20 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
6 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC908
Formula: C15H23NO3
Ingredient ID: NPC908
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1cc(ccc1O)C(=O)CCCCCN(C)C |
| Standard InCHI | InChI=1S/C15H23NO3/c1-16(2)10-6-4-5-7-13(17)12-8-9-14(18)15(11-12)19-3/h8-9,11,18H,4-7,10H2,1-3H3 |
| Standard InCHIKey | VSZILFSCHHLHOH-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
PMID: 19938815 Database: NPASS [NPC908] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Ficus septica | Ficus | Moraceae |
  |
Ingredient ID: NPC69712
Formula: C19H21NO4
Ingredient ID: NPC69712
| Common Name | Laurotetanine |
| IUPAC Name | (6aS)-1,2,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-9-ol |
| Canonical SMILES | COc1c(OC)cc2c3c1c1cc(OC)c(cc1C[C@@H]3NCC2)O |
| Standard InCHI | InChI=1S/C19H21NO4/c1-22-15-9-12-11(7-14(15)21)6-13-17-10(4-5-20-13)8-16(23-2)19(24-3)18(12)17/h7-9,13,20-21H,4-6H2,1-3H3/t13-/m0/s1 |
| Standard InCHIKey | GVVXPMORGFYVOO-ZDUSSCGKSA-N |
| Ingredient External Links |
PubChem CID: 31415 ChEMBL ID: CHEMBL464098 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD170844] Database: NPASS [NPC69712] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vachellia karroo | Vachellia | Fabaceae |
|
| Baccharis grandicapitulata | Baccharis | Asteraceae | |
| Renealmia alpinia | Renealmia | Zingiberaceae |
|
| Morella pensylvanica | Morella | Myricaceae | |
| Delphinium giraldii | Delphinium | Ranunculaceae |
|
| Stellaria media | Stellaria | Caryophyllaceae |
 |
| Curcuma aeruginosa | Curcuma | Zingiberaceae |
|
| Piper brachystachyum | Piper | Piperaceae |
|
| Tephroseris kirilowii | Tephroseris | Asteraceae |
|
| Senecio congestus | Senecio | Asteraceae |
|
| Papaver pseudocanescens | Papaver | Papaveraceae | |
| Cephalaria leucantha | Cephalaria | Caprifoliaceae | |
| Sideritis dasygnaphala | Sideritis | Lamiaceae | |
| Gutierrezia dracunculoides | Gutierrezia | Asteraceae | |
| Psidium acutangulum | Psidium | Myrtaceae |
|
| Beesia calthifolia | Beesia | Ranunculaceae | |
| Bursera kerberi | Bursera | Burseraceae | |
| Helenium integrifolium | Helenium | Asteraceae | |
| Rhododendron mucronulatum | Rhododendron | Ericaceae |
|
| Euonymus fortunei | Euonymus | Celastraceae |
|
| Phlomis crinita | Phlomis | Lamiaceae |
|
| Crotalaria stolzii | Crotalaria | Fabaceae | |
| Selinum libanotis | Selinum | Apiaceae | |
| Melampodium leucanthum | Melampodium | Asteraceae | |
| Clerodendrum trichotomum | Clerodendrum | Lamiaceae |
|
| Juniperus scopulorum | Juniperus | Cupressaceae |
|
| Diplacus aurantiacus | Diplacus | Phrymaceae | |
| Clinacanthus nutans | Clinacanthus | Acanthaceae |
|
| Alstonia angustiloba | Alstonia | Apocynaceae | |
| Lasianthaea podocephala | Lasianthaea | Asteraceae | |
| Eucalyptus albens | Eucalyptus | Myrtaceae | |
| Annona cherimola | Annona | Annonaceae |
|
| Pellacalyx axillaris | Pellacalyx | Rhizophoraceae | |
| Boschniakia rossica | Boschniakia | Orobanchaceae |
|
| Coffea liberica var. dewevrei | Coffea | Rubiaceae |
|
| Botrychium ternatum | Botrychium | Ophioglossaceae |
|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Polanisia trachysperma | Polanisia | Cleomaceae |
