NPASS Compound

Natural Product: NPC528936

Natural Product ID	NPC528936
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{R},6~{R})-5-hydroxy-6-(hydroxymethyl)-2-[(1~{S},2~{S},4~{S},5'~{R},6~{S},6'~{R},7~{S},8~{R},9~{S},12~{S},13~{R},16~{S})-6'-hydroxy-5',7,9,13-tetramethyl-spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-ene-6,2'-tetrahydropyran]-16-yl]oxy-4-[(2~{S},3~{R},4~{S},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{R},6~{R})-5-hydroxy-6-(hydroxymethyl)-2-[(1~{S},2~{S},4~{S},5'~{R},6~{S},6'~{R},7~{S},8~{R},9~{S},12~{S},13~{R},16~{S})-6'-hydroxy-5',7,9,13-tetramethyl-spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-ene-6,2'-tetrahydropyran]-16-yl]oxy-4-[(2~{S},3~{R},4~{S},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 131139 0 0 0 0 0 0 0 0999 V2000 12.4436 0.0245 0.7435 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0306 -0.3341 0.2997 C 0 0 2 0 0 0 0 0 0 0 0 0 10.4730 0.8180 -0.4619 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2215 1.3085 0.1764 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3103 0.2660 0.7239 C 0 0 1 0 0 0 0 0 0 0 0 0 8.9010 -0.8130 1.3168 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2570 -0.6953 1.5367 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7276 -1.9275 1.9882 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4291 0.9404 1.6012 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2960 0.1915 1.7220 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0229 1.0585 1.8042 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0895 0.1761 1.0939 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7204 0.6452 0.7749 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0375 1.3035 1.9039 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5823 1.4703 1.5700 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0548 0.6542 0.7827 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5108 0.8652 0.4869 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1907 -0.3325 1.1314 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2109 -0.8942 0.3733 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4598 -0.5012 0.7642 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1969 -1.6728 1.0316 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4253 -1.3611 1.5923 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2320 -2.6093 1.7498 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4806 -2.2652 2.3151 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2031 -0.3917 0.7213 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2197 0.8806 1.2978 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4819 -0.3375 -0.6035 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2957 -1.6603 -1.0048 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8953 -1.9275 -2.2261 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8503 -2.9085 -2.2148 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4139 -4.1826 -2.0160 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9600 -4.3267 -1.7374 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5345 -5.6564 -1.8134 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0393 -3.4750 -2.5293 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.9639 -2.9884 -1.7638 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7982 -2.3496 -3.1735 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3156 -2.8150 -4.3833 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1188 0.2601 -0.3575 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3086 1.5996 -0.0038 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8158 2.4825 -0.9567 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7510 3.2574 -0.5113 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9635 3.9494 0.6448 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7375 4.7310 1.0014 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1874 4.8286 0.6141 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5658 5.0704 1.9350 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3517 4.1672 -0.0760 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2446 5.1657 -0.4537 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9320 3.4306 -1.3262 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5623 4.3659 -2.2641 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2410 -1.2995 1.7463 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1373 -1.7136 0.8458 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5501 -0.5264 0.1669 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1499 -0.6826 -1.3135 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0146 -0.6101 0.2335 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6845 -0.8241 -1.1265 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1406 -1.2138 -0.9345 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8664 -0.1227 -0.1836 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1308 1.0805 -1.0193 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1532 -0.5959 0.4260 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3826 -0.2956 -0.3651 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9246 -1.6207 -0.8785 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0754 -0.8799 0.8663 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9034 0.7742 0.0498 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3570 0.4815 1.7502 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1758 -1.2148 -0.3897 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1824 1.7040 -0.4733 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3209 0.6140 -1.5593 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6381 1.8341 -0.6403 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4354 