NPASS Compound

Natural Product: NPC590699

Natural Product ID	NPC590699
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Protogracillin
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{S},6~{R})-5-hydroxy-6-(hydroxymethyl)-2-[[(1~{S},2~{S},4~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{R},16~{S})-6-hydroxy-7,9,13-trimethyl-6-[(3~{R})-3-methyl-4-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-butyl]-5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-en-16-yl]oxy]-4-[(2~{S},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 158166 0 0 0 0 0 0 0 0999 V2000 8.6141 1.8385 -0.4470 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1057 1.6255 -1.8270 C 0 0 2 0 0 0 0 0 0 0 0 0 8.9201 0.3116 -2.4646 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5783 -0.2358 -2.6943 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7054 -0.4904 -1.5351 C 0 0 1 0 0 0 0 0 0 0 0 0 7.2363 -1.3775 -0.6062 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0705 0.6010 -1.0058 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0795 0.1326 -0.1566 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7686 0.9168 -0.2946 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8253 -0.1574 0.1342 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3643 0.1293 -0.0397 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9252 1.3137 0.7679 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5402 1.4029 0.7602 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3339 0.3932 0.5624 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7984 0.6095 0.5797 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3596 -0.1682 1.7244 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6139 -0.6858 1.4433 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6208 -0.2459 2.2285 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2144 -1.3305 2.9605 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7193 -0.7141 4.1093 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1649 -1.7009 5.1386 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6490 -0.9978 6.2386 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8354 0.1859 3.7141 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.0208 -0.3161 4.2691 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0533 0.3004 2.2150 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7888 -0.8274 1.8607 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0022 -0.4966 1.3164 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.9977 -0.9920 2.1985 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1711 -0.3460 1.8522 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.2590 -0.8324 2.8028 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.8800 -0.5130 4.0896 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.6311 -0.6431 0.4542 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.4844 0.4122 0.0635 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5326 -0.7022 -0.5560 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.9557 -1.5383 -1.5978 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2316 -1.2326 0.0188 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2239 -1.0883 -0.9024 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7627 0.2870 1.4221 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5358 1.5118 0.8130 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6627 1.4772 -0.5798 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4423 1.7848 -1.1972 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4973 1.4018 -2.5129 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8573 0.0335 -2.7346 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9071 1.2839 -3.0358 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8218 1.4034 -4.4329 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8108 2.3802 -2.5478 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.1238 2.0027 -2.8738 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6822 2.4888 -1.0485 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9242 2.2543 -0.4949 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4097 -1.1954 2.2781 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5986 -1.9053 1.2438 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8580 -0.9662 0.3136 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2439 -1.4225 -1.1056 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6384 -1.0834 0.4938 C 0 0 1 0 0 0 0 0 0 0 0 0 1.1146 -2.3888 -0.0757 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5891 -2.5225 -0.2044 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2001 -1.2769 -0.8013 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7492 -1.1122 -2.2076 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6977 -1.2568 -0.6921 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4148 -1.2470 -2.0248 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7744 -2.5983 -2.5350 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5993 2.0337 -1.8237 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2878 1.2349 -0.9094 O 0 0 0 0 0 0 0 0 0 0 0 0 12.6403 1.5545 -0.8489 C 0 0 2 0 0 0 0 0 0 0 0 0 13.3335 0.3934 -1.1473 O 0 0 0 0 0 0 0 0 0 0 0 0 14.6744 0.4243 -0.7839 C 0 0 2 0 0 0 0 0 0 0 0 0 15.2391 -0.9629 -1.0928 C 0 0 0 0 0 0 0 0 0 0 0 0 16.6028 -1.0059 -0.7490 O 0 0 0 0 0 0 0 0 0 0 0 0 14.8533 0.6304 0.7079 C 0 0 1 0 0 0 0 0 0 0 0 0 15.6755 1.7299 0.9339 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5095 0.9757 1.3590 C 0 0 2 0 0 0 0 0 0 0 0 0 12.6702 -0.1273 1.1956 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9342 2.0988 0.5136 C 0 0 1 0 0 0 0 0 0 0 0 0 13.7862 3.2008 0.4860 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4479 0.9327 0.1627 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7456 2.5604 -0.3885 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3971 2.4072 0.1756 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6363 2.4137 -2.4808 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4028 0.4039 -3.5018 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6073 -0.4457 -1.9792 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0309 0.4154 -3.4303 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7257 -1.2432 -3.2068 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2260 -1.4105 -0.6201 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3906 0.0658 0.8985 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6680 1.2521 -1.3258 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7752 1.7965 0.4001 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0789 -0.4682 1.1609 