|
| Eupatorium rebaudianum | Eupatorium | Asteraceae |
|
| Solanum boerhaavii | Solanum | Solanaceae | |
| Coleus wulfenioides | Coleus | Lamiaceae | |
| Polygala senega | Polygala | Polygalaceae |
 |
| Bursera simaruba | Bursera | Burseraceae |
|
| Delphinium denudatum | Delphinium | Ranunculaceae |
|
| Mentha incana | Mentha | Lamiaceae | |
| Ericameria laricifolia | Ericameria | Asteraceae | |
| Cissus quadrangularis | Cissus | Vitaceae |
|
| Litsea cubeba | Litsea | Lauraceae |
|
| Ormosia fordiana | Ormosia | Fabaceae | |
| Loranthus longiflorus | Loranthus | Loranthaceae |
|
| Callistemon speciosus | Callistemon | Myrtaceae | |
| Lupinus cosentinii | Lupinus | Fabaceae | |
| nectandra salicifolia | Nectandra | Lauraceae | |
| Hedysarum gmelini | Hedysarum | Fabaceae | |
| Euploca racemosa | Euploca | Heliotropiaceae | |
| Ficus septica | Ficus | Moraceae |
|
| Podocarpus elatus | Podocarpus | Podocarpaceae |
|
| Artemisia pectinata | Artemisia | Asteraceae | |
| Zephyranthes flava | Zephyranthes | Amaryllidaceae |
Ingredient ID: NPC69543
Formula: C21H22O6
Ingredient ID: NPC69543
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=CC[C@@]12[C@H]3OC[C@@H]1[C@H]([C@@H]2C(=O)C(=C3OC)OC)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C21H22O6/c1-4-7-21-12-9-25-20(21)19(24-3)18(23-2)17(22)16(21)15(12)11-5-6-13-14(8-11)27-10-26-13/h4-6,8,12,15-16,20H,1,7,9-10H2,2-3H3/t12-,15-,16-,20+,21-/m1/s1 |
| Standard InCHIKey | CIYZXQSKZRSLTE-YMQVBBKESA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD203170] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Ficus septica | Ficus | Moraceae |
|
Ingredient ID: NPC469540
Formula: C14H19NO3
Ingredient ID: NPC469540
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1cc(ccc1O)C(=O)CC1CCCN1C |
| Standard InCHI | InChI=1S/C14H19NO3/c1-15-7-3-4-11(15)9-13(17)10-5-6-12(16)14(8-10)18-2/h5-6,8,11,16H,3-4,7,9H2,1-2H3 |
| Standard InCHIKey | LBNRVYIIEPDWHO-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
PMID: 19938815 Database: NPASS [NPC469540] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Ficus septica | Ficus | Moraceae |
|
Ingredient ID: NPC469539
Formula: C15H21NO3
Ingredient ID: NPC469539
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1cc(ccc1O)C(=O)CC1CCC[N+]1(C)C |
| Standard InCHI | InChI=1S/C15H21NO3/c1-16(2)8-4-5-12(16)10-14(18)11-6-7-13(17)15(9-11)19-3/h6-7,9,12H,4-5,8,10H2,1-3H3/p+1 |
| Standard InCHIKey | KMFMDBAYGMIWCI-UHFFFAOYSA-O |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
PMID: 19938815 Database: NPASS [NPC469539] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Ficus septica | Ficus | Moraceae |
|
Ingredient ID: NPC42057
Formula: C22H23NO4
Ingredient ID: NPC42057
| Common Name | n.a. |
| IUPAC Name | 3,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizine-6,14-diol |
| Canonical SMILES | COc1ccc2c(c1)c1cc(O)c(cc1c1c2C(O)C2CCCN2C1)OC |
| Standard InCHI | InChI=1S/C22H23NO4/c1-26-12-5-6-13-14(8-12)15-9-19(24)20(27-2)10-16(15)17-11-23-7-3-4-18(23)22(25)21(13)17/h5-6,8-10,18,22,24-25H,3-4,7,11H2,1-2H3 |
| Standard InCHIKey | CMFIDYCYVJWPPL-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 626522 |