2.0963 0.9303 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5093 0.0412 2.3375 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3647 -2.3550 1.3849 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3274 -0.5053 2.5997 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8159 1.2122 2.8925 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1996 2.0350 1.3308 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9998 -0.7780 1.6526 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6609 1.3581 -0.0964 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1500 0.7818 2.8780 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4507 2.3355 1.9985 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0623 2.3302 2.0312 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8719 1.7784 1.0185 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6968 1.0189 -0.5569 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7620 0.1590 1.9905 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4661 0.1782 1.6403 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2329 -0.9422 2.6019 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4195 -3.0441 0.7527 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6896 -3.3169 2.4246 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5017 -1.2977 2.5422 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2446 -0.7543 0.5486 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9978 1.3845 0.9326 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0640 0.2373 -1.3612 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4096 -0.9985 -2.6026 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9964 -4.7423 -1.2283 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6225 -4.7618 -2.9588 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7976 -4.0473 -0.6529 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8814 -5.8775 -1.0937 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5471 -4.1265 -3.2994 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8088 -3.4959 -0.9411 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0920 -1.5038 -3.3440 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7466 -3.5728 -4.6668 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5671 0.1848 -1.3295 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4225 1.8970 -1.8170 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1308 3.1966 1.4701 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0564 4.0672 1.5990 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2029 5.1154 0.1031 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9617 5.6013 1.6869 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9104 5.8061 0.1782 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3621 4.3250 2.5493 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8893 3.5109 0.6384 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0780 5.5162 -1.3642 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8388 2.8335 -1.6432 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2165 3.8534 -3.0532 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7588 -2.1649 2.2248 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7533 -0.7639 2.6181 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6684 -2.1483 1.5076 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3766 -2.5288 0.1362 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9276 -0.5042 -1.4765 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7112 0.0577 -1.8786 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3027 -1.7431 -1.6231 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3375 -1.4750 0.8564 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2383 -1.5990 -1.7341 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7046 0.2001 -1.5891 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2679 -2.2025 -0.4735 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5874 -1.2467 -1.9566 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2599 1.7196 -1.2417 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4566 0.7008 -2.0338 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8955 1.7481 -0.5907 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0596 -1.6760 0.6735 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2775 0.3910 -1.1998 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0793 -2.1009 -1.4202 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1968 -2.2849 -0.0521 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7398 -1.4868 -1.6075 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 1 6 7 1 0 7 8 1 0 5 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 22 25 1 0 25 26 1 0 25 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 27 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 18 50 1 0 50 51 1 0 51 52 1 0 52 53 1 6 52 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 6 57 59 1 0 59 60 1 0 60 61 1 0 7 2 1 0 59 10 1 0 60 5 1 0 57 12 1 0 54 13 1 0 52 16 1 0 38 20 1 0 48 40 1 0 36 29 1 0 1 62 1 0 1 63 1 0 1 64 1 0 2 65 1 6 3 66 1 0 3 67 1 0 4 68 1 0 4 69 1 0 7 70 1 1 8 71 1 0 10 72 1 1 11 73 1 0 11 74 1 0 12 75 1 1 13 76 1 6 14 77 1 0 14 78 1 0 15 79 1 0 17 80 1 0 17 81 1 0 18 82 1 1 20 83 1 1 22 84 1 1 23 85 1 0 23 86 1 0 24 87 1 0 25 88 1 6 26 89 1 0 27 90 1 6 29 91 1 6 31 92 1 0 31 93 1 0 32 94 1 1 33 95 1 0 34 96 1 6 35 97 1 0 36 98 1 6 37 99 1 0 38100 1 6 40101 1 6 42102 1 1 43103 1 0 43104 1 0 43105 1 0 44106 1 6 45107 1 0 46108 1 1 47109 1 0 48110 1 6 49111 1 0 50112 1 0 50113 1 0 51114 1 0 51115 1 0 53116 1 0 53117 1 0 53118 1 0 54119 1 1 55120 1 0 55121 1 0 56122 1 0 56123 1 0 58124 1 0 58125 1 0 58126 1 0 59127 1 1 60128 1 6 61129 1 0 61130 1 0 61131 1 0 M END