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1615 0.3375 -1.0891 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3604 1.3233 1.7896 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3267 2.2211 0.2259 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9869 2.4148 0.9380 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2752 0.3704 -0.3901 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9804 1.7168 0.6954 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5211 0.5480 2.5569 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3187 0.5348 2.9720 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9180 -0.0623 4.5721 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9829 -2.3218 4.7230 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3157 -2.3263 5.4855 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6039 -1.5578 7.0684 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7012 1.2139 4.0960 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2433 0.2245 5.0523 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5919 1.2366 1.9751 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2092 0.5799 1.2369 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0017 0.7377 1.9824 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.2071 -0.3311 2.5008 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3417 -1.9403 2.6985 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2571 0.2448 4.0565 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2619 -1.5531 0.4359 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4741 1.1528 0.7170 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3291 0.2889 -0.9994 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8652 -1.3303 -1.8880 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3784 -2.3186 0.2180 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5767 -0.9688 -1.8090 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9429 -0.4390 0.5728 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9654 0.4592 -0.8677 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9572 2.1268 -3.1743 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3683 -0.5377 -3.5374 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9917 -0.5944 -1.8081 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7770 0.1233 -2.9841 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3197 0.2768 -2.8577 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7294 1.6381 -4.7456 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5678 3.3620 -3.0265 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7631 2.3804 -2.2165 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3282 3.5371 -0.8111 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0727 2.8904 0.2619 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7164 -0.7613 3.0262 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0127 -1.9564 2.8114 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2221 -2.6375 0.6946 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8226 -2.5002 1.7651 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5453 -1.0574 -1.8573 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3353 -2.5512 -1.0780 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2883 -1.0934 -1.2795 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8385 -1.1149 1.5887 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6771 -2.6246 -1.0736 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7585 -3.1941 0.6108 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8150 -3.4092 -0.8284 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0357 -2.6719 0.7964 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7934 -0.0759 -2.5994 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3905 -1.8022 -2.8356 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7235 -1.4885 -2.3995 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1090 -2.0581 -0.0784 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9884 -0.5535 -2.7581 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8148 -2.8280 -2.2207 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8191 -2.5296 -3.6563 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0682 -3.3983 -2.2230 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0223 1.8759 -2.8205 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6401 3.0969 -1.5655 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8611 2.3938 -1.5704 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2646 1.1366 -1.3941 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7379 -1.7119 -0.4232 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1099 -1.2428 -2.1577 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1098 -0.9597 -1.5964 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2548 -0.2505 1.2101 H 0 0 0 0 0 0 0 0 0 0 0 0 16.4783 1.4124 1.4151 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6326 1.2630 2.4054 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1122 -0.9762 1.3904 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9863 2.4608 0.9617 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0881 3.4134 1.3973 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 1 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 20 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 29 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 25 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 16 50 1 0 50 51 1 0 51 52 1 0 52 53 1 6 52 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 6 57 59 1 0 59 60 1 0 60 61 1 0 2 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 66 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 71 73 1 0 73 74 1 0 60 5 1 0 73 64 1 0 59 8 1 0 57 10 1 0 54 11 1 0 52 14 1 0 38 18 1 0 48 40 1 0 36 27 1 0 1 75 1 0 1 76 1 0 1 77 1 0 2 78 1 6 3 79 1 0 3 80 1 0 4 81 1 0 4 82 1 0 6 83 1 0 8 84 1 1 9 85 1 0 9 86 1 0 10 87 1 1 11 88 1 6 12 89 1 0 12 90 1 0 13 91 1 0 15 92 1 0 15 93 1 0 16 94 1 1 18 95 1 1 20 96 1 1 21 97 1 0 21 98 1 0 22 99 1 0 23100 1 1 24101 1 0 25102 1 1 27103 1 6 29104 1 6 30105 1 0 30106 1 0 31107 1 0 32108 1 1 33109 1 0 34110 1 6 35111 1 0 36112 1 1 37113 1 0 38114 1 6 40115 1 1 42116 1 6 43117 1 0 43118 1 0 43119 1 0 44120 1 6 45121 1 0 46122 1 6 47123 1 0 48124 1 6 49125 1 0 50126 1 0 50127 1 0 51128 1 0 51129 1 0 53130 1 0 53131 1 0 53132 1 0 54133 1 1 55134 1 0 55135 1 0 56136 1 0 56137 1 0 58138 1 0 58139 1 0 58140 1 0 59141 1 1 60142 1 6 61143 1 0 61144 1 0 61145 1 0 62146 1 0 62147 1 0 64148 1 6 66149 1 6 67150 1 0 67151 1 0 68152 1 0 69153 1 1 70154 1 0 71155 1 1 72156 1 0 73157 1 1 74158 1 0 M END

