NPASS Compound

Natural Product: NPC88767

Natural Product ID	NPC88767
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NIAXDPKRLMXOKV-HLAVLWPQSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	24862011
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 114121 0 0 0 0 0 0 0 0999 V2000 7.9991 -1.8527 -1.1929 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5170 -0.6151 -0.4519 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2620 -0.9890 0.2937 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5351 -0.5926 1.7145 C 0 0 2 0 0 0 0 0 0 0 0 0 5.3446 0.2773 2.1583 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2980 -0.2006 1.2210 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0362 0.6088 1.1438 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2612 0.4288 2.4129 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8725 -0.0098 2.2611 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1720 0.0348 1.1405 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2057 -0.4334 1.1160 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0528 -0.0607 -0.0193 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2836 0.5312 -1.1608 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1237 0.0240 -1.2749 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8546 0.5624 -0.0471 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7785 2.0616 -0.1569 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2507 0.0199 0.0021 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9849 0.0994 -1.3093 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2435 -0.7404 -1.1924 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0805 -0.1524 -0.0880 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4476 1.2423 -0.4670 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0755 0.8398 0.2809 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3328 0.3252 -0.0144 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1207 0.2228 1.2579 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3294 1.1189 1.1624 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1126 0.6713 -0.0597 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2305 0.6582 -1.2874 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8718 1.4560 -2.3722 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1373 1.3756 -3.5750 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9390 1.0827 -0.9903 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7355 -0.5452 0.1877 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1110 -0.5012 0.1776 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6666 -1.4958 -0.8245 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.0966 -1.8466 -0.4426 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.7116 -0.6124 0.1759 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.9782 -0.3900 1.5028 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.9351 1.0880 1.8307 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6665 -0.8513 1.4101 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.0715 -0.7589 0.4313 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8288 -2.2467 -1.5629 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6190 -1.0416 -2.1201 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9912 2.4527 1.0694 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5687 -1.0850 1.4596 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7306 0.0672 1.7614 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4935 -0.3175 0.6645 C 0 0 2 0 0 0 0 0 0 0 0 0 9.3607 0.8344 0.2107 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5485 0.4063 -0.5979 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4254 -0.4736 0.2407 C 0 0 1 0 0 0 0 0 0 0 0 0 12.5684 0.3705 0.7876 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5788 -1.0265 1.3782 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3223 -1.3988 0.9273 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9800 -1.5361 -0.4682 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0556 -2.3831 -1.5159 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5230 -1.6019 -2.1376 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5410 -2.5466 -0.5456 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4081 0.2063 -1.1589 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9784 -2.0532 0.1792 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4938 -1.4862 2.3817 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0980 0.1151 3.2183 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6012 1.3466 2.0332 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0392 -1.2426 1.4545 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2377 1.6934 1.0485 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7729 -0.3071 3.0807 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2342 1.3718 3.0310 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3735 -0.4065 3.1508 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1266 -1.5790 1.1122 