| Plant-Ingredient Association Reference |
Database: TCMID [22136] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tylophora atrofolliculata | Tylophora | Apocynaceae |
|
| Tylophora asthmatica | Tylophora | Apocynaceae |
|
| Ficus septica | Ficus | Moraceae |
|
| Tylophora ovata | Tylophora | Apocynaceae |
|
| Vincetoxicum hirundinaria | Vincetoxicum | Apocynaceae |
|
Ingredient ID: NPC329911
Formula: C24H27NO6
Ingredient ID: NPC329911
| Common Name | 14Alpha-Hydroxyisocrebrine N-Oxide |
| IUPAC Name | (13aS,14S)-3,4,6,7-tetramethoxy-10-oxido-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-10-ium-14-ol |
| Canonical SMILES | COc1cc2c(cc1OC)c1CN3(=O)CCC[C@H]3[C@H](c1c1c2c(OC)c(OC)cc1)O |
| Standard InCHI | InChI=1S/C24H27NO6/c1-28-18-8-7-13-21-16(12-25(27)9-5-6-17(25)23(21)26)14-10-19(29-2)20(30-3)11-15(14)22(13)24(18)31-4/h7-8,10-11,17,23,26H,5-6,9,12H2,1-4H3/t17-,23+,25?/m0/s1 |
| Standard InCHIKey | MSEYHQHYVWQFRE-ACYOWCCNSA-N |
| Ingredient External Links |
PubChem CID: 15768065 ChEMBL ID: CHEMBL1092162 |
| Plant-Ingredient Association Reference |
PMID: 19938815 Database: NPASS [NPC329911] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Ficus septica | Ficus | Moraceae |
|
Ingredient ID: NPC306843
Formula: C19H21NO4
Ingredient ID: NPC306843
| Common Name | Boldine |
| IUPAC Name | (6aS)-1,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol |
| Canonical SMILES | COc1cc2c(cc1O)C[C@H]1c3c2c(OC)c(O)cc3CCN1C |
| Standard InCHI | InChI=1S/C19H21NO4/c1-20-5-4-10-7-15(22)19(24-3)18-12-9-16(23-2)14(21)8-11(12)6-13(20)17(10)18/h7-9,13,21-22H,4-6H2,1-3H3/t13-/m0/s1 |
| Standard InCHIKey | LZJRNLRASBVRRX-ZDUSSCGKSA-N |
| Ingredient External Links |
PubChem CID: 10154 ZINC ID: ZINC000000135449 ChEMBL ID: CHEMBL388342 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC306843] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Vachellia karroo | Vachellia | Fabaceae |
|
| Cephalaria leucantha | Cephalaria | Caprifoliaceae | |
| Diplacus aurantiacus | Diplacus | Phrymaceae | |
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Polanisia trachysperma | Polanisia | Cleomaceae |
|
| Eupatorium rebaudianum | Eupatorium | Asteraceae |
|
| Solanum boerhaavii | Solanum | Solanaceae | |
| Coleus wulfenioides | Coleus | Lamiaceae | |
| Polygala senega | Polygala | Polygalaceae |
|
| Bursera simaruba | Bursera | Burseraceae |
|
| Delphinium denudatum | Delphinium | Ranunculaceae |
|
| Mentha incana | Mentha | Lamiaceae | |
| Ericameria laricifolia | Ericameria | Asteraceae | |
| Cissus quadrangularis | Cissus | Vitaceae |
|
| Litsea cubeba | Litsea | Lauraceae |
|
| Ormosia fordiana | Ormosia | Fabaceae | |
| Loranthus longiflorus | Loranthus | Loranthaceae |
|
| Callistemon speciosus | Callistemon | Myrtaceae | |
| nectandra salicifolia | Nectandra | Lauraceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Ficus septica | Ficus | Moraceae |
|
| Podocarpus elatus | Podocarpus | Podocarpaceae |
|
Ingredient ID: NPC296592
Formula: C19H21NO4
Ingredient ID: NPC296592
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1ccc(cc1O)C[C@@H]1N(C)CCc2c1cc1OCOc1c2 |
| Standard InCHI | InChI=1S/C19H21NO4/c1-20-6-5-13-9-18-19(24-11-23-18)10-14(13)15(20)7-12-3-4-17(22-2)16(21)8-12/h3-4,8-10,15,21H,5-7,11H2,1-2H3/t15-/m0/s1 |
