Natural Product: NPC486882| Natural Product ID | NPC486882 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| VAAUVRVFOQPIGI-SPQHTLEESA-N |
| IUPAC Name | n.a. |
| Synonyms | |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | n.a. |
| PubChem CID |
5479530 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | VAAUVRVFOQPIGI-SPQHTLEESA-N |
| Standard InCHI | InChI=1S/C18H18N8O7S3/c1-25-18(22-12(28)13(29)23-25)36-4-6-3-34-15-9(14(30)26(15)10(6)16(31)32)21-11(27)8(24-33-2)7-5-35-17(19)20-7/h5,9,15H,3-4H2,1-2H3,(H2,19,20)(H,21,27)(H,23,29)(H,31,32)/b24-8-/t9-,15-/m1/s1 |
| SMILES | Cn1c(nc(=O)c(=O)[nH]1)SCC1=C(C(=O)O)N2C(=O)[C@H]([C@H]2SC1)N=C(/C(=NOC)/c1csc(=N)[nH]1)O |
  Calculated Properties| Molecular Weight:   | 554.05 | Volume:   | 464.327 Van der Waals volume.
|
| Dense:   | 1.193 | LogP:   | -0.522 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 0.452 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -2.921 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 8.0 | Rigid Bonds:   | 27.0 |
| TPSA:   | 219.18 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 15.0 |
| H-Bond Donor:   | 5.0 | Rings:   | 4.0 |
| Heavy Atoms:   | 18.0 |
| QED Drug-Likeness Score:   | 0.067 | GASA:   | 1.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 4.828 | Fsp3:   | 0.333 |
| MCE-18:   | 87.75 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Accepted |
| Pfizer Rule:   | Rejected | GSK Rule:   | Accepted |
| Golden Triangle Rule:   | Accepted | BMS Rule:   | 1 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.326 | Fluc inhibitor:   | 0.001 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.097 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.399 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.12 | Promiscuous compounds:   | 0.08 |
| Caco-2 Permeability:   | -6.628 | MDCK Permeability:   | -5.452 |
| Pgp-inhibitor:   | 0.758 | Pgp-substrate:   | 0.234 |
| PAMPA:   |
0.885 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.984 |
| 20% Bioavailability (F20%):   | 0.985 | 30% Bioavailability (F30%):   | 0.999 |
| 50% Bioavailability (F50%):   | 0.992 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.0 | MRP1:   | 0.844 |
| Plasma Protein Binding (PPB):   | 94.628% | Volume Distribution (VD):   | -0.887 |
| Fu: |
2.507% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.713 |
| OATP1B3 inhibitor:   | 0.999 | BCRP inhibitor:   | 0.0 |
| BSEP inhibitor:   | 0.813 |
| CYP1A2-inhibitor:   | 0.0 | CYP1A2-substrate:   | 0.0 |
| CYP2C19-inhibitor:   | 0.0 | CYP2C19-substrate:   | 0.0 |
| CYP2C9-inhibitor:   | 0.43 | CYP2C9-substrate:   | 0.0 |
| CYP2D6-inhibitor:   | 0.0 | CYP2D6-substrate:   | 0.0 |
| CYP3A4-inhibitor:   | 0.045 | CYP3A4-substrate:   | 0.0 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 0.0 |
| HLM stability:   |
0.023 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 0.273 | Half-life (T1/2):   | 1.653 |
| hERG Blockers:   | 0.007 | hERG Blockers (10um):   | 0.009 |
| Human Hepatotoxicity (H-HT):   | 0.999 | Drug-induced Liver Injury (DILI):   | 1.0 |
| AMES Toxicity:   | 0.036 | Rat Oral Acute Toxicity:   | 0.027 |
| Maximum Recommended Daily Dose:   | 0.0 | Skin Sensitization:   | 1.0 |
| Carcinogencity:   | 0.085 | Eye Corrosion:   | 0.0 |
| Eye Irritation:   | 0.07 | Respiratory Toxicity:   | 0.121 |
| Drug-induced Neurotoxicity:   | 0.0 | Ototoxicity:   | 0.984 |
| Hematotoxicity:   | 0.356 | Drug-induced Nephrotoxicity:   | 0.999 |
| Genotoxicity:   | 1.0 | RPMI-8226 Immunitoxicity:   | 0.001 |
| A549 Cytotoxicity:   | 0.0 | Hek293 Cytotoxicity:   | 0.009 |
| BCF:   |
0.527 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
3.368 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
4.676 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.339 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO40573 | Chryseobacterium indologenes 597 | Strain | n.a. | Bacteria | n.a. | n.a. | n.a. |
PMID[19651915] |
| NPO2453 | Stachybotrys chartarum | Species | Stachybotryaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[24387683] |
| NPO2453 | Stachybotrys chartarum | Species | Stachybotryaceae | Eukaryota | Niphates recondita | Weizhou Island, Beibuwan Bay, Guangxi,China | n.a. |
PMID[24387683] |
| NPO2453 | Stachybotrys chartarum | Species | Stachybotryaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28530828] |
| NPO40647 | Aspergillus sp. TJ29 | Strain | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28901763] |
| NPO2453 | Stachybotrys chartarum | Species | Stachybotryaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31265296] |
| NPO12970 | Aspergillus fischeri | Species | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31920082] |
| NPO2453 | Stachybotrys chartarum | Species | Stachybotryaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32966070] |
| NPO12970 | Aspergillus fischeri | Species | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2453 | Stachybotrys chartarum | Species | Stachybotryaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2453 | Stachybotrys chartarum | Species | Stachybotryaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO12970 | Aspergillus fischeri | Species | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1237 | Individual protein | Oligopeptide transporter small intestine isoform | Homo sapiens | Ki | > | 30000000.0 | nM | PMID[15974593] |
| NPT1237 | Individual protein | Oligopeptide transporter small intestine isoform | Homo sapiens | Ki | > | 30000000.0 | nM | PMID[15567297] |
| NPT1241 | Individual protein | Oligopeptide transporter, kidney isoform | Rattus norvegicus | Ki | > | 20000000.0 | nM | PMID[15567297] |
| NPT1472 | Individual protein | Solute carrier family 22 member 11 | Homo sapiens | Ki | = | 2380.0 | nM | PMID[11909604] |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[23033255] |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[23033255] |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[23033255] |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[23033255] |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[23033255] |
| NPT1463 | Individual protein | Cytochrome P450 2J2 | Homo sapiens | IC50 | = | 27400.0 | nM | PMID[23033255] |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1464 | Individual protein | Phosphodiesterase 4D | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2879 | Individual protein | Equilibrative nucleoside transporter 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1163 | Individual protein | Glutamate (NMDA) receptor subunit zeta 1 | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2691 | Individual protein | Voltage-gated L-type calcium channel alpha-1C subunit | Homo sapiens | AC50 | > | 50000.0 | nM | PMID[37468498] |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1647 | Individual protein | Vasopressin V2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2856 | Individual protein | Sodium channel protein type V alpha subunit | Homo sapiens | AC50 | > | 50000.0 | nM | PMID[37468498] |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1410 | Individual protein | GABA receptor alpha-1 subunit | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1519 | Individual protein | Excitatory amino acid transporter 2 | Homo sapiens | EC50 | > | 10000.0 | nM | PMID[36262387] |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT15209 | Single protein | Penicillin-binding protein 2 | Staphylococcus aureus | IC50 | = | 0.1 | ug.mL-1 | PMID[17470659] |
| NPT26363 | Single protein | Penicillin-binding protein 2x | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.1 | ug.mL-1 | PMID[20194704] |
| NPT26363 | Single protein | Penicillin-binding protein 2x | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 1.0 | ug.mL-1 | PMID[20194704] |
| NPT26363 | Single protein | Penicillin-binding protein 2x | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 4.0 | ug.mL-1 | PMID[20194704] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | > | 32.0 | ug.mL-1 | PMID[20194704] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 16.0 | ug.mL-1 | PMID[20194704] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 4.0 | ug.mL-1 | PMID[20194704] |
| NPT14749 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | > | 8.0 | ug.mL-1 | PMID[20696872] |
| NPT666 | Individual protein | Solute carrier family 22 member 6 | Rattus norvegicus | IC50 | = | 840000.0 | nM | PMID[12005172] |
| NPT669 | Individual protein | Solute carrier family 22 member 8 | Homo sapiens | Ki | = | 4390.0 | nM | PMID[11909604] |
| NPT645 | Individual protein | D-amino-acid oxidase | Homo sapiens | IC50 | = | 10000.0 | nM | PMID[26309148] |
| NPT987 | Individual protein | Histamine H3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5301 | Individual protein | Motilin receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT655 | Individual protein | Beta-lactamase | Proteus mirabilis | Activity | = | 897.0 | M min-1 (M of enzyme)-1 | PMID[8627610] |
| NPT15204 | Single protein | Cell shape peptidoglycan synthetase penicillin-binding protein 2 | Escherichia coli | IC50 | = | 0.2 | ug.mL-1 | PMID[17470659] |
| NPT665 | Individual protein | Solute carrier family 22 member 6 | Homo sapiens | Ki | = | 230.0 | nM | PMID[11909604] |
| NPT5065 | Protein family | Voltage-gated L-type calcium channel | Homo sapiens | IC50 | = | 153800.0 | nM | PMID[23812503] |
| NPT99 | Individual protein | Peroxisome proliferator-activated receptor gamma | Homo sapiens | AC50 | = | 1400.0 | nM | PMID[37468498] |
| NPT99 | Individual protein | Peroxisome proliferator-activated receptor gamma | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT29430 | Single protein | Neuronal acetylcholine receptor protein alpha-4 subunit | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT4729 | Individual protein | Cholecystokinin B receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT98 | Individual protein | HERG | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | = | 23000.1 | nM | PMID[37468498] |
| NPT652 | Individual protein | Beta-lactamase TEM | Escherichia coli | Activity | = | 79.0 | M min-1 (M of enzyme)-1 | PMID[8627610] |
| NPT652 | Individual protein | Beta-lactamase TEM | Escherichia coli | Activity | = | 643.0 | M min-1 (M of enzyme)-1 | PMID[8627610] |
| NPT5568 | Individual protein | Beta-lactamase SHV-1 | Escherichia coli | Activity | = | 2314.0 | M min-1 (M of enzyme)-1 | PMID[8627610] |
| NPT5568 | Individual protein | Beta-lactamase SHV-1 | Escherichia coli | Activity | = | 3339.0 | M min-1 (M of enzyme)-1 | PMID[8627610] |
| NPT15210 | Single protein | Penicillin-binding protein 3 | Staphylococcus aureus | IC50 | = | 1.0 | ug.mL-1 | PMID[17470659] |
| NPT27421 | Single protein | MecA | Staphylococcus aureus | IC50 | > | 50.0 | ug.mL-1 | PMID[17470659] |
| NPT27421 | Single protein | MecA | Staphylococcus aureus | IC50 | > | 128.0 | ug.mL-1 | PMID[20194704] |
| NPT27421 | Single protein | MecA | Staphylococcus aureus | IC50 | = | 1.0 | ug.mL-1 | PMID[20194704] |
| NPT27421 | Single protein | MecA | Staphylococcus aureus | IC50 | = | 2.0 | ug.mL-1 | PMID[20194704] |
| NPT27421 | Single protein | MecA | Staphylococcus aureus | IC50 | = | 0.25 | ug.mL-1 | PMID[20194704] |
| NPT14748 | Single protein | Penicillin-binding protein 1A | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.1 | ug.mL-1 | PMID[20194704] |
| NPT14748 | Single protein | Penicillin-binding protein 1A | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | IC50 | = | 0.25 | ug.mL-1 | PMID[20194704] |
| NPT667 | Individual protein | Solute carrier family 22 member 8 | Rattus norvegicus | IC50 | > | 2000000.0 | nM | PMID[12005172] |
| NPT920 | Individual protein | Alpha-synuclein | Homo sapiens | Kd | = | 530.0 | nM | PMID[30743095] |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5104 | Individual protein | Phosphodiesterase 3A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT28814 | Single protein | Ghrelin receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5789 | Individual protein | Beta-lactamase | Bacillus licheniformis | Activity | = | 1894.0 | M min-1 (M of enzyme)-1 | PMID[8627610] |
| NPT5577 | Individual protein | Beta-lactamase | Bacillus clausii | Activity | = | 0.4 | n.a. | PMID[17846134] |
| NPT15208 | Single protein | Penicillin-binding protein 1 | Staphylococcus aureus | IC50 | = | 0.5 | ug.mL-1 | PMID[17470659] |
| NPT15211 | Single protein | Penicillin-binding protein 4 | Staphylococcus aureus | IC50 | = | 10.0 | ug.mL-1 | PMID[17470659] |
| NPT15270 | Single protein | Penicillin-binding protein 2B | Streptococcus pneumoniae (strain ATCC BAA-255 / R6) | IC50 | > | 8.0 | ug.mL-1 | PMID[20696872] |
| NPT543 | Individual protein | Pregnane X receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT543 | Individual protein | Pregnane X receptor | Homo sapiens | AC50 | = | 1600.0 | nM | PMID[37468498] |
| NPT543 | Individual protein | Pregnane X receptor | Homo sapiens | AC50 | = | 620.0 | nM | PMID[37468498] |
| NPT425 | Individual protein | Serotonin 3a (5-HT3a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | <= | 0.06 | ug.mL-1 | PMID[8627610] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[8627610] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | = | 0.5 | ug.mL-1 | PMID[8627610] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC | = | 0.25 | ug.mL-1 | PMID[8627610] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | IC50 | = | 500.0 | nM | PMID[8627610] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | IC50 | = | 2500.0 | nM | PMID[8627610] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | IC50 | = | 5500.0 | nM | PMID[8627610] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.01 | ug.mL-1 | PMID[11844672] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[10230635] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 4.0 | ug.mL-1 | PMID[10230635] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[10230635] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 1.0 | ug.mL-1 | PMID[10230635] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.12 | ug.mL-1 | PMID[16640341] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 2.0 | ug.mL-1 | PMID[16640341] |
| NPT1605 | Organism | Enterococcus | Enterococcus | MIC50 | > | 128.0 | ug.mL-1 | PMID[16640341] |
| NPT1605 | Organism | Enterococcus | Enterococcus | MIC90 | > | 128.0 | ug.mL-1 | PMID[16640341] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | < | 0.06 | ug.mL-1 | PMID[16640341] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 0.12 | ug.mL-1 | PMID[16640341] |
| NPT1605 | Organism | Enterococcus | Enterococcus | MIC | > | 10000.0 | ug.mL-1 | PMID[17043115] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.016 | ug.mL-1 | PMID[17116666] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[17116666] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.06 | ug.mL-1 | PMID[17116666] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | <= | 0.008 | ug.mL-1 | PMID[17116666] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.125 | ug.mL-1 | PMID[17116666] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[17116666] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 1.0 | ug.mL-1 | PMID[17116666] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC | = | 256.0 | ug.mL-1 | PMID[17261621] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.12 | ug.mL-1 | PMID[17242152] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | > | 2.0 | ug.mL-1 | PMID[17242152] |
| NPT5738 | Organism | Enterobacter sp. | Enterobacter sp. | MIC50 | = | 0.12 | ug.mL-1 | PMID[17242152] |
| NPT5738 | Organism | Enterobacter sp. | Enterobacter sp. | MIC90 | > | 64.0 | ug.mL-1 | PMID[17242152] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | < | 0.008 | ug.mL-1 | PMID[17242152] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 0.015 | ug.mL-1 | PMID[17242152] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.5 | ug.mL-1 | PMID[17371817] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 2500.0 | cpm/min | PMID[17371817] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Ratio | = | 1.7 | n.a. | PMID[17371820] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Ratio | = | 1.1 | n.a. | PMID[17371820] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Ratio | = | 1.8 | n.a. | PMID[17371820] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.023 | ug.mL-1 | PMID[17371820] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.094 | ug.mL-1 | PMID[17371820] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 0.26 | % | PMID[17371820] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 5.6 | % | PMID[17371820] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 18.4 | % | PMID[17371820] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 9.0 | % | PMID[17371820] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.063 | ug.mL-1 | PMID[18330977] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.5 | ug.mL-1 | PMID[18330977] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.008 | ug.mL-1 | PMID[18330977] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | ED50 | = | 0.22 | mg.kg-1 | PMID[18330977] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | ED50 | = | 27.5 | mg.kg-1 | PMID[18330977] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[17470659] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[17470659] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 1.0 | ug.mL-1 | PMID[17502407] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 2.0 | ug.mL-1 | PMID[17502407] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 76.2 | % | PMID[17502407] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 3.4 | % | PMID[17502407] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | < | 0.06 | ug.mL-1 | PMID[17606681] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.008 | ug.mL-1 | PMID[17606681] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.06 | ug.mL-1 | PMID[17606681] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.012 | ug.mL-1 | PMID[17606681] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.25 | ug.mL-1 | PMID[17606681] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | <= | 0.015 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.5 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.03 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 1.0 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 0.03 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 1.0 | ug.mL-1 | PMID[17606689] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 2.0 | ug.mL-1 | PMID[17606689] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | < | 0.016 | ug.mL-1 | PMID[17620383] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.032 | ug.mL-1 | PMID[17620383] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[17876003] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.016 | ug.mL-1 | PMID[17876003] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.06 | ug.mL-1 | PMID[17876003] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.125 | ug.mL-1 | PMID[17876003] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 1.0 | ug.mL-1 | PMID[17876003] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[17876003] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.25 | ug.mL-1 | PMID[17876003] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[17876003] |