Standard InCHIKey	GMCGZPQYTRHQRU-ZFPKZURZSA-N
Standard InCHI	InChI=1S/C51H84O23/c1-20(19-66-45-40(62)38(60)34(56)29(16-52)69-45)8-13-51(65)21(2)32-28(74-51)15-27-25-7-6-23-14-24(9-11-49(23,4)26(25)10-12-50(27,32)5)68-48-44(73-46-41(63)37(59)33(55)22(3)67-46)43(36(58)31(18-54)71-48)72-47-42(64)39(61)35(57)30(17-53)70-47/h6,20-22,24-48,52-65H,7-19H2,1-5H3/t20-,21+,22+,24+,25-,26+,27+,28+,29-,30-,31-,32+,33+,34-,35-,36+,37-,38+,39+,40-,41-,42-,43+,44-,45-,46+,47+,48-,49+,50+,51-/m1/s1
SMILES	C[C@H](CC[C@@]1(O)O[C@H]2C[C@H]3[C@@H]4CC=C5C[C@@H](O[C@@H]6O[C@H](CO)[C@H](O)[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@H]6O[C@@H]6O[C@@H](C)[C@H](O)[C@@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]2[C@@H]1C)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1064.54	Volume:	1013.182 ? Van der Waals volume.
Dense:	1.051	LogP:	0.85 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.695 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.104 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	48.0
TPSA:	366.29 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	14.0	Rings:	9.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.073	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.802	Fsp³:	0.961
MCE-18:	178.1 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.56	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.313	Promiscuous compounds:	0.036

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.746	MDCK Permeability:	-5.135
Pgp-inhibitor:	0.0	Pgp-substrate:	0.986
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.09
20% Bioavailability (F20%):	0.09	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.004
Plasma Protein Binding (PPB):	44.472%	Volume Distribution (VD):	-0.374
Fu:	38.166% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.062
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.065	CYP3A4-substrate:	0.504
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.81
HLM stability:	0.085 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.434

Half-life (T1/2):