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7203 -0.2794 2.1175 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5496 -0.9981 -0.4413 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2961 1.6558 -1.0673 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7843 0.2662 -2.1363 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1311 -1.0600 -1.3501 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5749 0.5547 -2.1468 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1105 2.4848 0.3948 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6012 2.3814 -1.2259 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7048 2.5933 0.1276 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1789 -1.0840 0.2396 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3523 -0.4159 -2.0648 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1709 1.1057 -1.6721 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9231 -1.7845 -0.9444 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8551 -0.7185 -2.1184 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3352 1.6405 0.0664 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6984 1.2207 -1.5704 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6417 1.9656 -0.3686 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2561 -0.7154 -0.4289 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4504 0.5368 2.1036 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9706 0.9051 2.0400 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9024 1.4269 -0.2172 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1585 -0.3952 -1.6249 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0607 2.5109 -2.0936 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8639 1.0147 -2.5915 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6967 0.4733 -3.5242 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4553 0.5271 -0.0377 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0944 -2.4499 -0.7226 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0804 -2.6393 0.3289 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5534 0.2704 -0.4530 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5420 -0.8938 2.3018 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9872 1.6497 0.8754 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9643 1.3208 2.3082 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7979 1.3913 2.4651 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5359 -0.8186 -0.4617 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2871 -3.1075 -1.4358 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5408 -1.7490 -2.7819 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4818 2.6924 1.8885 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8593 -1.2074 2.4118 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7303 1.4390 1.0638 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7662 1.5482 -0.4180 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0971 1.3571 -0.8589 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2588 -0.0466 -1.5701 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4384 -0.2483 1.0906 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1607 0.9977 1.5902 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8675 1.0595 -0.0433 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4522 -0.3194 2.2062 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0666 -1.9472 1.8001 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3665 -2.3252 -0.4697 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 12 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 27 30 1 0 26 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 36 38 1 0 35 39 1 0 34 40 1 0 33 41 1 0 25 42 1 0 24 43 1 0 4 44 1 0 45 44 1 1 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 48 50 1 0 50 51 1 0 48 52 1 6 45 2 1 0 20 3 1 0 30 23 1 0 38 32 1 0 51 45 1 0 20 6 1 0 17 7 1 0 15 10 1 0 1 53 1 0 1 54 1 0 1 55 1 0 2 56 1 6 3 57 1 1 4 58 1 1 5 59 1 0 5 60 1 0 6 61 1 1 7 62 1 6 8 63 1 0 8 64 1 0 9 65 1 0 11 66 1 0 11 67 1 0 12 68 1 6 13 69 1 0 13 70 1 0 14 71 1 0 14 72 1 0 16 73 1 0 16 74 1 0 16 75 1 0 17 76 1 1 18 77 1 0 18 78 1 0 19 79 1 0 19 80 1 0 21 81 1 0 21 82 1 0 21 83 1 0 23 84 1 6 24 85 1 1 25 86 1 1 26 87 1 6 27 88 1 6 28 89 1 0 28 90 1 0 29 91 1 0 32 92 1 6 33 93 1 6 34 94 1 1 35 95 1 6 36 96 1 1 37 97 1 0 37 98 1 0 37 99 1 0 39100 1 0 40101 1 0 41102 1 0 42103 1 0 43104 1 0 46105 1 0 46106 1 0 47107 1 0 47108 1 0 49109 1 0 49110 1 0 49111 1 0 50112 1 0 50113 1 0 52114 1 0 M END

Standard InCHIKey	NIAXDPKRLMXOKV-HLAVLWPQSA-N
Standard InCHI	InChI=1S/C39H62O13/c1-18-27-25(52-39(18)13-12-36(3,46)17-47-39)15-24-22-7-6-20-14-21(8-10-37(20,4)23(22)9-11-38(24,27)5)49-35-32(45)30(43)33(26(16-40)50-35)51-34-31(44)29(42)28(41)19(2)48-34/h6,18-19,21-35,40-46H,7-17H2,1-5H3/t18-,19-,21-,22+,23-,24-,25-,26+,27-,28-,29+,30+,31+,32+,33+,34-,35+,36-,37-,38-,39+/m0/s1