| NPT3572 | Organism | Bacteroides thetaiotaomicron | Bacteroides thetaiotaomicron | MIC | > | 64.0 | ug.mL-1 | PMID[17938185] |
| NPT4829 | Organism | Prevotella melaninogenica | Prevotella melaninogenica | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT4818 | Organism | Peptoniphilus asaccharolyticus | Peptoniphilus asaccharolyticus | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT1359 | Organism | Clostridium perfringens | Clostridium perfringens | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT4989 | Organism | Clostridium ramosum | Clostridium ramosum | MIC | = | 0.25 | ug.mL-1 | PMID[17938185] |
| NPT4833 | Organism | Clostridium paraputrificum | Clostridium paraputrificum | MIC | = | 4.0 | ug.mL-1 | PMID[17938185] |
| NPT3572 | Organism | Bacteroides thetaiotaomicron | Bacteroides thetaiotaomicron | MIC50 | > | 128.0 | ug.mL-1 | PMID[17938185] |
| NPT4829 | Organism | Prevotella melaninogenica | Prevotella melaninogenica | MIC50 | = | 4.0 | ug.mL-1 | PMID[17938185] |
| NPT4828 | Organism | Fusobacterium necrophorum | Fusobacterium necrophorum | MIC50 | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT4818 | Organism | Peptoniphilus asaccharolyticus | Peptoniphilus asaccharolyticus | MIC50 | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT1359 | Organism | Clostridium perfringens | Clostridium perfringens | MIC50 | = | 2.0 | ug.mL-1 | PMID[17938185] |
| NPT4989 | Organism | Clostridium ramosum | Clostridium ramosum | MIC50 | = | 0.5 | ug.mL-1 | PMID[17938185] |
| NPT3572 | Organism | Bacteroides thetaiotaomicron | Bacteroides thetaiotaomicron | MIC90 | > | 128.0 | ug.mL-1 | PMID[17938185] |
| NPT4829 | Organism | Prevotella melaninogenica | Prevotella melaninogenica | MIC90 | = | 16.0 | ug.mL-1 | PMID[17938185] |
| NPT4828 | Organism | Fusobacterium necrophorum | Fusobacterium necrophorum | MIC90 | = | 0.5 | ug.mL-1 | PMID[17938185] |
| NPT4818 | Organism | Peptoniphilus asaccharolyticus | Peptoniphilus asaccharolyticus | MIC90 | = | 1.0 | ug.mL-1 | PMID[17938185] |
| NPT1359 | Organism | Clostridium perfringens | Clostridium perfringens | MIC90 | = | 4.0 | ug.mL-1 | PMID[17938185] |
| NPT1359 | Organism | Clostridium perfringens | Clostridium perfringens | MIC | = | 2.0 | ug.mL-1 | PMID[17938185] |
| NPT1117 | Organism | Salmonella enterica subsp. enterica | Salmonella enterica subsp. enterica | MIC | = | 16.0 | ug.mL-1 | PMID[17967918] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | > | 32.0 | ug.mL-1 | PMID[18025117] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 100.0 | % | PMID[19917756] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.03 | ug.mL-1 | PMID[20065058] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC50 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC50 | <= | 0.03 | ug.mL-1 | PMID[20065058] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC50 | = | 0.25 | ug.mL-1 | PMID[20065058] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 1.0 | ug.mL-1 | PMID[20065058] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | <= | 0.03 | ug.mL-1 | PMID[20065058] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC90 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | = | 0.12 | ug.mL-1 | PMID[20065058] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | = | 0.03 | ug.mL-1 | PMID[20065058] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC | = | 0.03 | ug.mL-1 | PMID[20065058] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.06 | ug.mL-1 | PMID[20065058] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.12 | ug.mL-1 | PMID[20065058] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC90 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC90 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 2.0 | ug.mL-1 | PMID[20065058] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | <= | 0.03 | ug.mL-1 | PMID[20065058] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.25 | ug.mL-1 | PMID[18160523] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.06 | ug.mL-1 | PMID[18160523] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 1.0 | ug.mL-1 | PMID[18160523] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 4.0 | ug.mL-1 | PMID[18160523] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[18160523] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.5 | ug.mL-1 | PMID[18160523] |
| NPT3572 | Organism | Bacteroides thetaiotaomicron | Bacteroides thetaiotaomicron | MIC50 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4809 | Organism | Bacteroides caccae | Bacteroides caccae | MIC50 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4807 | Organism | Bacteroides uniformis | Bacteroides uniformis | MIC50 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4829 | Organism | Prevotella melaninogenica | Prevotella melaninogenica | MIC50 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT4429 | Organism | Prevotella loescheii | Prevotella loescheii | MIC50 | = | 1.0 | ug.mL-1 | PMID[20100877] |
| NPT4828 | Organism | Fusobacterium necrophorum | Fusobacterium necrophorum | MIC50 | = | 0.015 | ug.mL-1 | PMID[20100877] |
| NPT4818 | Organism | Peptoniphilus asaccharolyticus | Peptoniphilus asaccharolyticus | MIC50 | = | 0.125 | ug.mL-1 | PMID[20100877] |
| NPT4830 | Organism | Actinomyces israelii | Actinomyces israelii | MIC50 | = | 0.125 | ug.mL-1 | PMID[20100877] |
| NPT4831 | Organism | Actinomyces meyeri | Actinomyces meyeri | MIC50 | = | 0.125 | ug.mL-1 | PMID[20100877] |
| NPT4836 | Organism | Eggerthella lenta | Eggerthella lenta | MIC50 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT1359 | Organism | Clostridium perfringens | Clostridium perfringens | MIC50 | = | 0.5 | ug.mL-1 | PMID[20100877] |
| NPT4989 | Organism | Clostridium ramosum | Clostridium ramosum | MIC50 | = | 0.25 | ug.mL-1 | PMID[20100877] |
| NPT4833 | Organism | Clostridium paraputrificum | Clostridium paraputrificum | MIC50 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT4835 | Organism | Clostridium tertium | Clostridium tertium | MIC50 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT3572 | Organism | Bacteroides thetaiotaomicron | Bacteroides thetaiotaomicron | MIC90 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4809 | Organism | Bacteroides caccae | Bacteroides caccae | MIC90 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4807 | Organism | Bacteroides uniformis | Bacteroides uniformis | MIC90 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4829 | Organism | Prevotella melaninogenica | Prevotella melaninogenica | MIC90 | = | 32.0 | ug.mL-1 | PMID[20100877] |
| NPT4429 | Organism | Prevotella loescheii | Prevotella loescheii | MIC90 | = | 8.0 | ug.mL-1 | PMID[20100877] |
| NPT4828 | Organism | Fusobacterium necrophorum | Fusobacterium necrophorum | MIC90 | = | 0.03 | ug.mL-1 | PMID[20100877] |
| NPT4818 | Organism | Peptoniphilus asaccharolyticus | Peptoniphilus asaccharolyticus | MIC90 | = | 0.25 | ug.mL-1 | PMID[20100877] |
| NPT4830 | Organism | Actinomyces israelii | Actinomyces israelii | MIC90 | = | 0.5 | ug.mL-1 | PMID[20100877] |
| NPT4831 | Organism | Actinomyces meyeri | Actinomyces meyeri | MIC90 | = | 0.5 | ug.mL-1 | PMID[20100877] |
| NPT4836 | Organism | Eggerthella lenta | Eggerthella lenta | MIC90 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT1359 | Organism | Clostridium perfringens | Clostridium perfringens | MIC90 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT4989 | Organism | Clostridium ramosum | Clostridium ramosum | MIC90 | = | 0.5 | ug.mL-1 | PMID[20100877] |
| NPT4833 | Organism | Clostridium paraputrificum | Clostridium paraputrificum | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4835 | Organism | Clostridium tertium | Clostridium tertium | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT5768 | Organism | Acinetobacter pittii | Acinetobacter pittii | MIC | >= | 8.0 | ug.mL-1 | PMID[20368407] |
| NPT5768 | Organism | Acinetobacter pittii | Acinetobacter pittii | MIC50 | >= | 64.0 | ug.mL-1 | PMID[20368407] |
| NPT5768 | Organism | Acinetobacter pittii | Acinetobacter pittii | MIC90 | >= | 64.0 | ug.mL-1 | PMID[20368407] |
| NPT5768 | Organism | Acinetobacter pittii | Acinetobacter pittii | Activity | = | 63.2 | % | PMID[20368407] |
| NPT5768 | Organism | Acinetobacter pittii | Acinetobacter pittii | MIC | > | 32.0 | ug.mL-1 | PMID[20368407] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 32.0 | ug.mL-1 | PMID[20194704] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[20194704] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[20194704] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[20194704] |
| NPT2909 | Organism | Shigella flexneri | Shigella flexneri | MIC | = | 16.0 | ug.mL-1 | PMID[20211893] |
| NPT2909 | Organism | Shigella flexneri | Shigella flexneri | MIC | = | 32.0 | ug.mL-1 | PMID[20211893] |
| NPT729 | Organism | Micrococcus luteus | Micrococcus luteus | MIC | = | 16.0 | ug.mL-1 | PMID[20385874] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC | = | 2.0 | ug.mL-1 | PMID[20385874] |
| NPT1190 | Organism | Salmonella enterica | Salmonella enterica | MIC | = | 4.0 | ug.mL-1 | PMID[20385874] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | > | 32.0 | ug.mL-1 | PMID[18852270] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.06 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.5 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 1.0 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 1.0 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 2.0 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 2.0 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 4.0 | ug.mL-1 | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 31.3 | % | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 83.3 | % | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 95.2 | % | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 95.3 | % | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 97.1 | % | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 97.2 | % | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 99.3 | % | PMID[18725443] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 98.8 | % | PMID[18725443] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | <= | 0.015 | ug.mL-1 | PMID[18779357] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | = | 0.06 | ug.mL-1 | PMID[18779357] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | Activity | = | 99.7 | % | PMID[18779357] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | Activity | = | 0.3 | % | PMID[18779357] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | Activity | = | 0.0 | % | PMID[18779357] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | Activity | = | 100.0 | % | PMID[18779357] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | >= | 0.015 | ug.mL-1 | PMID[18779357] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | > | 16.0 | ug.mL-1 | PMID[18779357] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 91.9 | % | PMID[18779357] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 4.7 | % | PMID[18779357] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 3.5 | % | PMID[18779357] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 0.0 | % | PMID[18779357] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 6.8 | % | PMID[18779357] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 93.2 | % | PMID[18779357] |
| NPT5764 | Organism | Citrobacter | Citrobacter | MIC | >= | 0.015 | ug.mL-1 | PMID[18779357] |
| NPT5764 | Organism | Citrobacter | Citrobacter | MIC | > | 8.0 | ug.mL-1 | PMID[18779357] |
| NPT5764 | Organism | Citrobacter | Citrobacter | Activity | = | 97.8 | % | PMID[18779357] |
| NPT5764 | Organism | Citrobacter | Citrobacter | Activity | = | 1.1 | % | PMID[18779357] |
| NPT5764 | Organism | Citrobacter | Citrobacter | Activity | = | 1.8 | % | PMID[18779357] |
| NPT5764 | Organism | Citrobacter | Citrobacter | Activity | = | 3.6 | % | PMID[18779357] |
| NPT5764 | Organism | Citrobacter | Citrobacter | Activity | = | 54.5 | % | PMID[18779357] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC90 | = | 64.0 | ug.mL-1 | PMID[18591277] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC90 | = | 64.0 | ug.mL-1 | PMID[18591277] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC90 | = | 4.0 | ug.mL-1 | PMID[18591277] |
| NPT2895 | Organism | Providencia stuartii | Providencia stuartii | MIC90 | = | 64.0 | ug.mL-1 | PMID[18591277] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC50 | <= | 0.015 | ug.mL-1 | PMID[18779357] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC90 | <= | 0.015 | ug.mL-1 | PMID[18779357] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC50 | = | 0.25 | ug.mL-1 | PMID[18779357] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC50 | > | 64.0 | ug.mL-1 | PMID[18779357] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC90 | = | 4.0 | ug.mL-1 | PMID[18779357] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC90 | > | 64.0 | ug.mL-1 | PMID[18779357] |
| NPT5764 | Organism | Citrobacter | Citrobacter | MIC50 | = | 0.12 | ug.mL-1 | PMID[18779357] |
| NPT5764 | Organism | Citrobacter | Citrobacter | MIC50 | = | 64.0 | ug.mL-1 | PMID[18779357] |
| NPT5764 | Organism | Citrobacter | Citrobacter | MIC90 | = | 0.5 | ug.mL-1 | PMID[18779357] |
| NPT5764 | Organism | Citrobacter | Citrobacter | MIC90 | > | 64.0 | ug.mL-1 | PMID[18779357] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 0.0 | % | PMID[18285482] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 13.9 | % | PMID[18285482] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 29.2 | % | PMID[18285482] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 25.0 | % | PMID[18285482] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 5.9 | % | PMID[18285482] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 10.2 | % | PMID[18285482] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 0.3 | % | PMID[18285482] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 0.0 | % | PMID[18285482] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 77.0 | % | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 73.0 | % | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 92.0 | % | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 1.0 | ug.mL-1 | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 2.0 | ug.mL-1 | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.5 | ug.mL-1 | PMID[18443122] |
| NPT2895 | Organism | Providencia stuartii | Providencia stuartii | MIC50 | = | 0.06 | ug.mL-1 | PMID[18591277] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC50 | <= | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC50 | <= | 0.25 | ug.mL-1 | PMID[18591277] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC50 | = | 0.06 | ug.mL-1 | PMID[18591277] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.25 | ug.mL-1 | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.5 | ug.mL-1 | PMID[18443122] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 1.0 | ug.mL-1 | PMID[18443122] |
| NPT2895 | Organism | Providencia stuartii | Providencia stuartii | MIC | > | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | > | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | > | 0.03 | ug.mL-1 | PMID[18591277] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC | > | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | = | 1.0 | ug.mL-1 | PMID[19015360] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | = | 2.0 | ug.mL-1 | PMID[19015360] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | = | 8.0 | ug.mL-1 | PMID[19015360] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC50 | = | 8.0 | ug.mL-1 | PMID[19015360] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC90 | = | 32.0 | ug.mL-1 | PMID[19015360] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | <= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | <= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | <= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT1264 | Organism | Burkholderia cepacia | Burkholderia cepacia | MIC50 | = | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT1264 | Organism | Burkholderia cepacia | Burkholderia cepacia | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT1264 | Organism | Burkholderia cepacia | Burkholderia cepacia | MIC | > | 2.0 | ug.mL-1 | PMID[19001109] |
| NPT2895 | Organism | Providencia stuartii | Providencia stuartii | MIC50 | = | 0.06 | ug.mL-1 | PMID[19001109] |
| NPT2895 | Organism | Providencia stuartii | Providencia stuartii | MIC | >= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT2895 | Organism | Providencia stuartii | Providencia stuartii | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | >= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC50 | <= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC50 | = | 0.5 | ug.mL-1 | PMID[19001109] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC | > | 0.12 | ug.mL-1 | PMID[19001109] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC50 | = | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | > | 4.0 | ug.mL-1 | PMID[19001109] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC50 | = | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC | > | 4.0 | ug.mL-1 | PMID[19001109] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | >= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC50 | = | 0.5 | ug.mL-1 | PMID[19001109] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | >= | 2.0 | ug.mL-1 | PMID[19015339] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 8.0 | ug.mL-1 | PMID[19015339] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 8.0 | ug.mL-1 | PMID[19015339] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[19015339] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 4.0 | ug.mL-1 | PMID[19015339] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.06 | ug.mL-1 | PMID[19114671] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[19114671] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | = | 0.06 | ug.mL-1 | PMID[19114671] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT2895 | Organism | Providencia stuartii | Providencia stuartii | MIC | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT1264 | Organism | Burkholderia cepacia | Burkholderia cepacia | MIC | = | 0.03 | ug.mL-1 | PMID[19114671] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.25 | ug.mL-1 | PMID[19114671] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 2.0 | ug.mL-1 | PMID[19114671] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.03 | ug.mL-1 | PMID[19114671] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC50 | = | 0.25 | ug.mL-1 | PMID[19114671] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC50 | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT2895 | Organism | Providencia stuartii | Providencia stuartii | MIC50 | = | 0.06 | ug.mL-1 | PMID[19114671] |
