NPASS Compound

Natural Product: NPC65708

Natural Product ID	NPC65708
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	BXKCSGRUPJSGIF-NLBSSAROSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	441937
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 113120 0 0 0 0 0 0 0 0999 V2000 1.9449 0.6427 -1.3129 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2579 -0.6618 -0.9888 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4836 -1.5326 -2.2393 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2031 -0.4236 -0.8295 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6414 0.9561 -1.2498 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1332 1.0486 -1.4324 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9243 0.4575 -0.3105 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1395 1.6192 0.6757 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2882 -0.6728 0.3875 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9528 -1.0932 1.6654 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4162 -1.0947 1.4619 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0466 -0.6285 0.3946 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5103 -0.7033 0.3446 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0822 -1.2392 -0.9672 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4099 -0.0722 -1.8293 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2817 -0.1772 -3.2728 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8160 0.4212 -1.4056 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5731 0.5720 0.0713 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0471 0.7246 0.2468 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5947 1.0319 -1.1358 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1427 0.9878 -1.4394 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2958 -0.0203 -0.7686 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0503 -1.2230 -1.6998 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7275 1.6098 1.3186 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2190 2.7439 1.2145 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9991 1.1954 2.6312 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7652 -0.6770 0.5162 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3524 0.2529 1.6037 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3983 -2.0909 0.9222 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0144 -2.3955 0.7917 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9195 -1.3658 0.1419 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5257 -0.5607 1.0948 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9016 -0.8053 1.2765 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7049 0.4425 1.2035 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0287 1.0354 2.5634 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5123 -0.0222 3.5260 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3975 -1.4042 2.8602 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6888 -2.4121 3.9051 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8336 -2.5451 4.4103 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6755 -3.2373 4.3449 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0751 -1.5036 2.4951 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7980 0.1952 3.9754 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9108 1.6371 3.1295 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8124 0.2502 0.4308 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9477 0.9992 -0.7132 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1496 1.9128 -0.5275 C 0 0 1 0 0 0 0 0 0 0 0 0 8.4376 1.1721 -0.8801 C 0 0 2 0 0 0 0 0 0 0 0 0 8.3034 0.6947 -2.2990 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8745 0.7121 -2.7839 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9476 0.2901 -1.8761 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0956 1.5015 -3.1104 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6543 0.1173 0.0076 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1014 3.0451 -1.3316 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0571 0.5289 -1.3141 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7292 0.8645 -2.3955 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7295 1.4480 -0.6249 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6415 -1.4277 -2.9471 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5068 -2.6017 -1.9446 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4673 -1.3123 -2.6886 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7306 -1.0943 -1.5555 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2612 1.7726 -0.6078 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2184 1.1409 -2.2646 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4775 