NPASS Compound

Natural Product: NPC115439

Natural Product ID	NPC115439
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ZIRMNOUZKRFCMK-FSUXQQLDSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	6325708
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 141148 0 0 0 0 0 0 0 0999 V2000 5.7531 0.3233 4.1024 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7622 1.3267 2.9709 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1300 1.4728 2.3576 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2359 0.7086 1.0493 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2268 -0.4076 0.9931 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8216 0.0742 1.1925 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7694 1.0465 2.1131 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2785 0.4233 -0.0432 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2026 -0.3443 -0.4469 C 0 0 2 0 0 0 0 0 0 0 0 0 3.3647 -1.0137 -1.7560 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4640 -0.5238 -2.8594 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1277 0.9308 -2.7699 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2584 1.4800 -1.5269 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9886 0.5464 -0.4900 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8893 -0.1514 -0.9096 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2239 0.0414 -0.0655 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2083 0.8991 -0.8322 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9788 0.0221 -1.7400 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8044 -1.0628 -1.0870 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7737 -2.2299 -2.0859 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2234 -1.4763 0.2125 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8620 -0.9101 1.4391 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3558 -0.8780 1.4700 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9790 -1.3749 0.1870 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9144 -2.8731 0.2286 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2690 -0.6989 -0.9532 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4659 0.7741 -0.7459 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8820 1.1733 -0.6282 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7877 0.3209 -0.2275 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2124 0.7380 -0.1064 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2477 1.9425 0.8391 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5877 2.6445 0.7595 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8731 3.2752 2.0916 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6674 3.6425 -0.3482 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6904 1.6068 0.5080 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2499 0.3584 1.2016 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1593 -0.3233 0.3367 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6281 -1.4160 1.1762 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1270 -1.4230 1.3529 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4407 -1.0517 0.0797 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9471 -1.9089 -1.0968 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9370 -0.8518 -0.8136 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8472 -0.4566 -1.9878 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8403 -1.8751 -0.5496 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7249 -1.2781 0.3564 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4170 -1.4130 1.8608 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0530 -2.4652 -0.2314 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5418 -3.6260 0.2715 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1509 -0.7519 -4.0647 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0994 -2.3750 -1.5956 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4633 -1.4326 1.8647 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5097 0.4088 0.7271 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0639 0.9869 -0.3755 C 0 0 1 0 0 0 0 0 0 0 0 0 10.1335 1.9615 0.1047 C 0 0 1 0 0 0 0 0 0 0 0 0 11.3115 1.2443 0.7228 C 0 0 2 0 0 0 0 0 0 0 0 0 11.7684 0.2095 -0.3100 C 0 0 1 0 0 0 0 0 0 0 0 0 10.5659 -0.6462 -0.6600 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6469 0.1548 -1.2897 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2085 0.8424 -1.4729 O 0 0 0 0 0 0 0 0 0 0 0 0 13.4670 0.7337 -2.0230 C 0 0 0 0 0 0 0 0 0 0 0 0 14.3050 0.0015 -1.4352 O 0 0 0 0 0 0 0 0 0 0 0 0 13.7968 1.4665 -3.2677 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9079 0.6477 1.8913 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6368 2.7295 -0.9531 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0649 0.9597 3.2463 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9738 -0.4486 3.9377 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5237 0.8231 5.0814 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7760 -0.0875 4.2236 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4752 2.3139 3.4598 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3475 2.5481 2.2677 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8835 1.4265 0.2729 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2368 -0.8878 -0.0342 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2571 -0.8108 1.6255 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0390 -1.0815 0.3777 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4506 -0.9836 -2.0789 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5144 -1.0901 -2.9514 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8267 1.5048 -3.4484 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1175 1.1620 -3.1633 