| Standard InCHIKey | LZDZXNMXZLWRLZ-HNNXBMFYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD224245] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Ficus septica | Ficus | Moraceae |
|
Ingredient ID: NPC252620
Formula: C19H21NO2
Ingredient ID: NPC252620
| Common Name | n.a. |
| IUPAC Name | 2-(3,4-dimethoxyphenanthren-1-yl)-N-methylethanamine |
| Canonical SMILES | CNCCc1cc(OC)c(c2c1ccc1c2cccc1)OC |
| Standard InCHI | InChI=1S/C19H21NO2/c1-20-11-10-14-12-17(21-2)19(22-3)18-15-7-5-4-6-13(15)8-9-16(14)18/h4-9,12,20H,10-11H2,1-3H3 |
| Standard InCHIKey | BRMNMGRFCCRFNA-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 10957406 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD186595] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Ficus septica | Ficus | Moraceae |
|
Ingredient ID: NPC229166
Formula: C19H19NO4
Ingredient ID: NPC229166
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1cc2c(cc1O)C[C@H]1c3c2c2OCOc2cc3CCN1C |
| Standard InCHI | InChI=1S/C19H19NO4/c1-20-4-3-10-7-16-19(24-9-23-16)18-12-8-15(22-2)14(21)6-11(12)5-13(20)17(10)18/h6-8,13,21H,3-5,9H2,1-2H3/t13-/m0/s1 |
| Standard InCHIKey | MPWZJVCAMFAIGV-ZDUSSCGKSA-N |
| Ingredient External Links |
PubChem CID: 442194 ZINC ID: ZINC000000898481 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC229166] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper sylvaticum | Piper | Piperaceae |
|
| Helichrysum fulvum | Helichrysum | Asteraceae | |
| Stephania pierrei | Stephania | Menispermaceae |
|
| Avena fatua | Avena | Poaceae |
|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Ficus septica | Ficus | Moraceae |
|
| Annona glabra | Annona | Annonaceae |
|
| Stephania delavayi | Stephania | Menispermaceae |
|
Ingredient ID: NPC213788
Formula: C19H21NO4
Ingredient ID: NPC213788
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COC1=C[C@]23CCN([C@H](C2=CC1=O)Cc1c3cc(OC)c(c1)O)C |
| Standard InCHI | InChI=1S/C19H21NO4/c1-20-5-4-19-10-18(24-3)16(22)8-13(19)14(20)6-11-7-15(21)17(23-2)9-12(11)19/h7-10,14,21H,4-6H2,1-3H3/t14-,19-/m0/s1 |
| Standard InCHIKey | FBCNBECEGOCMPI-LIRRHRJNSA-N |
| Ingredient External Links |
PubChem CID: 12313923 ZINC ID: ZINC000015216580 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Ficus septica | Ficus | Moraceae |
|
Ingredient ID: NPC205054
Formula: C14H18O8
Ingredient ID: NPC205054
| Common Name | n.a. |
| IUPAC Name | 1-[4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc(ccc2O)C(=O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C14H18O8/c1-6(16)7-2-3-8(17)9(4-7)21-14-13(20)12(19)11(18)10(5-15)22-14/h2-4,10-15,17-20H,5H2,1H3/t10-,11-,12+,13-,14-/m1/s1 |
| Standard InCHIKey | AOXMCWFZPZRDPE-RKQHYHRCSA-N |
| Ingredient External Links |
PubChem CID: 12314759 |
| Plant-Ingredient Association Reference |
PMID: 19938815 Database: NPASS [NPC205054] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Artemisia giraldii | Artemisia | Asteraceae | |
| Calystegia pubescens | Calystegia | Convolvulaceae |
|
| Millettia pinnata | Millettia | Fabaceae |
|
| Picea glauca | Picea | Pinaceae |
|
| Albizia procera | Albizia | Fabaceae |
|