0.6337 -2.3887 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3425 2.1526 -1.5204 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5415 1.3218 1.6322 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1663 2.2148 0.7421 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8207 2.3851 0.2530 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4370 -1.5822 -0.2851 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6870 -2.1839 1.8301 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6267 -0.5962 2.5728 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0141 -1.5238 2.2810 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9213 -1.2269 1.2221 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0605 -1.7234 -0.6510 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5236 -2.0522 -1.4101 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8202 -1.1181 -3.6080 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6999 0.6594 -3.7085 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2941 -0.0768 -3.7934 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9592 1.4094 -1.9175 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5875 -0.3215 -1.6443 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9571 -0.3142 0.5842 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0220 1.5219 0.4509 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9988 2.0087 -1.4333 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7476 2.0238 -1.4203 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0828 0.7384 -2.5527 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0242 -1.2391 -2.1172 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6841 -1.1641 -2.6149 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1552 -2.1910 -1.1712 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2125 1.8347 3.3850 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1804 0.7279 2.1707 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2008 -0.3555 2.3817 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3158 1.0554 1.3013 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6837 -2.1393 2.0211 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0937 -2.8176 0.4467 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4357 -2.7014 1.7993 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0823 -3.3839 0.2258 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7612 -2.0068 -0.2642 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1666 -1.5672 0.5152 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0811 1.2109 0.7076 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8106 1.8142 2.5196 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8420 -0.0586 4.4047 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0706 -1.4624 2.0011 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8292 -4.1223 4.8354 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9142 -0.1023 4.9104 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0648 1.3474 2.7028 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0559 1.6785 -0.7619 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2045 2.2785 0.5289 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2868 1.8655 -0.8085 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7482 -0.3261 -2.3684 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8746 0.0607 -3.7055 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6686 1.7330 -3.1893 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8041 2.4492 -3.1116 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2467 0.3687 0.8759 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4502 3.8369 -0.8469 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 1 7 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 6 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 6 19 24 1 1 24 25 2 0 24 26 1 0 9 27 1 0 27 28 1 1 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 38 40 1 0 37 41 1 0 36 42 1 0 35 43 1 0 34 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 48 51 1 0 47 52 1 0 46 53 1 0 31 2 1 0 41 33 1 0 50 45 1 0 27 4 1 0 22 7 1 0 22 12 1 0 19 13 1 0 20 15 1 0 1 54 1 0 1 55 1 0 1 56 1 0 3 57 1 0 3 58 1 0 3 59 1 0 4 60 1 6 5 61 1 0 5 62 1 0 6 63 1 0 6 64 1 0 8 65 1 0 8 66 1 0 8 67 1 0 9 68 1 6 10 69 1 0 10 70 1 0 11 71 1 0 13 72 1 1 14 73 1 0 14 74 1 0 16 75 1 0 16 76 1 0 16 77 1 0 17 78 1 0 17 79 1 0 18 80 1 0 18 81 1 0 20 82 1 6 21 83 1 0 21 84 1 0 23 85 1 0 23 86 1 0 23 87 1 0 26 88 1 0 28 89 1 0 28 90 1 0 28 91 1 0 29 92 1 0 29 93 1 0 30 94 1 0 30 95 1 0 31 96 1 6 33 97 1 6 34 98 1 6 35 99 1 6 36100 1 1 37101 1 6 40102 1 0 42103 1 0 43104 1 0 45105 1 6 46106 1 1 47107 1 6 48108 1 1 49109 1 0 49110 1 0 51111 1 0 52112 1 0 53113 1 0 M END

Standard InCHIKey	BXKCSGRUPJSGIF-NLBSSAROSA-N