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8170 1.1199 0.4484 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1497 0.7079 0.7539 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7345 1.6138 -0.2169 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5733 1.5427 -1.5198 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1569 -0.4982 -2.3405 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5198 0.5487 -2.5541 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0423 -2.0295 -2.9302 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7340 -2.3366 -2.6329 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3789 -3.1571 -1.6540 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3358 -2.6016 0.2725 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5362 -1.5695 2.2994 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4952 0.0984 1.7304 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7474 0.1317 1.7733 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7776 -1.5559 2.2740 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4315 -3.2682 1.1751 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4876 -3.3751 -0.6260 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9372 -3.3656 0.3182 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8087 -0.9649 -1.8856 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9777 1.1391 0.1891 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0403 1.4022 -1.5472 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1926 2.2137 -0.8952 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5286 1.1145 -1.0935 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9891 1.6474 1.8737 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5057 2.6672 0.4759 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9734 3.2874 2.3224 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3923 2.7519 2.9428 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5340 4.3348 2.1096 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4639 4.3771 -0.0821 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9844 3.1805 -1.3110 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7443 4.2302 -0.4829 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5995 2.0111 0.9652 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8281 1.4252 -0.5645 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7676 0.6361 2.1611 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0593 -0.3550 1.4014 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0243 -1.4216 2.2387 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9182 -2.4276 0.8054 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9097 -0.5882 2.0836 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8044 -2.3355 1.8370 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1072 -2.5304 -1.5332 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6876 -2.6539 -0.7831 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2494 -1.2731 -1.9544 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6410 -2.0209 -1.1559 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7160 -1.4001 1.8835 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6864 -2.3969 2.2497 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7164 -0.5441 2.4385 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0625 -2.3882 0.2257 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0443 -2.4812 -1.3151 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1049 -4.3019 0.5623 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2780 -1.7341 -4.1075 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5792 -2.7857 -0.8594 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4357 -1.5721 1.9208 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2729 1.6525 -0.8320 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7061 2.7088 0.8306 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1112 1.9977 0.8587 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5328 -0.4279 0.1790 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0715 -1.0344 0.2709 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8713 -1.5269 -1.2666 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8793 1.7180 -3.2084 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6326 0.8658 -4.1650 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1798 2.3948 -3.3636 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6886 0.1776 2.2789 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3182 2.3031 -1.7889 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5896 1.6541 3.7154 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 32 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 37 42 1 0 42 43 2 0 42 44 1 0 21 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 11 49 1 0 10 50 1 0 5 51 1 0 4 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 59 60 1 0 60 61 2 0 60 62 1 0 55 63 1 0 54 64 1 0 3 65 1 0 7 2 1 0 14 9 1 0 45 16 1 0 58 53 1 0 26 19 1 0 40 29 1 0 40 24 1 0 37 30 1 0 1 66 1 0 1 67 1 0 1 68 1 0 2 69 1 1 3 70 1 6 4 71 1 6 5 72 1 6 6 73 1 1 9 74 1 1 10 75 1 6 11 76 1 6 12 77 1 0 12 78 1 0 14 79 1 1 16 80 1 0 17 81 1 0 17 82 1 0 18 83 1 0 18 84 1 0 20 85 1 0 20 86 1 0 20 87 1 0 21 88 1 0 22 89 1 0 22 90 1 0 23 91 1 0 23 92 1 0 25 93 1 0 25 94 1 0 25 95 1 0 26 96 1 0 27 97 1 0 27 98 1 0 28 99 1 0 30100 1 0 31101 1 0 31102 1 0 33103 1 0 33104 1 0 33105 1 0 34106 1 0 34107 1 0 34108 1 0 35109 1 0 35110 1 0 36111 1 0 36112 1 0 38113 1 0 38114 1 0 39115 1 0 39116 1 0 41117 1 0 41118 1 0 41119 1 0 44120 1 0 46121 1 0 46122 1 0 46123 1 0 47124 1 0 47125 1 0 48126 1 0 49127 1 0 50128 1 0 51129 1 0 53130 1 6 54131 1 1 55132 1 1 56133 1 1 57134 1 0 57135 1 0 62136 1 0 62137 1 0 62138 1 0 63139 1 0 64140 1 0 65141 1 0 M END

