NPASS Compound

Natural Product: NPC567256

Natural Product ID	NPC567256
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{R},6~{R})-2-[(1~{S},2~{S},3'~{S},4~{S},5'~{R},6~{R},6'~{R},7~{S},8~{R},9~{S},12~{S},13~{R},16~{S})-3',6'-dihydroxy-5',7,9,13-tetramethyl-spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-ene-6,2'-tetrahydropyran]-16-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-[(2~{S},3~{R},4~{S},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{R},6~{R})-2-[(1~{S},2~{S},3'~{S},4~{S},5'~{R},6~{R},6'~{R},7~{S},8~{R},9~{S},12~{S},13~{R},16~{S})-3',6'-dihydroxy-5',7,9,13-tetramethyl-spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-ene-6,2'-tetrahydropyran]-16-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-[(2~{S},3~{R},4~{S},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 132140 0 0 0 0 0 0 0 0999 V2000 11.2666 3.8963 0.6307 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8194 2.7799 -0.2660 C 0 0 2 0 0 0 0 0 0 0 0 0 9.7550 3.1524 -1.2443 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3578 2.7938 -0.7932 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9713 3.7121 0.1818 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2314 1.3692 -0.3082 C 0 0 1 0 0 0 0 0 0 0 0 0 9.4737 0.8005 -0.2190 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3969 1.5519 0.5221 C 0 0 1 0 0 0 0 0 0 0 0 0 11.4901 0.6995 0.7635 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5022 1.3827 0.8719 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8387 0.1706 0.9599 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4512 0.3023 1.5258 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7040 -0.7402 0.7385 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2453 -0.6911 0.8313 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8562 -1.3584 2.1771 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3621 -1.2451 2.2263 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5791 -1.2315 1.1589 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8733 -1.1129 1.3449 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5594 -2.2092 0.5973 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5489 -1.7582 -0.2589 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7982 -2.2443 0.0005 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2769 -2.9572 -1.0801 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6840 -2.1601 -2.1331 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2394 -2.7503 -3.4747 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7879 -4.0129 -3.6399 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2411 -0.7444 -2.0662 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8475 -0.0880 -3.1637 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8145 -0.1091 -0.8077 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1535 1.1174 -0.5649 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9975 2.1856 -0.7051 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5385 3.0739 -1.7111 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0895 4.3271 -1.5930 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4940 4.3156 -1.0530 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2848 3.5596 -1.9078 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4679 3.7886 0.3674 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5538 4.8564 1.2631 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1365 3.0460 0.5297 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0973 2.3276 1.7055 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6850 -1.0655 0.3516 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9212 -1.4145 0.7969 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2979 -1.1379 2.0601 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6315 -2.2806 2.8015 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4885 -3.1158 2.1049 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2905 -3.9876 3.0377 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3782 -2.4289 1.1414 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9869 -2.6816 -0.2010 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6395 -0.9857 1.3689 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.8786 -0.7419 1.9742 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5351 -0.2808 2.0690 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8833 0.0859 3.3797 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5704 -3.1448 -0.0492 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4016 -2.4244 -0.9378 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1243 -1.3149 -0.2097 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8025 0.0022 -0.8993 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6200 -1.5505 -0.2069 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2001 -1.5223 -1.5678 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7194 -1.4875 -1.5565 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1567 -0.3838 -0.6616 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6306 0.9117 -1.1716 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6543 -0.3611 -0.4191 C 0 0 1 0 0 0 0 0 0 0 0 0 7.4099 0.5633 -1.2973 C 0 0 2 0 0 0 0 0 0 0 0 0 8.3121 -0.1396 -2.2961 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9530 4.9000 0.2952 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3885 3.9364 0.7245 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9128 3.7539 1.6879 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7252 2.4574 -0.8568 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9462 2.6882 -2.2188 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7655 4.2557 -1.4189 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6794 2.9879 -1.6591 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3819 4.4253 -0.1643 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9007 1.8527 1.4564 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2925 1.1599 0.3825 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3873 -0.5650 1.6026 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4702 0.0718 2.5948 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9925 1.2912 1.3015 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0568 -1.7542 0.9977 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8100 0.3231 0.9050 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0971 -2.4285 2.0839 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3498 -0.8368 3.0043 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9514 -1.1691 3.2464 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2254 -0.0955 1.0076 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0933 -1.2364 2.4356 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1047 -2.8400 1.3388 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7617 -2.9175 0.8645 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7922 -2.1864 -2.1731 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1202 -2.8132 -3.5163 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5472 -2.0952 -4.2861 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1529 -4.7363 -3.4308 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1570 -0.5853 -2.1798 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2036 0.5062 -3.6330 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8632 0.1419 -1.0396 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0268 1.8233 -0.9703 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1402 4.7863 -2.6233 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4243 5.0140 -1.0201 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8969 5.3496 -1.0910 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7192 4.1509 -2.5961 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2781 3.0583 0.4583 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4983 4.9442 1.5471 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3090 3.8113 0.6083 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3011 2.9683 2.4348 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1469 -0.5391 1.1653 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5420 -0.5845 2.6864 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8235 -3.8189 1.5191 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7576 -4.9419 3.2637 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2902 -4.2710 2.6353 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5405 -3.4399 3.9959 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3904 -2.9353 1.1892 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7606 -2.4988 -0.7740 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7261 -0.5102 0.3469 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5724 -0.8470 1.2709 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2819 0.7039 1.5739 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8094 -0.7551 3.9065 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0645 -3.9389 -0.6418 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0270 -3.6790 0.7194 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0291 -2.0357 -1.8561 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1736 -3.1808 -1.2496 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3140 0.1867 -0.8107 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9583 -0.0725 -1.9991 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2600 0.8711 -0.4229 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7255 -2.6222 0.1650 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9214 -2.4703 -2.0777 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8617 -0.7022 -2.2308 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0374 -1.4000 -2.6114 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0602 -2.4696 -1.1378 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6603 0.8297 -2.2963 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5809 1.0150 -0.9005 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1561 1.8174 -0.8053 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0636 -1.4049 -0.5242 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8090 1.2828 -1.8664 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2647 -0.4465 -1.8214 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5771 0.5577 -3.1300 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8050 -1.0079 -2.7662 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 4 6 1 0 6 7 1 1 7 8 1 0 8 9 1 0 6 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 23 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 28 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 19 51 1 0 51 52 1 0 52 53 1 0 53 54 1 6 53 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 6 58 60 1 0 60 61 1 0 61 62 1 0 8 2 1 0 60 11 1 0 61 6 1 0 58 13 1 0 55 14 1 0 53 17 1 0 39 21 1 0 49 41 1 0 37 30 1 0 1 63 1 0 1 64 1 0 1 65 1 0 2 66 1 6 3 67 1 0 3 68 1 0 4 69 1 6 5 70 1 0 8 71 1 1 9 72 1 0 11 73 1 1 12 74 1 0 12 75 1 0 13 76 1 1 14 77 1 1 15 78 1 0 15 79 1 0 16 80 1 0 18 81 1 0 18 82 1 0 19 83 1 1 21 84 1 1 23 85 1 6 24 86 1 0 24 87 1 0 25 88 1 0 26 89 1 6 27 90 1 0 28 91 1 6 30 92 1 6 32 93 1 0 32 94 1 0 33 95 1 1 34 96 1 0 35 97 1 6 36 98 1 0 37 99 1 1 38100 1 0 39101 1 1 41102 1 1 43103 1 6 44104 1 0 44105 1 0 44106 1 0 45107 1 6 46108 1 0 47109 1 6 48110 1 0 49111 1 6 50112 1 0 51113 1 0 51114 1 0 52115 1 0 52116 1 0 54117 1 0 54118 1 0 54119 1 0 55120 1 1 56121 1 0 56122 1 0 57123 1 0 57124 1 0 59125 1 0 59126 1 0 59127 1 0 60128 1 1 61129 1 6 62130 1 0 62131 1 0 62132 1 0 M END