| NPT1264 | Organism | Burkholderia cepacia | Burkholderia cepacia | MIC50 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 0.12 | ug.mL-1 | PMID[19114671] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 2.0 | ug.mL-1 | PMID[19114671] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 8.0 | ug.mL-1 | PMID[19114671] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 0.5 | ug.mL-1 | PMID[19114671] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 0.06 | ug.mL-1 | PMID[19114671] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC90 | = | 0.5 | ug.mL-1 | PMID[19114671] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC90 | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT2895 | Organism | Providencia stuartii | Providencia stuartii | MIC90 | = | 0.25 | ug.mL-1 | PMID[19114671] |
| NPT1264 | Organism | Burkholderia cepacia | Burkholderia cepacia | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 0.12 | ug.mL-1 | PMID[19114671] |
| NPT174 | Organism | Streptococcus | Streptococcus | MIC90 | = | 0.25 | ug.mL-1 | PMID[19124664] |
| NPT174 | Organism | Streptococcus | Streptococcus | MIC50 | = | 0.25 | ug.mL-1 | PMID[19124664] |
| NPT174 | Organism | Streptococcus | Streptococcus | MIC | = | 0.25 | ug.mL-1 | PMID[19124664] |
| NPT174 | Organism | Streptococcus | Streptococcus | MIC90 | = | 1.0 | ug.mL-1 | PMID[19124664] |
| NPT174 | Organism | Streptococcus | Streptococcus | Activity | = | 99.9 | % | PMID[19124664] |
| NPT174 | Organism | Streptococcus | Streptococcus | Activity | = | 92.5 | % | PMID[19124664] |
| NPT174 | Organism | Streptococcus | Streptococcus | Activity | = | 4.3 | % | PMID[19124664] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | Activity | = | 67.0 | % | PMID[20457818] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 64.0 | % | PMID[20457818] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | Activity | = | 100.0 | % | PMID[20457818] |
| NPT3664 | Tissue | Serum | Mus musculus | Ratio | = | 37.5 | % | PMID[20498314] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.008 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | > | 0.5 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 1.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.016 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.25 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 4.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.12 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | > | 8.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.5 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.03 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.125 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 1.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 0.06 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 1.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 2.0 | ug.mL-1 | PMID[19307366] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 2.0 | ug.mL-1 | PMID[19307366] |
| NPT4208 | Organism | Chlamydia trachomatis | Chlamydia trachomatis | MIC | > | 32.0 | ug.mL-1 | PMID[19332673] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 0.047 | ug.mL-1 | PMID[19470505] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 2.0 | ug.mL-1 | PMID[19470505] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 6.0 | ug.mL-1 | PMID[19470505] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 12.0 | ug.mL-1 | PMID[19470505] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 24.0 | ug.mL-1 | PMID[19470505] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 64.0 | ug.mL-1 | PMID[19470505] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | > | 256.0 | ug.mL-1 | PMID[19470505] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 4.0 | ug.mL-1 | PMID[19470505] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | Activity | = | 45.0 | % | PMID[19506060] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 48.0 | % | PMID[19506060] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | Activity | = | 77.0 | % | PMID[19506060] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 0.03 | ug.mL-1 | PMID[19651910] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 0.25 | ug.mL-1 | PMID[19651910] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | = | 0.25 | ug.mL-1 | PMID[19651910] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 100.0 | % | PMID[19651910] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | <= | 0.008 | ug.mL-1 | PMID[19651910] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | = | 0.12 | ug.mL-1 | PMID[19651910] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | >= | 0.015 | ug.mL-1 | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | <= | 0.015 | ug.mL-1 | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | > | 0.5 | ug.mL-1 | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 97.0 | % | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | <= | 0.06 | ug.mL-1 | PMID[19487444] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 0.12 | ug.mL-1 | PMID[19487444] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.06 | ug.mL-1 | PMID[19487444] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 99.7 | % | PMID[19487444] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 0.2 | % | PMID[19487444] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 0.1 | % | PMID[19487444] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 100.0 | % | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 99.5 | % | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 80.4 | % | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 1.2 | % | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 0.0 | % | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 0.5 | % | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 7.4 | % | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 1.0 | ug.mL-1 | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 0.03 | ug.mL-1 | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 0.5 | ug.mL-1 | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 2.0 | ug.mL-1 | PMID[19738026] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[20696872] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.06 | ug.mL-1 | PMID[20696872] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[20696872] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.008 | ug.mL-1 | PMID[20696872] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.015 | ug.mL-1 | PMID[20696872] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 1.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 1.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 0.25 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.25 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 65.6 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 2.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 2.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 4.0 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | <= | 0.25 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | <= | 0.25 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | <= | 0.25 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.5 | ug.mL-1 | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 100.0 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 98.3 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 98.0 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 43.9 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 97.0 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 65.5 | % | PMID[20308374] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 0.03 | ug.mL-1 | PMID[18625769] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 100.0 | % | PMID[18625769] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 0.0 | % | PMID[18625769] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 1.0 | ug.mL-1 | PMID[18625769] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 79.4 | % | PMID[18625769] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | Activity | = | 6.8 | % | PMID[18625769] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC50 | = | 0.12 | ug.mL-1 | PMID[18625769] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | Activity | = | 100.0 | % | PMID[18625769] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | Activity | = | 0.0 | % | PMID[18625769] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC50 | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | Activity | = | 6.1 | % | PMID[18625769] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC50 | = | 0.12 | ug.mL-1 | PMID[18625769] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 98.0 | % | PMID[18625769] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 0.0 | % | PMID[18625769] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC50 | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | Activity | = | 8.6 | % | PMID[18625769] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC50 | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | Activity | = | 96.6 | % | PMID[18625769] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | Activity | = | 0.0 | % | PMID[18625769] |
| NPT1207 | Organism | Acinetobacter | Acinetobacter | MIC50 | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT1207 | Organism | Acinetobacter | Acinetobacter | Activity | = | 0.0 | % | PMID[18625769] |
| NPT1207 | Organism | Acinetobacter | Acinetobacter | MIC50 | = | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT1207 | Organism | Acinetobacter | Acinetobacter | Activity | = | 44.7 | % | PMID[18625769] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC50 | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | Activity | = | 100.0 | % | PMID[18625769] |
| NPT6212 | Organism | Providencia sp. | Providencia sp. | MIC50 | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT6212 | Organism | Providencia sp. | Providencia sp. | Activity | = | 100.0 | % | PMID[18625769] |
| NPT6212 | Organism | Providencia sp. | Providencia sp. | Activity | = | 0.0 | % | PMID[18625769] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | <= | 0.015 | ug.mL-1 | PMID[18625769] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 2.0 | ug.mL-1 | PMID[18625769] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC90 | = | 0.5 | ug.mL-1 | PMID[18625769] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC90 | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT2897 | Organism | Citrobacter freundii | Citrobacter freundii | MIC | > | 4.0 | ug.mL-1 | PMID[18625769] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC90 | = | 1.0 | ug.mL-1 | PMID[18625769] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | >= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC90 | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | > | 1.0 | ug.mL-1 | PMID[18625769] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC90 | = | 0.12 | ug.mL-1 | PMID[18625769] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | >= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT1207 | Organism | Acinetobacter | Acinetobacter | MIC90 | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT1207 | Organism | Acinetobacter | Acinetobacter | MIC | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT1207 | Organism | Acinetobacter | Acinetobacter | MIC | >= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC90 | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT6212 | Organism | Providencia sp. | Providencia sp. | MIC90 | = | 2.0 | ug.mL-1 | PMID[18625769] |
| NPT6212 | Organism | Providencia sp. | Providencia sp. | MIC | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.01 | ug.mL-1 | PMID[18779351] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.02 | ug.mL-1 | PMID[18779351] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.16 | ug.mL-1 | PMID[18779351] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | EC50 | = | 0.004 | ug.mL-1 | PMID[18779351] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | EC50 | = | 0.015 | ug.mL-1 | PMID[18779351] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | EC50 | = | 0.084 | ug.mL-1 | PMID[18779351] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 8.0 | ug.mL-1 | PMID[20643895] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 16.0 | ug.mL-1 | PMID[20643895] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 32.0 | ug.mL-1 | PMID[20643895] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 64.0 | ug.mL-1 | PMID[20643895] |
| NPT4276 | Organism | Yersinia enterocolitica | Yersinia enterocolitica | MIC | = | 0.023 | ug.mL-1 | PMID[20547799] |
| NPT4276 | Organism | Yersinia enterocolitica | Yersinia enterocolitica | MIC | = | 0.016 | ug.mL-1 | PMID[20547799] |
| NPT4276 | Organism | Yersinia enterocolitica | Yersinia enterocolitica | MIC | = | 0.012 | ug.mL-1 | PMID[20547799] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.12 | ug.mL-1 | PMID[22365410] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | Ratio | = | 2.0 | n.a. | PMID[22483632] |
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | > | 64.0 | ug.mL-1 | PMID[30086230] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 0.063 | ug.mL-1 | PMID[31605865] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.063 | ug.mL-1 | PMID[31605865] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | = | 0.063 | ug.mL-1 | PMID[31605865] |
| NPT4805 | Organism | Rhodococcus equi | Rhodococcus equi | MIC | = | 0.063 | ug.mL-1 | PMID[31605865] |
| NPT1261 | Organism | Bacillus thuringiensis | Bacillus thuringiensis | MIC | = | 0.063 | ug.mL-1 | PMID[31605865] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 20000.0 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 19952.62 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT4829 | Organism | Prevotella melaninogenica | Prevotella melaninogenica | MIC | = | 1.0 | ug.mL-1 | PMID[33032189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | = | 0.5 | ug.mL-1 | PMID[33032189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC50 | = | 1.0 | ug.mL-1 | PMID[33032189] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC90 | = | 4.0 | ug.mL-1 | PMID[33032189] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 0.25 | ug.mL-1 | PMID[11844672] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | > | 32.0 | ug.mL-1 | PMID[11844672] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | = | 0.06 | ug.mL-1 | PMID[10230635] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC50 | < | 0.06 | ug.mL-1 | PMID[16640341] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC90 | < | 0.06 | ug.mL-1 | PMID[16640341] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 4.0 | ug.mL-1 | PMID[17043115] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 256.0 | ug.mL-1 | PMID[17145797] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | = | 16.0 | ug.mL-1 | PMID[17242152] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | = | 32.0 | ug.mL-1 | PMID[17242152] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC50 | = | 0.03 | ug.mL-1 | PMID[17242152] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC90 | = | 0.03 | ug.mL-1 | PMID[17242152] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC50 | = | 0.004 | ug.mL-1 | PMID[17242152] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC90 | = | 0.03 | ug.mL-1 | PMID[17242152] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.06 | ug.mL-1 | PMID[17242148] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | < | 0.002 | ug.mL-1 | PMID[17420216] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.094 | ug.mL-1 | PMID[17420216] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.064 | ug.mL-1 | PMID[17420216] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.125 | ug.mL-1 | PMID[17420216] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | = | 0.016 | ug.mL-1 | PMID[18330977] |
| NPT14707 | Organism | Bacillus clausii | Bacillus clausii | MIC | = | 128000.0 | ug.mL-1 | PMID[17846134] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | = | 60.0 | ug.mL-1 | PMID[17846134] |
| NPT1252 | Organism | Streptococcus sp. 'group A' | Streptococcus sp. 'group A' | MIC | <= | 0.015 | ug.mL-1 | PMID[17606689] |
| NPT1252 | Organism | Streptococcus sp. 'group A' | Streptococcus sp. 'group A' | MIC50 | = | 0.03 | ug.mL-1 | PMID[17606689] |
| NPT1252 | Organism | Streptococcus sp. 'group A' | Streptococcus sp. 'group A' | MIC90 | = | 0.03 | ug.mL-1 | PMID[17606689] |
| NPT15213 | Organism | Neisseria | Neisseria | MIC | = | 0.5 | ug.mL-1 | PMID[17591846] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.06 | ug.mL-1 | PMID[17591846] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.12 | ug.mL-1 | PMID[17591846] |
| NPT2940 | Organism | Clostridium difficile | Clostridium difficile | MIC | = | 32.0 | ug.mL-1 | PMID[17562807] |
| NPT2940 | Organism | Clostridium difficile | Clostridium difficile | MIC | = | 64.0 | ug.mL-1 | PMID[17562807] |
| NPT2940 | Organism | Clostridium difficile | Clostridium difficile | MIC | = | 16.0 | ug.mL-1 | PMID[17562807] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 24.0 | ug.mL-1 | PMID[17526756] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 64.0 | ug.mL-1 | PMID[17562800] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[17562800] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 4.0 | ug.mL-1 | PMID[17562802] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 78.0 | ug.mL-1 | PMID[17562802] |
| NPT4993 | Organism | Prevotella disiens | Prevotella disiens | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT1128 | Organism | Prevotella intermedia | Prevotella intermedia | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT4823 | Organism | Prevotella buccae | Prevotella buccae | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT1484 | Organism | Fusobacterium nucleatum | Fusobacterium nucleatum | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT4819 | Organism | Anaerococcus prevotii | Anaerococcus prevotii | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT4984 | Organism | Anaerococcus tetradius | Anaerococcus tetradius | MIC | = | 0.25 | ug.mL-1 | PMID[17938185] |
| NPT2940 | Organism | Clostridium difficile | Clostridium difficile | MIC | = | 32.0 | ug.mL-1 | PMID[17938185] |
| NPT4994 | Organism | Clostridium clostridioforme | Clostridium clostridioforme | MIC | = | 64.0 | ug.mL-1 | PMID[17938185] |
| NPT4993 | Organism | Prevotella disiens | Prevotella disiens | MIC50 | = | 2.0 | ug.mL-1 | PMID[17938185] |
| NPT1128 | Organism | Prevotella intermedia | Prevotella intermedia | MIC50 | = | 4.0 | ug.mL-1 | PMID[17938185] |
| NPT4823 | Organism | Prevotella buccae | Prevotella buccae | MIC50 | = | 0.25 | ug.mL-1 | PMID[17938185] |
| NPT1484 | Organism | Fusobacterium nucleatum | Fusobacterium nucleatum | MIC50 | = | 0.25 | ug.mL-1 | PMID[17938185] |
| NPT4984 | Organism | Anaerococcus tetradius | Anaerococcus tetradius | MIC50 | = | 0.25 | ug.mL-1 | PMID[17938185] |
| NPT2940 | Organism | Clostridium difficile | Clostridium difficile | MIC50 | = | 64.0 | ug.mL-1 | PMID[17938185] |
| NPT4993 | Organism | Prevotella disiens | Prevotella disiens | MIC90 | = | 64.0 | ug.mL-1 | PMID[17938185] |
| NPT1128 | Organism | Prevotella intermedia | Prevotella intermedia | MIC90 | = | 64.0 | ug.mL-1 | PMID[17938185] |