Standard InCHIKey	GREXOESHYXPSMM-RZZVIPFMSA-N
Standard InCHI	InChI=1S/C44H70O17/c1-18-8-13-44(61-38(18)53)19(2)29-27(60-44)15-25-23-7-6-21-14-22(9-11-42(21,4)24(23)10-12-43(25,29)5)56-41-37(59-40-35(52)33(50)30(47)20(3)55-40)36(32(49)28(16-45)57-41)58-39-34(51)31(48)26(46)17-54-39/h6,18-20,22-41,45-53H,7-17H2,1-5H3/t18-,19+,20+,22+,23-,24+,25+,26-,27+,28-,29+,30+,31+,32-,33-,34-,35-,36+,37-,38-,39+,40+,41-,42+,43+,44+/m1/s1
SMILES	C[C@@H]1CC[C@@]2(O[C@H]1O)O[C@H]1C[C@H]3[C@@H]4CC=C5C[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O[C@@H]7OC[C@@H](O)[C@H](O)[C@H]7O)[C@H]6O[C@@H]6O[C@@H](C)[C@H](O)[C@@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	870.46	Volume:	839.369 ? Van der Waals volume.
Dense:	1.037	LogP:	2.286 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.021 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.454 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	48.0
TPSA:	255.91 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.155	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.786	Fsp³:	0.955
MCE-18:	230.233 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.7	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.256	Promiscuous compounds:	0.013

