NPASS Compound

Natural Product: NPC182616

Natural Product ID	NPC182616
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	YQQPOCSAGKUABB-YRGOWXAZSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	101638318
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 143150 0 0 0 0 0 0 0 0999 V2000 -6.1703 0.6944 4.1449 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1969 0.1996 3.1720 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5777 0.2671 3.8217 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.5135 -0.4783 2.8998 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.3984 0.0372 1.4785 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9716 0.2468 1.0523 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2600 0.9819 2.0161 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2684 -0.9065 0.8046 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8284 -1.0114 -0.5196 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5439 -2.2078 -1.1034 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8509 -2.5939 -2.3887 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4091 -2.8851 -2.0866 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0343 -2.4711 -0.8322 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3304 -1.1218 -0.5985 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.7979 -0.2988 -1.5584 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8117 0.5725 -1.0998 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3561 2.0032 -1.2755 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7978 2.1419 -2.7090 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7002 1.5628 -3.6105 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4879 2.5230 -4.7195 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4124 2.7762 -5.5395 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2728 3.1894 -4.9145 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1409 4.1048 -6.0090 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5018 1.5009 -2.8794 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6012 0.4247 -1.9492 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4587 0.3851 -1.2069 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6190 -0.6926 -1.4230 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5776 -0.0590 -2.1584 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3671 0.8455 -1.3023 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7165 0.3517 0.0807 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0283 1.2785 1.0574 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2482 -1.0522 0.1839 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6287 -1.6325 1.4919 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1450 -1.8677 1.4202 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8398 -0.5691 1.1711 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9491 0.1159 2.5356 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2218 0.3596 0.2029 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8167 1.7340 0.3526 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2842 1.6029 0.4460 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9701 0.4820 0.5828 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4705 0.5155 0.6679 C 0 0 2 0 0 0 0 0 0 0 0 0 8.0869 0.0762 -0.5973 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5714 -0.2124 -0.4857 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4225 1.0117 -0.4771 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9494 -1.0101 -1.7440 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8456 -1.1104 0.6726 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3971 -0.4487 1.9261 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9054 -0.1639 1.9234 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7266 0.8664 3.0584 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1179 -1.3621 2.3236 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0352 -1.8224 1.4401 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2671 -0.8427 0.6580 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1302 -1.3725 -0.7666 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1324 0.6817 2.2724 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1891 -1.3157 -0.1604 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1898 -2.8575 -0.4346 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1379 -1.1952 0.9966 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3500 -1.8384 0.6456 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9537 1.4320 -2.9639 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2793 2.8413 -1.0178 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8977 -1.4937 -3.2533 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8281 -1.7910 -1.4654 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0767 1.2476 1.4220 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8471 -0.3459 3.3062 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5906 -0.3719 5.0596 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4878 0.3576 5.1561 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1941 0.2562 3.8710 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1050 1.7994 4.0673 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0197 -0.8609 2.8818 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9180 1.3270 3.8949 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2628 -1.5445 2.8754 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8819 -0.6816 0.8067 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0023 0.8206 0.0931 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1644 -0.1168 -1.0761 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5690 -3.0753 -0.4116 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3455 -3.4742 -2.8648 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2129 -3.9739 -2.1511 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7216 -2.4082 -2.8321 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8943 -0.9135 0.4097 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6128 0.4169 -0.0036 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1919 2.1717 -0.5609 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9177 3.2314 -2.9383 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9935 0.6007 -4.0401 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2985 4.7806 -5.8545 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8859 3.4535 -6.8933 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1078 4.6065 -6.2193 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6691 -0.5273 -2.5385 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1004 -1.3774 -2.1381 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2169 -0.9030 -2.4710 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2480 0.4470 -3.0776 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3185 1.0767 -1.8396 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8295 1.8239 -1.2669 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5778 2.2139 1.2338 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7798 0.8413 2.0208 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0368 1.6354 0.6428 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8393 -1.6252 -0.6006 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4756 -1.0128 2.3797 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1637 -2.6462 1.5958 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3900 -2.6948 0.7649 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3826 -2.2123 2.4720 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8601 0.6958 2.6575 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0631 0.7816 2.7227 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8756 -0.6544 3.3603 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5830 0.0418 -0.8270 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5209 2.2450 1.2989 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5890 2.3841 -0.5244 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8619 2.5336 0.3959 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7671 1.6054 0.7899 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6554 -0.7737 -1.1147 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0174 0.9303 -1.3369 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8514 1.9466 -0.2945 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2525 0.8627 0.2431 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9435 1.1572 -1.4682 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8733 -0.2915 -2.5878 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1100 -1.7442 -1.8808 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9274 -1.4825 -1.6398 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2688 -2.0395 0.5462 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9398 -1.2917 0.7416 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5474 -1.2090 2.7516 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9470 0.5235 3.7715 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4208 1.8541 2.6721 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6440 0.9763 3.6670 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8520 -2.2155 2.4523 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7096 -1.2757 3.3780 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3468 -2.4699 2.0645 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4857 -2.5941 0.7404 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3425 -0.6363 -1.5368 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1399 -1.8910 -0.9292 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8448 -2.2379 -0.9342 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7258 1.5321 2.0491 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9793 -3.1035 -1.1480 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7772 -3.1668 -0.8716 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3510 -3.4189 0.4844 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7780 -1.7407 1.8844 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4400 -0.1526 1.2265 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8520 -2.1026 1.4566 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7749 1.9646 -2.7901 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1149 3.4763 -1.7669 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3322 -1.7442 -4.1152 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6880 -0.9409 -1.9868 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4841 1.9465 1.0519 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3070 0.2700 2.7046 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5430 -0.6432 5.2166 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 20 22 1 0 22 23 1 0 19 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 1 30 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 1 35 37 1 0 37 38 1 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 43 46 1 0 46 47 1 0 47 48 1 0 48 49 1 1 48 50 1 0 50 51 1 0 51 52 1 0 52 53 1 6 47 54 1 0 32 55 1 0 55 56 1 6 55 57 1 0 57 58 1 0 18 59 1 0 17 60 1 0 11 61 1 0 10 62 1 0 5 63 1 0 4 64 1 0 3 65 1 0 7 2 1 0 14 9 1 0 25 16 1 0 55 27 1 0 37 30 1 0 52 40 1 0 52 35 1 0 48 41 1 0 1 66 1 0 1 67 1 0 1 68 1 0 2 69 1 6 3 70 1 1 4 71 1 6 5 72 1 6 6 73 1 6 9 74 1 6 10 75 1 1 11 76 1 6 12 77 1 0 12 78 1 0 14 79 1 1 16 80 1 1 17 81 1 1 18 82 1 6 19 83 1 6 23 84 1 0 23 85 1 0 23 86 1 0 25 87 1 6 27 88 1 6 28 89 1 0 28 90 1 0 29 91 1 0 29 92 1 0 31 93 1 0 31 94 1 0 31 95 1 0 32 96 1 6 33 97 1 0 33 98 1 0 34 99 1 0 34100 1 0 36101 1 0 36102 1 0 36103 1 0 37104 1 6 38105 1 0 38106 1 0 39107 1 0 41108 1 1 42109 1 0 42110 1 0 44111 1 0 44112 1 0 44113 1 0 45114 1 0 45115 1 0 45116 1 0 46117 1 0 46118 1 0 47119 1 1 49120 1 0 49121 1 0 49122 1 0 50123 1 0 50124 1 0 51125 1 0 51126 1 0 53127 1 0 53128 1 0 53129 1 0 54130 1 0 56131 1 0 56132 1 0 56133 1 0 57134 1 0 57135 1 0 58136 1 0 59137 1 0 60138 1 0 61139 1 0 62140 1 0 63141 1 0 64142 1 0 65143 1 0 M END