| Diospyros glaucifolia | Diospyros | Ebenaceae | |
| Lampranthus sociorum | Lampranthus | Aizoaceae | |
| Perymenium mendezii | Perymenium | Asteraceae | |
| Hortonia floribunda | Hortonia | Monimiaceae | |
| Nauclea rhynchophylla | Nauclea | Rubiaceae | |
| Bursera tonkinensis | Bursera | Burseraceae |
|
| Achlys triphylla | Achlys | Berberidaceae |
|
| Ficus septica | Ficus | Moraceae |
|
| Bulbophyllum protractum | Bulbophyllum | Orchidaceae | |
| Tarchonanthus camphoratus | Tarchonanthus | Asteraceae |
|
| Cypripedium calceolus | Cypripedium | Orchidaceae |
|
| Lactuca laciniata | Lactuca | Asteraceae |
|
| Artemisia porrecta | Artemisia | Asteraceae |
|
Ingredient ID: NPC185467
Formula: C19H19NO4
Ingredient ID: NPC185467
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1cc2c(cc1O)C[C@@H]1N([C@H]2Cc2c1cc1c(c2)OCO1)C |
| Standard InCHI | InChI=1S/C19H19NO4/c1-20-14-3-10-5-16(21)17(22-2)7-12(10)15(20)4-11-6-18-19(8-13(11)14)24-9-23-18/h5-8,14-15,21H,3-4,9H2,1-2H3/t14-,15-/m0/s1 |
| Standard InCHIKey | SMMBTQGVTOTRAA-GJZGRUSLSA-N |
| Ingredient External Links |
PubChem CID: 11823545 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD14280] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andira retusa | Andira | Fabaceae | |
| Baeckea frutescens | Baeckea | Myrtaceae |
|
| Marrubium parviflorum | Marrubium | Lamiaceae | |
| Dyssodia anthemidifolia | Dyssodia | Asteraceae | |
| Psathyrotes ramosissima | Psathyrotes | Asteraceae | |
| Lychnophora pinaster | Lychnophora | Asteraceae | |
| Chenopodium quinoa | Chenopodium | Chenopodiaceae |
|
| Lespedeza maximowiczi | Lespedeza | Fabaceae | |
| Coprosma foetidissima | Coprosma | Rubiaceae |
|
| Microglossa pyrifolia | Microglossa | Asteraceae |
|
| Parthenium confertum | Parthenium | Asteraceae | |
| Harpullia cupanioides | Harpullia | Sapindaceae | |
| Trifolium diffusum | Trifolium | Fabaceae | |
| Youngia japonica | Youngia | Asteraceae |
|
| Eriocephalus kingesii | Eriocephalus | Asteraceae | |
| Balanophora polyandra | Balanophora | Balanophoraceae |
|
| Lilium rubrum | Lilium | Liliaceae | |
| Lobelia syphilitica | Lobelia | Campanulaceae | |
| Cryptocarya chinensis | Cryptocarya | Lauraceae |
|
| Citrus medica | Citrus | Rutaceae |
|
| Panicum crus-galli | Panicum | Poaceae |
|
| Scleropyrum wallichianum | Scleropyrum | Cervantesiaceae |
|
| Isodon eriocalyx | Isodon | Lamiaceae | |
| Veronica stricta | Veronica | Plantaginaceae | |
| Zanthoxylum ocumarense | Zanthoxylum | Rutaceae | |
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Phymatopteris hastata | Phymatopteris | Polypodiaceae | |
| Geranium collinum | Geranium | Geraniaceae | |
| Polygonatum polyanthemum | Polygonatum | Asparagaceae | |
| Chenopodiastrum murale | Chenopodiastrum | Chenopodiaceae |
|
| Girgensohnia oppositiflora | Girgensohnia | Chenopodiaceae | |
| Ficus septica | Ficus | Moraceae |
|
| Davidsonia pruriens | Davidsonia | Cunoniaceae |
|
| Aralia hispida | Aralia | Araliaceae |
|
Ingredient ID: NPC170503
Formula: C18H19NO2
Ingredient ID: NPC170503
| Common Name | n.a. |
| IUPAC Name | (6aS)-1,2-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
| Canonical SMILES | COc1cc2CCN[C@@H]3c2c(c1OC)c1ccccc1C3 |