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.046	MDCK Permeability:	-5.148
Pgp-inhibitor:	0.0	Pgp-substrate:	0.99
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.002
20% Bioavailability (F20%):	0.018	30% Bioavailability (F30%):	0.861
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.004
Plasma Protein Binding (PPB):	51.311%	Volume Distribution (VD):	-0.476
Fu:	39.876% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.358
BSEP inhibitor:	0.054

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.164	CYP3A4-substrate:	0.999
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.344
HLM stability:	0.38 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.44

Half-life (T1/2):

3.513

ADMET: Toxicity

hERG Blockers:	0.045	hERG Blockers (10um):	0.133
Human Hepatotoxicity (H-HT):	0.276	Drug-induced Liver Injury (DILI):	0.83
AMES Toxicity:	0.614	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.015	Skin Sensitization:	1.0
Carcinogencity:	0.016	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.104	Drug-induced Nephrotoxicity:	0.473
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.236
A549 Cytotoxicity:	0.201	Hek293 Cytotoxicity:	0.672
BCF:	1.534 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.371 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.561 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.9 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8266	Solanum anguivi	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8266	Solanum anguivi	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC528936 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24128
0.1-0.2	22252
0.2-0.3	2577
0.3-0.4	662
0.4-0.5	128
0.5-0.6	61
0.6-0.7	39
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7843	Intermediate Similarity	NPC602423
0.783	Intermediate Similarity	NPC309278
0.7692	Intermediate Similarity	NPC300557
0.7054	Intermediate Similarity	NPC218571
0.7054	Intermediate Similarity	NPC487615
0.7027	Intermediate Similarity	NPC475333
0.7027	Intermediate Similarity	NPC224098
0.7027	Intermediate Similarity	NPC208383
0.6957	Remote Similarity	NPC232054
0.678	Remote Similarity	NPC480556
0.6607	Remote Similarity	NPC102016
0.6607	Remote Similarity	NPC95051
0.6581	Remote Similarity	NPC31896
0.6522	Remote Similarity	NPC194207
0.6522	Remote Similarity	NPC22779
0.6496	Remote Similarity	NPC477811
0.6422	Remote Similarity	NPC113044
0.6422	Remote Similarity	NPC283829
0.6422	Remote Similarity	NPC161676
0.6396	Remote Similarity	NPC470433
0.6396	Remote Similarity	NPC46190
0.6396	Remote Similarity	NPC171073
0.6393	Remote Similarity	NPC477808
0.6372	Remote Similarity	NPC480555
0.6372	Remote Similarity	NPC150372
0.6364	Remote Similarity	NPC475351
0.6339	Remote Similarity	NPC248746
0.6283	Remote Similarity	NPC42171
0.6283	Remote Similarity	NPC51172
0.6283	Remote Similarity	NPC6806
0.6283	Remote Similarity	NPC49032
0.6273	Remote Similarity	NPC14704
0.6239	Remote Similarity	NPC470432
0.6239	Remote Similarity	NPC230507
0.6228	Remote Similarity	NPC150057
0.6228	Remote Similarity	NPC147753
0.621	Remote Similarity	NPC210569
0.619	Remote Similarity	NPC263359
0.6186	Remote Similarity	NPC480554
0.6083	Remote Similarity	NPC480553
0.608	Remote Similarity	NPC15918
0.6068	Remote Similarity	NPC269297
0.6068	Remote Similarity	NPC222202
0.6063	Remote Similarity	NPC305771
0.6063	Remote Similarity	NPC94072
0.6063	Remote Similarity	NPC169816
0.6	Remote Similarity	NPC181845
0.5938	Remote Similarity	NPC244431
0.5917	Remote Similarity	NPC249265
0.5897	Remote Similarity	NPC97700
0.5897	Remote Similarity	NPC30856
0.5882	Remote Similarity	NPC116756
0.5841	Remote Similarity	NPC305423
0.5794	Remote Similarity	NPC224314
0.5739	Remote Similarity	NPC473601
0.5727	Remote Similarity	NPC206003
0.5727	Remote Similarity	NPC473610
0.5714	Remote Similarity	NPC475319
0.5678	Remote Similarity	NPC151134
0.5664	Remote Similarity	NPC125324
0.5656	Remote Similarity	NPC108072
0.5641	Remote Similarity	NPC477809
0.563	Remote Similarity	NPC294129
0.5593	Remote Similarity	NPC48886
0.5593	Remote Similarity	NPC94881
0.5574	Remote Similarity	NPC232037
0.5565	Remote Similarity	NPC132080
0.5556	Remote Similarity	NPC470866
0.55	Remote Similarity	NPC73243
0.55	Remote Similarity	NPC244086
0.55	Remote Similarity	NPC84956
0.55	Remote Similarity	NPC475247
0.547	Remote Similarity	NPC98696
0.5455	Remote Similarity	NPC115165
0.5447	Remote Similarity	NPC232611
0.544	Remote Similarity	NPC256983
0.5426	Remote Similarity	NPC477807
0.5417	Remote Similarity	NPC475182
0.541	Remote Similarity	NPC247037
0.5391	Remote Similarity	NPC94272
0.536	Remote Similarity	NPC476112
0.536	Remote Similarity	NPC307534
0.5317	Remote Similarity	NPC233433
0.5285	Remote Similarity	NPC475550
0.5252	Remote Similarity	NPC329807
0.5242	Remote Similarity	NPC32361
0.5242	Remote Similarity	NPC473518
0.5242	Remote Similarity	NPC13193
0.5238	Remote Similarity	NPC23808
0.5238	Remote Similarity	NPC87998
0.5227	Remote Similarity	NPC79900
0.5214	Remote Similarity	NPC141433
0.5159	Remote Similarity	NPC470864
0.5141	Remote Similarity	NPC481189
0.5124	Remote Similarity	NPC122819
0.5118	Remote Similarity	NPC83137
0.5116	Remote Similarity	NPC167183
0.5115	Remote Similarity	NPC248202
0.5105	Remote Similarity	NPC329727
0.5082	Remote Similarity	NPC249553
0.5082	Remote Similarity	NPC182900
0.505	Remote Similarity	NPC207617
0.505	Remote Similarity	NPC607440
0.5045	Remote Similarity	NPC165439
0.5041	Remote Similarity	NPC128572
0.5038	Remote Similarity	NPC94086
0.5038	Remote Similarity	NPC220836
0.5038	Remote Similarity	NPC473817

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC528936 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7633
0.1-0.2	1439
0.2-0.3	68
0.3-0.4	6
0.4-0.5	2
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6228	Remote Similarity	NPD8450	Suspended
0.5124	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data