Standard InCHIKey	YGPVRHSBAWKDQT-HQFFYUSISA-N
Standard InCHI	InChI=1S/C44H70O18/c1-17-12-28(47)44(62-38(17)54)18(2)29-26(61-44)14-24-22-7-6-20-13-21(8-10-42(20,4)23(22)9-11-43(24,29)5)57-41-37(60-40-35(53)33(51)30(48)19(3)56-40)36(32(50)27(15-45)58-41)59-39-34(52)31(49)25(46)16-55-39/h6,17-19,21-41,45-54H,7-16H2,1-5H3/t17-,18+,19+,21+,22-,23+,24+,25-,26+,27-,28+,29+,30+,31+,32-,33-,34-,35-,36+,37-,38-,39+,40+,41-,42+,43+,44-/m1/s1
SMILES	C[C@@H]1C[C@H](O)[C@@]2(O[C@H]1O)O[C@H]1C[C@H]3[C@@H]4CC=C5C[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O[C@@H]7OC[C@@H](O)[C@H](O)[C@H]7O)[C@H]6O[C@@H]6O[C@@H](C)[C@H](O)[C@@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	886.46	Volume:	848.159 ? Van der Waals volume.
Dense:	1.045	LogP:	2.282 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.966 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.35 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	48.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.139	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.913	Fsp³:	0.955
MCE-18:	234.07 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.674	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.27	Promiscuous compounds:	0.013

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.181	MDCK Permeability:	-5.15
Pgp-inhibitor:	0.0	Pgp-substrate:	0.989
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.015
20% Bioavailability (F20%):	0.042	30% Bioavailability (F30%):	0.951
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.008
Plasma Protein Binding (PPB):	52.318%	Volume Distribution (VD):	-0.469
Fu:	38.363% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.178
BSEP inhibitor:	0.005

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.002	CYP3A4-substrate:	0.145
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.126
HLM stability:	0.624 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.071

Half-life (T1/2):