| NPT4823 | Organism | Prevotella buccae | Prevotella buccae | MIC90 | = | 4.0 | ug.mL-1 | PMID[17938185] |
| NPT1484 | Organism | Fusobacterium nucleatum | Fusobacterium nucleatum | MIC90 | = | 0.5 | ug.mL-1 | PMID[17938185] |
| NPT2940 | Organism | Clostridium difficile | Clostridium difficile | MIC90 | = | 64.0 | ug.mL-1 | PMID[17938185] |
| NPT1128 | Organism | Prevotella intermedia | Prevotella intermedia | MIC | = | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT1484 | Organism | Fusobacterium nucleatum | Fusobacterium nucleatum | MIC | = | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 1.613 | ug.mL-1 | PMID[20231044] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 48.0 | ug.mL-1 | PMID[19995919] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 12.0 | ug.mL-1 | PMID[19995919] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MBC | = | 1.5 | mg/ml | PMID[19995919] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MBC | = | 0.78 | mg/ml | PMID[19995919] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC50 | <= | 0.06 | ug.mL-1 | PMID[20065058] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC50 | <= | 0.06 | ug.mL-1 | PMID[20065058] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 32.3 | % | PMID[20065055] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 27.4 | % | PMID[20065055] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[20065058] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | <= | 0.06 | ug.mL-1 | PMID[20065058] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC | = | 0.06 | ug.mL-1 | PMID[20065058] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC90 | <= | 0.06 | ug.mL-1 | PMID[20065058] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC90 | = | 0.12 | ug.mL-1 | PMID[20065058] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[18316518] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | <= | 0.015 | ug.mL-1 | PMID[18316518] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 256.0 | ug.mL-1 | PMID[18332176] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 256.0 | ug.mL-1 | PMID[18332176] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | >= | 64.0 | ug.mL-1 | PMID[18426899] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 32.0 | ug.mL-1 | PMID[18426899] |
| NPT4823 | Organism | Prevotella buccae | Prevotella buccae | MIC50 | = | 0.25 | ug.mL-1 | PMID[20100877] |
| NPT1128 | Organism | Prevotella intermedia | Prevotella intermedia | MIC50 | = | 1.0 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC50 | = | 1.0 | ug.mL-1 | PMID[20100877] |
| NPT4993 | Organism | Prevotella disiens | Prevotella disiens | MIC50 | = | 1.0 | ug.mL-1 | PMID[20100877] |
| NPT1484 | Organism | Fusobacterium nucleatum | Fusobacterium nucleatum | MIC50 | = | 0.125 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC50 | = | 4.0 | ug.mL-1 | PMID[20100877] |
| NPT4819 | Organism | Anaerococcus prevotii | Anaerococcus prevotii | MIC50 | = | 0.25 | ug.mL-1 | PMID[20100877] |
| NPT4984 | Organism | Anaerococcus tetradius | Anaerococcus tetradius | MIC50 | = | 0.25 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC50 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC50 | = | 0.25 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC50 | = | 0.125 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC50 | = | 0.5 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC50 | = | 32.0 | ug.mL-1 | PMID[20100877] |
| NPT4994 | Organism | Clostridium clostridioforme | Clostridium clostridioforme | MIC50 | = | 4.0 | ug.mL-1 | PMID[20100877] |
| NPT2940 | Organism | Clostridium difficile | Clostridium difficile | MIC50 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT4823 | Organism | Prevotella buccae | Prevotella buccae | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT1128 | Organism | Prevotella intermedia | Prevotella intermedia | MIC90 | = | 16.0 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC90 | = | 8.0 | ug.mL-1 | PMID[20100877] |
| NPT4993 | Organism | Prevotella disiens | Prevotella disiens | MIC90 | = | 8.0 | ug.mL-1 | PMID[20100877] |
| NPT1484 | Organism | Fusobacterium nucleatum | Fusobacterium nucleatum | MIC90 | = | 0.5 | ug.mL-1 | PMID[20100877] |
| NPT4819 | Organism | Anaerococcus prevotii | Anaerococcus prevotii | MIC90 | = | 0.5 | ug.mL-1 | PMID[20100877] |
| NPT4984 | Organism | Anaerococcus tetradius | Anaerococcus tetradius | MIC90 | = | 0.5 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC90 | = | 16.0 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC90 | = | 0.5 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC90 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4994 | Organism | Clostridium clostridioforme | Clostridium clostridioforme | MIC90 | = | 32.0 | ug.mL-1 | PMID[20100877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC90 | = | 32.0 | ug.mL-1 | PMID[20100877] |
| NPT2940 | Organism | Clostridium difficile | Clostridium difficile | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4072 | Organism | Shigella | Shigella | MIC | <= | 0.25 | ug.mL-1 | PMID[20211893] |
| NPT4072 | Organism | Shigella | Shigella | MIC | = | 32.0 | ug.mL-1 | PMID[20211893] |
| NPT4072 | Organism | Shigella | Shigella | MIC | > | 64.0 | ug.mL-1 | PMID[20211893] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.064 | ug.mL-1 | PMID[18663018] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.125 | ug.mL-1 | PMID[18663018] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | = | 0.06 | ug.mL-1 | PMID[19015350] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 256.0 | ug.mL-1 | PMID[19015350] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | > | 256.0 | ug.mL-1 | PMID[19015350] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 16.0 | ug.mL-1 | PMID[20350950] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 32.0 | ug.mL-1 | PMID[20350950] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 64.0 | ug.mL-1 | PMID[20350950] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[20350950] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | < | 1.0 | ug.mL-1 | PMID[20385874] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | MIC | < | 1.0 | ug.mL-1 | PMID[20385874] |
| NPT2911 | Organism | Pseudomonas putida | Pseudomonas putida | MIC | > | 32.0 | ug.mL-1 | PMID[18852270] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 4.3 | % | PMID[20421398] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 0.0 | % | PMID[20421398] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 90.5 | % | PMID[20421398] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 98.6 | % | PMID[20421398] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.016 | ug.mL-1 | PMID[20421400] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.008 | ug.mL-1 | PMID[20421400] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | <= | 0.004 | ug.mL-1 | PMID[20421400] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.064 | ug.mL-1 | PMID[20421400] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.032 | ug.mL-1 | PMID[20421400] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.004 | ug.mL-1 | PMID[20421400] |
| NPT2940 | Organism | Clostridium difficile | Clostridium difficile | MIC | = | 16.0 | ug.mL-1 | PMID[18725442] |
| NPT2940 | Organism | Clostridium difficile | Clostridium difficile | MIC50 | = | 32.0 | ug.mL-1 | PMID[18725442] |
| NPT2940 | Organism | Clostridium difficile | Clostridium difficile | MIC90 | = | 128.0 | ug.mL-1 | PMID[18725442] |
| NPT2940 | Organism | Clostridium difficile | Clostridium difficile | Activity | = | 1.0 | % | PMID[18725442] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | MIC | >= | 0.015 | ug.mL-1 | PMID[18779357] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | MIC | > | 0.25 | ug.mL-1 | PMID[18779357] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | Activity | = | 99.3 | % | PMID[18779357] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | Activity | = | 0.4 | % | PMID[18779357] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | Activity | = | 0.3 | % | PMID[18779357] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | Activity | = | 7.6 | % | PMID[18779357] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | Activity | = | 26.9 | % | PMID[18779357] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | Activity | = | 65.4 | % | PMID[18779357] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | >= | 0.015 | ug.mL-1 | PMID[18779357] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 4.0 | ug.mL-1 | PMID[18779357] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 99.3 | % | PMID[18779357] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 0.3 | % | PMID[18779357] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 9.1 | % | PMID[18779357] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 8.2 | % | PMID[18779357] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 72.7 | % | PMID[18779357] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC90 | = | 64.0 | ug.mL-1 | PMID[18591277] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | = | 64.0 | ug.mL-1 | PMID[18591277] |
| NPT1246 | Organism | Salmonella | Salmonella | MIC90 | = | 64.0 | ug.mL-1 | PMID[18591277] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | MIC50 | = | 0.03 | ug.mL-1 | PMID[18779357] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | MIC50 | > | 64.0 | ug.mL-1 | PMID[18779357] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | MIC90 | = | 0.25 | ug.mL-1 | PMID[18779357] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | MIC90 | > | 64.0 | ug.mL-1 | PMID[18779357] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | = | 0.03 | ug.mL-1 | PMID[18779357] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | = | 64.0 | ug.mL-1 | PMID[18779357] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | = | 0.12 | ug.mL-1 | PMID[18779357] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | > | 64.0 | ug.mL-1 | PMID[18779357] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 0.4 | % | PMID[18285482] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 0.0 | % | PMID[18285482] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 3.9 | % | PMID[18285482] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | > | 256.0 | ug.mL-1 | PMID[18505851] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | > | 256.0 | ug.mL-1 | PMID[18505851] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.03 | ug.mL-1 | PMID[18411316] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.06 | ug.mL-1 | PMID[18411316] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | < | 0.016 | ug.mL-1 | PMID[18411316] |
| NPT4066 | Organism | Streptococcus mitis | Streptococcus mitis | Activity | = | 75.0 | % | PMID[18443122] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | Activity | = | 96.0 | % | PMID[18443122] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | Activity | = | 92.0 | % | PMID[18443122] |
| NPT4066 | Organism | Streptococcus mitis | Streptococcus mitis | MIC | = | 0.03 | ug.mL-1 | PMID[18443122] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC90 | = | 0.06 | ug.mL-1 | PMID[18443122] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC50 | = | 0.06 | ug.mL-1 | PMID[18443122] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC | = | 0.03 | ug.mL-1 | PMID[18443122] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC90 | = | 0.12 | ug.mL-1 | PMID[18443122] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC50 | <= | 0.015 | ug.mL-1 | PMID[18443122] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | <= | 0.015 | ug.mL-1 | PMID[18443122] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | < | 2.0 | ug.mL-1 | PMID[18573929] |
| NPT1246 | Organism | Salmonella | Salmonella | MIC50 | = | 0.06 | ug.mL-1 | PMID[18591277] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC50 | = | 0.06 | ug.mL-1 | PMID[18591277] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | = | 0.12 | ug.mL-1 | PMID[18591277] |
| NPT1246 | Organism | Salmonella | Salmonella | MIC | > | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | > | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 1.613 | ug.mL-1 | PMID[20716467] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 16.0 | ug.mL-1 | PMID[19104021] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 32.0 | ug.mL-1 | PMID[19104021] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 4.0 | ug.mL-1 | PMID[19015360] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 1.0 | ug.mL-1 | PMID[19015360] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[19015360] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 16.0 | ug.mL-1 | PMID[19015360] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[19015360] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | > | 32.0 | ug.mL-1 | PMID[19015360] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | > | 32.0 | ug.mL-1 | PMID[19015360] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | = | 8.0 | ug.mL-1 | PMID[19015360] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 32.0 | ug.mL-1 | PMID[19029319] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC90 | = | 8.0 | ug.mL-1 | PMID[19001109] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC50 | = | 2.0 | ug.mL-1 | PMID[19001109] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | > | 0.5 | ug.mL-1 | PMID[19001109] |
| NPT3163 | Organism | Acinetobacter calcoaceticus | Acinetobacter calcoaceticus | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT3163 | Organism | Acinetobacter calcoaceticus | Acinetobacter calcoaceticus | MIC50 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT3163 | Organism | Acinetobacter calcoaceticus | Acinetobacter calcoaceticus | MIC | > | 4.0 | ug.mL-1 | PMID[19001109] |
| NPT2894 | Organism | Providencia rettgeri | Providencia rettgeri | MIC50 | = | 0.06 | ug.mL-1 | PMID[19001109] |
| NPT2894 | Organism | Providencia rettgeri | Providencia rettgeri | MIC | >= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT2894 | Organism | Providencia rettgeri | Providencia rettgeri | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | = | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 8.0 | ug.mL-1 | PMID[19001109] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 16.0 | ug.mL-1 | PMID[19001109] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 0.12 | ug.mL-1 | PMID[19001109] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | = | 0.12 | ug.mL-1 | PMID[19001109] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | = | 0.06 | ug.mL-1 | PMID[19001109] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | <= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.125 | ug.mL-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.0312 | ug.mL-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.0625 | ug.mL-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.0156 | ug.mL-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MBC | = | 2.0 | ug ml-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC90 | = | 0.0625 | ug.mL-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MBC | = | 4.0 | ug ml-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MBC | = | 1.0 | ug ml-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MBC | = | 0.5 | ug ml-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MBC90 | = | 4.0 | ug ml-1 | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 99.9 | % | PMID[19075048] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 4.0 | ug.mL-1 | PMID[19015330] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 2.0 | ug.mL-1 | PMID[19015330] |
| NPT5305 | Organism | Corynebacterium jeikeium | Corynebacterium jeikeium | MIC | = | 4.0 | ug.mL-1 | PMID[19114671] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | MIC | = | 8.0 | ug.mL-1 | PMID[19114671] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC | = | 0.06 | ug.mL-1 | PMID[19114671] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 0.03 | ug.mL-1 | PMID[19114671] |
| NPT2894 | Organism | Providencia rettgeri | Providencia rettgeri | MIC | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT5305 | Organism | Corynebacterium jeikeium | Corynebacterium jeikeium | MIC50 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | MIC50 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC50 | = | 0.06 | ug.mL-1 | PMID[19114671] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC50 | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | = | 0.06 | ug.mL-1 | PMID[19114671] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | = | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT2894 | Organism | Providencia rettgeri | Providencia rettgeri | MIC50 | = | 0.06 | ug.mL-1 | PMID[19114671] |
| NPT5305 | Organism | Corynebacterium jeikeium | Corynebacterium jeikeium | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC90 | = | 0.12 | ug.mL-1 | PMID[19114671] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC90 | = | 0.03 | ug.mL-1 | PMID[19114671] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | = | 0.12 | ug.mL-1 | PMID[19114671] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT2894 | Organism | Providencia rettgeri | Providencia rettgeri | MIC90 | = | 0.25 | ug.mL-1 | PMID[19114671] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 1.613 | ug.mL-1 | PMID[20889241] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 0.0 | % | PMID[20404127] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 85.0 | % | PMID[20457818] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 19.0 | % | PMID[20457818] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 99.0 | % | PMID[20457818] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | Activity | = | 7.0 | % | PMID[20457818] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | > | 32.0 | ug.mL-1 | PMID[19332673] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | > | 256.0 | ug.mL-1 | PMID[19273683] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | > | 256.0 | ug.mL-1 | PMID[19273683] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | = | 0.125 | ug.mL-1 | PMID[19273683] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | > | 256.0 | ug.mL-1 | PMID[19273688] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 64.0 | ug.mL-1 | PMID[19273688] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | Activity | = | 100.0 | % | PMID[20660671] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | Activity | = | 0.0 | % | PMID[20660671] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 10.0 | % | PMID[19506060] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 97.0 | % | PMID[19506060] |
| NPT1548 | Organism | Pseudomonas aeruginosa PAO1 | Pseudomonas aeruginosa PAO1 | MIC | = | 4.0 | ug.mL-1 | PMID[19752280] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.06 | ug.mL-1 | PMID[19546370] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.03 | ug.mL-1 | PMID[19546370] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | <= | 0.008 | ug.mL-1 | PMID[19546370] |