| Standard InCHI | InChI=1S/C18H19NO2/c1-20-15-10-12-7-8-19-14-9-11-5-3-4-6-13(11)17(16(12)14)18(15)21-2/h3-6,10,14,19H,7-9H2,1-2H3/t14-/m0/s1 |
| Standard InCHIKey | QQKAHDMMPBQDAC-AWEZNQCLSA-N |
| Ingredient External Links |
PubChem CID: 41169 ZINC ID: ZINC000026980973 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC170503] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Magnolia obovata | Magnolia | Magnoliaceae |
|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
|
| Magnolia officinalis | Magnolia | Magnoliaceae |
|
| Ficus septica | Ficus | Moraceae |
|
Ingredient ID: NPC138438
Formula: C15H23NO3
Ingredient ID: NPC138438
| Common Name | Ficuseptamine B |
| IUPAC Name | 6-(dimethylamino)-1-(3-hydroxy-4-methoxyphenyl)hexan-1-one |
| Canonical SMILES | COc1ccc(cc1O)C(=O)CCCCCN(C)C |
| Standard InCHI | InChI=1S/C15H23NO3/c1-16(2)10-6-4-5-7-13(17)12-8-9-15(19-3)14(18)11-12/h8-9,11,18H,4-7,10H2,1-3H3 |
| Standard InCHIKey | KHPBRJKLVIUPRG-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 44614017 ChEMBL ID: CHEMBL1088609 |
| Plant-Ingredient Association Reference |
PMID: 19938815 Database: NPASS [NPC138438] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Ficus septica | Ficus | Moraceae |
|
Ingredient ID: NPC130941
Formula: C24H27NO4
Ingredient ID: NPC130941
| Common Name | Tylophorine |
| IUPAC Name | (13aR)-2,3,6,7-tetramethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine |
| Canonical SMILES | COc1cc2c3C[C@H]4CCCN4Cc3c3c(c2cc1OC)cc(c(c3)OC)OC |
| Standard InCHI | InChI=1S/C24H27NO4/c1-26-21-9-16-15-8-14-6-5-7-25(14)13-20(15)19-12-24(29-4)23(28-3)11-18(19)17(16)10-22(21)27-2/h9-12,14H,5-8,13H2,1-4H3/t14-/m1/s1 |
| Standard InCHIKey | SSEUDFYBEOIWGF-CQSZACIVSA-N |
| Ingredient External Links |
PubChem CID: 10883727 ZINC ID: ZINC000014824781 ChEMBL ID: CHEMBL258137 |
| Plant-Ingredient Association Reference |
PMID: 19938815 PMID: 16038551 Database: NPASS [NPC130941] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tylophora asthmatica | Tylophora | Apocynaceae |
|
| Ficus septica | Ficus | Moraceae |
|
| Tylophora tanakae | Tylophora | Apocynaceae | |
| Vincetoxicum hirundinaria | Vincetoxicum | Apocynaceae |
|
Ingredient ID: NPC111603
Formula: C20H23NO4
Ingredient ID: NPC111603
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1c(OC)cc2c3c1c1cc(OC)c(cc1C[C@]3(C)NCC2)O |
| Standard InCHI | InChI=1S/C20H23NO4/c1-20-10-12-7-14(22)15(23-2)9-13(12)17-18(20)11(5-6-21-20)8-16(24-3)19(17)25-4/h7-9,21-22H,5-6,10H2,1-4H3/t20-/m0/s1 |
| Standard InCHIKey | XEZBZEXZYWKCJZ-FQEVSTJZSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD203169] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Ficus septica | Ficus | Moraceae |
|
Ingredient ID: NPC11147
Formula: C24H29NO4
Ingredient ID: NPC11147
| Common Name | Septicine |
| IUPAC Name | (8aR)-6,7-bis(3,4-dimethoxyphenyl)-1,2,3,5,8,8a-hexahydroindolizine |
| Canonical SMILES | COc1ccc(cc1OC)C1=C(C[C@@H]2N(C1)CCC2)c1ccc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C24H29NO4/c1-26-21-9-7-16(12-23(21)28-3)19-14-18-6-5-11-25(18)15-20(19)17-8-10-22(27-2)24(13-17)29-4/h7-10,12-13,18H,5-6,11,14-15H2,1-4H3/t18-/m1/s1 |
| Standard InCHIKey | MXMHNOVMTJDCLE-GOSISDBHSA-N |