SMILES	C[C@H]1[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@H](CC[C@]5(C)[C@H]4CC[C@]23C)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O)O)O[C@@]21CC[C@@](C)(CO2)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO17650	Dioscorea septemloba	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO17650	Dioscorea septemloba	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO17650	Dioscorea septemloba	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO17650	Dioscorea septemloba	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO17650	Dioscorea septemloba	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO17650	Dioscorea septemloba	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC88767 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22293
0.1-0.2	23773
0.2-0.3	3023
0.3-0.4	533
0.4-0.5	128
0.5-0.6	63
0.6-0.7	23
0.7-0.8	0
0.8-0.85	1
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8851	High Similarity	NPC470432
0.8851	High Similarity	NPC230507
0.8191	Intermediate Similarity	NPC6806
0.7423	Intermediate Similarity	NPC470433
0.7423	Intermediate Similarity	NPC46190
0.7423	Intermediate Similarity	NPC171073
0.7347	Intermediate Similarity	NPC248746
0.7347	Intermediate Similarity	NPC477809
0.7327	Intermediate Similarity	NPC269297
0.7327	Intermediate Similarity	NPC222202
0.7273	Intermediate Similarity	NPC42171
0.7222	Intermediate Similarity	NPC181845
0.72	Intermediate Similarity	NPC480555
0.72	Intermediate Similarity	NPC150372
0.7113	Intermediate Similarity	NPC14704
0.7087	Intermediate Similarity	NPC475333
0.7087	Intermediate Similarity	NPC224098
0.7087	Intermediate Similarity	NPC208383
0.7071	Intermediate Similarity	NPC602423
0.699	Remote Similarity	NPC475550
0.6939	Remote Similarity	NPC113044
0.6939	Remote Similarity	NPC283829
0.6939	Remote Similarity	NPC161676
0.6931	Remote Similarity	NPC300557
0.6822	Remote Similarity	NPC477811
0.6792	Remote Similarity	NPC480554
0.6735	Remote Similarity	NPC15249
0.6735	Remote Similarity	NPC25455
0.6667	Remote Similarity	NPC480553
0.6607	Remote Similarity	NPC224314
0.6542	Remote Similarity	NPC194207
0.6542	Remote Similarity	NPC22779
0.6518	Remote Similarity	NPC480556
0.6452	Remote Similarity	NPC486114
0.6449	Remote Similarity	NPC32361
0.6442	Remote Similarity	NPC249553
0.6396	Remote Similarity	NPC232054
0.6296	Remote Similarity	NPC309278
0.625	Remote Similarity	NPC325828
0.6117	Remote Similarity	NPC305423
0.6061	Remote Similarity	NPC250393
0.6018	Remote Similarity	NPC31896
0.5833	Remote Similarity	NPC182900
0.5769	Remote Similarity	NPC94272
0.5741	Remote Similarity	NPC122819
0.5714	Remote Similarity	NPC477808
0.5673	Remote Similarity	NPC107962
0.5667	Remote Similarity	NPC210569
0.5631	Remote Similarity	NPC19400
0.5575	Remote Similarity	NPC13193
0.5566	Remote Similarity	NPC141433
0.5556	Remote Similarity	NPC485594
0.5545	Remote Similarity	NPC124677
0.5537	Remote Similarity	NPC15918
0.5528	Remote Similarity	NPC305771
0.5528	Remote Similarity	NPC94072
0.5528	Remote Similarity	NPC169816
0.55	Remote Similarity	NPC477807
0.5487	Remote Similarity	NPC247037
0.5481	Remote Similarity	NPC306131
0.5481	Remote Similarity	NPC200802
0.5472	Remote Similarity	NPC485595
0.5472	Remote Similarity	NPC6295
0.5446	Remote Similarity	NPC97700
0.5446	Remote Similarity	NPC73243
0.5446	Remote Similarity	NPC244086
0.5446	Remote Similarity	NPC84956
0.5446	Remote Similarity	NPC30856
0.5431	Remote Similarity	NPC23808
0.5431	Remote Similarity	NPC87998
0.5376	Remote Similarity	NPC100451
0.5357	Remote Similarity	NPC150057
0.5357	Remote Similarity	NPC475182
0.5357	Remote Similarity	NPC147753
0.5345	Remote Similarity	NPC249265
0.5339	Remote Similarity	NPC287885
0.5333	Remote Similarity	NPC107188
0.531	Remote Similarity	NPC184617
0.528	Remote Similarity	NPC244431
0.528	Remote Similarity	NPC263359
0.5273	Remote Similarity	NPC161738
0.5273	Remote Similarity	NPC42482
0.5248	Remote Similarity	NPC165439
0.5238	Remote Similarity	NPC121453
0.5213	Remote Similarity	NPC486119
0.521	Remote Similarity	NPC308140
0.5192	Remote Similarity	NPC477451
0.5175	Remote Similarity	NPC294129
0.5175	Remote Similarity	NPC102016
0.5175	Remote Similarity	NPC95051
0.5161	Remote Similarity	NPC235126
0.5161	Remote Similarity	NPC242419
0.5138	Remote Similarity	NPC70204
0.5135	Remote Similarity	NPC98696
0.5135	Remote Similarity	NPC40440
0.5128	Remote Similarity	NPC232037
0.5126	Remote Similarity	NPC132080
0.5093	Remote Similarity	NPC295980
0.5089	Remote Similarity	NPC265275
0.5085	Remote Similarity	NPC218571
0.5085	Remote Similarity	NPC487615
0.5045	Remote Similarity	NPC112274
0.5043	Remote Similarity	NPC475625
0.5043	Remote Similarity	NPC116756
0.5042	Remote Similarity	NPC83137

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC88767 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7327
0.1-0.2	1720
0.2-0.3	86
0.3-0.4	13
0.4-0.5	0
0.5-0.6	3
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.625	Remote Similarity	NPD8171	Phase 2
0.5741	Remote Similarity	NPD8449	Approved
0.5619	Remote Similarity	NPD8170	Phase 2
0.5357	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data