| NPT1466 | Organism | Escherichia coli K12 | Escherichia coli K-12 | MIC | < | 0.25 | ug.mL-1 | PMID[20231393] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC50 | <= | 0.015 | ug.mL-1 | PMID[18625769] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | Activity | = | 100.0 | % | PMID[18625769] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC50 | = | 0.03 | ug.mL-1 | PMID[18625769] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | Activity | = | 100.0 | % | PMID[18625769] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC50 | = | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | Activity | = | 97.6 | % | PMID[18625769] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | MIC50 | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | Activity | = | 98.0 | % | PMID[18625769] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | Activity | = | 0.0 | % | PMID[18625769] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | MIC50 | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | Activity | = | 13.2 | % | PMID[18625769] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 99.5 | % | PMID[18625769] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 0.0 | % | PMID[18625769] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC50 | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Activity | = | 12.1 | % | PMID[18625769] |
| NPT746 | Organism | Pasteurella multocida | Pasteurella multocida | MIC50 | <= | 0.015 | ug.mL-1 | PMID[18625769] |
| NPT746 | Organism | Pasteurella multocida | Pasteurella multocida | Activity | = | 100.0 | % | PMID[18625769] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC90 | = | 0.03 | ug.mL-1 | PMID[18625769] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | <= | 0.015 | ug.mL-1 | PMID[18625769] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC90 | = | 0.12 | ug.mL-1 | PMID[18625769] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC90 | = | 0.12 | ug.mL-1 | PMID[18625769] |
| NPT2710 | Organism | Streptococcus agalactiae | Streptococcus agalactiae | MIC | = | 0.03 | ug.mL-1 | PMID[18625769] |
| NPT563 | Organism | Escherichia coli O157:H7 | Escherichia coli O157:H7 | MIC | = | 0.03 | ug.mL-1 | PMID[20585113] |
| NPT563 | Organism | Escherichia coli O157:H7 | Escherichia coli O157:H7 | MIC | = | 0.06 | ug.mL-1 | PMID[20585113] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | MIC90 | = | 0.25 | ug.mL-1 | PMID[18625769] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | MIC | >= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT5739 | Organism | Enterobacteriaceae | Enterobacteriaceae | MIC90 | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | = | 0.12 | ug.mL-1 | PMID[18625769] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC90 | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | >= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT746 | Organism | Pasteurella multocida | Pasteurella multocida | MIC90 | <= | 0.015 | ug.mL-1 | PMID[18625769] |
| NPT746 | Organism | Pasteurella multocida | Pasteurella multocida | MIC | <= | 0.015 | ug.mL-1 | PMID[18625769] |
| NPT1246 | Organism | Salmonella | Salmonella | MIC | = | 4.0 | ug.mL-1 | PMID[20643895] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 8.0 | ug.mL-1 | PMID[20643895] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 16.0 | ug.mL-1 | PMID[20643895] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | Activity | = | 100.0 | % | PMID[21098249] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC50 | <= | 0.03 | ug.mL-1 | PMID[21098249] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC90 | <= | 0.06 | ug.mL-1 | PMID[21098249] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.125 | ug.mL-1 | PMID[21098249] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.063 | ug.mL-1 | PMID[21098249] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.032 | ug.mL-1 | PMID[21098249] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | Activity | = | 0.0 | % | PMID[21098249] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 16.0 | ug.mL-1 | PMID[20679504] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 64.0 | ug.mL-1 | PMID[20679504] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 8.0 | ug.mL-1 | PMID[20679504] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 32.0 | ug.mL-1 | PMID[20679504] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 4.0 | ug.mL-1 | PMID[20679504] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 2.0 | ug.mL-1 | PMID[20679504] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 1.0 | ug.mL-1 | PMID[20679504] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.25 | ug.mL-1 | PMID[20679504] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.023 | ug.mL-1 | PMID[20733036] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.002 | ug.mL-1 | PMID[20733036] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | < | 0.12 | ug.mL-1 | PMID[22365410] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 4.0 | ug.mL-1 | PMID[22365410] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 1.613 | ug.mL-1 | DOI[10.1007/s00044-011-9796-9] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 1.613 | ug.mL-1 | DOI[10.1007/s00044-011-9607-3] |
| NPT767 | Organism | Pichia jadinii | Cyberlindnera jadinii | MIC | = | 15.62 | ug.mL-1 | DOI[10.1007/s00044-009-9279-4] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | = | 3.9 | ug.mL-1 | DOI[10.1007/s00044-009-9279-4] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 3.9 | ug.mL-1 | DOI[10.1007/s00044-009-9279-4] |
| NPT20 | Organism | Candida albicans | Candida albicans | MIC | > | 125.0 | ug.mL-1 | DOI[10.1007/s00044-009-9279-4] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | IZ | = | 16.0 | mm | DOI[10.1007/s00044-009-9178-8] |
| NPT4077 | Organism | Escherichia coli DH5[alpha] | Escherichia coli DH5[alpha] | IZ | = | 16.0 | mm | DOI[10.1007/s00044-009-9178-8] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 5.0 | ug.mL-1 | DOI[10.1007/s00044-009-9178-8] |
| NPT4077 | Organism | Escherichia coli DH5[alpha] | Escherichia coli DH5[alpha] | MIC | = | 5.0 | ug.mL-1 | DOI[10.1007/s00044-009-9178-8] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 1.613 | ug.mL-1 | PMID[23385092] |
| NPT1548 | Organism | Pseudomonas aeruginosa PAO1 | Pseudomonas aeruginosa PAO1 | MBC | = | 128.0 | ug ml-1 | PMID[24360606] |
| NPT1548 | Organism | Pseudomonas aeruginosa PAO1 | Pseudomonas aeruginosa PAO1 | MIC | = | 128.0 | ug.mL-1 | PMID[24360606] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.015 | ug.mL-1 | PMID[27469981] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | < | 0.06 | ug.mL-1 | PMID[27469981] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | ED50 | = | 0.1 | mg.kg-1 | PMID[27469981] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 2.0 | ug.mL-1 | PMID[27639362] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 1.0 | ug.mL-1 | PMID[27639362] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.125 | ug.mL-1 | PMID[27639362] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.25 | ug.mL-1 | PMID[27639362] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | ED50 | = | 0.11 | mg.kg-1 | PMID[27639362] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | ED50 | = | 5.65 | mg.kg-1 | PMID[27639362] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | MIC | = | 0.016 | ug.mL-1 | PMID[27639362] |
| NPT602 | Organism | Mycobacterium smegmatis | Mycobacterium smegmatis | MIC | = | 32.0 | ug.mL-1 | PMID[28063354] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 1.0 | ug.mL-1 | PMID[28901763] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | <= | 0.125 | ug.mL-1 | PMID[30086230] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | < | 0.25 | ug.mL-1 | PMID[30086230] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 64.0 | ug.mL-1 | PMID[30086230] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[30086230] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 2.0 | ug.mL-1 | PMID[31265296] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 0.063 | ug.mL-1 | PMID[31605865] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 8.0 | ug.mL-1 | PMID[31920082] |
| NPT1484 | Organism | Fusobacterium nucleatum | Fusobacterium nucleatum | MIC | = | 0.5 | ug.mL-1 | PMID[33032189] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.008 | ug.mL-1 | PMID[35707162] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 1.0 | ug.mL-1 | PMID[35707162] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 8192.0 | ug.mL-1 | PMID[33862468] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.004 | ug.mL-1 | PMID[35707162] |
| NPT29392 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-1/alpha-2/beta-2/gamma-2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | <= | 0.001 | ug.mL-1 | PMID[35707162] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC | = | 0.002 | ug.mL-1 | PMID[35707162] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC50 | = | 0.008 | ug.mL-1 | PMID[37506559] |
| NPT1522 | Organism | Neisseria gonorrhoeae | Neisseria gonorrhoeae | MIC90 | = | 0.25 | ug.mL-1 | PMID[37506559] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 4.0 | ug.mL-1 | PMID[8627610] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 32.0 | ug.mL-1 | PMID[8627610] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC | > | 32.0 | ug.mL-1 | PMID[8627610] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | <= | 0.06 | ug.mL-1 | PMID[8627610] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 16.0 | ug.mL-1 | PMID[8627610] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | IC50 | = | 290.0 | nM | PMID[8627610] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | IC50 | = | 960000.0 | nM | PMID[8627610] |
| NPT3730 | Organism | Enterococcus durans | Enterococcus durans | IC50 | > | 500000.0 | nM | PMID[8627610] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 4.0 | ug.mL-1 | PMID[11844672] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 32.0 | ug.mL-1 | PMID[11844672] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC | = | 16.0 | ug.mL-1 | PMID[11844672] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.06 | ug.mL-1 | PMID[11844672] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.01 | ug.mL-1 | PMID[11844672] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[10230635] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 4.0 | ug.mL-1 | PMID[10230635] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | > | 128.0 | ug.mL-1 | PMID[16640341] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | > | 128.0 | ug.mL-1 | PMID[16640341] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | MIC50 | = | 8.0 | ug.mL-1 | PMID[16640341] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | MIC90 | = | 32.0 | ug.mL-1 | PMID[16640341] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | = | 2.0 | ug.mL-1 | PMID[16640341] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | = | 2.0 | ug.mL-1 | PMID[16640341] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[17145797] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 64.0 | ug.mL-1 | PMID[17145797] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.094 | ug.mL-1 | PMID[17145797] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[17220425] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.047 | ug.mL-1 | PMID[17220425] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 256.0 | ug.mL-1 | PMID[17261621] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | = | 0.06 | ug.mL-1 | PMID[17242152] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | = | 0.06 | ug.mL-1 | PMID[17242152] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC50 | = | 64.0 | ug.mL-1 | PMID[17242152] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC90 | > | 64.0 | ug.mL-1 | PMID[17242152] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.06 | ug.mL-1 | PMID[17242148] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | > | 32.0 | ug.mL-1 | PMID[17371815] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | > | 32.0 | ug.mL-1 | PMID[17371815] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 100.0 | % | PMID[17371815] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.03 | ug.mL-1 | PMID[17371815] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[17371815] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 512.0 | ug.mL-1 | PMID[17371815] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 256.0 | ug.mL-1 | PMID[17371815] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 64.0 | ug.mL-1 | PMID[17371815] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 4.0 | ug.mL-1 | PMID[17438056] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 1024.0 | ug.mL-1 | PMID[17438056] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[17438056] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | < | 1.0 | ug.mL-1 | PMID[17439950] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[17439950] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 16.0 | ug.mL-1 | PMID[17439950] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | < | 2.0 | ug.mL-1 | PMID[17439950] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[17439950] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[18330977] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 128.0 | ug.mL-1 | PMID[18330977] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | MIC | = | 2.0 | ug.mL-1 | PMID[18330977] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC | = | 4.0 | ug.mL-1 | PMID[18330977] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | ED50 | = | 3.72 | mg.kg-1 | PMID[18330977] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | ED50 | > | 100.0 | mg.kg-1 | PMID[18330977] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 60.0 | ug.mL-1 | PMID[17846134] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.06 | ug.mL-1 | PMID[17470659] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[17470659] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 64.0 | ug.mL-1 | PMID[17470659] |
| NPT5308 | Organism | Streptococcus sp. group B | Streptococcus sp. group B | MIC | = | 0.03 | ug.mL-1 | PMID[17606689] |
| NPT5308 | Organism | Streptococcus sp. group B | Streptococcus sp. group B | MIC50 | = | 0.06 | ug.mL-1 | PMID[17606689] |
| NPT5308 | Organism | Streptococcus sp. group B | Streptococcus sp. group B | MIC90 | = | 0.06 | ug.mL-1 | PMID[17606689] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 16.0 | ug.mL-1 | PMID[17526756] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.19 | ug.mL-1 | PMID[17526756] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | < | 1.0 | ug.mL-1 | PMID[17562800] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[17664321] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 16.0 | ug.mL-1 | PMID[17664321] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.12 | ug.mL-1 | PMID[17664321] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[17664321] |
| NPT4808 | Organism | Bacteroides vulgatus | Bacteroides vulgatus | MIC | > | 2.0 | ug.mL-1 | PMID[17938185] |
| NPT4810 | Organism | Bacteroides distasonis | Parabacteroides distasonis | MIC | > | 1.0 | ug.mL-1 | PMID[17938185] |
| NPT5914 | Organism | Prevotella nigrescens | Prevotella nigrescens | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT5913 | Organism | Prevotella denticola | Prevotella denticola | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT4992 | Organism | Prevotella corporis | Prevotella corporis | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT1127 | Organism | Porphyromonas gingivalis | Porphyromonas gingivalis | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT6283 | Organism | Porphyromonas levii | Porphyromonas levii | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT4826 | Organism | Fusobacterium varium | Fusobacterium varium | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT4821 | Organism | Peptostreptococcus anaerobius | Peptostreptococcus anaerobius | MIC | = | 0.5 | ug.mL-1 | PMID[17938185] |
| NPT4995 | Organism | Clostridium innocuum | Clostridium innocuum | MIC | = | 8.0 | ug.mL-1 | PMID[17938185] |
| NPT4981 | Organism | Clostridium sordellii | Clostridium sordellii | MIC | = | 0.25 | ug.mL-1 | PMID[17938185] |
| NPT4808 | Organism | Bacteroides vulgatus | Bacteroides vulgatus | MIC50 | = | 16.0 | ug.mL-1 | PMID[17938185] |
| NPT4810 | Organism | Bacteroides distasonis | Parabacteroides distasonis | MIC50 | = | 8.0 | ug.mL-1 | PMID[17938185] |
| NPT5914 | Organism | Prevotella nigrescens | Prevotella nigrescens | MIC50 | = | 4.0 | ug.mL-1 | PMID[17938185] |
| NPT5913 | Organism | Prevotella denticola | Prevotella denticola | MIC50 | = | 4.0 | ug.mL-1 | PMID[17938185] |
| NPT4992 | Organism | Prevotella corporis | Prevotella corporis | MIC50 | = | 4.0 | ug.mL-1 | PMID[17938185] |
| NPT4826 | Organism | Fusobacterium varium | Fusobacterium varium | MIC50 | = | 4.0 | ug.mL-1 | PMID[17938185] |
| NPT4825 | Organism | Fusobacterium mortiferum | Fusobacterium mortiferum | MIC50 | = | 0.25 | ug.mL-1 | PMID[17938185] |
| NPT4821 | Organism | Peptostreptococcus anaerobius | Peptostreptococcus anaerobius | MIC50 | = | 0.5 | ug.mL-1 | PMID[17938185] |
| NPT4995 | Organism | Clostridium innocuum | Clostridium innocuum | MIC50 | = | 16.0 | ug.mL-1 | PMID[17938185] |
| NPT4808 | Organism | Bacteroides vulgatus | Bacteroides vulgatus | MIC90 | > | 128.0 | ug.mL-1 | PMID[17938185] |
| NPT4810 | Organism | Bacteroides distasonis | Parabacteroides distasonis | MIC90 | > | 128.0 | ug.mL-1 | PMID[17938185] |
| NPT5914 | Organism | Prevotella nigrescens | Prevotella nigrescens | MIC90 | = | 16.0 | ug.mL-1 | PMID[17938185] |
| NPT5913 | Organism | Prevotella denticola | Prevotella denticola | MIC90 | = | 64.0 | ug.mL-1 | PMID[17938185] |
| NPT4992 | Organism | Prevotella corporis | Prevotella corporis | MIC90 | = | 32.0 | ug.mL-1 | PMID[17938185] |
| NPT4826 | Organism | Fusobacterium varium | Fusobacterium varium | MIC90 | = | 8.0 | ug.mL-1 | PMID[17938185] |
| NPT4825 | Organism | Fusobacterium mortiferum | Fusobacterium mortiferum | MIC90 | >= | 128.0 | ug.mL-1 | PMID[17938185] |
| NPT4821 | Organism | Peptostreptococcus anaerobius | Peptostreptococcus anaerobius | MIC90 | = | 16.0 | ug.mL-1 | PMID[17938185] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 3.125 | ug.mL-1 | PMID[20231044] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.613 | ug.mL-1 | PMID[20231044] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 1.613 | ug.mL-1 | PMID[20231044] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | = | 4.0 | ug.mL-1 | PMID[20065058] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | MIC50 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | = | 0.06 | ug.mL-1 | PMID[20065058] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC50 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | = | 4.0 | ug.mL-1 | PMID[20065058] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | MIC90 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | = | 64.0 | ug.mL-1 | PMID[20065058] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 20.0 | % | PMID[20065055] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 21.7 | % | PMID[20065055] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 16.0 | ug.mL-1 | PMID[20065056] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.12 | ug.mL-1 | PMID[20065056] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[20065058] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | MIC | = | 4.0 | ug.mL-1 | PMID[20065058] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.06 | ug.mL-1 | PMID[20065058] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.03 | ug.mL-1 | PMID[20065058] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC90 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.03 | ug.mL-1 | PMID[18316518] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.06 | ug.mL-1 | PMID[18316518] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[18332176] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | <= | 0.125 | ug.mL-1 | PMID[18332176] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 256.0 | ug.mL-1 | PMID[18332176] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[18426899] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | <= | 1.0 | ug.mL-1 | PMID[18426899] |