Standard InCHIKey	ZIRMNOUZKRFCMK-FSUXQQLDSA-N
Standard InCHI	InChI=1S/C48H76O17/c1-23-32(52)37(64-39-35(55)34(54)28(21-60-39)62-24(2)50)36(56)40(61-23)65-38-33(53)27(51)20-59-41(38)63-31-12-13-44(5)29(45(31,6)22-49)11-14-47(8)30(44)10-9-25-26-19-43(3,4)15-17-48(26,42(57)58)18-16-46(25,47)7/h9,23,26-41,49,51-56H,10-22H2,1-8H3,(H,57,58)/t23-,26?,27+,28+,29?,30?,31?,32+,33-,34-,35+,36+,37+,38+,39-,40-,41-,44?,45?,46?,47?,48?/m0/s1
SMILES	C[C@H]1[C@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@H]([C@@H](CO[C@H]1OC1CCC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(CCC32C)C(=O)O)C1(C)CO)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H](CO1)OC(=O)C)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	924.51	Volume:	911.837 ? Van der Waals volume.
Dense:	1.014	LogP:	2.056 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.64 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.959 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	46.0
TPSA:	260.59 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	8.0	Rings:	8.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.094	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.337	Fsp³:	0.917
MCE-18:	171.174 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.979	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.031 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.141	Promiscuous compounds:	0.127

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.111	MDCK Permeability:	-5.142
Pgp-inhibitor:	0.0	Pgp-substrate:	0.151
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.006
20% Bioavailability (F20%):	0.0	30% Bioavailability (F30%):	0.013
50% Bioavailability (F50%):	0.913

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.998
Plasma Protein Binding (PPB):	66.468%	Volume Distribution (VD):	-0.519
Fu:	26.289% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.361
OATP1B3 inhibitor:	0.948	BCRP inhibitor:	0.0
BSEP inhibitor:	0.23

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.001	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.096
HLM stability:	0.163 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.236

Half-life (T1/2):