Standard InCHIKey	YQQPOCSAGKUABB-YRGOWXAZSA-N
Standard InCHI	InChI=1S/C48H78O17/c1-22-30(52)32(54)35(57)40(61-22)64-37-31(53)25(50)20-60-41(37)65-38-34(56)33(55)36(39(58)59-9)63-42(38)62-29-13-14-45(5)26(46(29,6)21-49)12-15-48(8)27(45)11-10-23-24-18-43(2,3)19-28(51)44(24,4)16-17-47(23,48)7/h10,22,24-38,40-42,49-57H,11-21H2,1-9H3/t22-,24-,25-,26+,27+,28+,29-,30-,31-,32+,33-,34-,35+,36-,37+,38+,40-,41-,42+,44+,45-,46+,47+,48+/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@H]([C@H](CO[C@H]1O[C@@H]1[C@H]([C@@H]([C@@H](C(=O)OC)O[C@H]1O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)[C@@H]2CC=C2[C@@H]4CC(C)(C)C[C@H]([C@]4(C)CC[C@@]32C)O)[C@@]1(C)CO)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	926.52	Volume:	914.473 ? Van der Waals volume.
Dense:	1.013	LogP:	1.399 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.1 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.985 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	45.0
TPSA:	263.75 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	8.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.095	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.399	Fsp³:	0.938
MCE-18:	173.419 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.799	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.013 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.225	Promiscuous compounds:	0.127

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.035	MDCK Permeability:	-5.181
Pgp-inhibitor:	0.0	Pgp-substrate:	0.895
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.005
20% Bioavailability (F20%):	0.375	30% Bioavailability (F30%):	0.477
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.569
Plasma Protein Binding (PPB):	75.497%	Volume Distribution (VD):	-0.327
Fu:	15.596% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.935	BCRP inhibitor:	0.002
BSEP inhibitor:	0.45

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.745	CYP3A4-substrate:	0.156
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.096
HLM stability:	0.002 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.307

Half-life (T1/2):