3.61

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.005
Human Hepatotoxicity (H-HT):	0.486	Drug-induced Liver Injury (DILI):	0.917
AMES Toxicity:	0.979	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.011	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.564	Drug-induced Nephrotoxicity:	0.962
Genotoxicity:	0.006	RPMI-8226 Immunitoxicity:	0.291
A549 Cytotoxicity:	0.98	Hek293 Cytotoxicity:	0.851
BCF:	1.39 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.336 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.49 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.738 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO59884	Solanum sodomaeum	Genus	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC590699 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23922
0.1-0.2	22197
0.2-0.3	2801
0.3-0.4	727
0.4-0.5	102
0.5-0.6	56
0.6-0.7	35
0.7-0.8	0
0.8-0.85	5
0.85-0.9	0
0.9-0.95	2
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC102016
1.0	High Similarity	NPC95051
0.9479	High Similarity	NPC218571
0.9479	High Similarity	NPC487615
0.8438	Intermediate Similarity	NPC98696
0.8384	Intermediate Similarity	NPC73243
0.8384	Intermediate Similarity	NPC244086
0.8384	Intermediate Similarity	NPC84956
0.8218	Intermediate Similarity	NPC247037
0.7981	Intermediate Similarity	NPC249265
0.7905	Intermediate Similarity	NPC23808
0.7905	Intermediate Similarity	NPC87998
0.7619	Intermediate Similarity	NPC309278
0.7308	Intermediate Similarity	NPC300557
0.7115	Intermediate Similarity	NPC602423
0.6916	Remote Similarity	NPC150057
0.6916	Remote Similarity	NPC147753
0.6759	Remote Similarity	NPC475182
0.6697	Remote Similarity	NPC98018
0.6697	Remote Similarity	NPC284104
0.6697	Remote Similarity	NPC103616
0.6667	Remote Similarity	NPC476538
0.6667	Remote Similarity	NPC476539
0.6577	Remote Similarity	NPC470863
0.646	Remote Similarity	NPC194207
0.646	Remote Similarity	NPC22779
0.6429	Remote Similarity	NPC486386
0.6381	Remote Similarity	NPC485601
0.6337	Remote Similarity	NPC485602
0.6316	Remote Similarity	NPC254255
0.6293	Remote Similarity	NPC84111
0.6293	Remote Similarity	NPC287483
0.6293	Remote Similarity	NPC470865
0.6275	Remote Similarity	NPC291203
0.6275	Remote Similarity	NPC217205
0.6195	Remote Similarity	NPC51520
0.6195	Remote Similarity	NPC303069
0.6186	Remote Similarity	NPC232054
0.6161	Remote Similarity	NPC480555
0.6161	Remote Similarity	NPC150372
0.6102	Remote Similarity	NPC308140
0.6087	Remote Similarity	NPC470861
0.6071	Remote Similarity	NPC48886
0.6071	Remote Similarity	NPC94881
0.6066	Remote Similarity	NPC477808
0.6055	Remote Similarity	NPC113044
0.6055	Remote Similarity	NPC283829
0.6055	Remote Similarity	NPC161676
0.6019	Remote Similarity	NPC94272
0.6017	Remote Similarity	NPC477811
0.5946	Remote Similarity	NPC486388
0.5941	Remote Similarity	NPC485600
0.5929	Remote Similarity	NPC6806
0.5893	Remote Similarity	NPC470433
0.5893	Remote Similarity	NPC46190
0.5893	Remote Similarity	NPC171073
0.5882	Remote Similarity	NPC92297
0.5882	Remote Similarity	NPC480553
0.5872	Remote Similarity	NPC306991
0.5812	Remote Similarity	NPC475333
0.5812	Remote Similarity	NPC224098
0.5812	Remote Similarity	NPC208383
0.5794	Remote Similarity	NPC476540
0.5794	Remote Similarity	NPC476541
0.5766	Remote Similarity	NPC305423
0.5714	Remote Similarity	NPC480554
0.5645	Remote Similarity	NPC480556
0.5625	Remote Similarity	NPC14704
0.5619	Remote Similarity	NPC181845
0.5593	Remote Similarity	NPC269297
0.5593	Remote Similarity	NPC222202
0.5586	Remote Similarity	NPC470432
0.5586	Remote Similarity	NPC230507
0.5574	Remote Similarity	NPC31896
0.5565	Remote Similarity	NPC248746
0.5565	Remote Similarity	NPC122819
0.5556	Remote Similarity	NPC273002
0.552	Remote Similarity	NPC248202
0.5431	Remote Similarity	NPC477809
0.5417	Remote Similarity	NPC13193
0.5385	Remote Similarity	NPC42171
0.5385	Remote Similarity	NPC263359
0.5364	Remote Similarity	NPC206003
0.5364	Remote Similarity	NPC473610
0.5351	Remote Similarity	NPC470748
0.5349	Remote Similarity	NPC208832
0.5323	Remote Similarity	NPC287885
0.531	Remote Similarity	NPC15249
0.531	Remote Similarity	NPC25455
0.5304	Remote Similarity	NPC475351
0.5271	Remote Similarity	NPC210569
0.5259	Remote Similarity	NPC40440
0.5246	Remote Similarity	NPC197003
0.5242	Remote Similarity	NPC256983
0.5234	Remote Similarity	NPC224314
0.5234	Remote Similarity	NPC165439
0.5221	Remote Similarity	NPC295980
0.5152	Remote Similarity	NPC305771
0.5152	Remote Similarity	NPC94072
0.5152	Remote Similarity	NPC169816
0.5126	Remote Similarity	NPC124677
0.5086	Remote Similarity	NPC485599
0.5047	Remote Similarity	NPC242748
0.5043	Remote Similarity	NPC125324
0.5041	Remote Similarity	NPC116756
0.504	Remote Similarity	NPC486383

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC590699 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7641
0.1-0.2	1429
0.2-0.3	71
0.3-0.4	6
0.4-0.5	1
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6916	Remote Similarity	NPD8450	Suspended
0.5565	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data