| Ingredient External Links |
PubChem CID: 10763252 ChEMBL ID: CHEMBL1092163 |
| Plant-Ingredient Association Reference |
PMID: 19938815 Database: NPASS [NPC11147] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Ficus septica | Ficus | Moraceae |
|
Ingredient ID: NPC101908
Formula: C17H23NO4
Ingredient ID: NPC101908
| Common Name | n.a. |
| IUPAC Name | (2E,4E,6R)-7-(3,4-dimethoxyphenyl)-N-ethyl-6-hydroxyhepta-2,4-dienamide |
| Canonical SMILES | CCN=C(/C=C/C=C/[C@@H](Cc1ccc(c(c1)OC)OC)O)O |
| Standard InCHI | InChI=1S/C17H23NO4/c1-4-18-17(20)8-6-5-7-14(19)11-13-9-10-15(21-2)16(12-13)22-3/h5-10,12,14,19H,4,11H2,1-3H3,(H,18,20)/b7-5+,8-6+/t14-/m0/s1 |
| Standard InCHIKey | XAJXBWHLLVMCFS-OBUCXMDBSA-N |
| Ingredient External Links |
PubChem CID: 72196849 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD214383] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Ficus septica | Ficus | Moraceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC101908 | C17H23NO4 | (2E,4E,6R)-7-(3,4-dimethoxyphenyl)-N-ethyl-6-hydroxyhepta-2,4-dienamide | 305.1627082 | 0.3239 | 2.78 | 2.239 | 3 | 2 | 71.28 | 8 | 1 | 22 | 0 |
| NPC11147 | C24H29NO4 | Septicine | 395.21 | -0.6582 | 3.55 | 3.306 | 1 | 0 | 40.16 | 10 | 4 | 29 | 0 |
| NPC111603 | C20H23NO4 | 341.1627082 | -0.2931 | 3.11 | 1.896 | 1 | 2 | 59.95 | 3 | 4 | 25 | 0 | |
| NPC130941 | C24H27NO4 | Tylophorine | 393.19 | -0.7348 | 3.55 | 3.006 | 1 | 0 | 40.16 | 8 | 5 | 29 | 0 |
| NPC138438 | C15H23NO3 | Ficuseptamine B | 265.17 | -1.3757 | 2.67 | 1.648 | 2 | 1 | 49.77 | 12 | 1 | 19 | 0 |
| NPC170503 | C18H19NO2 | 281.1415788 | -0.2448 | 3.11 | 3.73 | 1 | 1 | 30.49 | 4 | 4 | 21 | 0 | |
| NPC185467 | C19H19NO4 | 325.1314081 | -0.6753 | 3 | 1.993 | 1 | 1 | 51.16 | 1 | 5 | 24 | 0 | |
| NPC205054 | C14H18O8 | 314.1001675 | -2.9214 | 2.12 | -0.736 | 6 | 5 | 136.68 | 10 | 2 | 22 | 0 | |
| NPC213788 | C19H21NO4 | 327.1470582 | -0.6163 | 3 | 1.283 | 3 | 1 | 59 | 2 | 4 | 24 | 0 | |
| NPC229166 | C19H19NO4 | 325.1314081 | -0.4201 | 3 | 1.645 | 1 | 1 | 51.16 | 4 | 5 | 24 | 0 | |
| NPC252620 | C19H21NO2 | 2-(3,4-dimethoxyphenanthren-1-yl)-N-methylethanamine | 295.1572289 | -0.1545 | 3.22 | 5.11 | 1 | 1 | 30.49 | 5 | 3 | 22 | 1 |
| NPC296592 | C19H21NO4 | 327.1470582 | -0.4201 | 3 | 2.477 | 1 | 1 | 51.16 | 3 | 4 | 24 | 0 | |
| NPC306843 | C19H21NO4 | Boldine | 327.15 | -0.6295 | 3 | 1.199 | 1 | 2 | 62.16 | 7 | 4 | 24 | 0 |
| NPC329911 | C24H27NO6 | 14Alpha-Hydroxyisocrebrine N-Oxide | 425.18 | 3.33 | 5 | 1 | 74.22 | 9 | 5 | 31 | 0 | ||
| NPC42057 | C22H23NO4 | 3,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizine-6,14-diol | 365.1627082 | -1.6646 | 3.33 | 1.901 | 2 | 2 | 62.16 | 2 | 5 | 27 | 0 |
| NPC469539 | C15H21NO3 | 264.16 | -2.5952 | 2.67 | 0.926 | 1 | 1 | 46.53 | 8 | 2 | 19 | 0 | |
| NPC469540 | C14H19NO3 | 249.14 | -1.2404 | 2.56 | 1.117 | 2 | 1 | 49.77 | 7 | 2 | 18 | 0 | |
| NPC69543 | C21H22O6 | 370.1416384 | -1.2116 | 3.11 | 2.766 | 4 | 0 | 63.22 | 5 | 5 | 27 | 0 | |
| NPC69712 | C19H21NO4 | Laurotetanine | 327.15 | -0.7569 | 3 | 1.479 | 1 | 2 | 59.95 | 7 | 4 | 24 | 0 |
| NPC908 | C15H23NO3 | 265.17 | -1.3757 | 2.67 | 1.648 | 2 | 1 | 49.77 | 12 | 1 | 19 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
