Drug Information| Drug ID:   | NPD3572 |
| Drug Name:   | Cefepime |
| Molecular Formula:   | C19H24N6O5S2 |
| Canonical SMILES:   | CO/N=C(/c1csc(=N)[nH]1)C(=N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)[O-])C[N+]1(C)CCCC1)O |
| Standard InCHI:   | "InChI=1S/C19H24N6O5S2/c1-25(5-3-4-6-25)7-10-8-31-17-13(16(27)24(17)14(10)18(28)29)22-15(26)12(23-30-2)11-9-32-19(20)21-11/h9,13,17H,3-8H2,1-2H3,(H3-,20,21,22,26,28,29)/b23-12-/t13-,17-/m1/s1" |
| Standard InCHIKey:   | HVFLCNVBZFFHBT-ZKDACBOMSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD3572Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC487962 |
| Remote Similarity | 0.6386 | NPC478434 |
| Remote Similarity | 0.5306 | NPC485036 |
| Remote Similarity | 0.5196 | NPC486882 |
| Molecular Weight   | 480.12 |
| ALogP   | -3.1391 |
| MLogP   | 2.12 |
| XLogP   | 0.446 |
| HDA   | 8 |
| HBD   | 3 |
| Rotatable Bonds   | 11 |
| TPSA   | 201.1 |
| RO5 Violation   | 0 |