| NPT4810 | Organism | Bacteroides distasonis | Parabacteroides distasonis | MIC50 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4808 | Organism | Bacteroides vulgatus | Bacteroides vulgatus | MIC50 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4992 | Organism | Prevotella corporis | Prevotella corporis | MIC50 | = | 1.0 | ug.mL-1 | PMID[20100877] |
| NPT5913 | Organism | Prevotella denticola | Prevotella denticola | MIC50 | = | 1.0 | ug.mL-1 | PMID[20100877] |
| NPT4991 | Organism | Porphyromonas somerae | Porphyromonas somerae | MIC50 | = | 0.015 | ug.mL-1 | PMID[20100877] |
| NPT4825 | Organism | Fusobacterium mortiferum | Fusobacterium mortiferum | MIC50 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4826 | Organism | Fusobacterium varium | Fusobacterium varium | MIC50 | = | 1.0 | ug.mL-1 | PMID[20100877] |
| NPT4821 | Organism | Peptostreptococcus anaerobius | Peptostreptococcus anaerobius | MIC50 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT4983 | Organism | Eubacterium limosum | Eubacterium limosum | MIC50 | = | 0.5 | ug.mL-1 | PMID[20100877] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | MIC50 | = | 32.0 | ug.mL-1 | PMID[20100877] |
| NPT4995 | Organism | Clostridium innocuum | Clostridium innocuum | MIC50 | = | 8.0 | ug.mL-1 | PMID[20100877] |
| NPT4981 | Organism | Clostridium sordellii | Clostridium sordellii | MIC50 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT6240 | Organism | Clostridium sphenoides | Clostridium sphenoides | MIC50 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT4810 | Organism | Bacteroides distasonis | Parabacteroides distasonis | MIC90 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4808 | Organism | Bacteroides vulgatus | Bacteroides vulgatus | MIC90 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4992 | Organism | Prevotella corporis | Prevotella corporis | MIC90 | = | 8.0 | ug.mL-1 | PMID[20100877] |
| NPT5913 | Organism | Prevotella denticola | Prevotella denticola | MIC90 | = | 8.0 | ug.mL-1 | PMID[20100877] |
| NPT4991 | Organism | Porphyromonas somerae | Porphyromonas somerae | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4825 | Organism | Fusobacterium mortiferum | Fusobacterium mortiferum | MIC90 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4826 | Organism | Fusobacterium varium | Fusobacterium varium | MIC90 | = | 8.0 | ug.mL-1 | PMID[20100877] |
| NPT4821 | Organism | Peptostreptococcus anaerobius | Peptostreptococcus anaerobius | MIC90 | = | 8.0 | ug.mL-1 | PMID[20100877] |
| NPT4983 | Organism | Eubacterium limosum | Eubacterium limosum | MIC90 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4995 | Organism | Clostridium innocuum | Clostridium innocuum | MIC90 | = | 16.0 | ug.mL-1 | PMID[20100877] |
| NPT4981 | Organism | Clostridium sordellii | Clostridium sordellii | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT6240 | Organism | Clostridium sphenoides | Clostridium sphenoides | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | = | 32.0 | ug.mL-1 | PMID[18180353] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | > | 32.0 | ug.mL-1 | PMID[18180353] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 16.0 | ug.mL-1 | PMID[18180353] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 0.0 | % | PMID[18180353] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | = | 256.0 | ug.mL-1 | PMID[18086856] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | = | 128.0 | ug.mL-1 | PMID[18086856] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | Ratio | = | 5.5 | n.a. | PMID[18086856] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 98.7 | % | PMID[18180353] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[18212109] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[18212109] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.0 | ug.mL-1 | PMID[18212109] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.06 | ug.mL-1 | PMID[18212109] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | >= | 256.0 | ug.mL-1 | PMID[18212109] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[20194704] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 64.0 | ug.mL-1 | PMID[20194704] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 64.0 | ug.mL-1 | PMID[20194704] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 8.0 | ug.mL-1 | PMID[20194704] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.9 | ug.mL-1 | PMID[20211890] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 3.1 | ug.mL-1 | PMID[20211890] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 3.4 | ug.mL-1 | PMID[20211890] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | = | 4.0 | ug.mL-1 | PMID[20211890] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 0.12 | ug.mL-1 | PMID[18591277] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC50 | = | 64.0 | ug.mL-1 | PMID[18591277] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC90 | > | 128.0 | ug.mL-1 | PMID[18591277] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | < | 1.0 | ug.mL-1 | PMID[20350950] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 64.0 | ug.mL-1 | PMID[20385874] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 64.0 | ug.mL-1 | PMID[20385874] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | < | 1.0 | ug.mL-1 | PMID[20385874] |
| NPT4997 | Organism | Klebsiella oxytoca | Klebsiella oxytoca | MIC | < | 1.0 | ug.mL-1 | PMID[20385874] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 3.3 | % | PMID[20421398] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 2.7 | % | PMID[20421398] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 95.8 | % | PMID[20421398] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 98.3 | % | PMID[20421398] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | >= | 0.015 | ug.mL-1 | PMID[18779357] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | >= | 0.15 | ug.mL-1 | PMID[18779357] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 98.7 | % | PMID[18779357] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 1.1 | % | PMID[18779357] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 0.2 | % | PMID[18779357] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 20.0 | % | PMID[18779357] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 13.3 | % | PMID[18779357] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 66.7 | % | PMID[18779357] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC50 | > | 32.0 | ug.mL-1 | PMID[18591277] |
| NPT4997 | Organism | Klebsiella oxytoca | Klebsiella oxytoca | MIC50 | = | 0.06 | ug.mL-1 | PMID[18591277] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | = | 0.25 | ug.mL-1 | PMID[18591277] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | MIC90 | > | 128.0 | ug.mL-1 | PMID[18591277] |
| NPT766 | Organism | Proteus vulgaris | Proteus vulgaris | MIC90 | = | 64.0 | ug.mL-1 | PMID[18591277] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC90 | > | 128.0 | ug.mL-1 | PMID[18591277] |
| NPT4997 | Organism | Klebsiella oxytoca | Klebsiella oxytoca | MIC90 | = | 64.0 | ug.mL-1 | PMID[18591277] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | = | 0.03 | ug.mL-1 | PMID[18779357] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | > | 64.0 | ug.mL-1 | PMID[18779357] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | = | 0.06 | ug.mL-1 | PMID[18779357] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | > | 64.0 | ug.mL-1 | PMID[18779357] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 0.0 | % | PMID[18285482] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | Activity | = | 0.0 | % | PMID[18285482] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | Activity | = | 1.8 | % | PMID[18285482] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | Activity | = | 8.1 | % | PMID[18285482] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | Activity | = | 25.0 | % | PMID[18285482] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 100.0 | % | PMID[18285482] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | Activity | = | 100.0 | % | PMID[18285482] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 3.7 | % | PMID[18285482] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 5.5 | % | PMID[18285482] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 4.2 | % | PMID[18285482] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 1.7 | % | PMID[18285482] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 2.5 | % | PMID[18285482] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Activity | = | 30.0 | % | PMID[18285482] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Activity | = | 51.5 | % | PMID[18285482] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Activity | = | 33.3 | % | PMID[18285482] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Activity | = | 30.2 | % | PMID[18285482] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Activity | = | 27.0 | % | PMID[18285482] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 5.6 | % | PMID[18299417] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 11.1 | % | PMID[18299417] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | = | 16.0 | ug.mL-1 | PMID[18299417] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 44.4 | % | PMID[18299417] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | = | 64.0 | ug.mL-1 | PMID[18299417] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 83.3 | % | PMID[18299417] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | = | 128.0 | ug.mL-1 | PMID[18299417] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | > | 256.0 | ug.mL-1 | PMID[18299417] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[18299417] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 8.0 | ug.mL-1 | PMID[18299417] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | > | 256.0 | ug.mL-1 | PMID[18505851] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | > | 256.0 | ug.mL-1 | PMID[18505851] |
| NPT4401 | Organism | Streptococcus oralis | Streptococcus oralis | Activity | = | 75.0 | % | PMID[18443122] |
| NPT5315 | Organism | Streptococcus intermedius | Streptococcus intermedius | Activity | = | 75.0 | % | PMID[18443122] |
| NPT4401 | Organism | Streptococcus oralis | Streptococcus oralis | MIC | = | 0.03 | ug.mL-1 | PMID[18443122] |
| NPT5315 | Organism | Streptococcus intermedius | Streptococcus intermedius | MIC | = | 0.03 | ug.mL-1 | PMID[18443122] |
| NPT766 | Organism | Proteus vulgaris | Proteus vulgaris | MIC50 | = | 0.06 | ug.mL-1 | PMID[18591277] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | MIC50 | = | 0.03 | ug.mL-1 | PMID[18591277] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | = | 0.06 | ug.mL-1 | PMID[18591277] |
| NPT4997 | Organism | Klebsiella oxytoca | Klebsiella oxytoca | MIC | > | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | > | 8.0 | ug.mL-1 | PMID[18591277] |
| NPT766 | Organism | Proteus vulgaris | Proteus vulgaris | MIC | > | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | MIC | > | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 1.613 | ug.mL-1 | PMID[20716467] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.613 | ug.mL-1 | PMID[20716467] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 3.125 | ug.mL-1 | PMID[20716467] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[19104021] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 64.0 | ug.mL-1 | PMID[19104021] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 256.0 | ug.mL-1 | PMID[19104021] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[19104021] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.12 | ug.mL-1 | PMID[19104021] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[19015360] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2048.0 | ug.mL-1 | PMID[18955524] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | <= | 0.25 | ug.mL-1 | PMID[18955524] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[19015360] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 16.0 | ug.mL-1 | PMID[19015360] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | > | 32.0 | ug.mL-1 | PMID[19015360] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | > | 32.0 | ug.mL-1 | PMID[19015360] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | < | 0.25 | ug.mL-1 | PMID[19029319] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[19029319] |
| NPT3189 | Organism | Haemophilus parainfluenzae | Haemophilus parainfluenzae | MIC90 | <= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT3189 | Organism | Haemophilus parainfluenzae | Haemophilus parainfluenzae | MIC50 | <= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT3189 | Organism | Haemophilus parainfluenzae | Haemophilus parainfluenzae | MIC | <= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC50 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 8.0 | ug.mL-1 | PMID[19001109] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC50 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT766 | Organism | Proteus vulgaris | Proteus vulgaris | MIC50 | = | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT766 | Organism | Proteus vulgaris | Proteus vulgaris | MIC | >= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT766 | Organism | Proteus vulgaris | Proteus vulgaris | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | MIC90 | = | 8.0 | ug.mL-1 | PMID[19001109] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | MIC50 | = | 0.06 | ug.mL-1 | PMID[19001109] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | MIC | >= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT4997 | Organism | Klebsiella oxytoca | Klebsiella oxytoca | MIC90 | = | 0.12 | ug.mL-1 | PMID[19001109] |
| NPT4997 | Organism | Klebsiella oxytoca | Klebsiella oxytoca | MIC50 | = | 0.06 | ug.mL-1 | PMID[19001109] |
| NPT4997 | Organism | Klebsiella oxytoca | Klebsiella oxytoca | MIC | >= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 4.0 | ug.mL-1 | PMID[19001109] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[19001109] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | = | 0.06 | ug.mL-1 | PMID[19001109] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | = | 0.06 | ug.mL-1 | PMID[19001109] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | >= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 4.0 | ug.mL-1 | PMID[19075048] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 8.0 | ug.mL-1 | PMID[19114671] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[19114671] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 4.0 | ug.mL-1 | PMID[19114671] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC | = | 1.0 | ug.mL-1 | PMID[19114671] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | MIC | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT766 | Organism | Proteus vulgaris | Proteus vulgaris | MIC | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 1.0 | ug.mL-1 | PMID[19114671] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 16.0 | ug.mL-1 | PMID[19114671] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | = | 0.5 | ug.mL-1 | PMID[19114671] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | = | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | = | 4.0 | ug.mL-1 | PMID[19114671] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC50 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | = | 0.06 | ug.mL-1 | PMID[19114671] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | MIC50 | = | 0.5 | ug.mL-1 | PMID[19114671] |
| NPT766 | Organism | Proteus vulgaris | Proteus vulgaris | MIC50 | = | 1.0 | ug.mL-1 | PMID[19114671] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC50 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC50 | = | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | = | 4.0 | ug.mL-1 | PMID[19114671] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | = | 0.25 | ug.mL-1 | PMID[19114671] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | MIC90 | = | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT766 | Organism | Proteus vulgaris | Proteus vulgaris | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 32.0 | ug.mL-1 | PMID[19114677] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 0.256 | ug.mL-1 | PMID[19124662] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.003 | ug.mL-1 | PMID[19124662] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.004 | ug.mL-1 | PMID[19124662] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 1024.0 | ug.mL-1 | PMID[19188377] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[19188377] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.06 | ug.mL-1 | PMID[19188377] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 3.125 | ug.mL-1 | PMID[20889241] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.613 | ug.mL-1 | PMID[20889241] |
| NPT5315 | Organism | Streptococcus intermedius | Streptococcus intermedius | Activity | = | 0.0 | % | PMID[20404127] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 1.613 | ug.mL-1 | PMID[20889241] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 96.0 | % | PMID[20457818] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 38.0 | % | PMID[20457818] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 98.0 | % | PMID[20457818] |
| NPT4997 | Organism | Klebsiella oxytoca | Klebsiella oxytoca | Activity | = | 89.0 | % | PMID[20457818] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Activity | = | 17.0 | % | PMID[20457818] |
| NPT5770 | Organism | Pasteurella sp. | Pasteurella sp. | Activity | = | 15.0 | % | PMID[20457818] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | Activity | = | 15.0 | % | PMID[20457818] |
