similarity	NPC295823
0.5234	Remote Similarity	NPC174720
0.5234	Remote Similarity	NPC475467
0.5217	Remote Similarity	NPC100383
0.5217	Remote Similarity	NPC305981
0.5217	Remote Similarity	NPC481081
0.5207	Remote Similarity	NPC109079
0.52	Remote Similarity	NPC258885
0.52	Remote Similarity	NPC471383
0.5191	Remote Similarity	NPC475287
0.5191	Remote Similarity	NPC200788
0.518	Remote Similarity	NPC261506
0.518	Remote Similarity	NPC4328
0.5156	Remote Similarity	NPC323359
0.5147	Remote Similarity	NPC476068
0.5145	Remote Similarity	NPC43550
0.5141	Remote Similarity	NPC102505
0.5141	Remote Similarity	NPC488514
0.5126	Remote Similarity	NPC164194
0.5122	Remote Similarity	NPC22956
0.5109	Remote Similarity	NPC13998
0.5077	Remote Similarity	NPC481078
0.5075	Remote Similarity	NPC123199
0.5072	Remote Similarity	NPC41061
0.5072	Remote Similarity	NPC227551
0.5041	Remote Similarity	NPC12288
0.5038	Remote Similarity	NPC123522
0.5038	Remote Similarity	NPC11242
0.5038	Remote Similarity	NPC280941
0.5038	Remote Similarity	NPC235772
0.5037	Remote Similarity	NPC475160
0.5037	Remote Similarity	NPC475140
0.5037	Remote Similarity	NPC473714
0.5036	Remote Similarity	NPC21691

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC170666 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7058
0.1-0.2	2045
0.2-0.3	45
0.3-0.4	1
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data