3.735

ADMET: Toxicity

hERG Blockers:	0.02	hERG Blockers (10um):	0.081
Human Hepatotoxicity (H-HT):	0.309	Drug-induced Liver Injury (DILI):	0.931
AMES Toxicity:	0.666	Rat Oral Acute Toxicity:	0.007
Maximum Recommended Daily Dose:	0.021	Skin Sensitization:	1.0
Carcinogencity:	0.006	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.003
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.238	Drug-induced Nephrotoxicity:	0.817
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.522
A549 Cytotoxicity:	0.425	Hek293 Cytotoxicity:	0.678
BCF:	1.496 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.378 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.614 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.914 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8266	Solanum anguivi	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8266	Solanum anguivi	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC567256 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23997
0.1-0.2	22200
0.2-0.3	2805
0.3-0.4	630
0.4-0.5	142
0.5-0.6	68
0.6-0.7	13
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7103	Intermediate Similarity	NPC602423
0.6972	Remote Similarity	NPC300557
0.6964	Remote Similarity	NPC309278
0.6842	Remote Similarity	NPC218571
0.6842	Remote Similarity	NPC487615
0.6404	Remote Similarity	NPC102016
0.6404	Remote Similarity	NPC95051
0.6379	Remote Similarity	NPC475333
0.6379	Remote Similarity	NPC224098
0.6379	Remote Similarity	NPC208383
0.6198	Remote Similarity	NPC232054
0.6179	Remote Similarity	NPC480556
0.6174	Remote Similarity	NPC150057
0.6174	Remote Similarity	NPC147753
0.5984	Remote Similarity	NPC31896
0.5952	Remote Similarity	NPC477808
0.5929	Remote Similarity	NPC305423
0.5902	Remote Similarity	NPC477811
0.5789	Remote Similarity	NPC113044
0.5789	Remote Similarity	NPC283829
0.5789	Remote Similarity	NPC161676
0.5785	Remote Similarity	NPC194207
0.5785	Remote Similarity	NPC22779
0.5776	Remote Similarity	NPC470433
0.5776	Remote Similarity	NPC46190
0.5776	Remote Similarity	NPC171073
0.5763	Remote Similarity	NPC480555
0.5763	Remote Similarity	NPC150372
0.5739	Remote Similarity	NPC475351
0.5738	Remote Similarity	NPC249265
0.5726	Remote Similarity	NPC248746
0.5678	Remote Similarity	NPC48886
0.5678	Remote Similarity	NPC42171
0.5678	Remote Similarity	NPC51172
0.5678	Remote Similarity	NPC6806
0.5678	Remote Similarity	NPC49032
0.5678	Remote Similarity	NPC94881
0.5659	Remote Similarity	NPC210569
0.5652	Remote Similarity	NPC14704
0.5614	Remote Similarity	NPC470432
0.5614	Remote Similarity	NPC230507
0.561	Remote Similarity	NPC480554
0.5538	Remote Similarity	NPC15918
0.553	Remote Similarity	NPC244431
0.553	Remote Similarity	NPC305771
0.553	Remote Similarity	NPC263359
0.553	Remote Similarity	NPC94072
0.553	Remote Similarity	NPC169816
0.552	Remote Similarity	NPC480553
0.5492	Remote Similarity	NPC269297
0.5492	Remote Similarity	NPC222202
0.5397	Remote Similarity	NPC256983
0.5385	Remote Similarity	NPC224314
0.5372	Remote Similarity	NPC475182
0.5364	Remote Similarity	NPC181845
0.5345	Remote Similarity	NPC94272
0.5328	Remote Similarity	NPC97700
0.5328	Remote Similarity	NPC73243
0.5328	Remote Similarity	NPC244086
0.5328	Remote Similarity	NPC84956
0.5328	Remote Similarity	NPC30856
0.5294	Remote Similarity	NPC98696
0.5242	Remote Similarity	NPC247037
0.52	Remote Similarity	NPC116756
0.5167	Remote Similarity	NPC473601
0.5161	Remote Similarity	NPC475319
0.513	Remote Similarity	NPC206003
0.513	Remote Similarity	NPC473610
0.5122	Remote Similarity	NPC151134
0.5118	Remote Similarity	NPC108072
0.5085	Remote Similarity	NPC125324
0.5082	Remote Similarity	NPC122819
0.5082	Remote Similarity	NPC477809
0.5081	Remote Similarity	NPC475247
0.5081	Remote Similarity	NPC294129
0.5078	Remote Similarity	NPC23808
0.5078	Remote Similarity	NPC87998
0.5076	Remote Similarity	NPC248202
0.5041	Remote Similarity	NPC161738
0.5039	Remote Similarity	NPC232037
0.5039	Remote Similarity	NPC132080
0.5038	Remote Similarity	NPC477807

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC567256 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7600
0.1-0.2	1476
0.2-0.3	66
0.3-0.4	6
0.4-0.5	0
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6174	Remote Similarity	NPD8450	Suspended
0.5082	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data