| NPT4080 | Organism | Acinetobacter sp. | Acinetobacter sp. | Activity | = | 15.0 | % | PMID[20457818] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 3.5 | ug.mL-1 | PMID[20498314] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.88 | ug.mL-1 | PMID[20498314] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 38.8 | ug.mL-1 | PMID[20498314] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 3.75 | ug.mL-1 | PMID[20498314] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 6.0 | ug.mL-1 | PMID[20498314] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 3.88 | ug.mL-1 | PMID[20498314] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 5.88 | ug.mL-1 | PMID[20498314] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 1.09 | ug.mL-1 | PMID[20498314] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 1.38 | ug.mL-1 | PMID[20498314] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Ratio | = | 13.5 | n.a. | PMID[20498314] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Ratio | = | 1.6 | n.a. | PMID[20498314] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Ratio | = | 1.5 | n.a. | PMID[20498314] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Ratio | = | 1.3 | n.a. | PMID[20498314] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 256.0 | ug.mL-1 | PMID[19273683] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | < | 0.06 | ug.mL-1 | PMID[19273683] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.06 | ug.mL-1 | PMID[19273683] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | FC | = | 16.0 | n.a. | PMID[19289525] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | FC | = | 512.0 | n.a. | PMID[19289525] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | FC | = | 4.0 | n.a. | PMID[19289525] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | EC50 | = | 1.83 | ug.mL-1 | PMID[19289525] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 14.8 | mg/L | PMID[19289525] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | > | 200.0 | mg/L | PMID[19289525] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.064 | ug.mL-1 | PMID[19451298] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.094 | ug.mL-1 | PMID[19451298] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.032 | ug.mL-1 | PMID[19451298] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 64.0 | ug.mL-1 | PMID[19470504] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 128.0 | ug.mL-1 | PMID[19414570] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[19414570] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | = | 256.0 | ug.mL-1 | PMID[19414581] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 4.0 | % | PMID[19506060] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 96.0 | % | PMID[19506060] |
| NPT4997 | Organism | Klebsiella oxytoca | Klebsiella oxytoca | Activity | = | 9.0 | % | PMID[19506060] |
| NPT4997 | Organism | Klebsiella oxytoca | Klebsiella oxytoca | Activity | = | 97.0 | % | PMID[19506060] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Activity | = | 19.0 | % | PMID[19506060] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 16.0 | ug.mL-1 | PMID[19752280] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 32.0 | ug.mL-1 | PMID[19752280] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.12 | ug.mL-1 | PMID[19651915] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.03 | ug.mL-1 | PMID[19651915] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 128.0 | ug.mL-1 | PMID[20585124] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 64.0 | ug.mL-1 | PMID[20231393] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 16.0 | ug.mL-1 | PMID[20231393] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[20231393] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[20231393] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | = | 2.0 | ug.mL-1 | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 97.1 | % | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 0.3 | % | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | = | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 14.2 | % | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 33.1 | % | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | = | 1.0 | ug.mL-1 | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 98.0 | % | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 0.0 | % | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 27.1 | % | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 22.1 | % | PMID[18625769] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC50 | > | 32.0 | ug.mL-1 | PMID[18625769] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 97.4 | % | PMID[18625769] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 0.0 | % | PMID[18625769] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC50 | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 9.5 | % | PMID[18625769] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | MIC50 | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | Activity | = | 100.0 | % | PMID[18625769] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | Activity | = | 0.0 | % | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | = | 4.0 | ug.mL-1 | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 1.0 | ug.mL-1 | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | > | 32.0 | ug.mL-1 | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 0.5 | ug.mL-1 | PMID[18625769] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | <= | 0.25 | ug.mL-1 | PMID[18625769] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC90 | > | 32.0 | ug.mL-1 | PMID[18625769] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC | > | 8.0 | ug.mL-1 | PMID[18625769] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC | > | 1.0 | ug.mL-1 | PMID[18625769] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.03 | ug.mL-1 | PMID[20585113] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.06 | ug.mL-1 | PMID[20585113] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | = | 0.12 | ug.mL-1 | PMID[18625769] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | >= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | > | 16.0 | ug.mL-1 | PMID[18625769] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 1.0 | ug.mL-1 | PMID[18625769] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | MIC90 | = | 1.0 | ug.mL-1 | PMID[18625769] |
| NPT3495 | Organism | Morganella morganii | Morganella morganii | MIC | <= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.064 | ug.mL-1 | PMID[18779351] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[18779351] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | EC50 | = | 0.027 | ug.mL-1 | PMID[18779351] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | EC50 | = | 0.057 | ug.mL-1 | PMID[18779351] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | EC50 | = | 1.096 | ug.mL-1 | PMID[18779351] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[20643895] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.5 | ug.mL-1 | PMID[20643895] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[20643895] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[20643895] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[20643895] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[20498317] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.12 | ug.mL-1 | PMID[20498317] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[21041509] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[21041509] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.25 | ug.mL-1 | PMID[21041509] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 2.0 | % | PMID[20713672] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 0.0 | % | PMID[20713672] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | = | 11.0 | % | PMID[20713672] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Activity | = | 0.0 | % | PMID[20733038] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 256.0 | ug.mL-1 | PMID[20805396] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 4.0 | ug.mL-1 | PMID[20805396] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 256.0 | ug.mL-1 | PMID[20805396] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 4.0 | ug.mL-1 | PMID[22365410] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 1.0 | ug.mL-1 | PMID[22365410] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 8.0 | ug.mL-1 | PMID[22365410] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 256.0 | ug.mL-1 | PMID[22365410] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.12 | ug.mL-1 | PMID[22365410] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[22365410] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Ratio | = | 1.0 | n.a. | PMID[22483632] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.015 | ug.mL-1 | PMID[22483632] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[22951041] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 8.0 | ug.mL-1 | PMID[22951041] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[23116888] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 16.0 | ug.mL-1 | PMID[23116888] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 128.0 | ug.mL-1 | PMID[23116888] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 8.0 | ug.mL-1 | PMID[23116888] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 3.125 | ug.mL-1 | DOI[10.1007/s00044-011-9796-9] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 1.613 | ug.mL-1 | DOI[10.1007/s00044-011-9796-9] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.613 | ug.mL-1 | DOI[10.1007/s00044-011-9796-9] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 1.613 | ug.mL-1 | DOI[10.1007/s00044-011-9607-3] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.613 | ug.mL-1 | DOI[10.1007/s00044-011-9607-3] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 3.125 | ug.mL-1 | DOI[10.1007/s00044-011-9607-3] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 15.62 | ug.mL-1 | DOI[10.1007/s00044-009-9279-4] |
| NPT766 | Organism | Proteus vulgaris | Proteus vulgaris | MIC | = | 15.62 | ug.mL-1 | DOI[10.1007/s00044-009-9279-4] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 125.0 | ug.mL-1 | DOI[10.1007/s00044-009-9279-4] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 125.0 | ug.mL-1 | DOI[10.1007/s00044-009-9279-4] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 125.0 | ug.mL-1 | DOI[10.1007/s00044-009-9279-4] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | IZ | = | 18.0 | mm | DOI[10.1007/s00044-009-9178-8] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 5.0 | ug.mL-1 | DOI[10.1007/s00044-009-9178-8] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | > | 128.0 | ug.mL-1 | PMID[23314047] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | = | 8.0 | ug.mL-1 | PMID[23314047] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 1.0 | ug.mL-1 | PMID[23314047] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 1.613 | ug.mL-1 | PMID[23385092] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.613 | ug.mL-1 | PMID[23385092] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 3.125 | ug.mL-1 | PMID[23385092] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MBC | = | 4.0 | ug ml-1 | PMID[24360606] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MBC | = | 128.0 | ug ml-1 | PMID[24360606] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MBC | = | 64.0 | ug ml-1 | PMID[24360606] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MBC | = | 0.5 | ug ml-1 | PMID[24360606] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 4.0 | ug.mL-1 | PMID[24360606] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | = | 64.0 | ug.mL-1 | PMID[24360606] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[24360606] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | <= | 0.5 | ug.mL-1 | PMID[24360606] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 2.0 | ug.mL-1 | PMID[26522947] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 256.0 | ug.mL-1 | PMID[26522947] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 256.0 | ug.mL-1 | PMID[26522947] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 32.0 | ug.mL-1 | PMID[26522947] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 1.0 | ug.mL-1 | PMID[28901763] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | < | 0.25 | ug.mL-1 | PMID[30086230] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 64.0 | ug.mL-1 | PMID[30086230] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[31265296] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 2.0 | ug.mL-1 | PMID[31265296] |
| NPT766 | Organism | Proteus vulgaris | Proteus vulgaris | MIC | = | 0.063 | ug.mL-1 | PMID[31605865] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[31920082] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 2.0 | ug.mL-1 | PMID[31920082] |
| NPT4821 | Organism | Peptostreptococcus anaerobius | Peptostreptococcus anaerobius | MIC | = | 0.5 | ug.mL-1 | PMID[33032189] |
| NPT1127 | Organism | Porphyromonas gingivalis | Porphyromonas gingivalis | MIC | <= | 0.12 | ug.mL-1 | PMID[33032189] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 64.0 | ug.mL-1 | PMID[33862468] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | = | 1.0 | ug.mL-1 | PMID[37506559] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | > | 128.0 | ug.mL-1 | PMID[37506559] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 4096.0 | ug.mL-1 | PMID[33862468] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.97 | ug.mL-1 | PMID[36334453] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 16000.0 | ug.mL-1 | PMID[33862468] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | n.a. | n.a. | n.a. | PMID[35178184] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC50 | = | 0.12 | ug.mL-1 | PMID[17242152] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC90 | = | 1.0 | ug.mL-1 | PMID[17242152] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC50 | = | 8.0 | ug.mL-1 | PMID[17242152] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC90 | > | 64.0 | ug.mL-1 | PMID[17242152] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC50 | = | 0.5 | ug.mL-1 | PMID[17242152] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC90 | = | 1.0 | ug.mL-1 | PMID[17242152] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | > | 128.0 | ug.mL-1 | PMID[17404005] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC | = | 4.0 | ug.mL-1 | PMID[18330977] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC | > | 128.0 | ug.mL-1 | PMID[18330977] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC | = | 0.25 | ug.mL-1 | PMID[18330977] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC | = | 2.0 | ug.mL-1 | PMID[17646161] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC | = | 128.0 | ug.mL-1 | PMID[17646161] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 19.0 | ug.mL-1 | PMID[17646161] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 200.0 | ug ml-1 | PMID[17646161] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.2 | ug.mL-1 | PMID[17470659] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.5 | ug.mL-1 | PMID[17470659] |
| NPT2 | Others | Unspecified | n.a. | IC50 | < | 0.01 | ug.mL-1 | PMID[17470659] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.4 | ug.mL-1 | PMID[17470659] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 6.0 | ug.mL-1 | PMID[17470659] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 8.0 | ug.mL-1 | PMID[17470659] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.01 | ug.mL-1 | PMID[17470659] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.03 | ug.mL-1 | PMID[17470659] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.1 | ug.mL-1 | PMID[17470659] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 1.0 | ug.mL-1 | PMID[17470659] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.02 | ug.mL-1 | PMID[17470659] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 8.0 | ug.mL-1 | PMID[17470659] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC | <= | 0.015 | ug.mL-1 | PMID[17606689] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC50 | = | 0.12 | ug.mL-1 | PMID[17606689] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC90 | = | 2.0 | ug.mL-1 | PMID[17606689] |
| NPT4811 | Organism | Bacteroides ovatus | Bacteroides ovatus | MIC | > | 64.0 | ug.mL-1 | PMID[17938185] |
| NPT4824 | Organism | Prevotella bivia | Prevotella bivia | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT4827 | Organism | Porphyromonas asaccharolytica | Porphyromonas asaccharolytica | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT4817 | Organism | Finegoldia magna | Finegoldia magna | MIC | = | 1.0 | ug.mL-1 | PMID[17938185] |
| NPT4820 | Organism | Peptostreptococcus micros | Parvimonas micra | MIC | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT4986 | Organism | Clostridium bifermentans | Clostridium bifermentans | MIC | = | 0.25 | ug.mL-1 | PMID[17938185] |
| NPT4988 | Organism | Clostridium cadaveris | Clostridium cadaveris | MIC | = | 4.0 | ug.mL-1 | PMID[17938185] |
| NPT1092 | Organism | Bacteroides fragilis | Bacteroides fragilis | MIC50 | = | 64.0 | ug.mL-1 | PMID[17938185] |
| NPT4811 | Organism | Bacteroides ovatus | Bacteroides ovatus | MIC50 | = | 64.0 | ug.mL-1 | PMID[17938185] |
| NPT4824 | Organism | Prevotella bivia | Prevotella bivia | MIC50 | = | 8.0 | ug.mL-1 | PMID[17938185] |
| NPT4817 | Organism | Finegoldia magna | Finegoldia magna | MIC50 | = | 8.0 | ug.mL-1 | PMID[17938185] |
| NPT4820 | Organism | Peptostreptococcus micros | Parvimonas micra | MIC50 | <= | 0.125 | ug.mL-1 | PMID[17938185] |
| NPT1092 | Organism | Bacteroides fragilis | Bacteroides fragilis | MIC90 | > | 128.0 | ug.mL-1 | PMID[17938185] |
| NPT4811 | Organism | Bacteroides ovatus | Bacteroides ovatus | MIC90 | > | 128.0 | ug.mL-1 | PMID[17938185] |
| NPT4824 | Organism | Prevotella bivia | Prevotella bivia | MIC90 | = | 64.0 | ug.mL-1 | PMID[17938185] |
| NPT4817 | Organism | Finegoldia magna | Finegoldia magna | MIC90 | = | 8.0 | ug.mL-1 | PMID[17938185] |
| NPT4820 | Organism | Peptostreptococcus micros | Parvimonas micra | MIC90 | = | 1.0 | ug.mL-1 | PMID[17938185] |
| NPT1092 | Organism | Bacteroides fragilis | Bacteroides fragilis | MIC | = | 0.25 | ug.mL-1 | PMID[17938185] |
| NPT4817 | Organism | Finegoldia magna | Finegoldia magna | MIC | = | 8.0 | ug.mL-1 | PMID[17938185] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MIC50 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC50 | = | 0.25 | ug.mL-1 | PMID[20065058] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC50 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MIC90 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MIC | = | 4.0 | ug.mL-1 | PMID[20065058] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC | = | 0.06 | ug.mL-1 | PMID[20065058] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | = | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC90 | = | 0.5 | ug.mL-1 | PMID[20065058] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC90 | > | 8.0 | ug.mL-1 | PMID[20065058] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC | = | 32.0 | ug.mL-1 | PMID[18332176] |
| NPT1092 | Organism | Bacteroides fragilis | Bacteroides fragilis | MIC50 | = | 32.0 | ug.mL-1 | PMID[20100877] |
| NPT1092 | Organism | Bacteroides fragilis | Bacteroides fragilis | MIC50 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4812 | Organism | Parabacteroides merdae | Parabacteroides merdae | MIC50 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4811 | Organism | Bacteroides ovatus | Bacteroides ovatus | MIC50 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4824 | Organism | Prevotella bivia | Prevotella bivia | MIC50 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT4827 | Organism | Porphyromonas asaccharolytica | Porphyromonas asaccharolytica | MIC50 | = | 0.06 | ug.mL-1 | PMID[20100877] |