2.684

ADMET: Toxicity

hERG Blockers:	0.012	hERG Blockers (10um):	0.14
Human Hepatotoxicity (H-HT):	0.267	Drug-induced Liver Injury (DILI):	0.507
AMES Toxicity:	0.523	Rat Oral Acute Toxicity:	0.017
Maximum Recommended Daily Dose:	0.013	Skin Sensitization:	0.999
Carcinogencity:	0.046	Eye Corrosion:	0.0
Eye Irritation:	0.003	Respiratory Toxicity:	0.003
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.985
Hematotoxicity:	0.27	Drug-induced Nephrotoxicity:	0.963
Genotoxicity:	0.159	RPMI-8226 Immunitoxicity:	0.261
A549 Cytotoxicity:	0.336	Hek293 Cytotoxicity:	0.498
BCF:	1.062 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.54 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.22 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.302 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO6792	Hedysarum polybotrys	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6792	Hedysarum polybotrys	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO6792	Hedysarum polybotrys	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC182616 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19959
0.1-0.2	25492
0.2-0.3	3184
0.3-0.4	748
0.4-0.5	382
0.5-0.6	68
0.6-0.7	13
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.81	Intermediate Similarity	NPC486563
0.7767	Intermediate Similarity	NPC218954
0.7596	Intermediate Similarity	NPC486564
0.7048	Intermediate Similarity	NPC162574
0.6852	Remote Similarity	NPC236657
0.6514	Remote Similarity	NPC475504
0.6422	Remote Similarity	NPC118440
0.641	Remote Similarity	NPC471550
0.6348	Remote Similarity	NPC313110
0.6226	Remote Similarity	NPC174679
0.6226	Remote Similarity	NPC279554
0.6147	Remote Similarity	NPC112352
0.614	Remote Similarity	NPC187618
0.614	Remote Similarity	NPC470477
0.6068	Remote Similarity	NPC76972
0.6068	Remote Similarity	NPC469782
0.6068	Remote Similarity	NPC204414
0.5929	Remote Similarity	NPC297263
0.5893	Remote Similarity	NPC164389
0.5739	Remote Similarity	NPC95437
0.569	Remote Similarity	NPC114692
0.5673	Remote Similarity	NPC224121
0.5652	Remote Similarity	NPC131469
0.5636	Remote Similarity	NPC56713
0.5636	Remote Similarity	NPC59804
0.5614	Remote Similarity	NPC480475
0.5593	Remote Similarity	NPC120116
0.5591	Remote Similarity	NPC293330
0.5556	Remote Similarity	NPC473452
0.5547	Remote Similarity	NPC202828
0.5547	Remote Similarity	NPC119592
0.5537	Remote Similarity	NPC60557
0.5537	Remote Similarity	NPC475287
0.5537	Remote Similarity	NPC67857
0.5526	Remote Similarity	NPC160415
0.5526	Remote Similarity	NPC309714
0.5517	Remote Similarity	NPC222580
0.5504	Remote Similarity	NPC298034
0.5504	Remote Similarity	NPC71065
0.5478	Remote Similarity	NPC488526
0.5439	Remote Similarity	NPC469945
0.5431	Remote Similarity	NPC63159
0.5424	Remote Similarity	NPC276093
0.5417	Remote Similarity	NPC31838
0.5405	Remote Similarity	NPC12288
0.5403	Remote Similarity	NPC135904
0.5391	Remote Similarity	NPC117714
0.5378	Remote Similarity	NPC481079
0.5333	Remote Similarity	NPC241909
0.5289	Remote Similarity	NPC481078
0.5285	Remote Similarity	NPC610204
0.5259	Remote Similarity	NPC30289
0.5254	Remote Similarity	NPC123796
0.5242	Remote Similarity	NPC79643
0.5234	Remote Similarity	NPC21691
0.5234	Remote Similarity	NPC57484
0.5217	Remote Similarity	NPC469946
0.5175	Remote Similarity	NPC473373
0.5175	Remote Similarity	NPC127056
0.5169	Remote Similarity	NPC139044
0.5169	Remote Similarity	NPC471383
0.5159	Remote Similarity	NPC155410
0.5135	Remote Similarity	NPC214484
0.513	Remote Similarity	NPC295371
0.512	Remote Similarity	NPC123522
0.5118	Remote Similarity	NPC100639
0.5085	Remote Similarity	NPC10607
0.5085	Remote Similarity	NPC173859
0.5085	Remote Similarity	NPC148603
0.5085	Remote Similarity	NPC46665
0.5085	Remote Similarity	NPC2370
0.5079	Remote Similarity	NPC133818
0.5079	Remote Similarity	NPC165204
0.5077	Remote Similarity	NPC286457
0.5076	Remote Similarity	NPC236638
0.5076	Remote Similarity	NPC294453
0.5076	Remote Similarity	NPC305981
0.5046	Remote Similarity	NPC476883
0.5042	Remote Similarity	NPC105800
0.5041	Remote Similarity	NPC104137
0.5041	Remote Similarity	NPC207738
0.5041	Remote Similarity	NPC26626
0.5039	Remote Similarity	NPC123199
0.5038	Remote Similarity	NPC261506
0.5038	Remote Similarity	NPC4328

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC182616 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6968
0.1-0.2	2137
0.2-0.3	40
0.3-0.4	4
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data