3.901

ADMET: Toxicity

hERG Blockers:	0.005	hERG Blockers (10um):	0.056
Human Hepatotoxicity (H-HT):	0.395	Drug-induced Liver Injury (DILI):	0.468
AMES Toxicity:	0.161	Rat Oral Acute Toxicity:	0.005
Maximum Recommended Daily Dose:	0.059	Skin Sensitization:	0.947
Carcinogencity:	0.003	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.006
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.999
Hematotoxicity:	0.136	Drug-induced Nephrotoxicity:	0.641
Genotoxicity:	0.002	RPMI-8226 Immunitoxicity:	0.074
A549 Cytotoxicity:	0.013	Hek293 Cytotoxicity:	0.05
BCF:	0.549 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.104 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.042 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.464 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	Galls	n.a.	n.a.	PMID[16724837]
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	n.a.	gall	n.a.	PMID[17827775]
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO957	Sapindus mukorossi	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC115439 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20928
0.1-0.2	24668
0.2-0.3	3082
0.3-0.4	780
0.4-0.5	297
0.5-0.6	62
0.6-0.7	22
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8155	Intermediate Similarity	NPC276093
0.7982	Intermediate Similarity	NPC219180
0.7812	Intermediate Similarity	NPC284807
0.7788	Intermediate Similarity	NPC481082
0.7788	Intermediate Similarity	NPC164419
0.7727	Intermediate Similarity	NPC133818
0.757	Intermediate Similarity	NPC324875
0.757	Intermediate Similarity	NPC292677
0.7568	Intermediate Similarity	NPC323341
0.7525	Intermediate Similarity	NPC174679
0.7525	Intermediate Similarity	NPC279554
0.75	Intermediate Similarity	NPC161717
0.7203	Intermediate Similarity	NPC471385
0.7193	Intermediate Similarity	NPC251263
0.7184	Intermediate Similarity	NPC59804
0.7043	Intermediate Similarity	NPC166422
0.6857	Remote Similarity	NPC56713
0.6727	Remote Similarity	NPC139044
0.6727	Remote Similarity	NPC471383
0.6639	Remote Similarity	NPC54636
0.6636	Remote Similarity	NPC127056
0.6604	Remote Similarity	NPC136877
0.6522	Remote Similarity	NPC475486
0.6436	Remote Similarity	NPC28198
0.6436	Remote Similarity	NPC476123
0.6415	Remote Similarity	NPC270667
0.6339	Remote Similarity	NPC104400
0.6339	Remote Similarity	NPC10320
0.6296	Remote Similarity	NPC12288
0.6286	Remote Similarity	NPC473538
0.6228	Remote Similarity	NPC257468
0.6207	Remote Similarity	NPC323359
0.6186	Remote Similarity	NPC280941
0.6186	Remote Similarity	NPC235772
0.6126	Remote Similarity	NPC488561
0.6106	Remote Similarity	NPC114304
0.6087	Remote Similarity	NPC475504
0.6018	Remote Similarity	NPC469945
0.5984	Remote Similarity	NPC471384
0.5891	Remote Similarity	NPC298034
0.5891	Remote Similarity	NPC71065
0.5882	Remote Similarity	NPC488564
0.5868	Remote Similarity	NPC476992
0.5865	Remote Similarity	NPC204407
0.5814	Remote Similarity	NPC202828
0.5814	Remote Similarity	NPC119592
0.5812	Remote Similarity	NPC73829
0.581	Remote Similarity	NPC283849
0.5804	Remote Similarity	NPC25605
0.5794	Remote Similarity	NPC100383
0.5776	Remote Similarity	NPC180550
0.5776	Remote Similarity	NPC35405
0.5763	Remote Similarity	NPC119794
0.5702	Remote Similarity	NPC6377
0.5702	Remote Similarity	NPC208381
0.5676	Remote Similarity	NPC164194
0.5652	Remote Similarity	NPC80843
0.5645	Remote Similarity	NPC79643
0.563	Remote Similarity	NPC79718
0.5615	Remote Similarity	NPC293330
0.5565	Remote Similarity	NPC472949
0.5556	Remote Similarity	NPC123199
0.5492	Remote Similarity	NPC488209
0.5478	Remote Similarity	NPC114441
0.5462	Remote Similarity	NPC91838
0.5455	Remote Similarity	NPC120840
0.5447	Remote Similarity	NPC481078
0.5446	Remote Similarity	NPC475611
0.542	Remote Similarity	NPC41061
0.542	Remote Similarity	NPC227551
0.5414	Remote Similarity	NPC261506
0.5414	Remote Similarity	NPC4328
0.5378	Remote Similarity	NPC473383
0.5372	Remote Similarity	NPC488515
0.537	Remote Similarity	NPC606107
0.536	Remote Similarity	NPC288205
0.536	Remote Similarity	NPC51465
0.5345	Remote Similarity	NPC109079
0.5338	Remote Similarity	NPC236638
0.5338	Remote Similarity	NPC294453
0.5338	Remote Similarity	NPC305981
0.5333	Remote Similarity	NPC488212
0.5317	Remote Similarity	NPC475287
0.5317	Remote Similarity	NPC76972
0.5317	Remote Similarity	NPC469782
0.5317	Remote Similarity	NPC204414
0.5308	Remote Similarity	NPC488211
0.5285	Remote Similarity	NPC218954
0.528	Remote Similarity	NPC62725
0.5263	Remote Similarity	NPC127853
0.5263	Remote Similarity	NPC65105
0.5254	Remote Similarity	NPC22956
0.5242	Remote Similarity	NPC187618
0.5221	Remote Similarity	NPC220160
0.5221	Remote Similarity	NPC191410
0.5182	Remote Similarity	NPC177246
0.5113	Remote Similarity	NPC110633
0.5078	Remote Similarity	NPC313110
0.5041	Remote Similarity	NPC275668
0.504	Remote Similarity	NPC486564

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC115439 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6401
0.1-0.2	2704
0.2-0.3	40
0.3-0.4	4
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data