| NPT4817 | Organism | Finegoldia magna | Finegoldia magna | MIC50 | = | 4.0 | ug.mL-1 | PMID[20100877] |
| NPT4820 | Organism | Peptostreptococcus micros | Parvimonas micra | MIC50 | = | 0.5 | ug.mL-1 | PMID[20100877] |
| NPT6417 | Organism | Anaerococcus vaginalis | Anaerococcus vaginalis | MIC50 | = | 0.25 | ug.mL-1 | PMID[20100877] |
| NPT167 | Organism | Propionibacterium acnes | Propionibacterium acnes | MIC50 | = | 0.015 | ug.mL-1 | PMID[20100877] |
| NPT4982 | Organism | Collinsella aerofaciens | Collinsella aerofaciens | MIC50 | = | 0.5 | ug.mL-1 | PMID[20100877] |
| NPT4986 | Organism | Clostridium bifermentans | Clostridium bifermentans | MIC50 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT4987 | Organism | Clostridium butyricum | Clostridium butyricum | MIC50 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT4988 | Organism | Clostridium cadaveris | Clostridium cadaveris | MIC50 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT1092 | Organism | Bacteroides fragilis | Bacteroides fragilis | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT1092 | Organism | Bacteroides fragilis | Bacteroides fragilis | MIC90 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4812 | Organism | Parabacteroides merdae | Parabacteroides merdae | MIC90 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4811 | Organism | Bacteroides ovatus | Bacteroides ovatus | MIC90 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4824 | Organism | Prevotella bivia | Prevotella bivia | MIC90 | > | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4827 | Organism | Porphyromonas asaccharolytica | Porphyromonas asaccharolytica | MIC90 | = | 0.06 | ug.mL-1 | PMID[20100877] |
| NPT4817 | Organism | Finegoldia magna | Finegoldia magna | MIC90 | = | 8.0 | ug.mL-1 | PMID[20100877] |
| NPT4820 | Organism | Peptostreptococcus micros | Parvimonas micra | MIC90 | = | 1.0 | ug.mL-1 | PMID[20100877] |
| NPT6417 | Organism | Anaerococcus vaginalis | Anaerococcus vaginalis | MIC90 | = | 16.0 | ug.mL-1 | PMID[20100877] |
| NPT167 | Organism | Propionibacterium acnes | Propionibacterium acnes | MIC90 | = | 0.06 | ug.mL-1 | PMID[20100877] |
| NPT4982 | Organism | Collinsella aerofaciens | Collinsella aerofaciens | MIC90 | = | 2.0 | ug.mL-1 | PMID[20100877] |
| NPT4986 | Organism | Clostridium bifermentans | Clostridium bifermentans | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4987 | Organism | Clostridium butyricum | Clostridium butyricum | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT4988 | Organism | Clostridium cadaveris | Clostridium cadaveris | MIC90 | = | 64.0 | ug.mL-1 | PMID[20100877] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.25 | ug.mL-1 | PMID[20194704] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 2.0 | ug.mL-1 | PMID[20194704] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.5 | ug.mL-1 | PMID[20194704] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 4.0 | ug.mL-1 | PMID[20194704] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 1.0 | ug.mL-1 | PMID[20194704] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 16.0 | ug.mL-1 | PMID[20194704] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 8.0 | ug.mL-1 | PMID[20194704] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 128.0 | ug.mL-1 | PMID[20194704] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.1 | ug.mL-1 | PMID[20194704] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.125 | ug.mL-1 | PMID[20194704] |
| NPT1243 | Organism | Shigella sonnei | Shigella sonnei | MIC | = | 64.0 | ug.mL-1 | PMID[20211893] |
| NPT1243 | Organism | Shigella sonnei | Shigella sonnei | MIC | > | 64.0 | ug.mL-1 | PMID[20211893] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC | > | 64.0 | ug.mL-1 | PMID[20385874] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC | >= | 0.015 | ug.mL-1 | PMID[18779357] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC | > | 8.0 | ug.mL-1 | PMID[18779357] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | Activity | = | 98.1 | % | PMID[18779357] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | Activity | = | 1.4 | % | PMID[18779357] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | Activity | = | 0.6 | % | PMID[18779357] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | Activity | = | 10.0 | % | PMID[18779357] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | Activity | = | 30.0 | % | PMID[18779357] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | Activity | = | 60.0 | % | PMID[18779357] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC50 | > | 32.0 | ug.mL-1 | PMID[18591277] |
| NPT1209 | Organism | Pseudomonas fluorescens | Pseudomonas fluorescens | MIC50 | > | 32.0 | ug.mL-1 | PMID[18591277] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | MIC50 | = | 0.06 | ug.mL-1 | PMID[18591277] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC90 | = | 64.0 | ug.mL-1 | PMID[18591277] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC90 | > | 128.0 | ug.mL-1 | PMID[18591277] |
| NPT1209 | Organism | Pseudomonas fluorescens | Pseudomonas fluorescens | MIC90 | > | 128.0 | ug.mL-1 | PMID[18591277] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | MIC90 | = | 64.0 | ug.mL-1 | PMID[18591277] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC50 | = | 0.25 | ug.mL-1 | PMID[18779357] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC50 | = | 64.0 | ug.mL-1 | PMID[18779357] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC90 | = | 1.0 | ug.mL-1 | PMID[18779357] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC90 | > | 64.0 | ug.mL-1 | PMID[18779357] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | Activity | = | 75.0 | % | PMID[18443122] |
| NPT5314 | Organism | Streptococcus constellatus | Streptococcus constellatus | Activity | = | 75.0 | % | PMID[18443122] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC | = | 0.03 | ug.mL-1 | PMID[18443122] |
| NPT5314 | Organism | Streptococcus constellatus | Streptococcus constellatus | MIC | = | 0.03 | ug.mL-1 | PMID[18443122] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC50 | = | 0.06 | ug.mL-1 | PMID[18591277] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | MIC | > | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT1209 | Organism | Pseudomonas fluorescens | Pseudomonas fluorescens | MIC | > | 8.0 | ug.mL-1 | PMID[18591277] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | > | 8.0 | ug.mL-1 | PMID[18591277] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC | > | 0.015 | ug.mL-1 | PMID[18591277] |
| NPT1243 | Organism | Shigella sonnei | Shigella sonnei | MIC | = | 1024.0 | ug.mL-1 | PMID[18955524] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC90 | = | 0.5 | ug.mL-1 | PMID[19001109] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC50 | <= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC | <= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT2898 | Organism | Acinetobacter lwoffii | Acinetobacter lwoffii | MIC90 | = | 8.0 | ug.mL-1 | PMID[19001109] |
| NPT2898 | Organism | Acinetobacter lwoffii | Acinetobacter lwoffii | MIC50 | = | 2.0 | ug.mL-1 | PMID[19001109] |
| NPT2898 | Organism | Acinetobacter lwoffii | Acinetobacter lwoffii | MIC | > | 0.5 | ug.mL-1 | PMID[19001109] |
| NPT4842 | Organism | Acinetobacter haemolyticus | Acinetobacter haemolyticus | MIC90 | = | 8.0 | ug.mL-1 | PMID[19001109] |
| NPT4842 | Organism | Acinetobacter haemolyticus | Acinetobacter haemolyticus | MIC50 | = | 2.0 | ug.mL-1 | PMID[19001109] |
| NPT4842 | Organism | Acinetobacter haemolyticus | Acinetobacter haemolyticus | MIC | > | 0.5 | ug.mL-1 | PMID[19001109] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC50 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | > | 4.0 | ug.mL-1 | PMID[19001109] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC50 | = | 0.5 | ug.mL-1 | PMID[19001109] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC | > | 0.06 | ug.mL-1 | PMID[19001109] |
| NPT5757 | Organism | Citrobacter koseri | Citrobacter koseri | MIC90 | = | 0.25 | ug.mL-1 | PMID[19001109] |
| NPT5757 | Organism | Citrobacter koseri | Citrobacter koseri | MIC50 | = | 0.06 | ug.mL-1 | PMID[19001109] |
| NPT5757 | Organism | Citrobacter koseri | Citrobacter koseri | MIC | >= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | MIC50 | = | 0.12 | ug.mL-1 | PMID[19001109] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | MIC | >= | 0.03 | ug.mL-1 | PMID[19001109] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | MIC90 | > | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC50 | = | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC | > | 4.0 | ug.mL-1 | PMID[19001109] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | MIC50 | = | 32.0 | ug.mL-1 | PMID[19001109] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | MIC | > | 4.0 | ug.mL-1 | PMID[19001109] |
| NPT1624 | Organism | Streptococcus pneumoniae R6 | Streptococcus pneumoniae R6 | MIC | = | 0.03 | ug.mL-1 | PMID[19015339] |
| NPT1624 | Organism | Streptococcus pneumoniae R6 | Streptococcus pneumoniae R6 | MIC | = | 2.0 | ug.mL-1 | PMID[19015339] |
| NPT1624 | Organism | Streptococcus pneumoniae R6 | Streptococcus pneumoniae R6 | MIC | = | 0.06 | ug.mL-1 | PMID[19015339] |
| NPT1624 | Organism | Streptococcus pneumoniae R6 | Streptococcus pneumoniae R6 | MIC | = | 0.5 | ug.mL-1 | PMID[19015339] |
| NPT1624 | Organism | Streptococcus pneumoniae R6 | Streptococcus pneumoniae R6 | MIC | = | 1.0 | ug.mL-1 | PMID[19015339] |
| NPT1624 | Organism | Streptococcus pneumoniae R6 | Streptococcus pneumoniae R6 | MIC | = | 4.0 | ug.mL-1 | PMID[19015339] |
| NPT1624 | Organism | Streptococcus pneumoniae R6 | Streptococcus pneumoniae R6 | MIC | = | 8.0 | ug.mL-1 | PMID[19015339] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MIC | = | 4.0 | ug.mL-1 | PMID[19114671] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MIC | = | 0.5 | ug.mL-1 | PMID[19114671] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC | = | 0.5 | ug.mL-1 | PMID[19114671] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | MIC | = | 0.03 | ug.mL-1 | PMID[19114671] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC | = | 0.06 | ug.mL-1 | PMID[19114671] |
| NPT1247 | Organism | Shigella sp. | Shigella sp. | MIC | = | 0.03 | ug.mL-1 | PMID[19114671] |
| NPT2939 | Organism | Salmonella sp. | Salmonella sp. | MIC | = | 0.03 | ug.mL-1 | PMID[19114671] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC | = | 0.015 | ug.mL-1 | PMID[19114671] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MIC50 | = | 16.0 | ug.mL-1 | PMID[19114671] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MIC50 | = | 2.0 | ug.mL-1 | PMID[19114671] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC50 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC50 | = | 0.12 | ug.mL-1 | PMID[19114671] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | MIC50 | = | 0.12 | ug.mL-1 | PMID[19114671] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC50 | = | 0.25 | ug.mL-1 | PMID[19114671] |
| NPT1247 | Organism | Shigella sp. | Shigella sp. | MIC50 | = | 0.03 | ug.mL-1 | PMID[19114671] |
| NPT2939 | Organism | Salmonella sp. | Salmonella sp. | MIC50 | > | 0.06 | ug.mL-1 | PMID[19114671] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC50 | = | 0.5 | ug.mL-1 | PMID[19114671] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT1238 | Organism | Staphylococcus | Staphylococcus | MIC90 | = | 8.0 | ug.mL-1 | PMID[19114671] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC90 | = | 1.0 | ug.mL-1 | PMID[19114671] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC90 | = | 2.0 | ug.mL-1 | PMID[19114671] |
| NPT1247 | Organism | Shigella sp. | Shigella sp. | MIC90 | = | 0.06 | ug.mL-1 | PMID[19114671] |
| NPT2939 | Organism | Salmonella sp. | Salmonella sp. | MIC90 | > | 32.0 | ug.mL-1 | PMID[19114671] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC90 | = | 1.0 | ug.mL-1 | PMID[19114671] |
| NPT5314 | Organism | Streptococcus constellatus | Streptococcus constellatus | Activity | = | 0.0 | % | PMID[20404127] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | Activity | = | 79.0 | % | PMID[20457818] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | Activity | = | 100.0 | % | PMID[20457818] |
| NPT1209 | Organism | Pseudomonas fluorescens | Pseudomonas fluorescens | Activity | = | 15.0 | % | PMID[20457818] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | MIC | < | 0.002 | ug.mL-1 | PMID[19188396] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | MIC50 | < | 0.002 | ug.mL-1 | PMID[19188396] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | MIC90 | < | 0.002 | ug.mL-1 | PMID[19188396] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | Activity | = | 100.0 | % | PMID[19188396] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | Activity | = | 0.0 | % | PMID[19188396] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | MIC50 | <= | 0.015 | ug.mL-1 | PMID[20625152] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | MIC90 | <= | 0.015 | ug.mL-1 | PMID[20625152] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | MIC | = | 0.015 | ug.mL-1 | PMID[20625152] |
| NPT4815 | Organism | Neisseria meningitidis | Neisseria meningitidis | Activity | = | 100.0 | % | PMID[20625152] |
| NPT720 | Organism | Enterobacter aerogenes | Enterobacter aerogenes | Activity | = | 55.0 | % | PMID[19506060] |
| NPT1242 | Organism | Salmonella typhi | Salmonella enterica subsp. enterica serovar Typhi | MIC | > | 128.0 | ug.mL-1 | PMID[20585124] |
| NPT1242 | Organism | Salmonella typhi | Salmonella enterica subsp. enterica serovar Typhi | MIC | = | 0.125 | ug.mL-1 | PMID[20585124] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC50 | = | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | Activity | = | 100.0 | % | PMID[18625769] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | Activity | = | 0.0 | % | PMID[18625769] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC50 | = | 2.0 | ug.mL-1 | PMID[18625769] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | Activity | = | 28.6 | % | PMID[18625769] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC50 | > | 32.0 | ug.mL-1 | PMID[18625769] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC50 | = | 0.25 | ug.mL-1 | PMID[18625769] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | Activity | = | 93.2 | % | PMID[18625769] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | Activity | = | 0.0 | % | PMID[18625769] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC50 | <= | 0.25 | ug.mL-1 | PMID[18625769] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | Activity | = | 100.0 | % | PMID[18625769] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC90 | = | 0.25 | ug.mL-1 | PMID[18625769] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC | <= | 0.015 | ug.mL-1 | PMID[18625769] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC90 | = | 8.0 | ug.mL-1 | PMID[18625769] |
| NPT3843 | Organism | Streptococcus viridans | Streptococcus viridans | MIC | > | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC90 | > | 32.0 | ug.mL-1 | PMID[18625769] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC | > | 32.0 | ug.mL-1 | PMID[18625769] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC90 | = | 4.0 | ug.mL-1 | PMID[18625769] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC | >= | 0.06 | ug.mL-1 | PMID[18625769] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC90 | = | 1.0 | ug.mL-1 | PMID[18625769] |
| NPT1121 | Organism | Moraxella catarrhalis | Moraxella catarrhalis | MIC | <= | 0.25 | ug.mL-1 | PMID[18625769] |
| NPT3940 | Organism | Staphylococcus lentus | Staphylococcus lentus | MIC | = | 2.0 | ug.mL-1 | PMID[20679504] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC | < | 0.12 | ug.mL-1 | PMID[22365410] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | = | 8.0 | ug.mL-1 | PMID[23116888] |
| NPT3608 | Organism | Salmonella enteritidis | Salmonella enterica subsp. enterica serovar Enteritidis | MIC | = | 125.0 | ug.mL-1 | DOI[10.1007/s00044-009-9279-4] |
| NPT314 | Organism | Bacillus cereus | Bacillus cereus | MIC | > | 125.0 | ug.mL-1 | DOI[10.1007/s00044-009-9279-4] |
| NPT1209 | Organism | Pseudomonas fluorescens | Pseudomonas fluorescens | IZ | = | 16.0 | mm | DOI[10.1007/s00044-009-9178-8] |
| NPT1209 | Organism | Pseudomonas fluorescens | Pseudomonas fluorescens | MIC | = | 5.0 | ug.mL-1 | DOI[10.1007/s00044-009-9178-8] |
| NPT314 | Organism | Bacillus cereus | Bacillus cereus | MBC | = | 64.0 | ug ml-1 | PMID[24360606] |
| NPT4842 | Organism | Acinetobacter haemolyticus | Acinetobacter haemolyticus | MBC | = | 4.0 | ug ml-1 | PMID[24360606] |
| NPT314 | Organism | Bacillus cereus | Bacillus cereus | MIC | = | 32.0 | ug.mL-1 | PMID[24360606] |
| NPT4842 | Organism | Acinetobacter haemolyticus | Acinetobacter haemolyticus | MIC | = | 4.0 | ug.mL-1 | PMID[24360606] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | = | 8.0 | ug.mL-1 | PMID[31265296] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | = | 8.0 | ug.mL-1 | PMID[31920082] |
| NPT1092 | Organism | Bacteroides fragilis | Bacteroides fragilis | MIC | = | 64.0 | ug.mL-1 | PMID[33032189] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | MIC | = | 512.0 | ug.mL-1 | PMID[33862468] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 8.0 | % | PMID[27372371] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Activity | = | 94.5 | % | PMID[1635063] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Activity | = | 1.0 | % | PMID[20022146] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 4578.0 | pg/ml | PMID[17371820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 249.0 | pg/ml | PMID[17371820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 4.7 | % | PMID[20065062] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC486882 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC486882 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 1.0 | High Similarity | NPD2858 | Phase 4 |
| 0.7812 | Intermediate Similarity | NPD2857 | Approved |
| 0.7158 | Intermediate Similarity | NPD2027 | Phase 4 |
| 0.7083 | Intermediate Similarity | NPD20 | Approved |
| 0.6818 | Remote Similarity | NPD1665 | Phase 4 |
| 0.6593 | Remote Similarity | NPD2025 | Phase 4 |
| 0.6263 | Remote Similarity | NPD3291 | Phase 2 |
| 0.6154 | Remote Similarity | NPD3876 | Phase 4 |
| 0.5714 | Remote Similarity | NPD1959 | Phase 4 |
| 0.566 | Remote Similarity | NPD3332 | Phase 2 |
| 0.566 | Remote Similarity | NPD3333 | Approved |
| 0.5638 | Remote Similarity | NPD985 | Phase 4 |
| 0.5361 | Remote Similarity | NPD1263 | Phase 4 |
| 0.5354 | Remote Similarity | NPD2065 | Discontinued |
| 0.5315 | Remote Similarity | NPD3966 | Clinical (unspecified phase) |
| 0.5196 | Remote Similarity | NPD3572 | Phase 4 |
| 0.5146 | Remote Similarity | NPD3571 | Approved |
| 0.5094 | Remote Similarity | NPD1963 | Approved |
| 0.505 | Remote Similarity | NPD2023 | Approved |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