Standard InCHI	InChI=1S/C40H60O13/c1-35(2)21-9-12-38(5)22(8-7-18-19-15-36(3)13-14-40(19,34(48)49)23(36)16-39(18,38)6)37(21,4)11-10-24(35)51-33-30(27(44)26(43)29(52-33)31(46)47)53-32-28(45)25(42)20(41)17-50-32/h7,19-30,32-33,41-45H,8-17H2,1-6H3,(H,46,47)(H,48,49)/t19-,20+,21-,22+,23-,24-,25-,26-,27-,28+,29-,30+,32-,33+,36+,37-,38+,39+,40+/m0/s1
SMILES	CC1(C)[C@@H]2CC[C@]3(C)[C@H](CC=C4[C@@H]5C[C@@]6(C)CC[C@@]5([C@H]6C[C@@]34C)C(=O)O)[C@@]2(C)CC[C@@H]1O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO12302	Hebanthe paniculata	Species	Amaranthaceae	Eukaryota	n.a.	root	n.a.	PMID[19941264]
NPO12302	Hebanthe paniculata	Species	Amaranthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO12302	Hebanthe paniculata	Species	Amaranthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC65708 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22673
0.1-0.2	23474
0.2-0.3	2598
0.3-0.4	739
0.4-0.5	268
0.5-0.6	85
0.6-0.7	15
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.6634	Remote Similarity	NPC309780
0.6505	Remote Similarity	NPC472949
0.6422	Remote Similarity	NPC301449
0.6422	Remote Similarity	NPC601290
0.6346	Remote Similarity	NPC488561
0.6321	Remote Similarity	NPC471965
0.6321	Remote Similarity	NPC482749
0.6226	Remote Similarity	NPC469945
0.6186	Remote Similarity	NPC283849
0.6091	Remote Similarity	NPC484832
0.6038	Remote Similarity	NPC6377
0.6038	Remote Similarity	NPC208381
0.6	Remote Similarity	NPC481082
0.6	Remote Similarity	NPC164419
0.6	Remote Similarity	NPC242611
0.5963	Remote Similarity	NPC104400
0.5963	Remote Similarity	NPC10320
0.5943	Remote Similarity	NPC482748
0.5849	Remote Similarity	NPC56713
0.5818	Remote Similarity	NPC251768
0.5804	Remote Similarity	NPC488515
0.5794	Remote Similarity	NPC127056
0.5743	Remote Similarity	NPC286347
0.569	Remote Similarity	NPC280941
0.569	Remote Similarity	NPC235772
0.5688	Remote Similarity	NPC80843
0.5664	Remote Similarity	NPC64715
0.5641	Remote Similarity	NPC288205
0.5641	Remote Similarity	NPC51465
0.5614	Remote Similarity	NPC37134
0.5596	Remote Similarity	NPC488516
0.5575	Remote Similarity	NPC73829
0.5565	Remote Similarity	NPC291903
0.5545	Remote Similarity	NPC482747
0.5545	Remote Similarity	NPC202666
0.5545	Remote Similarity	NPC471961
0.5545	Remote Similarity	NPC28198
0.5545	Remote Similarity	NPC242015
0.5545	Remote Similarity	NPC476123
0.5526	Remote Similarity	NPC79718
0.5508	Remote Similarity	NPC475119
0.5472	Remote Similarity	NPC480938
0.5462	Remote Similarity	NPC200788
0.5462	Remote Similarity	NPC473824
0.5455	Remote Similarity	NPC166422
0.5431	Remote Similarity	NPC75318
0.5421	Remote Similarity	NPC164194
0.5405	Remote Similarity	NPC22956
0.5391	Remote Similarity	NPC262199
0.5385	Remote Similarity	NPC100383
0.5372	Remote Similarity	NPC243680
0.536	Remote Similarity	NPC488308
0.5345	Remote Similarity	NPC145899
0.5339	Remote Similarity	NPC187290
0.5317	Remote Similarity	NPC312650
0.5315	Remote Similarity	NPC482751
0.5299	Remote Similarity	NPC324875
0.5299	Remote Similarity	NPC218954
0.5299	Remote Similarity	NPC292677
0.5294	Remote Similarity	NPC480939
0.5285	Remote Similarity	NPC283417
0.5285	Remote Similarity	NPC200049
0.5273	Remote Similarity	NPC174679
0.5273	Remote Similarity	NPC25605
0.5273	Remote Similarity	NPC279554
0.5273	Remote Similarity	NPC59804
0.5254	Remote Similarity	NPC187618
0.5246	Remote Similarity	NPC471384
0.5238	Remote Similarity	NPC265841
0.5231	Remote Similarity	NPC488309
0.5225	Remote Similarity	NPC275343
0.521	Remote Similarity	NPC475486
0.5197	Remote Similarity	NPC271610
0.5192	Remote Similarity	NPC177246
0.5172	Remote Similarity	NPC257468
0.5169	Remote Similarity	NPC477075
0.5169	Remote Similarity	NPC477076
0.5169	Remote Similarity	NPC477079
0.5161	Remote Similarity	NPC475140
0.5135	Remote Similarity	NPC482750
0.5133	Remote Similarity	NPC469946
0.5126	Remote Similarity	NPC477077
0.5126	Remote Similarity	NPC477078
0.5096	Remote Similarity	NPC606107
0.5091	Remote Similarity	NPC482726
0.5089	Remote Similarity	NPC114441
0.5089	Remote Similarity	NPC480424
0.5088	Remote Similarity	NPC192791
0.5082	Remote Similarity	NPC313110
0.5081	Remote Similarity	NPC219180
0.5081	Remote Similarity	NPC257211
0.5079	Remote Similarity	NPC4749
0.5078	Remote Similarity	NPC258617
0.5043	Remote Similarity	NPC482734
0.5043	Remote Similarity	NPC182342
0.5043	Remote Similarity	NPC114304
0.5043	Remote Similarity	NPC482727
0.5043	Remote Similarity	NPC471964
0.504	Remote Similarity	NPC602995
0.5039	Remote Similarity	NPC470518

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC65708 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6710
0.1-0.2	2400
0.2-0.3	35
0.3-0.4	3
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5545	Remote Similarity	NPD8328	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data